diff options
Diffstat (limited to 'gstudio/static/gstudio')
238 files changed, 43604 insertions, 0 deletions
diff --git a/gstudio/static/gstudio/css/config.rb b/gstudio/static/gstudio/css/config.rb new file mode 100644 index 0000000..accf354 --- /dev/null +++ b/gstudio/static/gstudio/css/config.rb @@ -0,0 +1,9 @@ +# Require any additional compass plugins here. +project_type = :stand_alone +# Set this to the root of your project when deployed: +http_path = "/" +css_dir = "." +sass_dir = "src" +images_dir = "../img" +output_style = :compact +line_comments = false diff --git a/gstudio/static/gstudio/css/dashboard_gstudio.css b/gstudio/static/gstudio/css/dashboard_gstudio.css new file mode 100644 index 0000000..d1f4a24 --- /dev/null +++ b/gstudio/static/gstudio/css/dashboard_gstudio.css @@ -0,0 +1,32 @@ +body.dashboard #content { width: 75%; } + +.module { width: 400px; margin-right: 5px; } +.module table { width: 100%; } +.module table th, .module table td { font-size: 12px; } + +.managelink { background: url("../img/manage.png") no-repeat scroll 0 0.2em transparent; padding-left: 12px; } + +.previewlink { background: url("../img/preview.png") no-repeat scroll 0 0.2em transparent; padding-left: 12px; } + +input, textarea, select { border: 1px solid #cccccc; } + +.vTextField, .vLargeTextField { width: 25em; } + +.required label, label.required { color: #333333 !important; font-weight: bold !important; } + +.button { float: left; margin-right: 5px; } + +#contents th { width: 50%; } +#contents td { padding-left: 10px; } +#contents td a { font-weight: bold; } + +#quickpost th { width: 20%; vertical-align: middle; } +#quickpost td { width: 100%; } + +#comments th { width: 10%; } +#comments td { width: 100%; white-space: normal; } +#comments td a { display: inline; } + +#drafts th, #linkbacks th, #comments th { font-weight: normal; } +#drafts th a, #linkbacks th a, #comments th a { font-weight: bold; } +#drafts th abbr, #linkbacks th abbr, #comments th abbr { color: #666666; } diff --git a/gstudio/static/gstudio/css/dashboard_objectapp.css b/gstudio/static/gstudio/css/dashboard_objectapp.css new file mode 100644 index 0000000..d1f4a24 --- /dev/null +++ b/gstudio/static/gstudio/css/dashboard_objectapp.css @@ -0,0 +1,32 @@ +body.dashboard #content { width: 75%; } + +.module { width: 400px; margin-right: 5px; } +.module table { width: 100%; } +.module table th, .module table td { font-size: 12px; } + +.managelink { background: url("../img/manage.png") no-repeat scroll 0 0.2em transparent; padding-left: 12px; } + +.previewlink { background: url("../img/preview.png") no-repeat scroll 0 0.2em transparent; padding-left: 12px; } + +input, textarea, select { border: 1px solid #cccccc; } + +.vTextField, .vLargeTextField { width: 25em; } + +.required label, label.required { color: #333333 !important; font-weight: bold !important; } + +.button { float: left; margin-right: 5px; } + +#contents th { width: 50%; } +#contents td { padding-left: 10px; } +#contents td a { font-weight: bold; } + +#quickpost th { width: 20%; vertical-align: middle; } +#quickpost td { width: 100%; } + +#comments th { width: 10%; } +#comments td { width: 100%; white-space: normal; } +#comments td a { display: inline; } + +#drafts th, #linkbacks th, #comments th { font-weight: normal; } +#drafts th a, #linkbacks th a, #comments th a { font-weight: bold; } +#drafts th abbr, #linkbacks th abbr, #comments th abbr { color: #666666; } diff --git a/gstudio/static/gstudio/css/grappelli-skin-default.css b/gstudio/static/gstudio/css/grappelli-skin-default.css new file mode 100644 index 0000000..3cfc545 --- /dev/null +++ b/gstudio/static/gstudio/css/grappelli-skin-default.css @@ -0,0 +1,1884 @@ + + + +/* TYPOGRAPHY +–––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––– */ + + + +/* Paragraphs +------------------------------------------------------------------------------------------------------ */ + +.module p.help, +p.help { + color: #999; +} + +p.preview a { + display: inline-block; + padding: 3px; + line-height: 1px; + border-radius: 3px; -moz-border-radius: 3px; -webkit-border-radius: 3px; +} +p.preview a:link, p.preview a:visited { + border: 1px solid #309bbf; +} +p.preview a:hover, p.preview a:active { + border: 1px solid #444; +} + + + +/* Links +------------------------------------------------------------------------------------------------------ */ + +a:link, a:visited { + color: #309bbf; +} +a:hover, a:active, a.selected { + color: #444; +} + +.dashboard h2 a:link, .dashboard h2 a:visited, +.dashboard h3 a:link, .dashboard h3 a:visited { + color: #444; +} +.dashboard h2 a:hover, .dashboard h2 a:active, +.dashboard h3 a:hover, .dashboard h3 a:active { + color: #309bbf; +} + +.dashboard h4 a:link, .dashboard h4 a:visited { + color: #666; +} +.dashboard h4 a:hover, .dashboard h4 a:active { + color: #309bbf; +} + +#header a:link, #header a:visited { + color: #59AFCC; +} +#header a:hover, #header a:active { + color: #444; +} + + + +/* Blockquote, Pre, Code +------------------------------------------------------------------------------------------------------ */ + +blockquote { + color: #777; + border-left: 5px solid #ddd; +} + +code, pre { + color: #666; + background: inherit; +} + +pre.literal-block { + background: #eee; +} + +code strong { + color: #930; +} + +hr { + color: #eee; + border: 0; + background-color: #eee; +} + + + +/* RTE (Rich Text Edited) +------------------------------------------------------------------------------------------------------ */ + +.rte h3 { + border-top: 1px solid #d4d4d4; + border-bottom: 1px solid #d4d4d4; +} +.rte .group h3 { + border-top: 0; +} +.rte h3:last-child, +.rte h4:last-child { + border-bottom: 0; + border-bottom-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; + border-bottom-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; +} +.rte td { + border-left: 1px solid #f4f4f4; +} +.rte td:first-of-type { + border-left: 0; +} +.delete-confirmation ul.rte>li { + border-top: 1px solid #fff; + border-bottom: 1px solid #e0e0e0; +} +.delete-confirmation ul.rte>li:first-child { + border-top: 0; +} +.delete-confirmation ul.rte>li:last-child { + border-bottom: 0; +} +.delete-confirmation ul.rte>li>ul>li { + border-top: 1px dashed #e0e0e0; +} +.rte blockquote table { + border: 1px solid #d4d4d4; + border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; +} + + + +/* Other Styles +------------------------------------------------------------------------------------------------------ */ + +.warning { + color: #bf3030; +} +.quiet { + color: #999; +} + + + +/* STRUCTURES +–––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––– */ + +body { + color: #444; + background: #fff; +} + + + +/* Header +------------------------------------------------------------------------------------------------------ */ + +#header { + color: blue; + background: white; + background: -moz-linear-gradient(top, white, white); + background: -webkit-gradient(linear, left top, left bottom, from(white), to(white)); + background: -o-linear-gradient(top, white, white); +} +#header a:hover, #header a:active { + color: #ddd; +} + + + +/* Branding, Bookmarks & User-Tools +------------------------------------------------------------------------------------------------------ */ + +.branding { + border-left: 1px solid #343434; + background-color: #262626; +} +.admin-title { + border-left: 1px solid #404040; + border-right: 1px solid #303030; +} + + +/* User Tools ................................................... */ + +#user-tools { + border-left: 1px solid #303030; +} +#user-tools>li { + border-left: 1px solid #404040; + border-right: 1px solid #303030; +} +li.user-options-container.open a.user-options-handler { + color: #eee !important; +} +li.user-options-container.open ul.user-options { + border-top: 1px solid #262626; + border-bottom-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; + border-bottom-right-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; + background: #333; +} +ul.user-options li { + border-top: 1px solid #404040; + border-bottom: 1px solid #292929; +} +ul.user-options li:last-child { + border-bottom: 0; +} + + +/* Navigation Menu (UL Navigation-Menu of Admin-Tools) ................................................... */ + +ul.navigation-menu>li>a { + border-left: 1px solid #404040; + border-right: 1px solid #303030; +} +ul.navigation-menu>li.bookmark>a { + border-right: 0; +} +ul.navigation-menu li ul { + border-top: 1px solid #2a2a2a; + border-bottom-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; + border-bottom-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; + background: #333; +} +ul.navigation-menu li li { + border-top: 1px solid #404040; + border-bottom: 1px solid #2a2a2a; +} + +ul.navigation-menu li li li { + border-top: 1px solid #303030; + border-bottom: 1px solid #303030; + border-bottom: 0; +} +ul.navigation-menu li li li li { + border-top: 1px solid #383838; + border-bottom: 1px solid #383838; + border-bottom: 0; +} +ul.navigation-menu li li li li li { + border-top: 1px solid #404040; + border-bottom: 1px solid #383838; + border-bottom: 0; +} +ul.navigation-menu>li>ul>li.parent { + border-top: 1px solid #404040; + border-bottom: 1px solid #2a2a2a; +} +ul.navigation-menu li ul ul { + border-top: 0; + border-bottom: 0; + background: transparent; +} +ul.navigation-menu li.menu-item.last { + border-bottom-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; + border-bottom-right-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; +} + +ul.navigation-menu li ul ul>li:first-child a { + border-bottom: 0; +} +ul.navigation-menu li ul ul ul>li:first-child a { + border-bottom: 0; +} +ul.navigation-menu li ul ul ul ul>li:first-child a { + border-bottom: 0; +} +ul.navigation-menu li ul ul ul ul>li:first-child a { + border-bottom: 0; +} +ul.navigation-menu li.collapse.open>a.collapse-handler, +ul.navigation-menu li.bookmark.disabled>a, +ul.navigation-menu li.collapse.open + li.actions { + color: #eee !important; +} +ul.navigation-menu li.bookmark.disabled>a { + cursor: default !important; +} + +form#bookmark-form { + border-right: 1px solid #303030; +} +form#bookmark-form button { +/* border: 1px solid #2e2e2e;*/ +/* border-radius: 10px; -moz-border-radius: 10px; -webkit-border-radius: 10px;*/ + background-position: 50% 3px; + background-repeat: no-repeat; + background-color: transparent !important; +} +form#bookmark-form button { + background-image: url('../img/icons/icon-bookmark_add.png'); +} +form#bookmark-form button:hover { +/* border: 1px solid #ccc;*/ + background-image: url('../img/icons/icon-bookmark_add-hover.png'); +/* background-color: #e6e6e6 !important;*/ +} +form#bookmark-form button.bookmarked { + background-image: url('../img/icons/icon-bookmark_remove.png'); +} +form#bookmark-form button.bookmarked:hover { + background-image: url('../img/icons/icon-bookmark_remove-hover.png'); +} + + + +/* Breadcrumbs +------------------------------------------------------------------------------------------------------ */ + +div#breadcrumbs { + color: #666; + border-top: 1px solid #ccc; + border-bottom: 1px solid #ccc; + background: #e6e6e6; +} + + + +/* Messages +------------------------------------------------------------------------------------------------------ */ + +ul.messagelist li { + color: #fff; + border-top: 1px solid #949494; + border-bottom: 1px solid #949494; + background-color: #a6a6a6; +} +ul.messagelist li.success { + border-top-color: #72a629; + border-bottom-color: #72a629; + background-color: #83bf30; +} +ul.messagelist li.error, +ul.messagelist li.warning { + border-top-color: #a62929; + border-bottom-color: #a62929; + background-color: #bf3030; +} +ul.messagelist li + li { + border-top: 0; +} + + + +/* Login Form +------------------------------------------------------------------------------------------------------ */ + +.login .module { + border: 0; + border-top-left-radius: 0; -moz-border-radius-topleft: 0; -webkit-border-top-left-radius: 0; + border-top-right-radius: 0; -moz-border-radius-topright: 0; -webkit-border-top-right-radius: 0; + background: #333; +} +.login .module .row { + border-top: 1px solid #444; + border-bottom: 1px solid #222; +} +.login .module label { + color: #eee; +} + + + +/* COMPONENTS +–––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––– */ + + + +/* Modules +------------------------------------------------------------------------------------------------------ */ + +.module { + border: 1px solid #bdbdbd; + border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; + background: #eee; +} +.rte .module { + background: transparent; +} + + +/* Nested Modules Basics ......................................... */ + +.module .module, +.module fielset.module { + border: 0; + border-radius: 0; -moz-border-radius: 0; -webkit-border-radius: 0; +} +.module .module:first-child { + border-top-left-radius: 4px; -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; + border-top-right-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; +} + + + +/* Groups +------------------------------------------------------------------------------------------------------ */ + +.group { + border-radius: 7px; -moz-border-radius: 7px; -webkit-border-radius: 7px; +} + +.group.collapse.closed { + border: 2px solid #e0e0e0; +} +.group, +.group.collapse.closed:hover { + border: 2px solid #c7c7c7; +} + + + +/* Elements in Modules & Groups +------------------------------------------------------------------------------------------------------ */ + + +/* 1st Level Borders Top (Dark/Bright) ......................................... */ + +.group h2, +.module h2 { + border-bottom: 1px solid #bdbdbd; + border-top-left-radius: 4px; -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; + border-top-right-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; + background: #d6d6d6; + background: -moz-linear-gradient(top, #e3e3e3, #d6d6d6); + background: -webkit-gradient(linear, left top, left bottom, from(#e3e3e3), to(#d6d6d6)); + background: -o-linear-gradient(top, #e3e3e3, #d6d6d6); +} +.group h2 { + border: 1px solid #bdbdbd; + border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; +} +.module h2+*, +.module h2+.tools+* { + border-top: 1px solid #fff; +} +.module h2+.module, +.module h2+.tools, +.module h2+.tools+.module { + border-top: 0 !important; +} + + +/* 2nd Level Borders Top (Dark/Bright) ......................................... */ + +.module .module { + border-top: 1px solid #c7c7c7; +} +.module .module>*:first-child { + border-top: 1px solid #eee; +} +#changelist .span-flexible .module .module:first-child { + border-top: 0; +} + +.group h3, +.module h3 { + border-bottom: 1px solid #c7c7c7; + background: #e0e0e0; + background: -moz-linear-gradient(top, #e9e9e9, #e0e0e0); + background: -webkit-gradient(linear, left top, left bottom, from(#e9e9e9), to(#e0e0e0)); + background: -o-linear-gradient(top, #e9e9e9, #e0e0e0); +} +.group h3 { + border-top-left-radius: 4px; -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; + border-top-right-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; +} +.module h3+*, +.module h3+.tools+* { + border-top: 1px solid #fff; +} +.module h3+.module, +.module h3+.tools, +.module h3+.tools+.module { + border-top: 0 !important; +} + + +/* 3rd Level Borders Top (Dark/Bright) ......................................... */ + +.group .module .module, +.module .module .module { + border-top: 1px solid #d4d4d4; +} +.group .module .module>*:first-child, +.module .module .module>*:first-child { + border-top: 1px solid #f4f4f4; +} + +.group h4, +.module h4 { + border-bottom: 1px solid #d4d4d4; + background: #e8e8e8; + background: -moz-linear-gradient(top, #ededed, #e8e8e8); + background: -webkit-gradient(linear, left top, left bottom, from(#ededed), to(#e8e8e8)); + background: -o-linear-gradient(top, #ededed, #e8e8e8); +} +.module h4+*, +.module h4+.tools+* { + border-top: 1px solid #fff; +} +.module h4+.tools { + border-top: 0 !important; +} +.module .description { + border-bottom: 1px solid #d4d4d4; +} +.module .row.description, +.module.table .description { + border-bottom: 0; +} + + + +/* Modules & Groups Overrides +------------------------------------------------------------------------------------------------------ */ + +.module .module:last-of-type { + border-bottom-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; + border-bottom-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; +} + + + +/* Collapsible Structures +------------------------------------------------------------------------------------------------------ */ + +.group .module.collapse.closed h3.collapse-handler, +.group .module.collapse.closed h4.collapse-handler, +.collapse.closed h2.collapse-handler, +.module .module.collapse.closed.last .collapse-handler, +.module .module.collapse.closed:last-child .collapse-handler { + border-bottom-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; + border-bottom-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; +} +.module.collapse.closed h2.collapse-handler, +.module.collapse.closed h3.collapse-handler, +.module.collapse.closed h4.collapse-handler { + border-bottom: 0; +} + + +/* 1st Level Collapsible-Handler ......................................... */ + +.collapse h2.collapse-handler { + background: #a1d4e5; + background: -moz-linear-gradient(top, #bcdfeb, #a1d4e5); + background: -webkit-gradient(linear, left top, left bottom, from(#bcdfeb), to(#a1d4e5)); + background: -o-linear-gradient(top, #bcdfeb, #a1d4e5); +} +.collapse h2.collapse-handler:hover, +.collapse.open h2.collapse-handler { + background: #bcdfeb; + background: -moz-linear-gradient(top, #a1d4e5, #bcdfeb); + background: -webkit-gradient(linear, left top, left bottom, from(#a1d4e5), to(#bcdfeb)); + background: -o-linear-gradient(top, #a1d4e5, #bcdfeb); +} + + +/* 2nd Level Collapsible-Handler ......................................... */ + +.group .collapse h3.collapse-handler, +.module .collapse h3.collapse-handler { + background: #cee9f2; + background: -moz-linear-gradient(top, #e1f0f5, #cee9f2); + background: -webkit-gradient(linear, left top, left bottom, from(#e1f0f5), to(#cee9f2)); + background: -o-linear-gradient(top, #e1f0f5, #cee9f2); +} +.group .collapse h3.collapse-handler:hover, +.module .collapse h3.collapse-handler:hover, +.group .collapse.open h3.collapse-handler, +.module .collapse.open h3.collapse-handler { + background: #e1f0f5; + background: -moz-linear-gradient(top, #cee9f2, #e1f0f5); + background: -webkit-gradient(linear, left top, left bottom, from(#cee9f2), to(#e1f0f5)); + background: -o-linear-gradient(top, #cee9f2, #e1f0f5); +} +.module .collapse h3.collapse-handler { + border-top: 1px solid #e1f0f5; +} + + +/* 3rd Level Collapsible-Handler ......................................... */ + +.group .module .collapse > h4.collapse-handler, +.module .module .collapse > h4.collapse-handler { + border-top: 1px solid #f0f7fa; + background: #e1f0f5; + background: -moz-linear-gradient(top, #ebf2f5, #e1f0f5); + background: -webkit-gradient(linear, left top, left bottom, from(#ebf2f5), to(#e1f0f5)); + background: -o-linear-gradient(top, #ebf2f5, #e1f0f5); +} +.group .collapse > h4.collapse-handler:hover, +.module .collapse > h4.collapse-handler:hover, +.group .collapse.open > h4.collapse-handler, +.module .collapse.open > h4.collapse-handler { + background: #ebf2f5; + background: -moz-linear-gradient(top, #e1f0f5, #ebf2f5); + background: -webkit-gradient(linear, left top, left bottom, from(#e1f0f5), to(#ebf2f5)); + background: -o-linear-gradient(top, #e1f0f5, #ebf2f5); +} + + + +/* Row +------------------------------------------------------------------------------------------------------ */ + +.row { + margin: 0; + border-top: 1px solid #fff; + border-bottom: 1px solid #e0e0e0; + border-left: 0; + border-right: 0; +} +.row.first, +.row:first-child, +.module input[type=hidden] + .row { + border-top: 0 !important; + border-top-left-radius: 5px; -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; + border-top-right-radius: 5px; -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; +} +.row.last, +.row:last-child, +.row:last-of-type, +fieldset.module > .row.last, +fieldset.module > .row:last-child { + border-bottom: 0 !important; + border-bottom-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; + border-bottom-right-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; +} + + + +/* Cell +------------------------------------------------------------------------------------------------------ */ + +.cell { + border-right: 1px solid #e0e0e0; + border-left: 1px solid #fff; +} + + + +/* Fieldset Cell +------------------------------------------------------------------------------------------------------ */ + +fieldset.module .cell:first-child { + border-left: 0 !important; +} +fieldset.module .cell:last-child, +fieldset.module .cell.last { + border-right: 0 !important; +} +fieldset.module .cell.last + fieldset.module .cell { + border-left: 0 !important; +} + + + +/* Tabular Modules +------------------------------------------------------------------------------------------------------ */ + +.module.table { + border: 0; + border-collapse: separate; + border-spacing: 0 2px; + background: transparent; +} +.module.thead, +.module.tfoot { + color: #aaa; + background: transparent; +} +.module.table .tr, +.module.tbody { + background: transparent; +} +.module.table .th, +.module.table .td { + border-left: 1px solid #fff; + border-right: 1px solid #e0e0e0; +} +.module.thead .th:last-of-type, +.module.thead .td:last-of-type, +.module.tfoot .td:last-of-type { + border-right: 0; +} +.module.table .module.thead .th, +.module.table .module.thead .td { + border-top: 0; + border-bottom: 0; + background: none; +} +.module.tbody .th, +.module.tbody .td { + border-top: 1px solid #d4d4d4; + border-bottom: 1px solid #d4d4d4; + background: #eee; +} +.module.tbody .th:first-of-type, +.module.tbody .td:first-of-type { + border-left: 1px solid #ccc; + border-top-left-radius: 5px; -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; + border-top-right-radius: 0; -moz-border-radius-topright: 0; -webkit-border-top-right-radius: 0; + border-bottom-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; +} +.module.tbody .th:last-of-type, +.module.tbody .td:last-of-type { + border-top-right-radius: 5px; -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; + border-bottom-left-radius: 0; -moz-border-radius-bottomleft: 0; -webkit-border-bottom-left-radius: 0; + border-bottom-right-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; +} + + + +/* Add Items +------------------------------------------------------------------------------------------------------ */ + +.module.add-item { + border: 1px solid transparent; + background: #fff; +} + + + +/* Predelete +------------------------------------------------------------------------------------------------------ */ + +.predelete h2, .collapse.predelete > h2.collapse-handler, +.predelete h3, .collapse.predelete > h3.collapse-handler, +.predelete h4, .collapse.predelete .collapse > h4.collapse-handler { + background: #f2e6e6; + background: -moz-linear-gradient(top, #fff2f2, #f2e6e6); + background: -webkit-gradient(linear, left top, left bottom, from(#fff2f2), to(#f2e6e6)); + background: -o-linear-gradient(top, #fff2f2, #f2e6e6); +} +.collapse.predelete > h2.collapse-handler:hover, +.collapse.predelete > h3.collapse-handler:hover, +.predelete .collapse > h4.collapse-handler:hover, +.collapse.open.predelete > h2.collapse-handler, +.collapse.open.predelete > h3.collapse-handler, +.predelete .collapse.open > h4.collapse-handler { + background: #f2e6e6 !important; + background: -moz-linear-gradient(top, #f2e6e6, #fff2f2) !important; + background: -webkit-gradient(linear, left top, left bottom, from(#f2e6e6), to(#fff2f2)) !important; + background: -o-linear-gradient(top, #f2e6e6, #fff2f2) !important; +} +.predelete, +.predelete .module, +.predelete .th, +.predelete .td { + background: #f2e6e6 !important; +} + + + +/* Selectors +------------------------------------------------------------------------------------------------------ */ + +.selector-available, .selector-chosen { + border: 1px solid #ccc; + border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; + background: #ddd; +} +.selector h2, .inline-group .selector h2, +.inline-related fieldset .selector-available h2, .inline-related fieldset .selector-chosen h2 { + border: 0; + border-bottom: 1px solid #d0d0d0; + background: transparent; +} +.selector .selector-filter { + color: #666; + border-top: 1px solid #e4e4e4; + border-bottom: 1px solid #e4e4e4; + border-top-left-radius: 5px;-moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; + border-top-right-radius: 5px; -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; +} +.selector h2 + .selector-filter { + border-radius-topleft: 0; -moz-border-radius-topleft: 0; -webkit-border-top-left-radius: 0; + border-radius-topright: 0; -moz-border-radius-topright: 0; -webkit-border-top-right-radius: 0; +} +.selector select[multiple=multiple] { + border-left: 0; + border-top: 1px solid #d0d0d0; + border-bottom: 1px solid #d0d0d0; + border-radius: 0; -moz-border-radius: 0; -webkit-border-radius: 0; +} + +a.selector-chooseall, a.selector-clearall { + border-top: 1px solid #e4e4e4; +} + +.selector h2 + select { + border-top: 0; +} + +a.selector-chooseall, a.selector-clearall { + border-top: 1px solid #e4e4e4; +} + + + +/* Link-List, Actions, Feed, Table of Contents +------------------------------------------------------------------------------------------------------ */ + +.module.link-list, +.module.link-list .module, +.module.actions, +.module.actions .module, +.module.feed, +.module.feed .module { + background: #fff; +} +.link-list ul li, +.feed ul li, +.actions ul li, +.table-of-contents ul li { + border-top: 1px solid #fff; + border-bottom: 1px solid #e0e0e0; +} +.actions ul li { + color: #999; +} +.actions ul li:first-child, +.link-list ul li:first-child, +.feed ul li:first-child, +.table-of-contents ul li:first-child { + border-top: 0; +} +.actions ul li:last-child, +.link-list ul li:last-child, +.feed ul li:last-child, +.table-of-contents ul li:last-child { + border-bottom: 0; +} +.link-list ul li.selected a, +.table-of-contents ul li.selected a { + color: #444; +} +a.internal:link, a.internal:visited {} +a.internal:hover, a.internal:active, +.actions li.delete-link { + color: #666; +} +a.external:link, a.external:visited { + color: #83c3d9; +} +a.external:hover, a.external:active { + color: #666; +} + + + +/* Module Changelist Filters +------------------------------------------------------------------------------------------------------ */ + +.module.changelist-filters { + color: #666; + border: 1px solid #d4d4d4; + border-bottom-left-radius: 0; -moz-border-radius-bottomleft: 0; -webkit-border-bottom-left-radius: 0; + border-bottom-right-radius: 0; -moz-border-radius-bottomright: 0; -webkit-border-bottom-right-radius: 0; +} +.module.changelist-filters:last-of-type, +body.filebrowser .module.changelist-filters { + border-bottom-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; + border-bottom-right-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; +} + + + +/* Module Search & Module Filter +------------------------------------------------------------------------------------------------------ */ + +.module.search, +.module.filter { + border: 0; + border-top-right-radius: 5px; -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; +} +.module.filter .pulldown-container { + border: 1px solid #fff; + border-radius: 6px; -moz-border-radius: 6px; -webkit-border-radius: 6px; +} +.module.filter.open .pulldown-container { + border-color: #ccc; + box-shadow: 0 0 10px #444; -moz-box-shadow: 0 0 10px #444; -webkit-box-shadow: 0 0 10px #444; +} + +.open a.button.toggle-filters, +.open.selected a.button.toggle-filters { + border-color: transparent !important; + border-bottom-left-radius: 0; -moz-border-radius-bottomleft: 0 !important; -webkit-border-bottom-left-radius: 0; + border-bottom-right-radius: 0; -moz-border-radius-bottomright: 0 !important; -webkit-border-bottom-right-radius: 0; +} +a.button.toggle-filters:link, a.button.toggle-filters:visited { + color: #309bbf; + border-color: #ddd; +} +.selected a.button.toggle-filters:link, .selected a.button.toggle-filters:visited { + color: #444; + background-color: #e1f0f5; + background: #e1f0f5 url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat; + background: url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat, -moz-linear-gradient(top, #eee, #e0e0e0); + background: url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat, -webkit-gradient(linear, left top, left bottom, from(#eee), to(#e0e0e0)); + background: url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat, -o-linear-gradient(top, #eee, #e0e0e0); +} +.open a.button.toggle-filters, .selected a.button.toggle-filters, +.selected a.button.toggle-filters:hover, .selected a.button.toggle-filters:active, +a.button.toggle-filters:hover, a.button.toggle-filters:active { + color: #666; + border-color: #ccc; + background-color: #e1f0f5; + background: #e1f0f5 url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat; + background: url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat, -moz-linear-gradient(top, #f0f7fa, #e1f0f5); + background: url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat, -webkit-gradient(linear, left top, left bottom, from(#f0f7fa), to(#e1f0f5)); + background: url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat, -o-linear-gradient(top, #f0f7fa, #e1f0f5); +} +.selected a.button.toggle-filters:link, .selected a.button.toggle-filters:visited { + color: #666; + border-color: #ddd; + background-color: #e1f0f5; + background: #e1f0f5 url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat; + background: url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat, -moz-linear-gradient(top, #f0f7fa, #e1f0f5); + background: url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat, -webkit-gradient(linear, left top, left bottom, from(#f0f7fa), to(#e1f0f5)); + background: url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat, -o-linear-gradient(top, #f0f7fa, #e1f0f5); +} +.open a.button.toggle-filters, +.open.selected a.button.toggle-filters, +.selected a.button.toggle-filters:hover, .selected a.button.toggle-filters:active, +a.button.toggle-filters:hover, a.button.toggle-filters:active { + color: #666; + border-color: #ccc; + background-color: #e1f0f5; + background: #e1f0f5 url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat; + background: url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat, -moz-linear-gradient(top, #f0f7fa, #e1f0f5); + background: url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat, -webkit-gradient(linear, left top, left bottom, from(#f0f7fa), to(#e1f0f5)); + background: url('../img/icons/icon-dropdown-hover.png') 100% 3px no-repeat, -o-linear-gradient(top, #f0f7fa, #e1f0f5); +} + +.filter-pulldown { + border: 1px solid transparent; + border-top: 0; + border-bottom-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; + border-bottom-right-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; + background: #e1f0f5; +} +.filter-pulldown label { + color: #999; +} + + + +/* Module Date Hierarchy +------------------------------------------------------------------------------------------------------ */ + +.module.date-hierarchy { + border: 1px solid #d9d9d9; + border-bottom-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; + border-bottom-right-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; + background: #eee; + background: -moz-linear-gradient(top, #eee, #e7e7e7); + background: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#e7e7e7)); + background: -o-linear-gradient(top, #eee, #e7e7e7); +} +.module + .module.date-hierarchy { + border-top-left-radius: 0; -moz-border-radius-topleft: 0; -webkit-border-top-left-radius: 0; + border-top-right-radius: 0; -moz-border-radius-topright: 0; -webkit-border-top-right-radius: 0; +} +.module + .module.date-hierarchy .row { + border-top: 1px solid #fff !important; + border-top-left-radius: 0; -moz-border-radius-topleft: 0; -webkit-border-top-left-radius: 0; + border-top-right-radius: 0; -moz-border-radius-topright: 0; -webkit-border-top-right-radius: 0; +} +.date-hierarchy a:link, .date-hierarchy a:visited { + color: #59afcc; +} +.date-hierarchy a:hover, .date-hierarchy a:active { + color: #444; +} +.date-hierarchy a.date-hierarchy-back:hover, .date-hierarchy a.date-hierarchy-back:active { + color: #666; +} + + + +/* Pagination +------------------------------------------------------------------------------------------------------ */ + +.module.pagination { + border: 1px solid #d9d9d9; + border-bottom-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; +} +.module .module.pagination { + border: 0; +} +ul.pagination { + border-top: 0 !important; +} +ul.pagination li { + border: 1px solid #fff; + border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; +} + +ul.pagination span, +ul.pagination a { + border: 1px solid; + border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; + box-sizing: border-box; -moz-box-sizing: border-box; -webkit-box-sizing: border-box; +} +ul.pagination a:link, .pagination a:visited { + color: #59afcc; + border-color: #d9d9d9; +} +ul.pagination a:hover, .pagination a:active { + color: #444; + border-color: #bdbdbd; + background: #e0e0e0; + background: -moz-linear-gradient(top, #eee, #e0e0e0); + background: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#e0e0e0)); + background: -o-linear-gradient(top, #eee, #e0e0e0); +} +ul.pagination span { + color: #444; + border-color: #bdbdbd; + background: #e0e0e0; + background: -moz-linear-gradient(top, #eee, #e0e0e0); + background: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#e0e0e0)); + background: -o-linear-gradient(top, #eee, #e0e0e0); +} +ul.pagination li.separator span { + border-color: transparent; + background: transparent; +} + + + +/* Module Changelist-Results +------------------------------------------------------------------------------------------------------ */ + +.module.changelist-results { + border-bottom-right-radius: 0; -moz-border-radius-bottomright: 0; -webkit-border-bottom-right-radius: 0; + background-color: #eee !important; +} + + + +/* Module Changelist Actions +------------------------------------------------------------------------------------------------------ */ + +.changelist-actions { + color: #ccc; +} +.changelist-actions.all-selected, +.changelist-actions.all-selected + .changelist-results { + background: #ffffe6 !important; +} +.changelist-actions ul li { + border: 1px solid #444; + border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; +} +.changelist-actions ul a, +.changelist-actions ul span { + border: 1px solid; + border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; +} +.changelist-actions ul a:link, .changelist-actions ul a:visited { + color: #59afcc; + border-color: #333; + background: #333; + background: -moz-linear-gradient(top, #444, #333); + background: -webkit-gradient(linear, left top, left bottom, from(#444), to(#333)); + background: -o-linear-gradient(top, #444, #333); +} +.changelist-actions ul a:hover, .changelist-actions ul a:active { + color: #ccc; + border-color: #333; + background: #555; + background: -moz-linear-gradient(top, #666, #555); + background: -webkit-gradient(linear, left top, left bottom, from(#666), to(#555)); + background: -o-linear-gradient(top, #666, #555); +} +.changelist-actions ul span { + color: #ccc; + border-color: #333; +} +.changelist-actions ul span span { + border: 0; +} + + + +/* Module Footer +------------------------------------------------------------------------------------------------------ */ + +.module.footer { + border: 0; + border-top: 1px solid #bdbdbd; + border-radius: 0; -moz-border-radius: 0; -webkit-border-radius: 0; + background: #333; + background: -moz-linear-gradient(top, #444, #333); + background: -webkit-gradient(linear, left top, left bottom, from(#444), to(#333)); + background: -o-linear-gradient(top, #444, #333); +} + + + +/* Submit Row +------------------------------------------------------------------------------------------------------ */ + +.module.submit-row { + border: 0; + background: transparent; +} + + + +/* Tooltips +------------------------------------------------------------------------------------------------------ */ + +.module.search .tooltip .tooltip-content { + border: 1px solid #ccc; + border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; + background: #fff; + box-shadow: 0 10px 50px #333; -moz-box-shadow: 0 10px 50px #333; -webkit-box-shadow: 0 10px 50px #333; +} + + + +/* TOOLS +–––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––– */ + +ul.tools > li { + border-top: 0 !important; + border-bottom: 0 !important; +} + + + +/* H1 + Tools +------------------------------------------------------------------------------------------------------ */ + +h1 + .tools a { + color: #fff; + border-radius: 15px; -moz-border-radius: 15px; -webkit-border-radius: 15px; +} +h1 + .tools a:link, h1 + .tools a:visited { + background: #444; + background: -moz-linear-gradient(top, #666, #444); + background: -webkit-gradient(linear, left top, left bottom, from(#666), to(#444)); + background: -o-linear-gradient(top, #666, #444); +} +h1 + .tools a:hover, h1 + .tools a:active { + border-color: transparent; + background: #309bbf; + background: -moz-linear-gradient(top, #39bae5, #309bbf); + background: -webkit-gradient(linear, left top, left bottom, from(#39bae5), to(#309bbf)); + background: -o-linear-gradient(top, #39bae5, #309bbf); +} + +.tools-active { + border-color: transparent !important; + background: #309bbf !important; + background: -moz-linear-gradient(top, #39bae5, #309bbf) !important; + background: -webkit-gradient(linear, left top, left bottom, from(#39bae5), to(#309bbf)) !important; + background: -o-linear-gradient(top, #39bae5, #309bbf) !important; +} + +h1 + .tools a.add-handler:link, h1 + .tools a.add-handler:visited { + background-color: #444; + background: #444 0 50% no-repeat scroll; + background-image: url('../img/icons/icon-object-tools-add-handler.png'), -moz-linear-gradient(top, #666, #444); + background-image: url('../img/icons/icon-object-tools-add-handler.png'), -webkit-gradient(linear, left top, left bottom, from(#666), to(#444)); + background-image: url('../img/icons/icon-object-tools-add-handler.png'), -o-linear-gradient(top, #666, #444); +} +h1 + .tools a.add-handler:hover, h1 + .tools a.add-handler:active { + background-color: #309bbf; + background: #309bbf 0 50% no-repeat scroll; + background-image: url('../img/icons/icon-object-tools-add-handler.png'), -moz-linear-gradient(top, #39bae5, #309bbf); + background-image: url('../img/icons/icon-object-tools-add-handler.png'), -webkit-gradient(linear, left top, left bottom, from(#39bae5), to(#309bbf)); + background-image: url('../img/icons/icon-object-tools-add-handler.png'), -o-linear-gradient(top, #39bae5, #309bbf); +} + + +/* 1st Level H2 + Tools ......................................... */ + +.group h2+.tools, +.module h2+.tools { + border-top-right-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; +} + +.module h2+.tools li { + border-top-right-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; +} +.group h2+.tools, +.module.collapse.closed h2+.tools { + border-bottom-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; +} + + +/* 2nd Level H3 + Tools ......................................... */ + +.group .module.collapse.closed h3+.tools, +.group .module.collapse.closed h3+.tools li, +.module.collapse.closed:last-child h3+.tools, +.module.collapse.closed:last-child h3+.tools li { + border-bottom-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; +} +.group h3+.tools, +.group h3+.tools li { + border-top-right-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; +} + + +/* 3rd Level H4 + Tools ......................................... */ + +.module.collapse.closed:last-child h4+.tools, +.module.collapse.closed:last-child h4+.tools li { + border-bottom-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; +} + + + +/* FORMS +–––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––– */ + + + +/* Errors +------------------------------------------------------------------------------------------------------ */ + +.errornote { + color: #f7f7f7; + border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; + background: #bf3030; +} +/* little fix to accomodate the top aligned login form .. */ +.login .errornote, +.errornote.login-errors { + margin-bottom: 0 !important; + padding: 8px 10px 6px !important; + border-radius: 0px; -moz-border-radius: 0px; -webkit-border-radius: 0px; +} +ul.errorlist { + color: #bf3030; +} +.error input, .error select, .errors input, .errors select { + border: 1px solid #bf3030 !important; +} +.login ul.errorlist { + color: #d93636; +} + + + +/* Labels & Other Typographic Elements in Forms +------------------------------------------------------------------------------------------------------ */ + +label { + color: #444; +} + + + +/* Form Elements +------------------------------------------------------------------------------------------------------ */ + +input, textarea, select, button { + color: #666; + border: 1px solid #ccc; +/* border-color: #ccc #ddd #ddd #ccc;*/ + border-radius: 3px; -moz-border-radius: 3px; -webkit-border-radius: 3px; + outline: 0; +} +input, textarea, select { + box-shadow: 0 1px 3px #eaeaea inset; -moz-box-shadow: 0 1px 3px #eaeaea inset; -webkit-box-shadow: 0 1px 3px #eaeaea inset; + background-color: #fff; +} +@media screen and (-webkit-min-device-pixel-ratio:0) { + input[type=file] { + background-color: transparent; + } +} + +*:focus, input:focus, textarea:focus, select:focus { + border-color: #999; +} +select:focus * { + border: 0 !important; + outline: 0 !important; +} + + +/* Searchbar ................................................... */ + +form#changelist-search { + border: 1px solid #fff; + border-radius: 15px; -moz-border-radius: 15px; -webkit-border-radius: 15px; +} +input#searchbar { + border-radius: 14px; -moz-border-radius: 14px; -webkit-border-radius: 14px; +} + + +/* Select ................................................... */ + +option, +select[multiple=multiple] option { + border-bottom: 1px dotted #ddd !important; +} +option:last-child { + border-bottom: 0; +} + + +/* Autocomplete Fields ................................................... */ + +.vAutocompleteSearchField, +.vM2MAutocompleteSearchField { + background: #eaf5f8; +} + + +/* Read Only ................................................... */ + +input[readonly], +textarea[readonly], +select[readonly] { + background: #f4f4f4; +} + + + +/* BUTTONS +–––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––– */ + +input[type=submit], input[type=reset], input[type=button], button { + color: #fff; + border: 0; + border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; + background: #acd7e5; +} + + +/* Button Containers ................................................... */ + +.submit-row>*[class*="-container"] { + border-radius: 6px; -moz-border-radius: 6px; -webkit-border-radius: 6px; + box-shadow: 0 0 5px #666; -moz-box-shadow: 0 0 5px #666; -webkit-box-shadow: 0 0 5px #666; + background: #d6d6d6; +} +.submit-row>*[class*="-container"]:hover { + box-shadow: 0 0 5px #777; -moz-box-shadow: 0 0 5px #777; -webkit-box-shadow: 0 0 5px #777; + background: #d6d6d6; +} +.submit-row>*[class*="cancel-button-container"] { + box-shadow: 0 0 5px #aaa; -moz-box-shadow: 0 0 5px #aaa; -webkit-box-shadow: 0 0 5px #aaa; +} +.footer .submit-row>*[class*="-container"], +.footer .submit-row>*[class*="cancel-button-container"] { + border: 1px solid #666; + box-shadow: 0 0 5px #666; -moz-box-shadow: 0 0 5px #666; -webkit-box-shadow: 0 0 5px #666; + background: #666; +} +.submit-row>*[class*="cancel-button-container"] { + box-shadow: 0 0 5px #aaa; -moz-box-shadow: 0 0 5px #aaa; -webkit-box-shadow: 0 0 5px #aaa; +} +.footer .submit-row>*[class*="-container"]:hover, +.footer .submit-row>*[class*="cancel-button-container"]:hover { + border: 1px solid #777; + box-shadow: 0 0 5px #777; -moz-box-shadow: 0 0 5px #777; -webkit-box-shadow: 0 0 5px #777; + background: #777; +} + + +/* Buttons & Buttonlike Links +------------------------------------------------------------------------------------------------------ */ + +.submit-row a.submit-link, +.submit-row a.delete-link, +.submit-row a.cancel-link { + border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; +} +.submit-row a.submit-link, +.submit-row input[type=submit] { + border: 1px solid #267c99; +} + +input[type=submit], +#bookmark-add-cancel, +.submit-row a.delete-link:link, .submit-row a.delete-link:visited, +.submit-row a.cancel-link:link, .submit-row a.cancel-link:visited, +.submit-row input[type=button] { + box-shadow: none !important; -moz-box-shadow: none !important; -webkit-box-shadow: none !important; +} + +.submit-row a.delete-link:link, .submit-row a.delete-link:visited { + color: #fff; + border: 1px solid #992626; + background: #bf3030; + background: -moz-linear-gradient(top, #d93636, #bf3030); + background: -webkit-gradient(linear, left top, left bottom, from(#d93636), to(#bf3030)); + background: -o-linear-gradient(top, #d93636, #bf3030); +} +#bookmark-add-cancel, +.submit-row a.cancel-link:link, .submit-row a.cancel-link:visited, +.submit-row input.cancel:hover { + color: #fff; + border: 1px solid #444; + background: #666; + background: -moz-linear-gradient(top, #666, #444); + background: -webkit-gradient(linear, left top, left bottom, from(#666), to(#444)); + background: -o-linear-gradient(top, #666, #444); +} + +input[type=submit], +.submit-row a.submit-link:link, .submit-row a.submit-link:visited { + color: #fff; + background: #309bbf; + background: -moz-linear-gradient(top, #39bae5, #309bbf); + background: -webkit-gradient(linear, left top, left bottom, from(#39bae5), to(#309bbf)); + background: -o-linear-gradient(top, #39bae5, #309bbf); +} +input[type=submit]:hover, +#bookmark-add-cancel:hover, +.submit-row a.submit-link:hover, .submit-row a.submit-link:active, +.submit-row a.delete-link:hover, .submit-row a.delete-link:active, +.submit-row a.cancel-link:hover, .submit-row a.cancel-link:active, +.submit-row input.cancel { + color: #444; + border: 1px solid #aaa; + background: #d6d6d6; + background: -moz-linear-gradient(top, #e3e3e3, #d6d6d6); + background: -webkit-gradient(linear, left top, left bottom, from(#e3e3e3), to(#d6d6d6)); + background: -o-linear-gradient(top, #e3e3e3, #d6d6d6); +} +.footer input[type=submit]:hover, +.footer #bookmark-add-cancel:hover, +.footer .submit-row a.delete-link:hover, .footer .submit-row a.delete-link:active, +.footer .submit-row a.cancel-link:hover, .footer .submit-row a.cancel-link:active { + border: 1px solid #666; +} + +button.fb_show, +button.ui-datepicker-trigger, +button.ui-timepicker-trigger, +button.ui-gAutocomplete-browse, +button.ui-gAutoSlugField-toggle, +button.ui-gFacelist-browse, +a.button, +.vDateField + span a, +.vTimeField + span a, +a.fb_show, +a.related-lookup, +a.add-another, +.tinyMCE .browse span { + border-top-left-radius: 0; -moz-border-radius-topleft: 0; -webkit-border-top-left-radius: 0; + border-bottom-left-radius: 0; -moz-border-radius-bottomleft: 0; -webkit-border-bottom-left-radius: 0; + border-top-right-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; + border-bottom-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; +} + +button { + background: #309bbf; + background-image: -moz-linear-gradient(top, #33a6cc, #309bbf); + background-image: -webkit-gradient(linear, left top, left bottom, from(#33a6cc), to(#309bbf)); + background-image: -o-linear-gradient(top, #33a6cc, #309bbf); +} +button:hover { + background: #666; + background-image: -moz-linear-gradient(top, #555, #444); + background-image: -webkit-gradient(linear, left top, left bottom, from(#555), to(#444)); + background-image: -o-linear-gradient(top, #555, #444); +} + +button.fb_show, +button.ui-gAutocomplete-browse, +button.ui-gFacelist-browse, +button.ui-gAutoSlugField-toggle, +button.ui-datepicker-trigger, +button.ui-timepicker-trigger, +.tinyMCE .browse span { + border: 1px solid #ccc; + background-color: #e1f0f5; +} +button.fb_show:hover, +button.ui-gAutocomplete-browse:hover, +button.ui-gFacelist-browse:hover, +button.ui-gAutoSlugField-toggle:hover, +button.ui-datepicker-trigger:hover, +button.ui-timepicker-trigger:hover, +.tinyMCE .browse span:hover { + background-color: #e1e1e1; +} +button.fb_show[disabled], +button.ui-gAutocomplete-browse[disabled], +button.ui-gFacelist-browse[disabled], +button.ui-gAutoSlugField-toggle[disabled], +button.ui-datepicker-trigger[disabled], +button.ui-timepicker-trigger[disabled], +input[disabled] + a { + background-color: transparent !important; + opacity: 0.3; + cursor: auto !important; +} + + +/* Autocomplete Button ......................................... */ + +button.ui-gAutocomplete-browse, +button.ui-gFacelist-browse { + background-image: url('../img/icons/icon-related-lookup.png'), -moz-linear-gradient(top, #ebf2f5, #e1f0f5); + background-image: url('../img/icons/icon-related-lookup.png'), -webkit-gradient(linear, left top, left bottom, from(#ebf2f5), to(#e1f0f5)); + background-image: url('../img/icons/icon-related-lookup.png'), -o-linear-gradient(top, #ebf2f5, #e1f0f5); +} +button.ui-gAutocomplete-browse:hover, +button.ui-gFacelist-browse:hover { + background-image: url('../img/icons/icon-related-lookup-hover.png'), -moz-linear-gradient(top, #e1e1e1, #eee); + background-image: url('../img/icons/icon-related-lookup-hover.png'), -webkit-gradient(linear, left top, left bottom, from(#e1e1e1), to(#eee)); + background-image: url('../img/icons/icon-related-lookup-hover.png'), -o-linear-gradient(top, #e1e1e1, #eee); +} + +.errors button.ui-gAutocomplete-browse, +.errors button.ui-gFacelist-browse { + border-color: #bf3030 #bf3030 #bf3030 #ccc; +} + + +/* AutoSlugField Button ......................................... */ + +/* TODO: lock/unlock icons .. */ + +button.ui-gAutoSlugField-toggle { + background-image: url('../img/icons/icon-related-lookup.png'), -moz-linear-gradient(top, #ebf2f5, #e1f0f5); + background-image: url('../img/icons/icon-related-lookup.png'), -webkit-gradient(linear, left top, left bottom, from(#ebf2f5), to(#e1f0f5)); + background-image: url('../img/icons/icon-related-lookup.png'), -o-linear-gradient(top, #ebf2f5, #e1f0f5); +} +button.ui-gAutoSlugField-toggle:hover { + background-image: url('../img/icons/icon-related-lookup-hover.png'), -moz-linear-gradient(top, #e1e1e1, #eee); + background-image: url('../img/icons/icon-related-lookup-hover.png'), -webkit-gradient(linear, left top, left bottom, from(#e1e1e1), to(#eee)); + background-image: url('../img/icons/icon-related-lookup-hover.png'), -o-linear-gradient(top, #e1e1e1, #eee); +} +.errors button.ui-gAutoSlugField-toggle { + border-color: #bf3030 #bf3030 #bf3030 #ccc; +} + + +/* Datepicker Button ......................................... */ + +button.ui-datepicker-trigger { + background-image: url('../img/icons/icon-datepicker.png'), -moz-linear-gradient(top, #ebf2f5, #e1f0f5); + background-image: url('../img/icons/icon-datepicker.png'), -webkit-gradient(linear, left top, left bottom, from(#ebf2f5), to(#e1f0f5)); + background-image: url('../img/icons/icon-datepicker.png'), -o-linear-gradient(top, #ebf2f5, #e1f0f5); +} +button.ui-datepicker-trigger:hover { + background-image: url('../img/icons/icon-datepicker-hover.png'), -moz-linear-gradient(top, #e1e1e1, #eee); + background-image: url('../img/icons/icon-datepicker-hover.png'), -webkit-gradient(linear, left top, left bottom, from(#e1e1e1), to(#eee)); + background-image: url('../img/icons/icon-datepicker-hover.png'), -o-linear-gradient(top, #e1e1e1, #eee); +} + + +/* Timepicker Button ......................................... */ + +button.ui-timepicker-trigger { + background-image: url('../img/icons/icon-timepicker.png'), -moz-linear-gradient(top, #ebf2f5, #e1f0f5); + background-image: url('../img/icons/icon-timepicker.png'), -webkit-gradient(linear, left top, left bottom, from(#ebf2f5), to(#e1f0f5)); + background-image: url('../img/icons/icon-timepicker.png'), -o-linear-gradient(top, #ebf2f5, #e1f0f5); +} +button.ui-timepicker-trigger:hover { + background-image: url('../img/icons/icon-timepicker-hover.png'), -moz-linear-gradient(top, #e1e1e1, #eee); + background-image: url('../img/icons/icon-timepicker-hover.png'), -webkit-gradient(linear, left top, left bottom, from(#e1e1e1), to(#eee)); + background-image: url('../img/icons/icon-timepicker-hover.png'), -o-linear-gradient(top, #e1e1e1, #eee); +} + + +/* Search Button ......................................... */ + +button.search { + border-color: transparent !important; + background-color: transparent; +} + + + +/* Links as Buttons +------------------------------------------------------------------------------------------------------ */ + +a.button, +.datecrumbs a, +.datecrumbs span { + border: 1px solid #e0e0e0; + border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; +} + + +/* Drop-Down Button ......................................... */ + +a.button.drop-down[class*="selected"] { + color: #444 !important; + border-color: #b0b0b0; + border-bottom-width: 0 !important; + border-bottom-left-radius: 0; -moz-border-radius-bottomleft: 0 !important; -webkit-border-bottom-left-radius: 0; + border-bottom-right-radius: 0; -moz-border-radius-bottomright: 0 !important; -webkit-border-bottom-right-radius: 0; + box-shadow: 0 -2px 3px #bbb, -2px -2px 3px #bbb, 2px -2px 3px #bbb; + -moz-box-shadow: 0 -2px 3px #bbb, -2px -2px 3px #bbb, 2px -2px 3px #bbb; + -webkit-box-shadow: 0 -2px 3px #bbb, -2px -2px 3px #bbb, 2px -2px 3px #bbb; +} +a.button.drop-down:link, a.button.drop-down:visited { + color: #309bbf; + background-color: #fff; +} +a.button.drop-down[class*="selected"], +a.button.drop-down:hover, a.button.drop-down:active { + color: #666; + background-color: #e1f0f5; + background: #e1f0f5 url('../img/icons/icon-dropdown-hover.png') 3px 3px no-repeat; + background: url('../img/icons/icon-dropdown-hover.png') 3px 3px no-repeat, -moz-linear-gradient(top, #f0f7fa, #e1f0f5) !important; + background: url('../img/icons/icon-dropdown-hover.png') 3px 3px no-repeat, -webkit-gradient(linear, left top, left bottom, from(#f0f7fa), to(#e1f0f5)); + background: url('../img/icons/icon-dropdown-hover.png') 3px 3px no-repeat, -o-linear-gradient(top, #f0f7fa, #e1f0f5) !important; +} + + +/* Filebrowser & Related Lookup ......................................... */ + +a.fb_show, +a.related-lookup { + border: 1px solid #ccc; +} +a.fb_show:link, a.fb_show:visited, +a.related-lookup:link, a.related-lookup:visited { + background-color: #e1f0f5; +} +a.fb_show:hover, a.fb_show:active, +a.related-lookup:hover, a.related-lookup:active { + background-color: #e1e1e1; +} + +a.fb_show:link, a.fb_show:visited, +.tinyMCE .browse span { + background-image: url('../img/icons/icon-fb-show.png'), -moz-linear-gradient(top, #ebf2f5, #e1f0f5); + background-image: url('../img/icons/icon-fb-show.png'), -webkit-gradient(linear, left top, left bottom, from(#ebf2f5), to(#e1f0f5)); + background-image: url('../img/icons/icon-fb-show.png'), -o-linear-gradient(top, #ebf2f5, #e1f0f5); +} +a.fb_show:hover, a.fb_show:active, +.tinyMCE .browse span:hover { + background-image: url('../img/icons/icon-fb-show-hover.png'), -moz-linear-gradient(top, #e1e1e1, #eee); + background-image: url('../img/icons/icon-fb-show-hover.png'), -webkit-gradient(linear, left top, left bottom, from(#e1e1e1), to(#eee)); + background-image: url('../img/icons/icon-fb-show-hover.png'), -o-linear-gradient(top, #e1e1e1, #eee); +} +a.related-lookup:link, a.related-lookup:visited { + background-image: url('../img/icons/icon-related-lookup.png'), -moz-linear-gradient(top, #ebf2f5, #e1f0f5); + background-image: url('../img/icons/icon-related-lookup.png'), -webkit-gradient(linear, left top, left bottom, from(#ebf2f5), to(#e1f0f5)); + background-image: url('../img/icons/icon-related-lookup.png'), -o-linear-gradient(top, #ebf2f5, #e1f0f5); +} +a.related-lookup:hover, a.related-lookup:active { + background-image: url('../img/icons/icon-related-lookup-hover.png'), -moz-linear-gradient(top, #e1e1e1, #eee); + background-image: url('../img/icons/icon-related-lookup-hover.png'), -webkit-gradient(linear, left top, left bottom, from(#e1e1e1), to(#eee)); + background-image: url('../img/icons/icon-related-lookup-hover.png'), -o-linear-gradient(top, #e1e1e1, #eee); +} + + +/* Related Lookup M2M ......................................... */ + +a.related-lookup.m2m:link, a.related-lookup.m2m:visited, +div.autocomplete-wrapper-m2m a.related-lookup:link, div.autocomplete-wrapper-m2m a.related-lookup:visited { + background-image: url('../img/icons/icon-related-lookup-m2m.png'), -moz-linear-gradient(top, #ebf2f5, #e1f0f5); + background-image: url('../img/icons/icon-related-lookup-m2m.png'), -webkit-gradient(linear, left top, left bottom, from(#ebf2f5), to(#e1f0f5)); + background-image: url('../img/icons/icon-related-lookup-m2m.png'), -o-linear-gradient(top, #ebf2f5, #e1f0f5); +} +a.related-lookup.m2m:hover, a.related-lookup.m2m:active, +div.autocomplete-wrapper-m2m a.related-lookup:hover, div.autocomplete-wrapper-m2m a.related-lookup:active { + background-image: url('../img/icons/icon-related-lookup-m2m-hover.png'), -moz-linear-gradient(top, #e1e1e1, #eee); + background-image: url('../img/icons/icon-related-lookup-m2m-hover.png'), -webkit-gradient(linear, left top, left bottom, from(#e1e1e1), to(#eee)); + background-image: url('../img/icons/icon-related-lookup-m2m-hover.png'), -o-linear-gradient(top, #e1e1e1, #eee); +} + +a.related-lookup + strong { + color: #555; +} + + +/* Add Another ......................................... */ + +a.add-another { + border-radius: 3px; -moz-border-radius: 3px; -webkit-border-radius: 3px; +} + + +/* Buttons & Button Links in Errors ......................................... */ + +.error input + button, +.error .vDateField + button, +.error .vTimeField + button, +.error input + a.fb_show, +.error input + a.related-lookup, +.error input + a.add-another, +.errors input + button, +.errors .vDateField + button, +.errors .vTimeField + button, +.errors input + a.fb_show, +.errors input + a.related-lookup, +.errors input + a.add-another, +.errors .autocomplete-wrapper-m2m { + border-color: #bf3030; +} + + +/* Focused Buttons & Button Links ......................................... */ + +input:focus + button, +.vDateField:focus + span a, +.vTimeField:focus + span a, +input:focus + a.fb_show, +input:focus + a.related-lookup, +input:focus + a.add-another { + border-color: #999; + /*border-left-color: #ccc;*/ +} +/* Reset the style for focused links in autocompletes as there is an automatically + focused (invisible) input which causes the a.related-lookup to be "focused" though it's not */ +div.autocomplete-wrapper-fk input:focus + a.related-lookup, +div.autocomplete-wrapper-m2m input:focus + a.related-lookup { + border-color: #ccc !important; +} + + +/* TABLES +–––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––––– */ + +tr.alt th, tr.alt td { + background: #f4f4f4; +} +.row1 th, .row1 td { + background: #f4f4f4; +} +.row2 th, .row2 td { + background: #fff; +} +.selected th, .selected td { + background: #ffd; +} + + +/* Thead ................................................... */ + +thead th, +tfoot td { + color: #aaa; + border-left: 1px solid #d4d4d4; + border-bottom: 1px solid #d4d4d4; + background: #eee; + background: -moz-linear-gradient(top, #eee, #e0e0e0); + background: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#e0e0e0)); + background: -o-linear-gradient(top, #eee, #e0e0e0); +} +thead th:first-of-type { + border-top-left-radius: 4px; -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; +} +thead th:last-of-type { + border-top-right-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; +} +thead th.sorted { + border-bottom: 1px solid #ccc; + background: #e0e0e0; + background: -moz-linear-gradient(top, #e0e0e0, #eee); + background: -webkit-gradient(linear, left top, left bottom, from(#e0e0e0), to(#eee)); + background: -o-linear-gradient(top, #e0e0e0, #eee); +} + +thead th a:link, thead th a:visited { + color: #59afcc; + border-top: 1px solid #fff; +} +thead th a:hover, thead th a:active, +thead th.sorted a { + color: #444; +} +thead th.sorted a { + border-top: 1px solid #ececec; +} + + +/* Tbody ................................................... */ + +tbody th, tbody td { + border-top: 1px solid #fff; + border-bottom: 1px solid #e0e0e0; +} + +tfoot td { + border-bottom: 0; + border-top: 1px solid #d4d4d4; +} + +thead th:first-child, +tfoot td:first-child { + border-left: 0; +} + +fieldset table { + border-right: 1px solid #eee; +} + +tr.row-label td { + border-bottom: 0; + color: #666; +} + + + +/* Changelist Table +------------------------------------------------------------------------------------------------------ */ + +#changelist table { + border: 1px solid #bdbdbd; +} +#changelist tbody th, #changelist tbody td { + border: 0; + border-top: 1px solid #e8e8e8; + border-left: 1px solid #e0e0e0; +} +#changelist tbody tr:first-child th, #changelist tbody tr:first-child td { + border-top: 1px solid #fff; +} +#changelist tbody tr th:first-child, #changelist tbody tr td:first-child { + border-left: 0; +} + +#changelist .changelist-results, +#changelist table { + border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; +} + +#changelist thead th:first-of-type, +#changelist thead th:first-of-type a, +#changelist thead *:first-child[style^="display: none"] + *, +#changelist thead *:first-child[style^="display: none"] + * a { + border-top-left-radius: 5px; -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; +} +#changelist thead th:last-of-type, +#changelist thead th:last-of-type a { + border-top-right-radius: 5px; -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; +} +#changelist tbody tr:last-of-type>*:first-child, +#changelist tbody tr:last-of-type>*:first-child[style^="display: none"] + * { + border-bottom-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; +} +#changelist tbody tr:last-of-type>*:last-child, +#changelist.editable tbody tr:last-of-type td:nth-last-child(-n+2) { + border-bottom-right-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; +} + +#changelist thead *[style^="display: none"] + *, +#changelist tbody tr *[style^="display: none"] + * { + border-left: 0; +} + + + +/* Change History +------------------------------------------------------------------------------------------------------ */ + +table#change-history thead th:first-child { + border-top-left-radius: 5px; -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; +} +table#change-history thead th:last-child { + border-top-right-radius: 5px; -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; +} + + + +/* Overrides +------------------------------------------------------------------------------------------------------ */ + +tbody th:first-child, tbody td:first-child { + border-left: 0; +} +tbody tr:last-child td, tbody tr:last-child th { + border-bottom: 0; +} diff --git a/gstudio/static/gstudio/css/ie.css b/gstudio/static/gstudio/css/ie.css new file mode 100644 index 0000000..1840905 --- /dev/null +++ b/gstudio/static/gstudio/css/ie.css @@ -0,0 +1,39 @@ +body { text-align: center; } +* html body legend { margin: 0px -8px 16px 0; padding: 0; } +html > body p code { *white-space: normal; } + +.container { text-align: left; } + +sup { vertical-align: text-top; } + +sub { vertical-align: text-bottom; } + +hr { margin: -8px auto 11px; } + +img { -ms-interpolation-mode: bicubic; } + +fieldset { padding-top: 0; } + +legend { margin-top: -0.2em; margin-bottom: 1em; margin-left: -0.5em; } + +fieldset, #IE8#HACK { padding-top: 1.4em; } + +legend, #IE8#HACK { margin-top: 0; margin-bottom: 0; } + +textarea { overflow: auto; } + +label { position: relative; top: -0.25em; } + +input.text { margin: 0.5em 0; background-color: white; border: 1px solid #bbbbbb; } +input.text:focus { border: 1px solid #666666; } +input.title { margin: 0.5em 0; background-color: white; border: 1px solid #bbbbbb; } +input.title:focus { border: 1px solid #666666; } +input.checkbox { position: relative; top: 0.25em; } +input.radio { position: relative; top: 0.25em; } +input.button { position: relative; top: 0.25em; } + +textarea { margin: 0.5em 0; } + +select { margin: 0.5em 0; } + +button { position: relative; top: 0.25em; } diff --git a/gstudio/static/gstudio/css/jquery-ui.css b/gstudio/static/gstudio/css/jquery-ui.css new file mode 100644 index 0000000..759a187 --- /dev/null +++ b/gstudio/static/gstudio/css/jquery-ui.css @@ -0,0 +1,566 @@ +/* + * jQuery UI CSS Framework 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } +/* + * jQuery UI Accordion 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/* + * jQuery UI Autocomplete 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.16 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/* + * jQuery UI Button 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/* + * jQuery UI Datepicker 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* + * jQuery UI Dialog 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * jQuery UI Progressbar 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/* + * jQuery UI Resizable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * jQuery UI Selectable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * jQuery UI Slider 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * jQuery UI Tabs 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/* + * jQuery UI CSS Framework 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/ + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; } +.ui-widget-content a { color: #222222/*{fcContent}*/; } +.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; } +.ui-widget-header a { color: #222222/*{fcHeader}*/; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -khtml-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; -khtml-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; } +.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -khtml-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; }
\ No newline at end of file diff --git a/gstudio/static/gstudio/css/jquery.autocomplete.css b/gstudio/static/gstudio/css/jquery.autocomplete.css new file mode 100644 index 0000000..44747e2 --- /dev/null +++ b/gstudio/static/gstudio/css/jquery.autocomplete.css @@ -0,0 +1,48 @@ +.ac_results { + padding: 0px; + border: 1px solid #cccccc; + background-color: white; + overflow: hidden; + z-index: 99999; +} + +.ac_results ul { + width: 100%; + list-style-position: outside; + list-style: none; + padding: 0; + margin: 0; +} + +.ac_results li { + margin: 0px; + padding: 2px 5px; + cursor: default; + display: block; + /* + if width will be 100% horizontal scrollbar will apear + when scroll mode will be used + */ + /*width: 100%;*/ + font: menu; + font-size: 12px; + /* + it is very important, if line-height not setted or setted + in relative units scroll will be broken in firefox + */ + line-height: 16px; + overflow: hidden; +} + +.ac_loading { + background: white url('indicator.gif') right center no-repeat; +} + +.ac_odd { + background-color: #eee; +} + +.ac_over { + background-color: #7CA0C7; + color: white; +} diff --git a/gstudio/static/gstudio/css/print.css b/gstudio/static/gstudio/css/print.css new file mode 100644 index 0000000..f89d498 --- /dev/null +++ b/gstudio/static/gstudio/css/print.css @@ -0,0 +1,33 @@ +body { line-height: 1.5; font-family: "Helvetica Neue", Arial, Helvetica, sans-serif; color: black; background: none; font-size: 10pt; } + +.container { background: none; } + +hr { background: #cccccc; color: #cccccc; width: 100%; height: 2px; margin: 2em 0; padding: 0; border: none; } +hr.space { background: white; color: white; } + +h1, h2, h3, h4, h5, h6 { font-family: "Helvetica Neue", Arial, Helvetica, sans-serif; } + +code { font-size: 0.9em; font-family: "andale mono", "lucida console", monospace; } + +a img { border: none; } +a:link, a:visited { background: transparent; font-weight: 700; text-decoration: underline; } + +p img.top { margin-top: 0; } + +blockquote { margin: 1.5em; padding: 1em; font-style: italic; font-size: 0.9em; } + +.small { font-size: 0.9em; } + +.large { font-size: 1.1em; } + +.quiet { color: #999999; } + +.hide { display: none; } + +body { font-size: 2em; } +body a, body a:link, body a:visited, body a:focus, body a:active, body a:hover { text-decoration: none; color: #006699; } + +#sidebar, .top-navigation, .commentForm { display: none; } + +#header h1 { margin-bottom: 0; } +#header h1 a { font-size: 2em; font-weight: bold; } diff --git a/gstudio/static/gstudio/css/screen.css b/gstudio/static/gstudio/css/screen.css new file mode 100644 index 0000000..4ef6458 --- /dev/null +++ b/gstudio/static/gstudio/css/screen.css @@ -0,0 +1,569 @@ +body { line-height: 1.5; font-family: Arial, Helvetica, sans-serif; color: #333333; font-size: 75%; height:1500px;width:1500px} + +h1, h2, h3, h4, h5, h6 { font-weight: normal; color: #176691; border-radius:15px; } +h1 img, h2 img, h3 img, h4 img, h5 img, h6 img { margin: 0; } + +h1 { font-size: 3em; line-height: 1; margin-bottom: 0.50em; } + +h2 { font-size: 2em; margin-bottom: 0.05em; } + +h3 { font-size: 1em; line-height: 1; margin-bottom: 1.00em; } + +h4 { font-size: 1.2em; line-height: 1.25; margin-bottom: 1.25em; } + +h5 { font-size: 1em; font-weight: bold; margin-bottom: 1.50em; } + +h6 { font-size: 1em; font-weight: bold; } + +p { margin: 0 0 1.5em; } +p .left { display: inline; float: left; margin: 1.5em 1.5em 1.5em 0; padding: 0; } +p .right { display: inline; float: right; margin: 1.5em 0 1.5em 1.5em; padding: 0; } + +a { text-decoration:underline; color: #0888CC; } +a:visited { color: #006699; } +a:focus { color: #003366; } +a:hover { color: #E83E65; } +a:active { color: #006699; } + +blockquote { margin-bottom: 1em; margin-left: 1em; margin-right: 1em; margin-top: 0.5em; color: #666666; font-style: oblique; } + + +strong, dfn { font-weight: bold; } + +em, dfn { font-style: italic; } + +sup, sub { line-height: 0; } + +abbr, acronym { border-bottom: 1px dotted #666666; } + +address { margin: 0 0 1.5em; font-style: italic; } + +del { color: #666666; } + +pre { margin: 1.5em 0; white-space: pre; } + +pre, code, tt { font: 1em "andale mono", "lucida console", monospace; line-height: 1.5; } + +li ul, li ol { margin: 0; } + +ul, ol { margin: 0 1.5em 1.5em 0; padding-left: 1.5em; } + +ul { list-style-type: disc; } + +ol { list-style-type: decimal; } + +dl { margin: 0 0 1.5em 0; } +dl dt { font-weight: bold; } + +dd { margin-left: 1.5em; } + +table { margin-bottom: 1.4em; width: 100%; } + +th { font-weight: bold; } + +thead th { background: #c3d9ff; } + +th, td, caption { padding: 4px 10px 4px 5px; } + +table.striped tr:nth-child(even) td, table tr.even td { background: #e5ecf9; } + +tfoot { font-style: italic; } + +caption { background: #eeeeee; } + +.quiet { color: #666666; } + +.loud { color: #111111; } + +.clear { clear: both; } + +.nowrap { white-space: nowrap; } + +.clearfix { overflow: hidden; *zoom: 1; } + +.small { font-size: 0.8em; margin-bottom: 1.875em; line-height: 1.875em; } + +.large { font-size: 1.2em; line-height: 2.5em; margin-bottom: 1.25em; } + +.first { margin-left: 0; padding-left: 0; } + +.last { margin-right: 0; padding-right: 0; } + +.top { margin-top: 0; padding-top: 0; } + +.bottom { margin-bottom: 0; padding-bottom: 0; } + +.container { width: 950px; margin: 0 auto; overflow: hidden; *zoom: 1; } + +.column, .span-1, .span-2, .span-3, .span-4, .span-5, .span-6, .span-7, .span-8, .span-9, .span-10, .span-11, .span-12, .span-13, .span-14, .span-15, .span-16, .span-17, .span-18, .span-19, .span-20, .span-21, .span-22, .span-23, .span-24 { display: inline; float: left; margin-right: 10px; } +* html .column, * html .span-1, * html .span-2, * html .span-3, * html .span-4, * html .span-5, * html .span-6, * html .span-7, * html .span-8, * html .span-9, * html .span-10, * html .span-11, * html .span-12, * html .span-13, * html .span-14, * html .span-15, * html .span-16, * html .span-17, * html .span-18, * html .span-19, * html .span-20, * html .span-21, * html .span-22, * html .span-23, * html .span-24 { overflow-x: hidden; } + +.last { margin-right: 0; } + +.span-1 { width: 30px; } + +.span-2 { width: 70px; } + +.span-3 { width: 110px; } + +.span-4 { width: 150px; } + +.span-5 { width: 190px; } + +.span-6 { width: 230px; } + +.span-7 { width: 270px; } + +.span-8 { width: 310px; } + +.span-9 { width: 350px; } + +.span-10 { width: 390px; } + +.span-11 { width: 430px; } + +.span-12 { width: 470px; } + +.span-13 { width: 510px; } + +.span-14 { width: 550px; } + +.span-15 { width: 590px; } + +.span-16 { width: 500px; } + +.span-17 { width: 670px; } + +.span-18 { width: 710px; } + +.span-19 { width: 750px; } + +.span-20 { width: 790px; } + +.span-21 { width: 830px; } + +.span-22 { width: 870px; } + +.span-23 { width: 910px; } + +.span-24 { width: 950px; margin: 0; } + +input.span-1, textarea.span-1, select.span-1 { width: 30px; } +input.span-2, textarea.span-2, select.span-2 { width: 70px; } +input.span-3, textarea.span-3, select.span-3 { width: 110px; } +input.span-4, textarea.span-4, select.span-4 { width: 150px; } +input.span-5, textarea.span-5, select.span-5 { width: 190px; } +input.span-6, textarea.span-6, select.span-6 { width: 230px; } +input.span-7, textarea.span-7, select.span-7 { width: 270px; } +input.span-8, textarea.span-8, select.span-8 { width: 310px; } +input.span-9, textarea.span-9, select.span-9 { width: 350px; } +input.span-10, textarea.span-10, select.span-10 { width: 390px; } +input.span-11, textarea.span-11, select.span-11 { width: 430px; } +input.span-12, textarea.span-12, select.span-12 { width: 470px; } +input.span-13, textarea.span-13, select.span-13 { width: 510px; } +input.span-14, textarea.span-14, select.span-14 { width: 550px; } +input.span-15, textarea.span-15, select.span-15 { width: 590px; } +input.span-16, textarea.span-16, select.span-16 { width: 630px; } +input.span-17, textarea.span-17, select.span-17 { width: 670px; } +input.span-18, textarea.span-18, select.span-18 { width: 710px; } +input.span-19, textarea.span-19, select.span-19 { width: 750px; } +input.span-20, textarea.span-20, select.span-20 { width: 790px; } +input.span-21, textarea.span-21, select.span-21 { width: 830px; } +input.span-22, textarea.span-22, select.span-22 { width: 870px; } +input.span-23, textarea.span-23, select.span-23 { width: 910px; } +input.span-24, textarea.span-24, select.span-24 { width: 950px; } + +.append-1 { padding-right: 40px; } + +.append-2 { padding-right: 80px; } + +.append-3 { padding-right: 120px; } + +.append-4 { padding-right: 160px; } + +.append-5 { padding-right: 200px; } + +.append-6 { padding-right: 240px; } + +.append-7 { padding-right: 280px; } + +.append-8 { padding-right: 320px; } + +.append-9 { padding-right: 360px; } + +.append-10 { padding-right: 400px; } + +.append-11 { padding-right: 440px; } + +.append-12 { padding-right: 480px; } + +.append-13 { padding-right: 520px; } + +.append-14 { padding-right: 560px; } + +.append-15 { padding-right: 600px; } + +.append-16 { padding-right: 640px; } + +.append-17 { padding-right: 680px; } + +.append-18 { padding-right: 720px; } + +.append-19 { padding-right: 760px; } + +.append-20 { padding-right: 800px; } + +.append-21 { padding-right: 840px; } + +.append-22 { padding-right: 880px; } + +.append-23 { padding-right: 920px; } + +.prepend-1 { padding-left: 40px; } + +.prepend-2 { padding-left: 80px; } + +.prepend-3 { padding-left: 120px; } + +.prepend-4 { padding-left: 160px; } + +.prepend-5 { padding-left: 200px; } + +.prepend-6 { padding-left: 240px; } + +.prepend-7 { padding-left: 280px; } + +.prepend-8 { padding-left: 320px; } + +.prepend-9 { padding-left: 360px; } + +.prepend-10 { padding-left: 400px; } + +.prepend-11 { padding-left: 440px; } + +.prepend-12 { padding-left: 480px; } + +.prepend-13 { padding-left: 520px; } + +.prepend-14 { padding-left: 560px; } + +.prepend-15 { padding-left: 600px; } + +.prepend-16 { padding-left: 640px; } + +.prepend-17 { padding-left: 680px; } + +.prepend-18 { padding-left: 720px; } + +.prepend-19 { padding-left: 760px; } + +.prepend-20 { padding-left: 800px; } + +.prepend-21 { padding-left: 840px; } + +.prepend-22 { padding-left: 880px; } + +.prepend-23 { padding-left: 920px; } + +.pull-1, .pull-2, .pull-3, .pull-4, .pull-5, .pull-6, .pull-7, .pull-8, .pull-9, .pull-10, .pull-11, .pull-12, .pull-13, .pull-14, .pull-15, .pull-16, .pull-17, .pull-18, .pull-19, .pull-20, .pull-21, .pull-22, .pull-23, .pull-24 { display: inline; float: left; position: relative; } + +.pull-1 { margin-left: -40px; } + +.pull-2 { margin-left: -80px; } + +.pull-3 { margin-left: -120px; } + +.pull-4 { margin-left: -160px; } + +.pull-5 { margin-left: -200px; } + +.pull-6 { margin-left: -240px; } + +.pull-7 { margin-left: -280px; } + +.pull-8 { margin-left: -320px; } + +.pull-9 { margin-left: -360px; } + +.pull-10 { margin-left: -400px; } + +.pull-11 { margin-left: -440px; } + +.pull-12 { margin-left: -480px; } + +.pull-13 { margin-left: -520px; } + +.pull-14 { margin-left: -560px; } + +.pull-15 { margin-left: -600px; } + +.pull-16 { margin-left: -640px; } + +.pull-17 { margin-left: -680px; } + +.pull-18 { margin-left: -720px; } + +.pull-19 { margin-left: -760px; } + +.pull-20 { margin-left: -800px; } + +.pull-21 { margin-left: -840px; } + +.pull-22 { margin-left: -880px; } + +.pull-23 { margin-left: -920px; } + +.pull-24 { margin-left: -960px; } + +.push-1, .push-2, .push-3, .push-4, .push-5, .push-6, .push-7, .push-8, .push-9, .push-10, .push-11, .push-12, .push-13, .push-14, .push-15, .push-16, .push-17, .push-18, .push-19, .push-20, .push-21, .push-22, .push-23, .push-24 { display: inline; float: left; position: relative; } + +.push-1 { margin: 0 -40px 1.5em 40px; } + +.push-2 { margin: 0 -80px 1.5em 80px; } + +.push-3 { margin: 0 -120px 1.5em 120px; } + +.push-4 { margin: 0 -160px 1.5em 160px; } + +.push-5 { margin: 0 -200px 1.5em 200px; } + +.push-6 { margin: 0 -240px 1.5em 240px; } + +.push-7 { margin: 0 -280px 1.5em 280px; } + +.push-8 { margin: 0 -320px 1.5em 320px; } + +.push-9 { margin: 0 -360px 1.5em 360px; } + +.push-10 { margin: 0 -400px 1.5em 400px; } + +.push-11 { margin: 0 -440px 1.5em 440px; } + +.push-12 { margin: 0 -480px 1.5em 480px; } + +.push-13 { margin: 0 -520px 1.5em 520px; } + +.push-14 { margin: 0 -560px 1.5em 560px; } + +.push-15 { margin: 0 -600px 1.5em 600px; } + +.push-16 { margin: 0 -640px 1.5em 640px; } + +.push-17 { margin: 0 -680px 1.5em 680px; } + +.push-18 { margin: 0 -720px 1.5em 720px; } + +.push-19 { margin: 0 -760px 1.5em 760px; } + +.push-20 { margin: 0 -800px 1.5em 800px; } + +.push-21 { margin: 0 -840px 1.5em 840px; } + +.push-22 { margin: 0 -880px 1.5em 880px; } + +.push-23 { margin: 0 -920px 1.5em 920px; } + +.push-24 { margin: 0 -960px 1.5em 960px; } + +.prepend-top { margin-top: 1.5em; } + +.append-bottom { margin-bottom: 1.5em; } + +.showgrid { background: url('/../img/grid.png?1317027277'); } + +.feedback, .error, .alert, .notice, .success, .info { padding: 0.8em; margin-bottom: 1em; border: 2px solid #dddddd; } + +.error, .alert { background: #fbe3e4; color: #8a1f11; border-color: #fbc2c4; } +.error a, .alert a { color: #8a1f11; } + +.notice { background: #fff6bf; color: #514721; border-color: #ffd324; } +.notice a { color: #514721; } + +.success { background: #e6efc2; color: #264409; border-color: #c6d880; } +.success a { color: #264409; } + +.info { background: #d5edf8; color: #205791; border-color: #92cae4; } +.info a { color: #205791; } + +.hide { display: none; } + +.highlight { background: yellow; } + +.added { background: #006600; color: white; } + +.removed { background: #990000; color: white; } + +label { font-weight: bold; } + +fieldset { padding: 1.4em; margin: 0 0 1.5em 0; } + +legend { font-weight: bold; font-size: 1.2em; } + +input.text, input.title, input[type=email], input[type=text], input[type=password] { margin: 0.5em 0; background-color: white; padding: 5px; } +input.title { font-size: 1.5em; } + +textarea { margin: 0.5em 0; padding: 5px; } + +select { margin: 0.5em 0; } + +fieldset { border: 1px solid #cccccc; } + +input.text, input.title, input[type=email], input[type=text], input[type=password], textarea { background-color: #fff; border: 1px solid #bbbbbb; } +input.text:focus, input.title:focus, input[type=email]:focus, input[type=text]:focus, input[type=password]:focus, textarea:focus { border: 1px solid #666666; } + +select { background-color: #fff; border-width: 1px; border-style: solid; } + +input.text, input.title, input[type=email], input[type=text], input[type=password] { width: 300px; } + +textarea { width: 390px; height: 250px; } + +body { background: transparent url(../img/background.gif) repeat-x scroll left top; } + +ul, ol { margin: 0 1.5em 1.5em 0; padding-left: 3.333em; } + +a { text-decoration: none; } +a:hover { text-decoration: underline; } + +#header { margin-bottom: 1em; border-bottom: 1px solid #e9e9f3; } +#header h1 { font-size: 2em; font-weight: bold; margin-bottom: 0; } +#header .top-navigation { float: right; } +#header .top-navigation img { border: 0; } +#header .top-navigation .link { padding-left: 1.5em; } +#header .top-navigation .sitemap { background: transparent url(../img/sitemap.png) no-repeat scroll left center; } +#header .top-navigation .feeds { background: transparent url(../img/rss.png) no-repeat scroll left center; } + +#breadcrumbs { background-color:#0888CC; font-size: 1.2em; color:white; } +#b1 {position:relative; center:5%; background-color:#43AEE7; color: white; border: 1px solid #000000; font-size:1em;} +#b2 {position:relative; center:6%; background-color:#43AEE7; color: white; border: 1px solid #000000; font-size:1em;} + +#body { margin-bottom: 1em; border-bottom: 1px solid #e9e9f3; } + +#content h1, #content h2, #content h3 { margin-top: 10px; } + +/* copied from structure.css */ +#content { + position: relative; + float: left; + clear: both; + margin-bottom: 10px; + margin-left: 0; + margin-right: 60px; + margin-top: 10px; + padding-right: 30px; + width:250px; +} + +#graph { + position: absolute; + float: left; + clear: both; + margin-bottom: 10px; + margin-left: 0; + margin-right: 60px; + margin-top: 10px; + padding-right: 30px; + width: 250px; +} + +/* copied from tools.css */ +.tools { + position: relative; + float: left; + clear: both; + padding: 6px 10px; + font-size: 11px; + font-weight: bold; +} +#sidebar{position:absolute; margin-left:1000px; margin-right:150px; margin-top:10px; width:300px;} +#sidebar div:first-child h3 { margin-top:0px; } +#sidebar h3 { background-color: #C4EBF4; padding: 0.5em; } +#sidebar p { padding-left: 1em; } +#sidebar ul, #sidebar ol { padding-left: 2.5em; list-style-image: url(../img/bullet.png); } +#sidebar li ul, #sidebar li ol { margin: 0 0.0em 0 0; } +#sidebar input { width: auto; } +#button {background-color:#43AEE7; color: white;} +#sidebar .calendar h3 { margin-bottom: 0; } +#sidebar .calendar .month-navigation { padding-bottom: 1.5em; } +#sidebar .calendar .month-navigation .month-previous { float: left; } +#sidebar .calendar .month-navigation .month-next { float: right; } +#sidebar .tags div { padding: 0 5px 0 18px; } +#sidebar .tags div ul { list-style-type: none; list-style: none; font-size: 1.5em; line-height: 1.8em; } +#sidebar .tags div ul, #sidebar .tags div ul li { margin: 0px; padding: 0px; display: inline; } +#sidebar .tags div ul li { list-style-image: none; list-style-type: none; margin-left: 0px; } +#sidebar .tags div ul .tag_1 { font-size: 0.75em; color: #001e2d; } +#sidebar .tags div ul .tag_2 { font-size: 1em; color: #00334c; } +#sidebar .tags div ul .tag_3 { font-size: 1.125em; color: #005b89; } +#sidebar .tags div ul .tag_4 { font-size: 2em; color: #0070a8; } +#sidebar .tags div ul .tag_5 { font-size: 2.25em; color: #0099e5; } +#sidebar .tags div ul .tag_6 { font-size: 3em; color: #00adff; } + +th.month{padding:0cm 2.5cm;} +table.month { margin-bottom: 0; } +table.month th.month { text-transform: uppercase; color: #006699; background: none; } +table.month th { text-transform: capitalize; color: #917E7E; background-color: #C4EBF4; border-radius:15px;} +table.month td { text-align: center; font-weight: bold; } +table.month td.objecttype { background-color: #C4EBF4; } + +div.paginator { margin-bottom: 1em; } +div.paginator span { font-size: 1.2em; margin-left: 0.3em; padding: 0 0.5em 0 0.5em; float: left; border: 1px solid #e9e9f3; } +div.paginator span.index { margin-left: 0; } +div.paginator span.page:hover, div.paginator span.next:hover, div.paginator span.previous:hover { background-color: #006699; } +div.paginator span.page:hover a, div.paginator span.next:hover a, div.paginator span.previous:hover a { color: white; } +div.paginator span.current { border-color: #006699; background-color: #006699; color: white; } + +.hobjecttype { margin-bottom: 1em; } +.hobjecttype .objecttype-header { margin-bottom: 1em; border-radius:15px;} +.hobjecttype .objecttype-header .objecttype-title { margin: 0; padding-left: 0.25em; padding-right: 0.25em; background-color:#C4EBF4} +.hobjecttype .objecttype-header .objecttype-info { margin: 0; padding-left: 2em; background: #C4EBF4 url(../img/metatype.png) no-repeat scroll 0.5em; border-radius:15px;} +.hobjecttype .objecttype-body .objecttype-content { padding-left: 1em; padding-right: 1em; } +.hobjecttype .objecttype-body .objecttype-image { margin-top: -1.5em; } +.hobjecttype .objecttype-body .objecttype-image p img { border: 0; margin: 0 1.5em 1.5em 0; } +.hobjecttype .objecttype-footer p { margin-bottom: 0; } +.hobjecttype .objecttype-footer p strong { padding-left: 1.5em; } +.hobjecttype .objecttype-footer .objecttype-tags strong { background: transparent url(../img/tags.png) no-repeat scroll; } +.hobjecttype .objecttype-footer .objecttype-shorturl strong { background: transparent url(../img/shorturl.png) no-repeat scroll; } +.hobjecttype .objecttype-footer .objecttype-comments strong { background: transparent url(../img/comments.png) no-repeat scroll; } +.hobjecttype .objecttype-header { background-color: #C4EBF4; } +.hobjecttype .objecttype-content p { font-size: 1.2em; } +.hobjecttype .objecttype-content pre, .hobjecttype .objecttype-content blockquote { overflow: auto; padding: 1em; clear: none; float: none; margin: 0 0 1.5em 0; width: auto; } +.hobjecttype .objecttype-content blockquote { margin: 0 2em 1.5em 2em; border: 1px dashed #94949e; background-color: #fafaff; } +.hobjecttype .objecttype-content blockquote p { font-size: 1.5em; margin: 0; } +.hobjecttype .objecttype-content pre { line-height: 110%; background-color: #e9e9ff; border-top: 1px solid #94949e; border-bottom: 1px solid #94949e; } +.hobjecttype .objecttype-footer p strong { color: #94949e; } + +.objecttype-widgets ul, .objecttype-widgets ol { padding-left: 2.5em; list-style-image: url(../img/bullet.png); } + +.featured .objecttype-header { background-color: #c4d9c4; } + +.hnodetype { margin-bottom: 1em; } +.hnodetype .nodetype-header { margin-bottom: 1em; } +.hnodetype .nodetype-header .nodetype-title { margin: 0; padding-left: 0.25em; padding-right: 0.25em; } +.hnodetype .nodetype-header .nodetype-info { margin: 0; padding-left: 2em; background: transparent url(../img/Objecttype.png) no-repeat scroll 0.5em; } +.hnodetype .nodetype-body .nodetype-content { padding-left: 1em; padding-right: 1em; } +.hnodetype .nodetype-body .nodetype-image { margin-top: -1.5em; } +.hnodetype .nodetype-body .nodetype-image p img { border: 0; margin: 0 1.5em 1.5em 0; } +.hnodetype .nodetype-footer p { margin-bottom: 0; } +.hnodetype .nodetype-footer p strong { padding-left: 1.5em; } +.hnodetype .nodetype-footer .nodetype-tags strong { background: transparent url(../img/tags.png) no-repeat scroll; } +.hnodetype .nodetype-footer .nodetype-shorturl strong { background: transparent url(../img/shorturl.png) no-repeat scroll; } +.hnodetype .nodetype-footer .nodetype-comments strong { background: transparent url(../img/comments.png) no-repeat scroll; } +.hnodetype .nodetype-header { background-color: #ffffff; } +.hnodetype .nodetype-content p { font-size: 1.2em; } +.hnodetype .nodetype-content pre, .hnodetype .nodetype-content blockquote { overflow: auto; padding: 1em; clear: none; float: none; margin: 0 0 1.5em 0; width: auto; } +.hnodetype .nodetype-content blockquote { margin: 0 2em 1.5em 2em; border: 1px dashed #94949e; background-color: #fafaff; } +.hnodetype .nodetype-content blockquote p { font-size: 1.5em; margin: 0; } +.hnodetype .nodetype-content pre { line-height: 110%; background-color: #e9e9ff; border-top: 1px solid #94949e; border-bottom: 1px solid #94949e; } +.hnodetype .nodetype-footer p strong { color: #94949e; } + +.nodetype-widgets ul, .nodetype-widgets ol { padding-left: 2.5em; list-style-image: url(../img/bullet.png); } + +.featured .nodetype-header { background-color: #c4d9c4; } + +ol#comment-list, ol#pingback-list, ol#trackback-list { width: 100%; margin-bottom: 0; padding-left: 1em; } +ol#comment-list li, ol#pingback-list li, ol#trackback-list li { margin-bottom: 1em; border: 1px solid #e9e9f3; } +ol#comment-list li.box2, ol#pingback-list li.box2, ol#trackback-list li.box2 { border-color: #94949e; background-color: #e9e9f3; } +ol#comment-list li.post-author, ol#pingback-list li.post-author, ol#trackback-list li.post-author { color: #94949e; } +ol#comment-list li p, ol#pingback-list li p, ol#trackback-list li p { margin-bottom: 0.5em; } +ol#comment-list li img, ol#pingback-list li img, ol#trackback-list li img { padding: 5px; } +ol#comment-list li .pingback-body, ol#comment-list li .trackback-body, ol#pingback-list li .pingback-body, ol#pingback-list li .trackback-body, ol#trackback-list li .pingback-body, ol#trackback-list li .trackback-body { padding: 5px; } +ol#comment-list li .comment-author, ol#comment-list li .pingback-author, ol#comment-list li .trackback-author, ol#pingback-list li .comment-author, ol#pingback-list li .pingback-author, ol#pingback-list li .trackback-author, ol#trackback-list li .comment-author, ol#trackback-list li .pingback-author, ol#trackback-list li .trackback-author { font-size: 1.2em; font-weight: bold; color: #666666; } diff --git a/gstudio/static/gstudio/css/slider.css b/gstudio/static/gstudio/css/slider.css new file mode 100644 index 0000000..d3bae53 --- /dev/null +++ b/gstudio/static/gstudio/css/slider.css @@ -0,0 +1,12 @@ +#slider { width: 400px; padding-right: 230px; position: relative; height: 250px; overflow: hidden; margin-bottom: 5px; } +#slider ul.ui-tabs-nav { list-style: none; padding: 0; margin: 0; top: 0; left: 400px; width: 230px; position: absolute; overflow: hidden; } +#slider ul.ui-tabs-nav li a { display: block; height: 49px; border-bottom: 1px solid #e9e9f3; } +#slider ul.ui-tabs-nav li a img { float: left; border: 0; padding: 3px; width: 78.4px; height: 43px; } +#slider ul.ui-tabs-nav li a:hover { text-decoration: none; background: #e9e9f3; } +#slider ul.ui-tabs-nav li.ui-tabs-selected a { background: #44aadd; color: white; } +#slider div.ui-tabs-panel { position: relative; width: 400px; height: 250px; } +#slider div.ui-tabs-panel .panel_info { left: 0; bottom: 0; position: absolute; height: 70px; padding: 5px; color: white; background: url(../img/trans.png); width: 390px; } +#slider div.ui-tabs-panel a { color: #44aadd; } +#slider div.ui-tabs-panel h2 { margin: 0; overflow: hidden; } +#slider div.ui-tabs-panel img { width: 400px; height: 250px; } +#slider .ui-tabs-hide { display: none; } diff --git a/gstudio/static/gstudio/css/src/_base.sass b/gstudio/static/gstudio/css/src/_base.sass new file mode 100644 index 0000000..9b9f570 --- /dev/null +++ b/gstudio/static/gstudio/css/src/_base.sass @@ -0,0 +1,32 @@ +// Here is where you can define your constants for your application +// and to configure the blueprint framework. + +$blueprint_grid_columns: 24 +$blueprint_container_size: 950px +$blueprint_grid_margin: 10px + +// Use this to calculate the width based on the total width. +// Or you can set !blueprint_grid_width to a fixed value +// and unset !blueprint_container_size -- it will be calculated for you. + +$blueprint_font_size: 12px +$blueprint_font_family: unquote("Arial, Helvetica, sans-serif") +$blueprint_grid_width: ($blueprint_container_size + $blueprint_grid_margin) / $blueprint_grid_columns - $blueprint_grid_margin + +// Colors +$font_color: #333333 +$link_color: #006699 +$box_color: #e9e9f3 + +// Derived colors +$box_font_color: $box_color - #555555 +$link_hover_color: $link_color - #333333 +$link_active_color: $link_color +$link_visited_color: $link_color +$header_color: $link_color + #333333 + +// Mixins +@import gbobject +@import calendar +@import paginator +@import tag-cloud diff --git a/gstudio/static/gstudio/css/src/_calendar.sass b/gstudio/static/gstudio/css/src/_calendar.sass new file mode 100644 index 0000000..d3c18d5 --- /dev/null +++ b/gstudio/static/gstudio/css/src/_calendar.sass @@ -0,0 +1,15 @@ +=calendar($head_color, $box_color, $box_font_color) + margin-bottom: 0 + th.month + text-transform: uppercase + color: $head_color + background: none + th + text-transform: capitalize + color: $box_font_color + background-color: $box_color + td + text-align: center + font-weight: bold + &.gbobject + background-color: $box_color diff --git a/gstudio/static/gstudio/css/src/_gbobject.sass b/gstudio/static/gstudio/css/src/_gbobject.sass new file mode 100644 index 0000000..5805303 --- /dev/null +++ b/gstudio/static/gstudio/css/src/_gbobject.sass @@ -0,0 +1,35 @@ +=gbobject + margin-bottom: 1em + .gbobject-header + margin-bottom: 1em + .gbobject-title + margin: 0 + padding-left: 0.25em + padding-right: 0.25em + .gbobject-info + margin: 0 + padding-left: 2em + background: transparent url(../img/Objecttype.png) no-repeat scroll 0.5em + .gbobject-body + .gbobject-content + padding-left: 1em + padding-right: 1em + .gbobject-image + margin-top: -1.5em + p img + border: 0 + margin: 0 1.5em 1.5em 0 + .gbobject-footer + p + margin-bottom: 0 + strong + padding-left: 1.5em + .gbobject-tags + strong + background: transparent url(../img/tags.png) no-repeat scroll + .gbobject-shorturl + strong + background: transparent url(../img/shorturl.png) no-repeat scroll + .gbobject-comments + strong + background: transparent url(../img/comments.png) no-repeat scroll diff --git a/gstudio/static/gstudio/css/src/_gstudio.sass b/gstudio/static/gstudio/css/src/_gstudio.sass new file mode 100644 index 0000000..5805303 --- /dev/null +++ b/gstudio/static/gstudio/css/src/_gstudio.sass @@ -0,0 +1,35 @@ +=gbobject + margin-bottom: 1em + .gbobject-header + margin-bottom: 1em + .gbobject-title + margin: 0 + padding-left: 0.25em + padding-right: 0.25em + .gbobject-info + margin: 0 + padding-left: 2em + background: transparent url(../img/Objecttype.png) no-repeat scroll 0.5em + .gbobject-body + .gbobject-content + padding-left: 1em + padding-right: 1em + .gbobject-image + margin-top: -1.5em + p img + border: 0 + margin: 0 1.5em 1.5em 0 + .gbobject-footer + p + margin-bottom: 0 + strong + padding-left: 1.5em + .gbobject-tags + strong + background: transparent url(../img/tags.png) no-repeat scroll + .gbobject-shorturl + strong + background: transparent url(../img/shorturl.png) no-repeat scroll + .gbobject-comments + strong + background: transparent url(../img/comments.png) no-repeat scroll diff --git a/gstudio/static/gstudio/css/src/_paginator.sass b/gstudio/static/gstudio/css/src/_paginator.sass new file mode 100644 index 0000000..b1258fc --- /dev/null +++ b/gstudio/static/gstudio/css/src/_paginator.sass @@ -0,0 +1,19 @@ +=paginator($link_color, $box_color) + margin-bottom: 1em + span + font-size: 1.2em + margin-left: 0.3em + padding: 0 0.5em 0 0.5em + float: left + border: 1px solid $box_color + &.index + margin-left: 0 + &.page, &.next, &.previous + &:hover + background-color: $link_color + a + color: white + &.current + border-color: $link_color + background-color: $link_color + color: white diff --git a/gstudio/static/gstudio/css/src/_tag-cloud.sass b/gstudio/static/gstudio/css/src/_tag-cloud.sass new file mode 100644 index 0000000..6d859b6 --- /dev/null +++ b/gstudio/static/gstudio/css/src/_tag-cloud.sass @@ -0,0 +1,21 @@ +=tag-cloud($link_color, $base_size: 1em) + font-size: $base_size + line-height: 1.2 * $base_size + .tag_1 + font-size: $base_size / 2 + color: $link_color * 0.3 + .tag_2 + font-size: 2 * $base_size / 3 + color: $link_color * 0.5 + .tag_3 + font-size: 3 * $base_size / 4 + color: $link_color * 0.9 + .tag_4 + font-size: 4 * $base_size / 3 + color: $link_color * 1.1 + .tag_5 + font-size: 3 * $base_size / 2 + color: $link_color * 1.5 + .tag_6 + font-size: 2 * $base_size + color: $link_color * 1.7
\ No newline at end of file diff --git a/gstudio/static/gstudio/css/src/dashboard_gstudio.sass b/gstudio/static/gstudio/css/src/dashboard_gstudio.sass new file mode 100644 index 0000000..1aa979d --- /dev/null +++ b/gstudio/static/gstudio/css/src/dashboard_gstudio.sass @@ -0,0 +1,66 @@ +body + &.dashboard + #content + width: 75% + +.module + width: 400px + margin-right: 5px + table + width: 100% + th, td + font-size: 12px + +.managelink + background: url("../img/manage.png") no-repeat scroll 0 0.2em transparent + padding-left: 12px + +.previewlink + background: url("../img/preview.png") no-repeat scroll 0 0.2em transparent + padding-left: 12px + +input, textarea, select + border: 1px solid #cccccc + +.vTextField, .vLargeTextField + width: 25em + +.required label, label.required + color: #333333 !important + font-weight: bold !important + +.button + float: left + margin-right: 5px + +#contents + th + width: 50% + td + padding-left: 10px + a + font-weight: bold + +#quickpost + th + width: 20% + vertical-align: middle + td + width: 100% + +#comments + th + width: 10% + td + width: 100% + white-space: normal + a + display: inline + +#drafts, #linkbacks, #comments + th + font-weight: normal + a + font-weight: bold + abbr + color: #666666 diff --git a/gstudio/static/gstudio/css/src/dashboard_objectapp.sass b/gstudio/static/gstudio/css/src/dashboard_objectapp.sass new file mode 100644 index 0000000..1aa979d --- /dev/null +++ b/gstudio/static/gstudio/css/src/dashboard_objectapp.sass @@ -0,0 +1,66 @@ +body + &.dashboard + #content + width: 75% + +.module + width: 400px + margin-right: 5px + table + width: 100% + th, td + font-size: 12px + +.managelink + background: url("../img/manage.png") no-repeat scroll 0 0.2em transparent + padding-left: 12px + +.previewlink + background: url("../img/preview.png") no-repeat scroll 0 0.2em transparent + padding-left: 12px + +input, textarea, select + border: 1px solid #cccccc + +.vTextField, .vLargeTextField + width: 25em + +.required label, label.required + color: #333333 !important + font-weight: bold !important + +.button + float: left + margin-right: 5px + +#contents + th + width: 50% + td + padding-left: 10px + a + font-weight: bold + +#quickpost + th + width: 20% + vertical-align: middle + td + width: 100% + +#comments + th + width: 10% + td + width: 100% + white-space: normal + a + display: inline + +#drafts, #linkbacks, #comments + th + font-weight: normal + a + font-weight: bold + abbr + color: #666666 diff --git a/gstudio/static/gstudio/css/src/ie.sass b/gstudio/static/gstudio/css/src/ie.sass new file mode 100644 index 0000000..5bad66b --- /dev/null +++ b/gstudio/static/gstudio/css/src/ie.sass @@ -0,0 +1,3 @@ +@import blueprint + ++blueprint-ie diff --git a/gstudio/static/gstudio/css/src/print.sass b/gstudio/static/gstudio/css/src/print.sass new file mode 100644 index 0000000..6453761 --- /dev/null +++ b/gstudio/static/gstudio/css/src/print.sass @@ -0,0 +1,22 @@ +@import blueprint +@import compass/utilities/links/link-colors + +$link_color: #006699 + ++blueprint-print + +body + font-size: 2em + a, a:link, a:visited, a:focus, a:active, a:hover + text-decoration: none + color: $link_color + +#sidebar, .top-navigation, .commentForm + display: none + +#header + h1 + margin-bottom: 0 + a + font-size: 2em + font-weight: bold
\ No newline at end of file diff --git a/gstudio/static/gstudio/css/src/screen.sass b/gstudio/static/gstudio/css/src/screen.sass new file mode 100644 index 0000000..9feb174 --- /dev/null +++ b/gstudio/static/gstudio/css/src/screen.sass @@ -0,0 +1,198 @@ +@import base +@import blueprint +@import compass/utilities/lists/bullets +@import compass/utilities/lists/inline-list +@import compass/utilities/links/hover-link + ++blueprint + +// Global +body + background: transparent url(../img/background.gif) repeat-x scroll left top + +ul, ol + margin: 0 1.5em 1.5em 0 + padding-left: 3.333em +a + +hover-link + +// Header +#header + margin-bottom: 1em + border-bottom: 1px solid $box_color + h1 + font-size: 4em + font-weight: bold + margin-bottom: 0 + .top-navigation + float: right + img + border: 0 + .link + padding-left: 1.5em + .sitemap + background: transparent url(../img/sitemap.png) no-repeat scroll left center + .feeds + background: transparent url(../img/rss.png) no-repeat scroll left center + +// Breadcrumbs +#breadcrumbs + font-size: 1.2em + +// Body +#body + margin-bottom: 1em + border-bottom: 1px solid $box_color + +// Content +#content + h1, h2, h3 + margin-top: 0 + +// Sidebar +#sidebar + div:first-child + h3 + margin-top: 0 + h3 + background-color: $box_color + padding: 0.5em + p + padding-left: 1em + ul, ol + padding-left: 2.5em + list-style-image: url(../img/bullet.png) + li ul, li ol + margin: 0 1.5em 0 0 + input + width: auto + .calendar + h3 + margin-bottom: 0 + .month-navigation + padding-bottom: 1.5em + .month-previous + float: left + .month-next + float: right + .tags + div + padding: 0 5px 0 18px + ul + +inline-list + +no-bullets + +tag-cloud($link_color, 1.5em) + +// Calendar +table.month + +calendar($link_color, $box_color, $box_font_color) + +// Pagination +div.paginator + +paginator($link_color, $box_color) + +// Gbobject +// .hgbobject +// +gbobject +// .gbobject-header +// background-color: $box_color +// .gbobject-content +// p +// font-size: 1.2em + // pre, blockquote + // overflow: auto + // padding: 1em + // clear: none + // float: none + // margin: 0 0 1.5em 0 + // width: auto + // blockquote + // margin: 0 2em 1.5em 2em + // border: 1px dashed $box_font_color + // background-color: $box_color + #111 + // p + // font-size: 1.5em + // margin: 0 + // pre + // line-height: 110% + // background-color: $box_color + #002 + // border-top: 1px solid $box_font_color + // border-bottom: 1px solid $box_font_color + + // .gbobject-footer + // p + // strong + // color: $box_font_color + + // .gbobject-widgets + // ul, ol + // padding-left: 2.5em + // list-style-image: url(../img/bullet.png) + + // .featured + // .gbobject-header + // background-color: #C4D9C4 + +//Nodetype +.hnodetype + +ndoetype + .nodetype-header + background-color: $box_color + .nodetype-content + p + font-size: 1.2em + pre, blockquote + overflow: auto + padding: 1em + clear: none + float: none + margin: 0 0 1.5em 0 + width: auto + blockquote + margin: 0 2em 1.5em 2em + border: 1px dashed $box_font_color + background-color: $box_color + #111 + p + font-size: 1.5em + margin: 0 + pre + line-height: 110% + background-color: $box_color + #002 + border-top: 1px solid $box_font_color + border-bottom: 1px solid $box_font_color + .gbobject-footer + p + strong + color: $box_font_color +.gbobject-widgets + ul, ol + padding-left: 2.5em + list-style-image: url(../img/bullet.png) +.featured + .gbobject-header + background-color: #C4D9C4 + +// Discussions +ol#comment-list, ol#pingback-list, ol#trackback-list + width: 100% + margin-bottom: 0 + padding-left: 1em + li + margin-bottom: 1em + border: 1px solid $box_color + &.box2 + border-color: $box_font_color + background-color: $box_color + &.post-author + color: $box_font_color + p + margin-bottom: 0.5em + img + padding: 5px + .pingback-body, .trackback-body + padding: 5px + .comment-author, .pingback-author, .trackback-author, + font-size: 1.2em + font-weight: bold + color: #666 + diff --git a/gstudio/static/gstudio/css/src/slider.sass b/gstudio/static/gstudio/css/src/slider.sass new file mode 100644 index 0000000..7172745 --- /dev/null +++ b/gstudio/static/gstudio/css/src/slider.sass @@ -0,0 +1,74 @@ +@import base + +$max_width: 630px +$number_of_items: 5 + +$slider_width: 400px +$slider_height: 250px +$slider_color: $link_color + #444444 + +$nav_padding: 3px +$info_padding: 5px + +$tab_nav_width: $max_width - $slider_width +$tab_nav_height: $slider_height / $number_of_items - 1 +$tab_nav_img_height: $tab_nav_height - $nav_padding * 2 +$tab_nav_img_width: $tab_nav_height * $slider_width / $slider_height + +#slider + width: $slider_width + padding-right: $tab_nav_width + position: relative + height: $slider_height + overflow: hidden + margin-bottom: 5px + ul.ui-tabs-nav + list-style: none + padding: 0 + margin: 0 + top: 0 + left: $slider_width + width: $tab_nav_width + position: absolute + overflow: hidden + li + a + display: block + height: $tab_nav_height + border-bottom: 1px solid $box_color + img + float: left + border: 0 + padding: $nav_padding + width: $tab_nav_img_width + height: $tab_nav_img_height + a:hover + text-decoration: none + background: $box_color + &.ui-tabs-selected + a + background: $slider_color + color: white + div.ui-tabs-panel + position: relative + width: $slider_width + height: $slider_height + .panel_info + left: 0 + bottom: 0 + position: absolute + height: 70px + padding: $info_padding + color: white + background: url(../img/trans.png) + width: $slider_width - $info_padding * 2 + a + color: $slider_color + h2 + margin: 0 + overflow: hidden + img + width: $slider_width + height: $slider_height + .ui-tabs-hide + display: none diff --git a/gstudio/static/gstudio/css/structures.css b/gstudio/static/gstudio/css/structures.css new file mode 100644 index 0000000..fd44c5a --- /dev/null +++ b/gstudio/static/gstudio/css/structures.css @@ -0,0 +1,662 @@ + + + +/* Body +------------------------------------------------------------------------------------------------------ */ + +body { + padding: 58px 20px 0; + font-family: Arial, sans-serif; + font-size: 12px; + line-height: 16px; +} +body.popup { + padding-top: 0; +} + + + +/* Container +------------------------------------------------------------------------------------------------------ */ + +#container { + z-index: 0; + position: relative; + float: left; + clear: both; + margin: 0; + padding: 0; + width: 100%; +} + + + +/* Header +------------------------------------------------------------------------------------------------------ */ + +#header { + position: fixed; + top: 0; + left: 0; + z-index: 1100; + padding: 0 20px; + width: 100%; + height: 30px; + font-size: 11px; + line-height: 14px; + font-weight: bold; +} +body.filebrowser.popup #header { + display: none; +} + + + +/* Branding, Bookmarks & User-Tools +------------------------------------------------------------------------------------------------------ */ + +.branding, .admin-title, +#bookmarks li, #user-tools li { + margin: 0; + padding: 8px 10px; +} +.branding { + display: none; + position: relative; + float: right; + width: 10px; + background: url('../img/grappelli-icon.png') 50% 50% no-repeat; +} +.admin-title { + position: relative; + float: left; + margin: 0 0 0 -20px; + padding-left: 20px; + padding-right: 20px; +} +#header ul li { + position: relative; + float: left; +} + + +/* Navigation Menu (UL Navigation-Menu of Admin-Tools) ................................................... */ + +ul.navigation-menu { + position: relative; + float: left; +} +ul.navigation-menu li { + float: none !important; +} +ul.navigation-menu>li { + position: relative; + float: none !important; + display: block; + margin: 0; +} +ul.navigation-menu>li>a { + display: block; + padding: 8px 10px; + font-size: 11px !important; +} +ul.navigation-menu li.bookmark, +ul.navigation-menu li.actions { + float: left !important; +} +ul.navigation-menu li ul { + position: absolute; + z-index: 1 !important; + float: none !important; + margin-top: -1px; + padding: 0; + min-width: 220px; + white-space: nowrap; + +/* box-sizing: border-box; -moz-box-sizing: border-box; -webkit-box-sizing: border-box;*/ +} +ul.navigation-menu>li>a+ul { + overflow-x: hidden !important; +/* padding-right: 20px;*/ +/* width: 500px;*/ + box-sizing: border-box; -moz-box-sizing: border-box; -webkit-box-sizing: border-box; + box-shadow: 0 0 20px #333; -moz-box-shadow: 0 0 20px #333; -webkit-box-shadow: 0 0 20px #333; +} +ul.navigation-menu>li>ul>li.parent { + overflow-x: hidden !important; +} + +ul.navigation-menu li ul ul { + position: relative; + float: none; + margin-top: 0; + margin: 0; + padding: 0; + width: 100%; + overflow: inherit; +} + +ul.navigation-menu li li.item-collapse.item-open { + background: #3a3a3a; +} +ul.navigation-menu li li li.item-collapse.item-open { +/* border: 1px solid #383838;*/ + -moz-border-radius: 4px; + background: #424242; +} +ul.navigation-menu li li li.item-collapse.item-open + li { +/* border: 0 !important;*/ +} +ul.navigation-menu li li li li.item-collapse.item-open { +/* border: 1px solid #404040;*/ + background: #4a4a4a; +} +ul.navigation-menu li li li li.item-collapse.oitem-pen + li { +/* border: 0 !important;*/ +} +ul.navigation-menu li li li li li.item-collapse.item-open { +/* border: 1px solid #484848;*/ + background: #525252; +} + + +ul.navigation-menu li li { +/* padding: 0 10px;*/ +} +ul.navigation-menu li li li { +/* margin: 0 -20px 0 -10px;*/ +/* padding: 0 10px 0 20px;*/ + box-sizing: border-box; -moz-box-sizing: border-box; -webkit-box-sizing: border-box; +} +ul.navigation-menu li li li li { +/* margin: 0 -10px 0 -20px;*/ +/* padding: 0 10px 0 30px;*/ +/* box-sizing: border-box; -moz-box-sizing: border-box; -webkit-box-sizing: border-box;*/ +} +ul.navigation-menu li li li li li { +/* margin: 0 -10px 0 -30px;*/ +/* padding: 0 10px 0 40px;*/ + overflow: hidden; +/* box-sizing: border-box; -moz-box-sizing: border-box; -webkit-box-sizing: border-box;*/ +} +ul.navigation-menu li li li li li li { +/* margin: 0 0 0 -40px;*/ +/* padding: 0 10px 0 50px;*/ + overflow: hidden; +/* box-sizing: border-box; -moz-box-sizing: border-box; -webkit-box-sizing: border-box;*/ +} + + +ul.navigation-menu li li.last { + border-bottom: 0 !important; +} + +ul.navigation-menu li ul ul>li:first-child a { +/* margin-left: -10px;*/ +/* padding-left: 10px;*/ +} +ul.navigation-menu li li a { + display: block; + padding: 8px 10px; + font-size: 11px; +} +ul.navigation-menu li li li a { + padding: 4px 10px 4px 20px; + font-size: 11px; + white-space: normal; +} +ul.navigation-menu li li li li a { + padding-left: 30px; +} +ul.navigation-menu li li li li li a { + padding-left: 40px; +} +ul.navigation-menu li li li li li li a { + padding-left: 50px; +} +ul.navigation-menu li.parent>a { + font-size: 11px; +} +ul.navigation-menu li li.parent>a { + font-size: 11px; +} + +ul.navigation-menu li.item-collapse.item-closed>* { + display: none !important; +} +ul.navigation-menu li.item-collapse.item-open>* { + display: block !important; +} + +ul.navigation-menu li.item-collapse a.item-collapse-handler-container { + display: block !important; +/* padding: 10px 0 !important;*/ +} + +form#bookmark-form { + position: relative; + float: left; + padding: 3px 10px 1px 0; + height: 26px; +} +form#bookmark-form button { + position: relative; display: block; + margin: 3px 0 0; + width: 20px; + height: 20px; +} + +ul.navigation-menu li.item-collapse a.item-collapse-handler { + position: relative; + float: right; + display: inline-block !important; + right: 0; + margin: -30px 0 -30px 0; + padding: 0; + width: 28px; + height: 30px; + cursor: pointer; +} +ul.navigation-menu li li li.item-collapse a.item-collapse-handler { + margin: -22px 0; + width: 28px; + height: 22px; +} +a.item-collapse-handler-container { + padding-right: 38px !important; +} +ul.navigation-menu li li.item-collapse.item-closed>a+a.item-collapse-handler:link, +ul.navigation-menu li li.item-collapse.item-closed>a+a.item-collapse-handler:visited { + background: transparent url("../img/icons/icon-admin_tools-dropdown.png") no-repeat scroll 50% 50%; +} +ul.navigation-menu li li.item-collapse.item-closed>a+a.item-collapse-handler:hover, +ul.navigation-menu li li.item-collapse.item-closed>a+a.item-collapse-handler:active { + background: transparent url("../img/icons/icon-admin_tools-dropdown-hover.png") no-repeat scroll 50% 50%; +} +ul.navigation-menu li li.item-collapse.item-open>a+a.item-collapse-handler:link, +ul.navigation-menu li li.item-collapse.item-open>a+a.item-collapse-handler:visited { + background: transparent url("../img/icons/icon-admin_tools-dropdown-active.png") no-repeat scroll 50% 50%; +} +ul.navigation-menu li li.item-collapse.item-open>a+a.item-collapse-handler:hover, +ul.navigation-menu li li.item-collapse.item-open>a+a.item-collapse-handler:active { + background: transparent url("../img/icons/icon-admin_tools-dropdown-active-hover.png") no-repeat scroll 50% 50%; +} + + +/* User Tools ................................................... */ + +#user-tools { + position: absolute; + right: 40px; +} +#user-tools>li:last-child { + padding-right: 20px; +} + +#user-tools li.user-options-container { + position: relative; + width: 200px; +} + +li.user-options-container.open a.user-options-handler { + display: block; +} +ul.user-options { + display: none; +} +li.user-options-container.open ul.user-options { + display: block; + position: absolute; + float: none; + clear: both; + z-index: 1000; + margin: 7px -10px 0; + width: 221px; +} +ul.user-options li { + float: none !important; + clear: both; +} +ul.user-options li a { + display: block; +} + + + +/* Breadcrumbs +------------------------------------------------------------------------------------------------------ */ + +div#breadcrumbs { + position: fixed; + top: 30px; + left: 0; + z-index: 1000; + padding: 5px 10px 5px 20px; + width: 100%; + font-size: 11px; +/* font-weight: bold;*/ + text-align: left; +} +div#breadcrumbs > a { + padding: 10px 2px; +} +body.popup div#breadcrumbs { + top: 0; +} + + + +/* Messages +------------------------------------------------------------------------------------------------------ */ + +ul.messagelist { + position: relative; + top: 0; + z-index: 990; + margin: 0 -20px; +} +ul.messagelist li { + display: block; + padding: 5px 10px 5px 20px; + font-size: 11px; + font-weight: bold; +} +body.popup .breadcrumbs + ul.messagelist { + top: 24px; +} +body.filebrowser.popup ul.messagelist { + top: 28px; +} +body.login ul.messagelist { + top: -28px; +} + + +/* Masthead +------------------------------------------------------------------------------------------------------ */ + +#masthead { + position: relative; + float: left; + clear: both; + z-index: 900; + padding: 60px 0 10px; + width: 100%; +} + + + +/* Login Form +------------------------------------------------------------------------------------------------------ */ + +div.login { + top: -30px; +} +#login-form { + margin: 0 auto; +} + + + +/* Content +------------------------------------------------------------------------------------------------------ */ + +#content { + position: relative; + float: left; + clear: both; + margin:0 0 80px; + + padding-right: 10px; + width: 50%; +} +#content.content-flexible { + width: 100%; +} +body.filebrowser.popup #content { + top: 28px; +} + + + +/* Container +------------------------------------------------------------------------------------------------------ */ + +.container, +.container-grid { + position: relative; + float: left; + clear: both; + width: 940px; +} +.container-flexible { + position: relative; + float: none; + clear: both; + width: auto; + height: 100%; +} + + + +/* Blueprint Grid Columns & Spans +------------------------------------------------------------------------------------------------------ */ + +.column { + position: relative; + float: left; +} +.column.centered { + position: relative; + float: none !important; + margin: 0 auto !important; +} +.span-flexible { + position: relative; + width: 100%; +} +.container-flexible.layout-flexible-grid .span-flexible { + float: left; + margin-right: 20px; + width: 100%; +} +.container-flexible.layout-flexible-grid .span-flexible + .column { + float: left !important; +} +.container-flexible.layout-grid-flexible .column { + float: left; +} +.container-flexible.layout-grid-flexible .span-flexible { + float: left; + width: 100%; +} +fieldset.module .row .column:first-child { + margin-left: 0 !important; +} +fieldset.module .row .column:last-child { + margin-right: -20px !important; +} +fieldset.module .row .column.span-flexible:last-child { + margin-right: 0 !important; +} +.row .span-flexible, +.row .span-flexible:last-child { + float: none; + width: auto; + margin-right: 0 !important; +} + + +/* Basic Float & Margin ......................................... */ + +.span-1, .span-2, .span-3, .span-4, .span-5, .span-6, +.span-7, .span-8, .span-9, .span-10, .span-11, .span-12, +.span-13, .span-14, .span-15, .span-16, .span-17, .span-18, +.span-19, .span-20, .span-21, .span-22, .span-23, .span-24 { +/* float: left;*/ + margin-right: 20px; +} +.column.last { margin-right: 0; } + + +/* Column Widths ......................................... */ + +.span-1 { width: 20px; } +.span-2 { width: 60px; } +.span-3 { width: 100px; } +.span-4 { width: 140px; } +.span-5 { width: 180px; } +.span-6 { width: 220px; } +.span-7 { width: 260px; } +.span-8 { width: 300px; } +.span-9 { width: 340px; } +.span-10 { width: 380px; } +.span-11 { width: 420px; } +.span-12 { width: 460px; } +.span-13 { width: 500px; } +.span-14 { width: 540px; } +.span-15 { width: 580px; } +.span-16 { width: 620px; } +.span-17 { width: 660px; } +.span-18 { width: 700px; } +.span-19 { width: 740px; } +.span-20 { width: 780px; } +.span-21 { width: 820px; } +.span-22 { width: 860px; } +.span-23 { width: 900px; } +.span-24 { width: 940px; margin: 0; } + + +/* Append empty columns ......................................... */ + +.append-1 { padding-right: 40px; } +.append-2 { padding-right: 80px; } +.append-3 { padding-right: 120px; } +.append-4 { padding-right: 160px; } +.append-5 { padding-right: 200px; } +.append-6 { padding-right: 240px; } +.append-7 { padding-right: 280px; } +.append-8 { padding-right: 320px; } +.append-9 { padding-right: 360px; } +.append-10 { padding-right: 400px; } +.append-11 { padding-right: 440px; } +.append-12 { padding-right: 480px; } +.append-13 { padding-right: 520px; } +.append-14 { padding-right: 560px; } +.append-15 { padding-right: 600px; } +.append-16 { padding-right: 640px; } +.append-17 { padding-right: 680px; } +.append-18 { padding-right: 720px; } +.append-19 { padding-right: 760px; } +.append-20 { padding-right: 800px; } +.append-21 { padding-right: 840px; } +.append-22 { padding-right: 880px; } +.append-23 { padding-right: 920px; } + + +/* Prepend empty columns ......................................... */ + +.prepend-1 { padding-left: 40px; } +.prepend-2 { padding-left: 80px; } +.prepend-3 { padding-left: 120px; } +.prepend-4 { padding-left: 160px; } +.prepend-5 { padding-left: 200px; } +.prepend-6 { padding-left: 240px; } +.prepend-7 { padding-left: 280px; } +.prepend-8 { padding-left: 320px; } +.prepend-9 { padding-left: 360px; } +.prepend-10 { padding-left: 400px; } +.prepend-11 { padding-left: 440px; } +.prepend-12 { padding-left: 480px; } +.prepend-13 { padding-left: 520px; } +.prepend-14 { padding-left: 560px; } +.prepend-15 { padding-left: 600px; } +.prepend-16 { padding-left: 640px; } +.prepend-17 { padding-left: 680px; } +.prepend-18 { padding-left: 720px; } +.prepend-19 { padding-left: 760px; } +.prepend-20 { padding-left: 800px; } +.prepend-21 { padding-left: 840px; } +.prepend-22 { padding-left: 880px; } +.prepend-23 { padding-left: 920px; } + + +/* Span-X + Span-Flexible ......................................... */ + +.span-1 + .span-flexible { margin-left: 40px; } +.span-2 + .span-flexible { margin-left: 80px; } +.span-3 + .span-flexible { margin-left: 120px; } +.span-4 + .span-flexible { margin-left: 160px; Xmin-width: 758px; } +.span-5 + .span-flexible { margin-left: 200px; } +.span-6 + .span-flexible { margin-left: 240px; } +.span-7 + .span-flexible { margin-left: 280px; } +.span-8 + .span-flexible { margin-left: 320px; } +.span-9 + .span-flexible { margin-left: 360px; } +.span-10 + .span-flexible { margin-left: 400px; } +.span-11 + .span-flexible { margin-left: 440px; } +.span-12 + .span-flexible { margin-left: 480px; } +.span-13 + .span-flexible { margin-left: 520px; } +.span-14 + .span-flexible { margin-left: 560px; } +.span-15 + .span-flexible { margin-left: 600px; } +.span-16 + .span-flexible { margin-left: 640px; } +.span-17 + .span-flexible { margin-left: 680px; } +.span-18 + .span-flexible { margin-left: 720px; } +.span-19 + .span-flexible { margin-left: 760px; } +.span-20 + .span-flexible { margin-left: 800px; } +.span-21 + .span-flexible { margin-left: 840px; } +.span-22 + .span-flexible { margin-left: 880px; } +.span-23 + .span-flexible { margin-left: 920px; } +.span-24 + .span-flexible { margin-left: 960px; } + + +/* Columns in Cells ......................................... */ + +.cell.span-1 { width: 0px; } +.cell.span-2 { width: 40px; } +.cell.span-3 { width: 80px; } +.cell.span-4 { width: 120px; } +.cell.span-5 { width: 160px; } +.cell.span-6 { width: 200px; } +.cell.span-7 { width: 240px; } +.cell.span-8 { width: 280px; } +.cell.span-9 { width: 330px; } +.cell.span-10 { width: 360px; } +.cell.span-11 { width: 400px; } +.cell.span-12 { width: 440px; } +.cell.span-13 { width: 480px; } +.cell.span-14 { width: 520px; } +.cell.span-15 { width: 560px; } +.cell.span-16 { width: 600px; } +.cell.span-17 { width: 640px; } +.cell.span-18 { width: 680px; } +.cell.span-19 { width: 720px; } +.cell.span-20 { width: 760px; } +.cell.span-21 { width: 800px; } +.cell.span-22 { width: 840px; } +.cell.span-23 { width: 880px; } +.cell.span-24 { width: 920px; margin: 0; } + + +/* Clearing floats without extra markup + Based on How To Clear Floats Without Structural Markup by PiE + [http://www.positioniseverything.net/easyclearing.html] */ + +.clearfix:after, .container:after { + content: "."; + display: block; + height: 0; + clear: both; + visibility: hidden; +} +.clearfix, .container { display: inline-block; } +* html .clearfix, +* html .container { height: 1%; } +.clearfix, .container { display: block; } + +/* Regular clearing + apply to column that should drop below previous ones. */ + +.clear { clear: both; } + + + diff --git a/gstudio/static/gstudio/css/wymeditor_styles.css b/gstudio/static/gstudio/css/wymeditor_styles.css new file mode 100644 index 0000000..fb2f569 --- /dev/null +++ b/gstudio/static/gstudio/css/wymeditor_styles.css @@ -0,0 +1,45 @@ +/* EDITOR RELATED STYLES - CUSTOMIZE FOR YOUR NEEDS */ +/* + The classes panel, the visual feedback and the preview + will be affected by these values. + + - Commented styles inside style definitions are used for visual + feedback when using the editor. + - Comments before opening the style are used as caption. + - Comments after the class name and before the style declaration ({) + define the jQuery expression that decides whether this + style should be applied or not. + + Note: the WYMeditor and /WYMeditor comments below are required + for the CSS parser to work properly. +*/ + +/* WYMeditor */ + +/* PARA: Highlight */ +p.highlight { + background: yellow; + /* background: yellow; border: 2px solid orange; */ +} + +/* PARA: Hidden note */ +p.hide { + display: none; + /* color: #999; border: 2px solid #ccc; */ +} + +/* IMG: floating left */ +img.left /* img[@class!="right"] */ { + display: inline; + float: left; + /* float: left; */ +} + +/* IMG: floating right */ +img.right /* img[@class!="left"] */ { + display: inline; + float: right; + /* float: right; */ +} + +/* /WYMeditor */ diff --git a/gstudio/static/gstudio/img/background.gif b/gstudio/static/gstudio/img/background.gif Binary files differnew file mode 100644 index 0000000..0f892b1 --- /dev/null +++ b/gstudio/static/gstudio/img/background.gif diff --git a/gstudio/static/gstudio/img/bullet.png b/gstudio/static/gstudio/img/bullet.png Binary files differnew file mode 100644 index 0000000..3e9c121 --- /dev/null +++ b/gstudio/static/gstudio/img/bullet.png diff --git a/gstudio/static/gstudio/img/comments.png b/gstudio/static/gstudio/img/comments.png Binary files differnew file mode 100644 index 0000000..64d81a5 --- /dev/null +++ b/gstudio/static/gstudio/img/comments.png diff --git a/gstudio/static/gstudio/img/community.png b/gstudio/static/gstudio/img/community.png Binary files differnew file mode 100644 index 0000000..bb8ca4a --- /dev/null +++ b/gstudio/static/gstudio/img/community.png diff --git a/gstudio/static/gstudio/img/favicon.ico b/gstudio/static/gstudio/img/favicon.ico Binary files differnew file mode 100644 index 0000000..6baafb3 --- /dev/null +++ b/gstudio/static/gstudio/img/favicon.ico diff --git a/gstudio/static/gstudio/img/favicon.png b/gstudio/static/gstudio/img/favicon.png Binary files differnew file mode 100644 index 0000000..d3269bf --- /dev/null +++ b/gstudio/static/gstudio/img/favicon.png diff --git a/gstudio/static/gstudio/img/grid.png b/gstudio/static/gstudio/img/grid.png Binary files differnew file mode 100644 index 0000000..129d4a2 --- /dev/null +++ b/gstudio/static/gstudio/img/grid.png diff --git a/gstudio/static/gstudio/img/help.png b/gstudio/static/gstudio/img/help.png Binary files differnew file mode 100644 index 0000000..8e49281 --- /dev/null +++ b/gstudio/static/gstudio/img/help.png diff --git a/gstudio/static/gstudio/img/logo.png b/gstudio/static/gstudio/img/logo.png Binary files differnew file mode 100644 index 0000000..668cbfd --- /dev/null +++ b/gstudio/static/gstudio/img/logo.png diff --git a/gstudio/static/gstudio/img/manage.png b/gstudio/static/gstudio/img/manage.png Binary files differnew file mode 100644 index 0000000..807b82d --- /dev/null +++ b/gstudio/static/gstudio/img/manage.png diff --git a/gstudio/static/gstudio/img/objecttype.png b/gstudio/static/gstudio/img/objecttype.png Binary files differnew file mode 100644 index 0000000..6647a4b --- /dev/null +++ b/gstudio/static/gstudio/img/objecttype.png diff --git a/gstudio/static/gstudio/img/plugin.png b/gstudio/static/gstudio/img/plugin.png Binary files differnew file mode 100644 index 0000000..0b26234 --- /dev/null +++ b/gstudio/static/gstudio/img/plugin.png diff --git a/gstudio/static/gstudio/img/preview.png b/gstudio/static/gstudio/img/preview.png Binary files differnew file mode 100644 index 0000000..292c578 --- /dev/null +++ b/gstudio/static/gstudio/img/preview.png diff --git a/gstudio/static/gstudio/img/rss.png b/gstudio/static/gstudio/img/rss.png Binary files differnew file mode 100644 index 0000000..9006ffe --- /dev/null +++ b/gstudio/static/gstudio/img/rss.png diff --git a/gstudio/static/gstudio/img/shorturl.png b/gstudio/static/gstudio/img/shorturl.png Binary files differnew file mode 100644 index 0000000..25eacb7 --- /dev/null +++ b/gstudio/static/gstudio/img/shorturl.png diff --git a/gstudio/static/gstudio/img/sitemap.png b/gstudio/static/gstudio/img/sitemap.png Binary files differnew file mode 100644 index 0000000..092c959 --- /dev/null +++ b/gstudio/static/gstudio/img/sitemap.png diff --git a/gstudio/static/gstudio/img/tags.png b/gstudio/static/gstudio/img/tags.png Binary files differnew file mode 100644 index 0000000..1478033 --- /dev/null +++ b/gstudio/static/gstudio/img/tags.png diff --git a/gstudio/static/gstudio/img/trans.png b/gstudio/static/gstudio/img/trans.png Binary files differnew file mode 100644 index 0000000..cd1db6c --- /dev/null +++ b/gstudio/static/gstudio/img/trans.png diff --git a/gstudio/static/gstudio/img/wlw/comments.png b/gstudio/static/gstudio/img/wlw/comments.png Binary files differnew file mode 100644 index 0000000..981b1af --- /dev/null +++ b/gstudio/static/gstudio/img/wlw/comments.png diff --git a/gstudio/static/gstudio/img/wlw/gstudio.png b/gstudio/static/gstudio/img/wlw/gstudio.png Binary files differnew file mode 100644 index 0000000..d3269bf --- /dev/null +++ b/gstudio/static/gstudio/img/wlw/gstudio.png diff --git a/gstudio/static/gstudio/img/wlw/watermark.png b/gstudio/static/gstudio/img/wlw/watermark.png Binary files differnew file mode 100644 index 0000000..09223aa --- /dev/null +++ b/gstudio/static/gstudio/img/wlw/watermark.png diff --git a/gstudio/static/gstudio/js/d3.chart.js b/gstudio/static/gstudio/js/d3.chart.js new file mode 100644 index 0000000..281d007 --- /dev/null +++ b/gstudio/static/gstudio/js/d3.chart.js @@ -0,0 +1,984 @@ +(function(){d3.chart = {}; +// Inspired by http://informationandvisualization.de/blog/box-plot +d3.chart.box = function() { + var width = 1, + height = 1, + duration = 0, + domain = null, + value = Number, + whiskers = d3_chart_boxWhiskers, + quartiles = d3_chart_boxQuartiles, + tickFormat = null; + + // For each small multiple… + function box(g) { + g.each(function(d, i) { + d = d.map(value).sort(d3.ascending); + var g = d3.select(this), + n = d.length, + min = d[0], + max = d[n - 1]; + + // Compute quartiles. Must return exactly 3 elements. + var quartileData = d.quartiles = quartiles(d); + + // Compute whiskers. Must return exactly 2 elements, or null. + var whiskerIndices = whiskers && whiskers.call(this, d, i), + whiskerData = whiskerIndices && whiskerIndices.map(function(i) { return d[i]; }); + + // Compute outliers. If no whiskers are specified, all data are "outliers". + // We compute the outliers as indices, so that we can join across transitions! + var outlierIndices = whiskerIndices + ? d3.range(0, whiskerIndices[0]).concat(d3.range(whiskerIndices[1] + 1, n)) + : d3.range(n); + + // Compute the new x-scale. + var x1 = d3.scale.linear() + .domain(domain && domain.call(this, d, i) || [min, max]) + .range([height, 0]); + + // Retrieve the old x-scale, if this is an update. + var x0 = this.__chart__ || d3.scale.linear() + .domain([0, Infinity]) + .range(x1.range()); + + // Stash the new scale. + this.__chart__ = x1; + + // Note: the box, median, and box tick elements are fixed in number, + // so we only have to handle enter and update. In contrast, the outliers + // and other elements are variable, so we need to exit them! Variable + // elements also fade in and out. + + // Update center line: the vertical line spanning the whiskers. + var center = g.selectAll("line.center") + .data(whiskerData ? [whiskerData] : []); + + center.enter().insert("svg:line", "rect") + .attr("class", "center") + .attr("x1", width / 2) + .attr("y1", function(d) { return x0(d[0]); }) + .attr("x2", width / 2) + .attr("y2", function(d) { return x0(d[1]); }) + .style("opacity", 1e-6) + .transition() + .duration(duration) + .style("opacity", 1) + .attr("y1", function(d) { return x1(d[0]); }) + .attr("y2", function(d) { return x1(d[1]); }); + + center.transition() + .duration(duration) + .style("opacity", 1) + .attr("y1", function(d) { return x1(d[0]); }) + .attr("y2", function(d) { return x1(d[1]); }); + + center.exit().transition() + .duration(duration) + .style("opacity", 1e-6) + .attr("y1", function(d) { return x1(d[0]); }) + .attr("y2", function(d) { return x1(d[1]); }) + .remove(); + + // Update innerquartile box. + var box = g.selectAll("rect.box") + .data([quartileData]); + + box.enter().append("svg:rect") + .attr("class", "box") + .attr("x", 0) + .attr("y", function(d) { return x0(d[2]); }) + .attr("width", width) + .attr("height", function(d) { return x0(d[0]) - x0(d[2]); }) + .transition() + .duration(duration) + .attr("y", function(d) { return x1(d[2]); }) + .attr("height", function(d) { return x1(d[0]) - x1(d[2]); }); + + box.transition() + .duration(duration) + .attr("y", function(d) { return x1(d[2]); }) + .attr("height", function(d) { return x1(d[0]) - x1(d[2]); }); + + // Update median line. + var medianLine = g.selectAll("line.median") + .data([quartileData[1]]); + + medianLine.enter().append("svg:line") + .attr("class", "median") + .attr("x1", 0) + .attr("y1", x0) + .attr("x2", width) + .attr("y2", x0) + .transition() + .duration(duration) + .attr("y1", x1) + .attr("y2", x1); + + medianLine.transition() + .duration(duration) + .attr("y1", x1) + .attr("y2", x1); + + // Update whiskers. + var whisker = g.selectAll("line.whisker") + .data(whiskerData || []); + + whisker.enter().insert("svg:line", "circle, text") + .attr("class", "whisker") + .attr("x1", 0) + .attr("y1", x0) + .attr("x2", width) + .attr("y2", x0) + .style("opacity", 1e-6) + .transition() + .duration(duration) + .attr("y1", x1) + .attr("y2", x1) + .style("opacity", 1); + + whisker.transition() + .duration(duration) + .attr("y1", x1) + .attr("y2", x1) + .style("opacity", 1); + + whisker.exit().transition() + .duration(duration) + .attr("y1", x1) + .attr("y2", x1) + .style("opacity", 1e-6) + .remove(); + + // Update outliers. + var outlier = g.selectAll("circle.outlier") + .data(outlierIndices, Number); + + outlier.enter().insert("svg:circle", "text") + .attr("class", "outlier") + .attr("r", 5) + .attr("cx", width / 2) + .attr("cy", function(i) { return x0(d[i]); }) + .style("opacity", 1e-6) + .transition() + .duration(duration) + .attr("cy", function(i) { return x1(d[i]); }) + .style("opacity", 1); + + outlier.transition() + .duration(duration) + .attr("cy", function(i) { return x1(d[i]); }) + .style("opacity", 1); + + outlier.exit().transition() + .duration(duration) + .attr("cy", function(i) { return x1(d[i]); }) + .style("opacity", 1e-6) + .remove(); + + // Compute the tick format. + var format = tickFormat || x1.tickFormat(8); + + // Update box ticks. + var boxTick = g.selectAll("text.box") + .data(quartileData); + + boxTick.enter().append("svg:text") + .attr("class", "box") + .attr("dy", ".3em") + .attr("dx", function(d, i) { return i & 1 ? 6 : -6 }) + .attr("x", function(d, i) { return i & 1 ? width : 0 }) + .attr("y", x0) + .attr("text-anchor", function(d, i) { return i & 1 ? "start" : "end"; }) + .text(format) + .transition() + .duration(duration) + .attr("y", x1); + + boxTick.transition() + .duration(duration) + .text(format) + .attr("y", x1); + + // Update whisker ticks. These are handled separately from the box + // ticks because they may or may not exist, and we want don't want + // to join box ticks pre-transition with whisker ticks post-. + var whiskerTick = g.selectAll("text.whisker") + .data(whiskerData || []); + + whiskerTick.enter().append("svg:text") + .attr("class", "whisker") + .attr("dy", ".3em") + .attr("dx", 6) + .attr("x", width) + .attr("y", x0) + .text(format) + .style("opacity", 1e-6) + .transition() + .duration(duration) + .attr("y", x1) + .style("opacity", 1); + + whiskerTick.transition() + .duration(duration) + .text(format) + .attr("y", x1) + .style("opacity", 1); + + whiskerTick.exit().transition() + .duration(duration) + .attr("y", x1) + .style("opacity", 1e-6) + .remove(); + }); + d3.timer.flush(); + } + + box.width = function(x) { + if (!arguments.length) return width; + width = x; + return box; + }; + + box.height = function(x) { + if (!arguments.length) return height; + height = x; + return box; + }; + + box.tickFormat = function(x) { + if (!arguments.length) return tickFormat; + tickFormat = x; + return box; + }; + + box.duration = function(x) { + if (!arguments.length) return duration; + duration = x; + return box; + }; + + box.domain = function(x) { + if (!arguments.length) return domain; + domain = x == null ? x : d3.functor(x); + return box; + }; + + box.value = function(x) { + if (!arguments.length) return value; + value = x; + return box; + }; + + box.whiskers = function(x) { + if (!arguments.length) return whiskers; + whiskers = x; + return box; + }; + + box.quartiles = function(x) { + if (!arguments.length) return quartiles; + quartiles = x; + return box; + }; + + return box; +}; + +function d3_chart_boxWhiskers(d) { + return [0, d.length - 1]; +} + +function d3_chart_boxQuartiles(d) { + return [ + d3.quantile(d, .25), + d3.quantile(d, .5), + d3.quantile(d, .75) + ]; +} +// Chart design based on the recommendations of Stephen Few. Implementation +// based on the work of Clint Ivy, Jamie Love, and Jason Davies. +// http://projects.instantcognition.com/protovis/bulletchart/ +d3.chart.bullet = function() { + var orient = "left", // TODO top & bottom + reverse = false, + duration = 0, + ranges = d3_chart_bulletRanges, + markers = d3_chart_bulletMarkers, + measures = d3_chart_bulletMeasures, + width = 380, + height = 30, + tickFormat = null; + + // For each small multiple… + function bullet(g) { + g.each(function(d, i) { + var rangez = ranges.call(this, d, i).slice().sort(d3.descending), + markerz = markers.call(this, d, i).slice().sort(d3.descending), + measurez = measures.call(this, d, i).slice().sort(d3.descending), + g = d3.select(this); + + // Compute the new x-scale. + var x1 = d3.scale.linear() + .domain([0, Math.max(rangez[0], markerz[0], measurez[0])]) + .range(reverse ? [width, 0] : [0, width]); + + // Retrieve the old x-scale, if this is an update. + var x0 = this.__chart__ || d3.scale.linear() + .domain([0, Infinity]) + .range(x1.range()); + + // Stash the new scale. + this.__chart__ = x1; + + // Derive width-scales from the x-scales. + var w0 = d3_chart_bulletWidth(x0), + w1 = d3_chart_bulletWidth(x1); + + // Update the range rects. + var range = g.selectAll("rect.range") + .data(rangez); + + range.enter().append("svg:rect") + .attr("class", function(d, i) { return "range s" + i; }) + .attr("width", w0) + .attr("height", height) + .attr("x", reverse ? x0 : 0) + .transition() + .duration(duration) + .attr("width", w1) + .attr("x", reverse ? x1 : 0); + + range.transition() + .duration(duration) + .attr("x", reverse ? x1 : 0) + .attr("width", w1) + .attr("height", height); + + // Update the measure rects. + var measure = g.selectAll("rect.measure") + .data(measurez); + + measure.enter().append("svg:rect") + .attr("class", function(d, i) { return "measure s" + i; }) + .attr("width", w0) + .attr("height", height / 3) + .attr("x", reverse ? x0 : 0) + .attr("y", height / 3) + .transition() + .duration(duration) + .attr("width", w1) + .attr("x", reverse ? x1 : 0); + + measure.transition() + .duration(duration) + .attr("width", w1) + .attr("height", height / 3) + .attr("x", reverse ? x1 : 0) + .attr("y", height / 3); + + // Update the marker lines. + var marker = g.selectAll("line.marker") + .data(markerz); + + marker.enter().append("svg:line") + .attr("class", "marker") + .attr("x1", x0) + .attr("x2", x0) + .attr("y1", height / 6) + .attr("y2", height * 5 / 6) + .transition() + .duration(duration) + .attr("x1", x1) + .attr("x2", x1); + + marker.transition() + .duration(duration) + .attr("x1", x1) + .attr("x2", x1) + .attr("y1", height / 6) + .attr("y2", height * 5 / 6); + + // Compute the tick format. + var format = tickFormat || x1.tickFormat(8); + + // Update the tick groups. + var tick = g.selectAll("g.tick") + .data(x1.ticks(8), function(d) { + return this.textContent || format(d); + }); + + // Initialize the ticks with the old scale, x0. + var tickEnter = tick.enter().append("svg:g") + .attr("class", "tick") + .attr("transform", d3_chart_bulletTranslate(x0)) + .style("opacity", 1e-6); + + tickEnter.append("svg:line") + .attr("y1", height) + .attr("y2", height * 7 / 6); + + tickEnter.append("svg:text") + .attr("text-anchor", "middle") + .attr("dy", "1em") + .attr("y", height * 7 / 6) + .text(format); + + // Transition the entering ticks to the new scale, x1. + tickEnter.transition() + .duration(duration) + .attr("transform", d3_chart_bulletTranslate(x1)) + .style("opacity", 1); + + // Transition the updating ticks to the new scale, x1. + var tickUpdate = tick.transition() + .duration(duration) + .attr("transform", d3_chart_bulletTranslate(x1)) + .style("opacity", 1); + + tickUpdate.select("line") + .attr("y1", height) + .attr("y2", height * 7 / 6); + + tickUpdate.select("text") + .attr("y", height * 7 / 6); + + // Transition the exiting ticks to the new scale, x1. + tick.exit().transition() + .duration(duration) + .attr("transform", d3_chart_bulletTranslate(x1)) + .style("opacity", 1e-6) + .remove(); + }); + d3.timer.flush(); + } + + // left, right, top, bottom + bullet.orient = function(x) { + if (!arguments.length) return orient; + orient = x; + reverse = orient == "right" || orient == "bottom"; + return bullet; + }; + + // ranges (bad, satisfactory, good) + bullet.ranges = function(x) { + if (!arguments.length) return ranges; + ranges = x; + return bullet; + }; + + // markers (previous, goal) + bullet.markers = function(x) { + if (!arguments.length) return markers; + markers = x; + return bullet; + }; + + // measures (actual, forecast) + bullet.measures = function(x) { + if (!arguments.length) return measures; + measures = x; + return bullet; + }; + + bullet.width = function(x) { + if (!arguments.length) return width; + width = x; + return bullet; + }; + + bullet.height = function(x) { + if (!arguments.length) return height; + height = x; + return bullet; + }; + + bullet.tickFormat = function(x) { + if (!arguments.length) return tickFormat; + tickFormat = x; + return bullet; + }; + + bullet.duration = function(x) { + if (!arguments.length) return duration; + duration = x; + return bullet; + }; + + return bullet; +}; + +function d3_chart_bulletRanges(d) { + return d.ranges; +} + +function d3_chart_bulletMarkers(d) { + return d.markers; +} + +function d3_chart_bulletMeasures(d) { + return d.measures; +} + +function d3_chart_bulletTranslate(x) { + return function(d) { + return "translate(" + x(d) + ",0)"; + }; +} + +function d3_chart_bulletWidth(x) { + var x0 = x(0); + return function(d) { + return Math.abs(x(d) - x0); + }; +} +// Implements a horizon layout, which is a variation of a single-series +// area chart where the area is folded into multiple bands. Color is used to +// encode band, allowing the size of the chart to be reduced significantly +// without impeding readability. This layout algorithm is based on the work of +// J. Heer, N. Kong and M. Agrawala in "Sizing the Horizon: The Effects of Chart +// Size and Layering on the Graphical Perception of Time Series Visualizations", +// CHI 2009. http://hci.stanford.edu/publications/2009/heer-horizon-chi09.pdf +d3.chart.horizon = function() { + var bands = 1, // between 1 and 5, typically + mode = "offset", // or mirror + interpolate = "linear", // or basis, monotone, step-before, etc. + x = d3_chart_horizonX, + y = d3_chart_horizonY, + w = 960, + h = 40, + duration = 0; + + var color = d3.scale.linear() + .domain([-1, 0, 1]) + .range(["#d62728", "#fff", "#1f77b4"]); + + // For each small multiple… + function horizon(g) { + g.each(function(d, i) { + var g = d3.select(this), + n = 2 * bands + 1, + xMin = Infinity, + xMax = -Infinity, + yMax = -Infinity, + x0, // old x-scale + y0, // old y-scale + id; // unique id for paths + + // Compute x- and y-values along with extents. + var data = d.map(function(d, i) { + var xv = x.call(this, d, i), + yv = y.call(this, d, i); + if (xv < xMin) xMin = xv; + if (xv > xMax) xMax = xv; + if (-yv > yMax) yMax = -yv; + if (yv > yMax) yMax = yv; + return [xv, yv]; + }); + + // Compute the new x- and y-scales. + var x1 = d3.scale.linear().domain([xMin, xMax]).range([0, w]), + y1 = d3.scale.linear().domain([0, yMax]).range([0, h * bands]); + + // Retrieve the old scales, if this is an update. + if (this.__chart__) { + x0 = this.__chart__.x; + y0 = this.__chart__.y; + id = this.__chart__.id; + } else { + x0 = d3.scale.linear().domain([0, Infinity]).range(x1.range()); + y0 = d3.scale.linear().domain([0, Infinity]).range(y1.range()); + id = ++d3_chart_horizonId; + } + + // We'll use a defs to store the area path and the clip path. + var defs = g.selectAll("defs") + .data([data]); + + var defsEnter = defs.enter().append("svg:defs"); + + // The clip path is a simple rect. + defsEnter.append("svg:clipPath") + .attr("id", "d3_chart_horizon_clip" + id) + .append("svg:rect") + .attr("width", w) + .attr("height", h); + + defs.select("rect").transition() + .duration(duration) + .attr("width", w) + .attr("height", h); + + // The area path is rendered with our resuable d3.svg.area. + defsEnter.append("svg:path") + .attr("id", "d3_chart_horizon_path" + id) + .attr("d", d3_chart_horizonArea + .interpolate(interpolate) + .x(function(d) { return x0(d[0]); }) + .y0(h * bands) + .y1(function(d) { return h * bands - y0(d[1]); })) + .transition() + .duration(duration) + .attr("d", d3_chart_horizonArea + .x(function(d) { return x1(d[0]); }) + .y1(function(d) { return h * bands - y1(d[1]); })); + + defs.select("path").transition() + .duration(duration) + .attr("d", d3_chart_horizonArea); + + // We'll use a container to clip all horizon layers at once. + g.selectAll("g") + .data([null]) + .enter().append("svg:g") + .attr("clip-path", "url(#d3_chart_horizon_clip" + id + ")"); + + // Define the transform function based on the mode. + var transform = mode == "offset" + ? function(d) { return "translate(0," + (d + (d < 0) - bands) * h + ")"; } + : function(d) { return (d < 0 ? "scale(1,-1)" : "") + "translate(0," + (d - bands) * h + ")"; }; + + // Instantiate each copy of the path with different transforms. + var u = g.select("g").selectAll("use") + .data(d3.range(-1, -bands - 1, -1).concat(d3.range(1, bands + 1)), Number); + + // TODO don't fudge the enter transition + u.enter().append("svg:use") + .attr("xlink:href", "#d3_chart_horizon_path" + id) + .attr("transform", function(d) { return transform(d + (d > 0 ? 1 : -1)); }) + .style("fill", color) + .transition() + .duration(duration) + .attr("transform", transform); + + u.transition() + .duration(duration) + .attr("transform", transform) + .style("fill", color); + + u.exit().transition() + .duration(duration) + .attr("transform", transform) + .remove(); + + // Stash the new scales. + this.__chart__ = {x: x1, y: y1, id: id}; + }); + d3.timer.flush(); + } + + horizon.duration = function(x) { + if (!arguments.length) return duration; + duration = +x; + return horizon; + }; + + horizon.bands = function(x) { + if (!arguments.length) return bands; + bands = +x; + color.domain([-bands, 0, bands]); + return horizon; + }; + + horizon.mode = function(x) { + if (!arguments.length) return mode; + mode = x + ""; + return horizon; + }; + + horizon.colors = function(x) { + if (!arguments.length) return color.range(); + color.range(x); + return horizon; + }; + + horizon.interpolate = function(x) { + if (!arguments.length) return interpolate; + interpolate = x + ""; + return horizon; + }; + + horizon.x = function(z) { + if (!arguments.length) return x; + x = z; + return horizon; + }; + + horizon.y = function(z) { + if (!arguments.length) return y; + y = z; + return horizon; + }; + + horizon.width = function(x) { + if (!arguments.length) return w; + w = +x; + return horizon; + }; + + horizon.height = function(x) { + if (!arguments.length) return h; + h = +x; + return horizon; + }; + + return horizon; +}; + +var d3_chart_horizonArea = d3.svg.area(), + d3_chart_horizonId = 0; + +function d3_chart_horizonX(d) { + return d[0]; +} + +function d3_chart_horizonY(d) { + return d[1]; +} +// Based on http://vis.stanford.edu/protovis/ex/qqplot.html +d3.chart.qq = function() { + var width = 1, + height = 1, + duration = 0, + domain = null, + tickFormat = null, + n = 100, + x = d3_chart_qqX, + y = d3_chart_qqY; + + // For each small multiple… + function qq(g) { + g.each(function(d, i) { + var g = d3.select(this), + qx = d3_chart_qqQuantiles(n, x.call(this, d, i)), + qy = d3_chart_qqQuantiles(n, y.call(this, d, i)), + xd = domain && domain.call(this, d, i) || [d3.min(qx), d3.max(qx)], // new x-domain + yd = domain && domain.call(this, d, i) || [d3.min(qy), d3.max(qy)], // new y-domain + x0, // old x-scale + y0; // old y-scale + + // Compute the new x-scale. + var x1 = d3.scale.linear() + .domain(xd) + .range([0, width]); + + // Compute the new y-scale. + var y1 = d3.scale.linear() + .domain(yd) + .range([height, 0]); + + // Retrieve the old scales, if this is an update. + if (this.__chart__) { + x0 = this.__chart__.x; + y0 = this.__chart__.y; + } else { + x0 = d3.scale.linear().domain([0, Infinity]).range(x1.range()); + y0 = d3.scale.linear().domain([0, Infinity]).range(y1.range()); + } + + // Stash the new scales. + this.__chart__ = {x: x1, y: y1}; + + // Update diagonal line. + var diagonal = g.selectAll("line.diagonal") + .data([null]); + + diagonal.enter().append("svg:line") + .attr("class", "diagonal") + .attr("x1", x1(yd[0])) + .attr("y1", y1(xd[0])) + .attr("x2", x1(yd[1])) + .attr("y2", y1(xd[1])); + + diagonal.transition() + .duration(duration) + .attr("x1", x1(yd[0])) + .attr("y1", y1(xd[0])) + .attr("x2", x1(yd[1])) + .attr("y2", y1(xd[1])); + + // Update quantile plots. + var circle = g.selectAll("circle") + .data(d3.range(n).map(function(i) { + return {x: qx[i], y: qy[i]}; + })); + + circle.enter().append("svg:circle") + .attr("class", "quantile") + .attr("r", 4.5) + .attr("cx", function(d) { return x0(d.x); }) + .attr("cy", function(d) { return y0(d.y); }) + .style("opacity", 1e-6) + .transition() + .duration(duration) + .attr("cx", function(d) { return x1(d.x); }) + .attr("cy", function(d) { return y1(d.y); }) + .style("opacity", 1); + + circle.transition() + .duration(duration) + .attr("cx", function(d) { return x1(d.x); }) + .attr("cy", function(d) { return y1(d.y); }) + .style("opacity", 1); + + circle.exit().transition() + .duration(duration) + .attr("cx", function(d) { return x1(d.x); }) + .attr("cy", function(d) { return y1(d.y); }) + .style("opacity", 1e-6) + .remove(); + + var xformat = tickFormat || x1.tickFormat(4), + yformat = tickFormat || y1.tickFormat(4), + tx = function(d) { return "translate(" + x1(d) + "," + height + ")"; }, + ty = function(d) { return "translate(0," + y1(d) + ")"; }; + + // Update x-ticks. + var xtick = g.selectAll("g.x.tick") + .data(x1.ticks(4), function(d) { + return this.textContent || xformat(d); + }); + + var xtickEnter = xtick.enter().append("svg:g") + .attr("class", "x tick") + .attr("transform", function(d) { return "translate(" + x0(d) + "," + height + ")"; }) + .style("opacity", 1e-6); + + xtickEnter.append("svg:line") + .attr("y1", 0) + .attr("y2", -6); + + xtickEnter.append("svg:text") + .attr("text-anchor", "middle") + .attr("dy", "1em") + .text(xformat); + + // Transition the entering ticks to the new scale, x1. + xtickEnter.transition() + .duration(duration) + .attr("transform", tx) + .style("opacity", 1); + + // Transition the updating ticks to the new scale, x1. + xtick.transition() + .duration(duration) + .attr("transform", tx) + .style("opacity", 1); + + // Transition the exiting ticks to the new scale, x1. + xtick.exit().transition() + .duration(duration) + .attr("transform", tx) + .style("opacity", 1e-6) + .remove(); + + // Update ticks. + var ytick = g.selectAll("g.y.tick") + .data(y1.ticks(4), function(d) { + return this.textContent || yformat(d); + }); + + var ytickEnter = ytick.enter().append("svg:g") + .attr("class", "y tick") + .attr("transform", function(d) { return "translate(0," + y0(d) + ")"; }) + .style("opacity", 1e-6); + + ytickEnter.append("svg:line") + .attr("x1", 0) + .attr("x2", 6); + + ytickEnter.append("svg:text") + .attr("text-anchor", "end") + .attr("dx", "-.5em") + .attr("dy", ".3em") + .text(yformat); + + // Transition the entering ticks to the new scale, y1. + ytickEnter.transition() + .duration(duration) + .attr("transform", ty) + .style("opacity", 1); + + // Transition the updating ticks to the new scale, y1. + ytick.transition() + .duration(duration) + .attr("transform", ty) + .style("opacity", 1); + + // Transition the exiting ticks to the new scale, y1. + ytick.exit().transition() + .duration(duration) + .attr("transform", ty) + .style("opacity", 1e-6) + .remove(); + }); + } + + qq.width = function(x) { + if (!arguments.length) return width; + width = x; + return qq; + }; + + qq.height = function(x) { + if (!arguments.length) return height; + height = x; + return qq; + }; + + qq.duration = function(x) { + if (!arguments.length) return duration; + duration = x; + return qq; + }; + + qq.domain = function(x) { + if (!arguments.length) return domain; + domain = x == null ? x : d3.functor(x); + return qq; + }; + + qq.count = function(z) { + if (!arguments.length) return n; + n = z; + return qq; + }; + + qq.x = function(z) { + if (!arguments.length) return x; + x = z; + return qq; + }; + + qq.y = function(z) { + if (!arguments.length) return y; + y = z; + return qq; + }; + + qq.tickFormat = function(x) { + if (!arguments.length) return tickFormat; + tickFormat = x; + return qq; + }; + + return qq; +}; + +function d3_chart_qqQuantiles(n, values) { + var m = values.length - 1; + values = values.slice().sort(d3.ascending); + return d3.range(n).map(function(i) { + return values[~~(i * m / n)]; + }); +} + +function d3_chart_qqX(d) { + return d.x; +} + +function d3_chart_qqY(d) { + return d.y; +} +})(); diff --git a/gstudio/static/gstudio/js/d3.chart.min.js b/gstudio/static/gstudio/js/d3.chart.min.js new file mode 100644 index 0000000..464690d --- /dev/null +++ b/gstudio/static/gstudio/js/d3.chart.min.js @@ -0,0 +1 @@ +(function(){function a(a){return[0,a.length-1]}function b(a){return[d3.quantile(a,.25),d3.quantile(a,.5),d3.quantile(a,.75)]}function c(a){return a.ranges}function d(a){return a.markers}function e(a){return a.measures}function f(a){return function(b){return"translate("+a(b)+",0)"}}function g(a){var b=a(0);return function(c){return Math.abs(a(c)-b)}}function j(a){return a[0]}function k(a){return a[1]}function l(a,b){var c=b.length-1;return b=b.slice().sort(d3.ascending),d3.range(a).map(function(d){return b[~~(d*c/a)]})}function m(a){return a.x}function n(a){return a.y}d3.chart={},d3.chart.box=function(){function k(a){a.each(function(a,b){a=a.map(g).sort(d3.ascending);var k=d3.select(this),l=a.length,m=a[0],n=a[l-1],o=a.quartiles=i(a),p=h&&h.call(this,a,b),q=p&&p.map(function(b){return a[b]}),r=p?d3.range(0,p[0]).concat(d3.range(p[1]+1,l)):d3.range(l),s=d3.scale.linear().domain(f&&f.call(this,a,b)||[m,n]).range([d,0]),t=this.__chart__||d3.scale.linear().domain([0,Infinity]).range(s.range());this.__chart__=s;var u=k.selectAll("line.center").data(q?[q]:[]);u.enter().insert("svg:line","rect").attr("class","center").attr("x1",c/2).attr("y1",function(a){return t(a[0])}).attr("x2",c/2).attr("y2",function(a){return t(a[1])}).style("opacity",1e-6).transition().duration(e).style("opacity",1).attr("y1",function(a){return s(a[0])}).attr("y2",function(a){return s(a[1])}),u.transition().duration(e).style("opacity",1).attr("y1",function(a){return s(a[0])}).attr("y2",function(a){return s(a[1])}),u.exit().transition().duration(e).style("opacity",1e-6).attr("y1",function(a){return s(a[0])}).attr("y2",function(a){return s(a[1])}).remove();var v=k.selectAll("rect.box").data([o]);v.enter().append("svg:rect").attr("class","box").attr("x",0).attr("y",function(a){return t(a[2])}).attr("width",c).attr("height",function(a){return t(a[0])-t(a[2])}).transition().duration(e).attr("y",function(a){return s(a[2])}).attr("height",function(a){return s(a[0])-s(a[2])}),v.transition().duration(e).attr("y",function(a){return s(a[2])}).attr("height",function(a){return s(a[0])-s(a[2])});var w=k.selectAll("line.median").data([o[1]]);w.enter().append("svg:line").attr("class","median").attr("x1",0).attr("y1",t).attr("x2",c).attr("y2",t).transition().duration(e).attr("y1",s).attr("y2",s),w.transition().duration(e).attr("y1",s).attr("y2",s);var x=k.selectAll("line.whisker").data(q||[]);x.enter().insert("svg:line","circle, text").attr("class","whisker").attr("x1",0).attr("y1",t).attr("x2",c).attr("y2",t).style("opacity",1e-6).transition().duration(e).attr("y1",s).attr("y2",s).style("opacity",1),x.transition().duration(e).attr("y1",s).attr("y2",s).style("opacity",1),x.exit().transition().duration(e).attr("y1",s).attr("y2",s).style("opacity",1e-6).remove();var y=k.selectAll("circle.outlier").data(r,Number);y.enter().insert("svg:circle","text").attr("class","outlier").attr("r",5).attr("cx",c/2).attr("cy",function(b){return t(a[b])}).style("opacity",1e-6).transition().duration(e).attr("cy",function(b){return s(a[b])}).style("opacity",1),y.transition().duration(e).attr("cy",function(b){return s(a[b])}).style("opacity",1),y.exit().transition().duration(e).attr("cy",function(b){return s(a[b])}).style("opacity",1e-6).remove();var z=j||s.tickFormat(8),A=k.selectAll("text.box").data(o);A.enter().append("svg:text").attr("class","box").attr("dy",".3em").attr("dx",function(a,b){return b&1?6:-6}).attr("x",function(a,b){return b&1?c:0}).attr("y",t).attr("text-anchor",function(a,b){return b&1?"start":"end"}).text(z).transition().duration(e).attr("y",s),A.transition().duration(e).text(z).attr("y",s);var B=k.selectAll("text.whisker").data(q||[]);B.enter().append("svg:text").attr("class","whisker").attr("dy",".3em").attr("dx",6).attr("x",c).attr("y",t).text(z).style("opacity",1e-6).transition().duration(e).attr("y",s).style("opacity",1),B.transition().duration(e).text(z).attr("y",s).style("opacity",1),B.exit().transition().duration(e).attr("y",s).style("opacity",1e-6).remove()}),d3.timer.flush()}var c=1,d=1,e=0,f=null,g=Number,h=a,i=b,j=null;return k.width=function(a){return arguments.length?(c=a,k):c},k.height=function(a){return arguments.length?(d=a,k):d},k.tickFormat=function(a){return arguments.length?(j=a,k):j},k.duration=function(a){return arguments.length?(e=a,k):e},k.domain=function(a){return arguments.length?(f=a==null?a:d3.functor(a),k):f},k.value=function(a){return arguments.length?(g=a,k):g},k.whiskers=function(a){return arguments.length?(h=a,k):h},k.quartiles=function(a){return arguments.length?(i=a,k):i},k},d3.chart.bullet=function(){function o(a){a.each(function(a,c){var d=i.call(this,a,c).slice().sort(d3.descending),e=j.call(this,a,c).slice().sort(d3.descending),o=k.call(this,a,c).slice().sort(d3.descending),p=d3.select(this),q=d3.scale.linear().domain([0,Math.max(d[0],e[0],o[0])]).range(b?[l,0]:[0,l]),r=this.__chart__||d3.scale.linear().domain([0,Infinity]).range(q.range());this.__chart__=q;var s=g(r),t=g(q),u=p.selectAll("rect.range").data(d);u.enter().append("svg:rect").attr("class",function(a,b){return"range s"+b}).attr("width",s).attr("height",m).attr("x",b?r:0).transition().duration(h).attr("width",t).attr("x",b?q:0),u.transition().duration(h).attr("x",b?q:0).attr("width",t).attr("height",m);var v=p.selectAll("rect.measure").data(o);v.enter().append("svg:rect").attr("class",function(a,b){return"measure s"+b}).attr("width",s).attr("height",m/3).attr("x",b?r:0).attr("y",m/3).transition().duration(h).attr("width",t).attr("x",b?q:0),v.transition().duration(h).attr("width",t).attr("height",m/3).attr("x",b?q:0).attr("y",m/3);var w=p.selectAll("line.marker").data(e);w.enter().append("svg:line").attr("class","marker").attr("x1",r).attr("x2",r).attr("y1",m/6).attr("y2",m*5/6).transition().duration(h).attr("x1",q).attr("x2",q),w.transition().duration(h).attr("x1",q).attr("x2",q).attr("y1",m/6).attr("y2",m*5/6);var x=n||q.tickFormat(8),y=p.selectAll("g.tick").data(q.ticks(8),function(a){return this.textContent||x(a)}),z=y.enter().append("svg:g").attr("class","tick").attr("transform",f(r)).style("opacity",1e-6);z.append("svg:line").attr("y1",m).attr("y2",m*7/6),z.append("svg:text").attr("text-anchor","middle").attr("dy","1em").attr("y",m*7/6).text(x),z.transition().duration(h).attr("transform",f(q)).style("opacity",1);var A=y.transition().duration(h).attr("transform",f(q)).style("opacity",1);A.select("line").attr("y1",m).attr("y2",m*7/6),A.select("text").attr("y",m*7/6),y.exit().transition().duration(h).attr("transform",f(q)).style("opacity",1e-6).remove()}),d3.timer.flush()}var a="left",b=!1,h=0,i=c,j=d,k=e,l=380,m=30,n=null;return o.orient=function(c){return arguments.length?(a=c,b=a=="right"||a=="bottom",o):a},o.ranges=function(a){return arguments.length?(i=a,o):i},o.markers=function(a){return arguments.length?(j=a,o):j},o.measures=function(a){return arguments.length?(k=a,o):k},o.width=function(a){return arguments.length?(l=a,o):l},o.height=function(a){return arguments.length?(m=a,o):m},o.tickFormat=function(a){return arguments.length?(n=a,o):n},o.duration=function(a){return arguments.length?(h=a,o):h},o},d3.chart.horizon=function(){function n(j){j.each(function(j,k){var n=d3.select(this),o=2*a+1,p=Infinity,q=-Infinity,r=-Infinity,s,t,u,v=j.map(function(a,b){var c=d.call(this,a,b),f=e.call(this,a,b);return c<p&&(p=c),c>q&&(q=c),-f>r&&(r=-f),f>r&&(r=f),[c,f]}),z=d3.scale.linear().domain([p,q]).range([0,f]),A=d3.scale.linear().domain([0,r]).range([0,g*a]);this.__chart__?(s=this.__chart__.x,t=this.__chart__.y,u=this.__chart__.id):(s=d3.scale.linear().domain([0,Infinity]).range(z.range()),t=d3.scale.linear().domain([0,Infinity]).range(A.range()),u=++i);var B=n.selectAll("defs").data([v]),C=B.enter().append("svg:defs");C.append("svg:clipPath").attr("id","d3_chart_horizon_clip"+u).append("svg:rect").attr("width",f).attr("height",g),B.select("rect").transition().duration(l).attr("width",f).attr("height",g),C.append("svg:path").attr("id","d3_chart_horizon_path"+u).attr("d",h.interpolate(c).x(function(a){return s(a[0])}).y0(g*a).y1(function(b){return g*a-t(b[1])})).transition().duration(l).attr("d",h.x(function(a){return z(a[0])}).y1(function(b){return g*a-A(b[1])})),B.select("path").transition().duration(l).attr("d",h),n.selectAll("g").data([null]).enter().append("svg:g").attr("clip-path","url(#d3_chart_horizon_clip"+u+")");var D=b=="offset"?function(b){return"translate(0,"+(b+(b<0)-a)*g+")"}:function(b){return(b<0?"scale(1,-1)":"")+"translate(0,"+(b-a)*g+")"},E=n.select("g").selectAll("use").data(d3.range(-1,-a-1,-1).concat(d3.range(1,a+1)),Number);E.enter().append("svg:use").attr("xlink:href","#d3_chart_horizon_path"+u).attr("transform",function(a){return D(a+(a>0?1:-1))}).style("fill",m).transition().duration(l).attr("transform",D),E.transition().duration(l).attr("transform",D).style("fill",m),E.exit().transition().duration(l).attr("transform",D).remove(),this.__chart__={x:z,y:A,id:u}}),d3.timer.flush()}var a=1,b="offset",c="linear",d=j,e=k,f=960,g=40,l=0,m=d3.scale.linear().domain([-1,0,1]).range(["#d62728","#fff","#1f77b4"]);return n.duration=function(a){return arguments.length?(l=+a,n):l},n.bands=function(b){return arguments.length?(a=+b,m.domain([-a,0,a]),n):a},n.mode=function(a){return arguments.length?(b=a+"",n):b},n.colors=function(a){return arguments.length?(m.range(a),n):m.range()},n.interpolate=function(a){return arguments.length?(c=a+"",n):c},n.x=function(a){return arguments.length?(d=a,n):d},n.y=function(a){return arguments.length?(e=a,n):e},n.width=function(a){return arguments.length?(f=+a,n):f},n.height=function(a){return arguments.length?(g=+a,n):g},n};var h=d3.svg.area(),i=0;d3.chart.qq=function(){function i(i){i.each(function(i,j){var k=d3.select(this),m=l(f,g.call(this,i,j)),n=l(f,h.call(this,i,j)),o=d&&d.call(this,i,j)||[d3.min(m),d3.max(m)],p=d&&d.call(this,i,j)||[d3.min(n),d3.max(n)],q,r,s=d3.scale.linear().domain(o).range([0,a]),t=d3.scale.linear().domain(p).range([b,0]);this.__chart__?(q=this.__chart__.x,r=this.__chart__.y):(q=d3.scale.linear().domain([0,Infinity]).range(s.range()),r=d3.scale.linear().domain([0,Infinity]).range(t.range())),this.__chart__={x:s,y:t};var u=k.selectAll("line.diagonal").data([null]);u.enter().append("svg:line").attr("class","diagonal").attr("x1",s(p[0])).attr("y1",t(o[0])).attr("x2",s(p[1])).attr("y2",t(o[1])),u.transition().duration(c).attr("x1",s(p[0])).attr("y1",t(o[0])).attr("x2",s(p[1])).attr("y2",t(o[1]));var v=k.selectAll("circle").data(d3.range(f).map(function(a){return{x:m[a],y:n[a]}}));v.enter().append("svg:circle").attr("class","quantile").attr("r",4.5).attr("cx",function(a){return q(a.x)}).attr("cy",function(a){return r(a.y)}).style("opacity",1e-6).transition().duration(c).attr("cx",function(a){return s(a.x)}).attr("cy",function(a){return t(a.y)}).style("opacity",1),v.transition().duration(c).attr("cx",function(a){return s(a.x)}).attr("cy",function(a){return t(a.y)}).style("opacity",1),v.exit().transition().duration(c).attr("cx",function(a){return s(a.x)}).attr("cy",function(a){return t(a.y)}).style("opacity",1e-6).remove();var w=e||s.tickFormat(4),z=e||t.tickFormat(4),A=function(a){return"translate("+s(a)+","+b+")"},B=function(a){return"translate(0,"+t(a)+")"},C=k.selectAll("g.x.tick").data(s.ticks(4),function(a){return this.textContent||w(a)}),D=C.enter().append("svg:g").attr("class","x tick").attr("transform",function(a){return"translate("+q(a)+","+b+")"}).style("opacity",1e-6);D.append("svg:line").attr("y1",0).attr("y2",-6),D.append("svg:text").attr("text-anchor","middle").attr("dy","1em").text(w),D.transition().duration(c).attr("transform",A).style("opacity",1),C.transition().duration(c).attr("transform",A).style("opacity",1),C.exit().transition().duration(c).attr("transform",A).style("opacity",1e-6).remove();var E=k.selectAll("g.y.tick").data(t.ticks(4),function(a){return this.textContent||z(a)}),F=E.enter().append("svg:g").attr("class","y tick").attr("transform",function(a){return"translate(0,"+r(a)+")"}).style("opacity",1e-6);F.append("svg:line").attr("x1",0).attr("x2",6),F.append("svg:text").attr("text-anchor","end").attr("dx","-.5em").attr("dy",".3em").text(z),F.transition().duration(c).attr("transform",B).style("opacity",1),E.transition().duration(c).attr("transform",B).style("opacity",1),E.exit().transition().duration(c).attr("transform",B).style("opacity",1e-6).remove()})}var a=1,b=1,c=0,d=null,e=null,f=100,g=m,h=n;return i.width=function(b){return arguments.length?(a=b,i):a},i.height=function(a){return arguments.length?(b=a,i):b},i.duration=function(a){return arguments.length?(c=a,i):c},i.domain=function(a){return arguments.length?(d=a==null?a:d3.functor(a),i):d},i.count=function(a){return arguments.length?(f=a,i):f},i.x=function(a){return arguments.length?(g=a,i):g},i.y=function(a){return arguments.length?(h=a,i):h},i.tickFormat=function(a){return arguments.length?(e=a,i):e},i}})();
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/d3.csv.js b/gstudio/static/gstudio/js/d3.csv.js new file mode 100644 index 0000000..7565b83 --- /dev/null +++ b/gstudio/static/gstudio/js/d3.csv.js @@ -0,0 +1,92 @@ +(function(){d3.csv = function(url, callback) { + d3.text(url, "text/csv", function(text) { + callback(text && d3.csv.parse(text)); + }); +}; +d3.csv.parse = function(text) { + var header; + return d3.csv.parseRows(text, function(row, i) { + if (i) { + var o = {}, j = -1, m = header.length; + while (++j < m) o[header[j]] = row[j]; + return o; + } else { + header = row; + return null; + } + }); +}; + +d3.csv.parseRows = function(text, f) { + var EOL = {}, // sentinel value for end-of-line + EOF = {}, // sentinel value for end-of-file + rows = [], // output rows + re = /\r\n|[,\r\n]/g, // field separator regex + n = 0, // the current line number + t, // the current token + eol; // is the current token followed by EOL? + + re.lastIndex = 0; // work-around bug in FF 3.6 + + /** @private Returns the next token. */ + function token() { + if (re.lastIndex >= text.length) return EOF; // special case: end of file + if (eol) { eol = false; return EOL; } // special case: end of line + + // special case: quotes + var j = re.lastIndex; + if (text.charCodeAt(j) === 34) { + var i = j; + while (i++ < text.length) { + if (text.charCodeAt(i) === 34) { + if (text.charCodeAt(i + 1) !== 34) break; + i++; + } + } + re.lastIndex = i + 2; + var c = text.charCodeAt(i + 1); + if (c === 13) { + eol = true; + if (text.charCodeAt(i + 2) === 10) re.lastIndex++; + } else if (c === 10) { + eol = true; + } + return text.substring(j + 1, i).replace(/""/g, "\""); + } + + // common case + var m = re.exec(text); + if (m) { + eol = m[0].charCodeAt(0) !== 44; + return text.substring(j, m.index); + } + re.lastIndex = text.length; + return text.substring(j); + } + + while ((t = token()) !== EOF) { + var a = []; + while ((t !== EOL) && (t !== EOF)) { + a.push(t); + t = token(); + } + if (f && !(a = f(a, n++))) continue; + rows.push(a); + } + + return rows; +}; +d3.csv.format = function(rows) { + return rows.map(d3_csv_formatRow).join("\n"); +}; + +function d3_csv_formatRow(row) { + return row.map(d3_csv_formatValue).join(","); +} + +function d3_csv_formatValue(text) { + return /[",\n]/.test(text) + ? "\"" + text.replace(/\"/g, "\"\"") + "\"" + : text; +} +})(); diff --git a/gstudio/static/gstudio/js/d3.csv.min.js b/gstudio/static/gstudio/js/d3.csv.min.js new file mode 100644 index 0000000..3a384ea --- /dev/null +++ b/gstudio/static/gstudio/js/d3.csv.min.js @@ -0,0 +1 @@ +(function(){function a(a){return a.map(b).join(",")}function b(a){return/[",\n]/.test(a)?'"'+a.replace(/\"/g,'""')+'"':a}d3.csv=function(a,b){d3.text(a,"text/csv",function(a){b(a&&d3.csv.parse(a))})},d3.csv.parse=function(a){var b;return d3.csv.parseRows(a,function(a,c){if(c){var d={},e=-1,f=b.length;while(++e<f)d[b[e]]=a[e];return d}return b=a,null})},d3.csv.parseRows=function(a,b){function j(){if(f.lastIndex>=a.length)return d;if(i)return i=!1,c;var b=f.lastIndex;if(a.charCodeAt(b)===34){var e=b;while(e++<a.length)if(a.charCodeAt(e)===34){if(a.charCodeAt(e+1)!==34)break;e++}f.lastIndex=e+2;var g=a.charCodeAt(e+1);return g===13?(i=!0,a.charCodeAt(e+2)===10&&f.lastIndex++):g===10&&(i=!0),a.substring(b+1,e).replace(/""/g,'"')}var h=f.exec(a);return h?(i=h[0].charCodeAt(0)!==44,a.substring(b,h.index)):(f.lastIndex=a.length,a.substring(b))}var c={},d={},e=[],f=/\r\n|[,\r\n]/g,g=0,h,i;f.lastIndex=0;while((h=j())!==d){var k=[];while(h!==c&&h!==d)k.push(h),h=j();if(b&&!(k=b(k,g++)))continue;e.push(k)}return e},d3.csv.format=function(b){return b.map(a).join("\n")}})();
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/d3.geo.js b/gstudio/static/gstudio/js/d3.geo.js new file mode 100644 index 0000000..2b40252 --- /dev/null +++ b/gstudio/static/gstudio/js/d3.geo.js @@ -0,0 +1,938 @@ +(function(){d3.geo = {}; + +var d3_geo_radians = Math.PI / 180; +// TODO clip input coordinates on opposite hemisphere +d3.geo.azimuthal = function() { + var mode = "orthographic", // or stereographic, gnomonic, equidistant or equalarea + origin, + scale = 200, + translate = [480, 250], + x0, + y0, + cy0, + sy0; + + function azimuthal(coordinates) { + var x1 = coordinates[0] * d3_geo_radians - x0, + y1 = coordinates[1] * d3_geo_radians, + cx1 = Math.cos(x1), + sx1 = Math.sin(x1), + cy1 = Math.cos(y1), + sy1 = Math.sin(y1), + cc = mode !== "orthographic" ? sy0 * sy1 + cy0 * cy1 * cx1 : null, + c, + k = mode === "stereographic" ? 1 / (1 + cc) + : mode === "gnomonic" ? 1 / cc + : mode === "equidistant" ? (c = Math.acos(cc), c ? c / Math.sin(c) : 0) + : mode === "equalarea" ? Math.sqrt(2 / (1 + cc)) + : 1, + x = k * cy1 * sx1, + y = k * (sy0 * cy1 * cx1 - cy0 * sy1); + return [ + scale * x + translate[0], + scale * y + translate[1] + ]; + } + + azimuthal.invert = function(coordinates) { + var x = (coordinates[0] - translate[0]) / scale, + y = (coordinates[1] - translate[1]) / scale, + p = Math.sqrt(x * x + y * y), + c = mode === "stereographic" ? 2 * Math.atan(p) + : mode === "gnomonic" ? Math.atan(p) + : mode === "equidistant" ? p + : mode === "equalarea" ? 2 * Math.asin(.5 * p) + : Math.asin(p), + sc = Math.sin(c), + cc = Math.cos(c); + return [ + (x0 + Math.atan2(x * sc, p * cy0 * cc + y * sy0 * sc)) / d3_geo_radians, + Math.asin(cc * sy0 - (p ? (y * sc * cy0) / p : 0)) / d3_geo_radians + ]; + }; + + azimuthal.mode = function(x) { + if (!arguments.length) return mode; + mode = x + ""; + return azimuthal; + }; + + azimuthal.origin = function(x) { + if (!arguments.length) return origin; + origin = x; + x0 = origin[0] * d3_geo_radians; + y0 = origin[1] * d3_geo_radians; + cy0 = Math.cos(y0); + sy0 = Math.sin(y0); + return azimuthal; + }; + + azimuthal.scale = function(x) { + if (!arguments.length) return scale; + scale = +x; + return azimuthal; + }; + + azimuthal.translate = function(x) { + if (!arguments.length) return translate; + translate = [+x[0], +x[1]]; + return azimuthal; + }; + + return azimuthal.origin([0, 0]); +}; +// Derived from Tom Carden's Albers implementation for Protovis. +// http://gist.github.com/476238 +// http://mathworld.wolfram.com/AlbersEqual-AreaConicProjection.html + +d3.geo.albers = function() { + var origin = [-98, 38], + parallels = [29.5, 45.5], + scale = 1000, + translate = [480, 250], + lng0, // d3_geo_radians * origin[0] + n, + C, + p0; + + function albers(coordinates) { + var t = n * (d3_geo_radians * coordinates[0] - lng0), + p = Math.sqrt(C - 2 * n * Math.sin(d3_geo_radians * coordinates[1])) / n; + return [ + scale * p * Math.sin(t) + translate[0], + scale * (p * Math.cos(t) - p0) + translate[1] + ]; + } + + albers.invert = function(coordinates) { + var x = (coordinates[0] - translate[0]) / scale, + y = (coordinates[1] - translate[1]) / scale, + p0y = p0 + y, + t = Math.atan2(x, p0y), + p = Math.sqrt(x * x + p0y * p0y); + return [ + (lng0 + t / n) / d3_geo_radians, + Math.asin((C - p * p * n * n) / (2 * n)) / d3_geo_radians + ]; + }; + + function reload() { + var phi1 = d3_geo_radians * parallels[0], + phi2 = d3_geo_radians * parallels[1], + lat0 = d3_geo_radians * origin[1], + s = Math.sin(phi1), + c = Math.cos(phi1); + lng0 = d3_geo_radians * origin[0]; + n = .5 * (s + Math.sin(phi2)); + C = c * c + 2 * n * s; + p0 = Math.sqrt(C - 2 * n * Math.sin(lat0)) / n; + return albers; + } + + albers.origin = function(x) { + if (!arguments.length) return origin; + origin = [+x[0], +x[1]]; + return reload(); + }; + + albers.parallels = function(x) { + if (!arguments.length) return parallels; + parallels = [+x[0], +x[1]]; + return reload(); + }; + + albers.scale = function(x) { + if (!arguments.length) return scale; + scale = +x; + return albers; + }; + + albers.translate = function(x) { + if (!arguments.length) return translate; + translate = [+x[0], +x[1]]; + return albers; + }; + + return reload(); +}; + +// A composite projection for the United States, 960x500. The set of standard +// parallels for each region comes from USGS, which is published here: +// http://egsc.usgs.gov/isb/pubs/MapProjections/projections.html#albers +// TODO allow the composite projection to be rescaled? +d3.geo.albersUsa = function() { + var lower48 = d3.geo.albers(); + + var alaska = d3.geo.albers() + .origin([-160, 60]) + .parallels([55, 65]); + + var hawaii = d3.geo.albers() + .origin([-160, 20]) + .parallels([8, 18]); + + var puertoRico = d3.geo.albers() + .origin([-60, 10]) + .parallels([8, 18]); + + function albersUsa(coordinates) { + var lon = coordinates[0], + lat = coordinates[1]; + return (lat > 50 ? alaska + : lon < -140 ? hawaii + : lat < 21 ? puertoRico + : lower48)(coordinates); + } + + albersUsa.scale = function(x) { + if (!arguments.length) return lower48.scale(); + lower48.scale(x); + alaska.scale(x * .6); + hawaii.scale(x); + puertoRico.scale(x * 1.5); + return albersUsa.translate(lower48.translate()); + }; + + albersUsa.translate = function(x) { + if (!arguments.length) return lower48.translate(); + var dz = lower48.scale() / 1000, + dx = x[0], + dy = x[1]; + lower48.translate(x); + alaska.translate([dx - 400 * dz, dy + 170 * dz]); + hawaii.translate([dx - 190 * dz, dy + 200 * dz]); + puertoRico.translate([dx + 580 * dz, dy + 430 * dz]); + return albersUsa; + }; + + return albersUsa.scale(lower48.scale()); +}; +d3.geo.bonne = function() { + var scale = 200, + translate = [480, 250], + x0, // origin longitude in radians + y0, // origin latitude in radians + y1, // parallel latitude in radians + c1; // cot(y1) + + function bonne(coordinates) { + var x = coordinates[0] * d3_geo_radians - x0, + y = coordinates[1] * d3_geo_radians - y0; + if (y1) { + var p = c1 + y1 - y, E = x * Math.cos(y) / p; + x = p * Math.sin(E); + y = p * Math.cos(E) - c1; + } else { + x *= Math.cos(y); + y *= -1; + } + return [ + scale * x + translate[0], + scale * y + translate[1] + ]; + } + + bonne.invert = function(coordinates) { + var x = (coordinates[0] - translate[0]) / scale, + y = (coordinates[1] - translate[1]) / scale; + if (y1) { + var c = c1 + y, p = Math.sqrt(x * x + c * c); + y = c1 + y1 - p; + x = x0 + p * Math.atan2(x, c) / Math.cos(y); + } else { + y *= -1; + x /= Math.cos(y); + } + return [ + x / d3_geo_radians, + y / d3_geo_radians + ]; + }; + + // 90° for Werner, 0° for Sinusoidal + bonne.parallel = function(x) { + if (!arguments.length) return y1 / d3_geo_radians; + c1 = 1 / Math.tan(y1 = x * d3_geo_radians); + return bonne; + }; + + bonne.origin = function(x) { + if (!arguments.length) return [x0 / d3_geo_radians, y0 / d3_geo_radians]; + x0 = x[0] * d3_geo_radians; + y0 = x[1] * d3_geo_radians; + return bonne; + }; + + bonne.scale = function(x) { + if (!arguments.length) return scale; + scale = +x; + return bonne; + }; + + bonne.translate = function(x) { + if (!arguments.length) return translate; + translate = [+x[0], +x[1]]; + return bonne; + }; + + return bonne.origin([0, 0]).parallel(45); +}; +d3.geo.equirectangular = function() { + var scale = 500, + translate = [480, 250]; + + function equirectangular(coordinates) { + var x = coordinates[0] / 360, + y = -coordinates[1] / 360; + return [ + scale * x + translate[0], + scale * y + translate[1] + ]; + } + + equirectangular.invert = function(coordinates) { + var x = (coordinates[0] - translate[0]) / scale, + y = (coordinates[1] - translate[1]) / scale; + return [ + 360 * x, + -360 * y + ]; + }; + + equirectangular.scale = function(x) { + if (!arguments.length) return scale; + scale = +x; + return equirectangular; + }; + + equirectangular.translate = function(x) { + if (!arguments.length) return translate; + translate = [+x[0], +x[1]]; + return equirectangular; + }; + + return equirectangular; +}; +d3.geo.mercator = function() { + var scale = 500, + translate = [480, 250]; + + function mercator(coordinates) { + var x = coordinates[0] / 360, + y = -(Math.log(Math.tan(Math.PI / 4 + coordinates[1] * d3_geo_radians / 2)) / d3_geo_radians) / 360; + return [ + scale * x + translate[0], + scale * Math.max(-.5, Math.min(.5, y)) + translate[1] + ]; + } + + mercator.invert = function(coordinates) { + var x = (coordinates[0] - translate[0]) / scale, + y = (coordinates[1] - translate[1]) / scale; + return [ + 360 * x, + 2 * Math.atan(Math.exp(-360 * y * d3_geo_radians)) / d3_geo_radians - 90 + ]; + }; + + mercator.scale = function(x) { + if (!arguments.length) return scale; + scale = +x; + return mercator; + }; + + mercator.translate = function(x) { + if (!arguments.length) return translate; + translate = [+x[0], +x[1]]; + return mercator; + }; + + return mercator; +}; +function d3_geo_type(types, defaultValue) { + return function(object) { + return object && object.type in types ? types[object.type](object) : defaultValue; + }; +} +/** + * Returns a function that, given a GeoJSON object (e.g., a feature), returns + * the corresponding SVG path. The function can be customized by overriding the + * projection. Point features are mapped to circles with a default radius of + * 4.5px; the radius can be specified either as a constant or a function that + * is evaluated per object. + */ +d3.geo.path = function() { + var pointRadius = 4.5, + pointCircle = d3_path_circle(pointRadius), + projection = d3.geo.albersUsa(); + + function path(d, i) { + if (typeof pointRadius === "function") { + pointCircle = d3_path_circle(pointRadius.apply(this, arguments)); + } + return pathType(d) || null; + } + + function project(coordinates) { + return projection(coordinates).join(","); + } + + var pathType = d3_geo_type({ + + FeatureCollection: function(o) { + var path = [], + features = o.features, + i = -1, // features.index + n = features.length; + while (++i < n) path.push(pathType(features[i].geometry)); + return path.join(""); + }, + + Feature: function(o) { + return pathType(o.geometry); + }, + + Point: function(o) { + return "M" + project(o.coordinates) + pointCircle; + }, + + MultiPoint: function(o) { + var path = [], + coordinates = o.coordinates, + i = -1, // coordinates.index + n = coordinates.length; + while (++i < n) path.push("M", project(coordinates[i]), pointCircle); + return path.join(""); + }, + + LineString: function(o) { + var path = ["M"], + coordinates = o.coordinates, + i = -1, // coordinates.index + n = coordinates.length; + while (++i < n) path.push(project(coordinates[i]), "L"); + path.pop(); + return path.join(""); + }, + + MultiLineString: function(o) { + var path = [], + coordinates = o.coordinates, + i = -1, // coordinates.index + n = coordinates.length, + subcoordinates, // coordinates[i] + j, // subcoordinates.index + m; // subcoordinates.length + while (++i < n) { + subcoordinates = coordinates[i]; + j = -1; + m = subcoordinates.length; + path.push("M"); + while (++j < m) path.push(project(subcoordinates[j]), "L"); + path.pop(); + } + return path.join(""); + }, + + Polygon: function(o) { + var path = [], + coordinates = o.coordinates, + i = -1, // coordinates.index + n = coordinates.length, + subcoordinates, // coordinates[i] + j, // subcoordinates.index + m; // subcoordinates.length + while (++i < n) { + subcoordinates = coordinates[i]; + j = -1; + if ((m = subcoordinates.length - 1) > 0) { + path.push("M"); + while (++j < m) path.push(project(subcoordinates[j]), "L"); + path[path.length - 1] = "Z"; + } + } + return path.join(""); + }, + + MultiPolygon: function(o) { + var path = [], + coordinates = o.coordinates, + i = -1, // coordinates index + n = coordinates.length, + subcoordinates, // coordinates[i] + j, // subcoordinates index + m, // subcoordinates.length + subsubcoordinates, // subcoordinates[j] + k, // subsubcoordinates index + p; // subsubcoordinates.length + while (++i < n) { + subcoordinates = coordinates[i]; + j = -1; + m = subcoordinates.length; + while (++j < m) { + subsubcoordinates = subcoordinates[j]; + k = -1; + if ((p = subsubcoordinates.length - 1) > 0) { + path.push("M"); + while (++k < p) path.push(project(subsubcoordinates[k]), "L"); + path[path.length - 1] = "Z"; + } + } + } + return path.join(""); + }, + + GeometryCollection: function(o) { + var path = [], + geometries = o.geometries, + i = -1, // geometries index + n = geometries.length; + while (++i < n) path.push(pathType(geometries[i])); + return path.join(""); + } + + }); + + var areaType = path.area = d3_geo_type({ + + FeatureCollection: function(o) { + var area = 0, + features = o.features, + i = -1, // features.index + n = features.length; + while (++i < n) area += areaType(features[i]); + return area; + }, + + Feature: function(o) { + return areaType(o.geometry); + }, + + Polygon: function(o) { + return polygonArea(o.coordinates); + }, + + MultiPolygon: function(o) { + var sum = 0, + coordinates = o.coordinates, + i = -1, // coordinates index + n = coordinates.length; + while (++i < n) sum += polygonArea(coordinates[i]); + return sum; + }, + + GeometryCollection: function(o) { + var sum = 0, + geometries = o.geometries, + i = -1, // geometries index + n = geometries.length; + while (++i < n) sum += areaType(geometries[i]); + return sum; + } + + }, 0); + + function polygonArea(coordinates) { + var sum = area(coordinates[0]), // exterior ring + i = 0, // coordinates.index + n = coordinates.length; + while (++i < n) sum -= area(coordinates[i]); // holes + return sum; + } + + function polygonCentroid(coordinates) { + var polygon = d3.geom.polygon(coordinates[0].map(projection)), // exterior ring + area = polygon.area(), + centroid = polygon.centroid(area < 0 ? (area *= -1, 1) : -1), + x = centroid[0], + y = centroid[1], + z = area, + i = 0, // coordinates index + n = coordinates.length; + while (++i < n) { + polygon = d3.geom.polygon(coordinates[i].map(projection)); // holes + area = polygon.area(); + centroid = polygon.centroid(area < 0 ? (area *= -1, 1) : -1); + x -= centroid[0]; + y -= centroid[1]; + z -= area; + } + return [x, y, 6 * z]; // weighted centroid + } + + var centroidType = path.centroid = d3_geo_type({ + + // TODO FeatureCollection + // TODO Point + // TODO MultiPoint + // TODO LineString + // TODO MultiLineString + // TODO GeometryCollection + + Feature: function(o) { + return centroidType(o.geometry); + }, + + Polygon: function(o) { + var centroid = polygonCentroid(o.coordinates); + return [centroid[0] / centroid[2], centroid[1] / centroid[2]]; + }, + + MultiPolygon: function(o) { + var area = 0, + coordinates = o.coordinates, + centroid, + x = 0, + y = 0, + z = 0, + i = -1, // coordinates index + n = coordinates.length; + while (++i < n) { + centroid = polygonCentroid(coordinates[i]); + x += centroid[0]; + y += centroid[1]; + z += centroid[2]; + } + return [x / z, y / z]; + } + + }); + + function area(coordinates) { + return Math.abs(d3.geom.polygon(coordinates.map(projection)).area()); + } + + path.projection = function(x) { + projection = x; + return path; + }; + + path.pointRadius = function(x) { + if (typeof x === "function") pointRadius = x; + else { + pointRadius = +x; + pointCircle = d3_path_circle(pointRadius); + } + return path; + }; + + return path; +}; + +function d3_path_circle(radius) { + return "m0," + radius + + "a" + radius + "," + radius + " 0 1,1 0," + (-2 * radius) + + "a" + radius + "," + radius + " 0 1,1 0," + (+2 * radius) + + "z"; +} +/** + * Given a GeoJSON object, returns the corresponding bounding box. The bounding + * box is represented by a two-dimensional array: [[left, bottom], [right, + * top]], where left is the minimum longitude, bottom is the minimum latitude, + * right is maximum longitude, and top is the maximum latitude. + */ +d3.geo.bounds = function(feature) { + var left = Infinity, + bottom = Infinity, + right = -Infinity, + top = -Infinity; + d3_geo_bounds(feature, function(x, y) { + if (x < left) left = x; + if (x > right) right = x; + if (y < bottom) bottom = y; + if (y > top) top = y; + }); + return [[left, bottom], [right, top]]; +}; + +function d3_geo_bounds(o, f) { + if (o.type in d3_geo_boundsTypes) d3_geo_boundsTypes[o.type](o, f); +} + +var d3_geo_boundsTypes = { + Feature: d3_geo_boundsFeature, + FeatureCollection: d3_geo_boundsFeatureCollection, + GeometryCollection: d3_geo_boundsGeometryCollection, + LineString: d3_geo_boundsLineString, + MultiLineString: d3_geo_boundsMultiLineString, + MultiPoint: d3_geo_boundsLineString, + MultiPolygon: d3_geo_boundsMultiPolygon, + Point: d3_geo_boundsPoint, + Polygon: d3_geo_boundsPolygon +}; + +function d3_geo_boundsFeature(o, f) { + d3_geo_bounds(o.geometry, f); +} + +function d3_geo_boundsFeatureCollection(o, f) { + for (var a = o.features, i = 0, n = a.length; i < n; i++) { + d3_geo_bounds(a[i].geometry, f); + } +} + +function d3_geo_boundsGeometryCollection(o, f) { + for (var a = o.geometries, i = 0, n = a.length; i < n; i++) { + d3_geo_bounds(a[i], f); + } +} + +function d3_geo_boundsLineString(o, f) { + for (var a = o.coordinates, i = 0, n = a.length; i < n; i++) { + f.apply(null, a[i]); + } +} + +function d3_geo_boundsMultiLineString(o, f) { + for (var a = o.coordinates, i = 0, n = a.length; i < n; i++) { + for (var b = a[i], j = 0, m = b.length; j < m; j++) { + f.apply(null, b[j]); + } + } +} + +function d3_geo_boundsMultiPolygon(o, f) { + for (var a = o.coordinates, i = 0, n = a.length; i < n; i++) { + for (var b = a[i][0], j = 0, m = b.length; j < m; j++) { + f.apply(null, b[j]); + } + } +} + +function d3_geo_boundsPoint(o, f) { + f.apply(null, o.coordinates); +} + +function d3_geo_boundsPolygon(o, f) { + for (var a = o.coordinates[0], i = 0, n = a.length; i < n; i++) { + f.apply(null, a[i]); + } +} +// TODO breakAtDateLine? + +d3.geo.circle = function() { + var origin = [0, 0], + degrees = 90 - 1e-2, + radians = degrees * d3_geo_radians, + arc = d3.geo.greatArc().target(Object); + + function circle() { + // TODO render a circle as a Polygon + } + + function visible(point) { + return arc.distance(point) < radians; + } + + circle.clip = function(d) { + arc.source(typeof origin === "function" ? origin.apply(this, arguments) : origin); + return clipType(d); + }; + + var clipType = d3_geo_type({ + + FeatureCollection: function(o) { + var features = o.features.map(clipType).filter(Object); + return features && (o = Object.create(o), o.features = features, o); + }, + + Feature: function(o) { + var geometry = clipType(o.geometry); + return geometry && (o = Object.create(o), o.geometry = geometry, o); + }, + + Point: function(o) { + return visible(o.coordinates) && o; + }, + + MultiPoint: function(o) { + var coordinates = o.coordinates.filter(visible); + return coordinates.length && { + type: o.type, + coordinates: coordinates + }; + }, + + LineString: function(o) { + var coordinates = clip(o.coordinates); + return coordinates.length && (o = Object.create(o), o.coordinates = coordinates, o); + }, + + MultiLineString: function(o) { + var coordinates = o.coordinates.map(clip).filter(function(d) { return d.length; }); + return coordinates.length && (o = Object.create(o), o.coordinates = coordinates, o); + }, + + Polygon: function(o) { + var coordinates = o.coordinates.map(clip); + return coordinates[0].length && (o = Object.create(o), o.coordinates = coordinates, o); + }, + + MultiPolygon: function(o) { + var coordinates = o.coordinates.map(function(d) { return d.map(clip); }).filter(function(d) { return d[0].length; }); + return coordinates.length && (o = Object.create(o), o.coordinates = coordinates, o); + }, + + GeometryCollection: function(o) { + var geometries = o.geometries.map(clipType).filter(Object); + return geometries.length && (o = Object.create(o), o.geometries = geometries, o); + } + + }); + + function clip(coordinates) { + var i = -1, + n = coordinates.length, + clipped = [], + p0, + p1, + p2, + d0, + d1; + + while (++i < n) { + d1 = arc.distance(p2 = coordinates[i]); + if (d1 < radians) { + if (p1) clipped.push(d3_geo_greatArcInterpolate(p1, p2)((d0 - radians) / (d0 - d1))); + clipped.push(p2); + p0 = p1 = null; + } else { + p1 = p2; + if (!p0 && clipped.length) { + clipped.push(d3_geo_greatArcInterpolate(clipped[clipped.length - 1], p1)((radians - d0) / (d1 - d0))); + p0 = p1; + } + } + d0 = d1; + } + + if (p1 && clipped.length) { + d1 = arc.distance(p2 = clipped[0]); + clipped.push(d3_geo_greatArcInterpolate(p1, p2)((d0 - radians) / (d0 - d1))); + } + + return resample(clipped); + } + + // Resample coordinates, creating great arcs between each. + function resample(coordinates) { + var i = 0, + n = coordinates.length, + j, + m, + resampled = n ? [coordinates[0]] : coordinates, + resamples, + origin = arc.source(); + + while (++i < n) { + resamples = arc.source(coordinates[i - 1])(coordinates[i]).coordinates; + for (j = 0, m = resamples.length; ++j < m;) resampled.push(resamples[j]); + } + + arc.source(origin); + return resampled; + } + + circle.origin = function(x) { + if (!arguments.length) return origin; + origin = x; + return circle; + }; + + circle.angle = function(x) { + if (!arguments.length) return degrees; + radians = (degrees = +x) * d3_geo_radians; + return circle; + }; + + // Precision is specified in degrees. + circle.precision = function(x) { + if (!arguments.length) return arc.precision(); + arc.precision(x); + return circle; + }; + + return circle; +} +d3.geo.greatArc = function() { + var source = d3_geo_greatArcSource, + target = d3_geo_greatArcTarget, + precision = 6 * d3_geo_radians; + + function greatArc() { + var a = typeof source === "function" ? source.apply(this, arguments) : source, + b = typeof target === "function" ? target.apply(this, arguments) : target, + i = d3_geo_greatArcInterpolate(a, b), + dt = precision / i.d, + t = 0, + coordinates = [a]; + while ((t += dt) < 1) coordinates.push(i(t)); + coordinates.push(b); + return { + type: "LineString", + coordinates: coordinates + }; + } + + // Length returned in radians; multiply by radius for distance. + greatArc.distance = function() { + var a = typeof source === "function" ? source.apply(this, arguments) : source, + b = typeof target === "function" ? target.apply(this, arguments) : target; + return d3_geo_greatArcInterpolate(a, b).d; + }; + + greatArc.source = function(x) { + if (!arguments.length) return source; + source = x; + return greatArc; + }; + + greatArc.target = function(x) { + if (!arguments.length) return target; + target = x; + return greatArc; + }; + + // Precision is specified in degrees. + greatArc.precision = function(x) { + if (!arguments.length) return precision / d3_geo_radians; + precision = x * d3_geo_radians; + return greatArc; + }; + + return greatArc; +}; + +function d3_geo_greatArcSource(d) { + return d.source; +} + +function d3_geo_greatArcTarget(d) { + return d.target; +} + +function d3_geo_greatArcInterpolate(a, b) { + var x0 = a[0] * d3_geo_radians, cx0 = Math.cos(x0), sx0 = Math.sin(x0), + y0 = a[1] * d3_geo_radians, cy0 = Math.cos(y0), sy0 = Math.sin(y0), + x1 = b[0] * d3_geo_radians, cx1 = Math.cos(x1), sx1 = Math.sin(x1), + y1 = b[1] * d3_geo_radians, cy1 = Math.cos(y1), sy1 = Math.sin(y1), + d = interpolate.d = Math.acos(Math.max(-1, Math.min(1, sy0 * sy1 + cy0 * cy1 * Math.cos(x1 - x0)))), + sd = Math.sin(d); + + // From http://williams.best.vwh.net/avform.htm#Intermediate + function interpolate(t) { + var A = Math.sin(d - (t *= d)) / sd, + B = Math.sin(t) / sd, + x = A * cy0 * cx0 + B * cy1 * cx1, + y = A * cy0 * sx0 + B * cy1 * sx1, + z = A * sy0 + B * sy1; + return [ + Math.atan2(y, x) / d3_geo_radians, + Math.atan2(z, Math.sqrt(x * x + y * y)) / d3_geo_radians + ]; + } + + return interpolate; +} +d3.geo.greatCircle = d3.geo.circle; +})(); diff --git a/gstudio/static/gstudio/js/d3.geo.min.js b/gstudio/static/gstudio/js/d3.geo.min.js new file mode 100644 index 0000000..a4fcd24 --- /dev/null +++ b/gstudio/static/gstudio/js/d3.geo.min.js @@ -0,0 +1 @@ +(function(){function b(a,b){return function(c){return c&&c.type in a?a[c.type](c):b}}function c(a){return"m0,"+a+"a"+a+","+a+" 0 1,1 0,"+ -2*a+"a"+a+","+a+" 0 1,1 0,"+2*a+"z"}function d(a,b){a.type in e&&e[a.type](a,b)}function f(a,b){d(a.geometry,b)}function g(a,b){for(var c=a.features,e=0,f=c.length;e<f;e++)d(c[e].geometry,b)}function h(a,b){for(var c=a.geometries,e=0,f=c.length;e<f;e++)d(c[e],b)}function i(a,b){for(var c=a.coordinates,d=0,e=c.length;d<e;d++)b.apply(null,c[d])}function j(a,b){for(var c=a.coordinates,d=0,e=c.length;d<e;d++)for(var f=c[d],g=0,h=f.length;g<h;g++)b.apply(null,f[g])}function k(a,b){for(var c=a.coordinates,d=0,e=c.length;d<e;d++)for(var f=c[d][0],g=0,h=f.length;g<h;g++)b.apply(null,f[g])}function l(a,b){b.apply(null,a.coordinates)}function m(a,b){for(var c=a.coordinates[0],d=0,e=c.length;d<e;d++)b.apply(null,c[d])}function n(a){return a.source}function o(a){return a.target}function p(b,c){function r(b){var c=Math.sin(p-(b*=p))/q,d=Math.sin(b)/q,g=c*h*e+d*n*k,j=c*h*f+d*n*l,m=c*i+d*o;return[Math.atan2(j,g)/a,Math.atan2(m,Math.sqrt(g*g+j*j))/a]}var d=b[0]*a,e=Math.cos(d),f=Math.sin(d),g=b[1]*a,h=Math.cos(g),i=Math.sin(g),j=c[0]*a,k=Math.cos(j),l=Math.sin(j),m=c[1]*a,n=Math.cos(m),o=Math.sin(m),p=r.d=Math.acos(Math.max(-1,Math.min(1,i*o+h*n*Math.cos(j-d)))),q=Math.sin(p);return r}d3.geo={};var a=Math.PI/180;d3.geo.azimuthal=function(){function j(c){var g=c[0]*a-f,j=c[1]*a,k=Math.cos(g),l=Math.sin(g),m=Math.cos(j),n=Math.sin(j),o=b!=="orthographic"?i*n+h*m*k:null,p,q=b==="stereographic"?1/(1+o):b==="gnomonic"?1/o:b==="equidistant"?(p=Math.acos(o),p?p/Math.sin(p):0):b==="equalarea"?Math.sqrt(2/(1+o)):1,r=q*m*l,s=q*(i*m*k-h*n);return[d*r+e[0],d*s+e[1]]}var b="orthographic",c,d=200,e=[480,250],f,g,h,i;return j.invert=function(c){var g=(c[0]-e[0])/d,j=(c[1]-e[1])/d,k=Math.sqrt(g*g+j*j),l=b==="stereographic"?2*Math.atan(k):b==="gnomonic"?Math.atan(k):b==="equidistant"?k:b==="equalarea"?2*Math.asin(.5*k):Math.asin(k),m=Math.sin(l),n=Math.cos(l);return[(f+Math.atan2(g*m,k*h*n+j*i*m))/a,Math.asin(n*i-(k?j*m*h/k:0))/a]},j.mode=function(a){return arguments.length?(b=a+"",j):b},j.origin=function(b){return arguments.length?(c=b,f=c[0]*a,g=c[1]*a,h=Math.cos(g),i=Math.sin(g),j):c},j.scale=function(a){return arguments.length?(d=+a,j):d},j.translate=function(a){return arguments.length?(e=[+a[0],+a[1]],j):e},j.origin([0,0])},d3.geo.albers=function(){function j(b){var c=g*(a*b[0]-f),j=Math.sqrt(h-2*g*Math.sin(a*b[1]))/g;return[d*j*Math.sin(c)+e[0],d*(j*Math.cos(c)-i)+e[1]]}function k(){var d=a*c[0],e=a*c[1],k=a*b[1],l=Math.sin(d),m=Math.cos(d);return f=a*b[0],g=.5*(l+Math.sin(e)),h=m*m+2*g*l,i=Math.sqrt(h-2*g*Math.sin(k))/g,j}var b=[-98,38],c=[29.5,45.5],d=1e3,e=[480,250],f,g,h,i;return j.invert=function(b){var c=(b[0]-e[0])/d,j=(b[1]-e[1])/d,k=i+j,l=Math.atan2(c,k),m=Math.sqrt(c*c+k*k);return[(f+l/g)/a,Math.asin((h-m*m*g*g)/(2*g))/a]},j.origin=function(a){return arguments.length?(b=[+a[0],+a[1]],k()):b},j.parallels=function(a){return arguments.length?(c=[+a[0],+a[1]],k()):c},j.scale=function(a){return arguments.length?(d=+a,j):d},j.translate=function(a){return arguments.length?(e=[+a[0],+a[1]],j):e},k()},d3.geo.albersUsa=function(){function e(e){var f=e[0],g=e[1];return(g>50?b:f<-140?c:g<21?d:a)(e)}var a=d3.geo.albers(),b=d3.geo.albers().origin([-160,60]).parallels([55,65]),c=d3.geo.albers().origin([-160,20]).parallels([8,18]),d=d3.geo.albers().origin([-60,10]).parallels([8,18]);return e.scale=function(f){return arguments.length?(a.scale(f),b.scale(f*.6),c.scale(f),d.scale(f*1.5),e.translate(a.translate())):a.scale()},e.translate=function(f){if(!arguments.length)return a.translate();var g=a.scale()/1e3,h=f[0],i=f[1];return a.translate(f),b.translate([h-400*g,i+170*g]),c.translate([h-190*g,i+200*g]),d.translate([h+580*g,i+430*g]),e},e.scale(a.scale())},d3.geo.bonne=function(){function h(h){var i=h[0]*a-d,j=h[1]*a-e;if(f){var k=g+f-j,l=i*Math.cos(j)/k;i=k*Math.sin(l),j=k*Math.cos(l)-g}else i*=Math.cos(j),j*=-1;return[b*i+c[0],b*j+c[1]]}var b=200,c=[480,250],d,e,f,g;return h.invert=function(e){var h=(e[0]-c[0])/b,i=(e[1]-c[1])/b;if(f){var j=g+i,k=Math.sqrt(h*h+j*j);i=g+f-k,h=d+k*Math.atan2(h,j)/Math.cos(i)}else i*=-1,h/=Math.cos(i);return[h/a,i/a]},h.parallel=function(b){return arguments.length?(g=1/Math.tan(f=b*a),h):f/a},h.origin=function(b){return arguments.length?(d=b[0]*a,e=b[1]*a,h):[d/a,e/a]},h.scale=function(a){return arguments.length?(b=+a,h):b},h.translate=function(a){return arguments.length?(c=[+a[0],+a[1]],h):c},h.origin([0,0]).parallel(45)},d3.geo.equirectangular=function(){function c(c){var d=c[0]/360,e=-c[1]/360;return[a*d+b[0],a*e+b[1]]}var a=500,b=[480,250];return c.invert=function(c){var d=(c[0]-b[0])/a,e=(c[1]-b[1])/a;return[360*d,-360*e]},c.scale=function(b){return arguments.length?(a=+b,c):a},c.translate=function(a){return arguments.length?(b=[+a[0],+a[1]],c):b},c},d3.geo.mercator=function(){function d(d){var e=d[0]/360,f=-(Math.log(Math.tan(Math.PI/4+d[1]*a/2))/a)/360;return[b*e+c[0],b*Math.max(-0.5,Math.min(.5,f))+c[1]]}var b=500,c=[480,250];return d.invert=function(d){var e=(d[0]-c[0])/b,f=(d[1]-c[1])/b;return[360*e,2*Math.atan(Math.exp(-360*f*a))/a-90]},d.scale=function(a){return arguments.length?(b=+a,d):b},d.translate=function(a){return arguments.length?(c=[+a[0],+a[1]],d):c},d},d3.geo.path=function(){function f(b,e){return typeof a=="function"&&(d=c(a.apply(this,arguments))),h(b)||null}function g(a){return e(a).join(",")}function j(a){var b=m(a[0]),c=0,d=a.length;while(++c<d)b-=m(a[c]);return b}function k(a){var b=d3.geom.polygon(a[0].map(e)),c=b.area(),d=b.centroid(c<0?(c*=-1,1):-1),f=d[0],g=d[1],h=c,i=0,j=a.length;while(++i<j)b=d3.geom.polygon(a[i].map(e)),c=b.area(),d=b.centroid(c<0?(c*=-1,1):-1),f-=d[0],g-=d[1],h-=c;return[f,g,6*h]}function m(a){return Math.abs(d3.geom.polygon(a.map(e)).area())}var a=4.5,d=c(a),e=d3.geo.albersUsa(),h=b({FeatureCollection:function(a){var b=[],c=a.features,d=-1,e=c.length;while(++d<e)b.push(h(c[d].geometry));return b.join("")},Feature:function(a){return h(a.geometry)},Point:function(a){return"M"+g(a.coordinates)+d},MultiPoint:function(a){var b=[],c=a.coordinates,e=-1,f=c.length;while(++e<f)b.push("M",g(c[e]),d);return b.join("")},LineString:function(a){var b=["M"],c=a.coordinates,d=-1,e=c.length;while(++d<e)b.push(g(c[d]),"L");return b.pop(),b.join("")},MultiLineString:function(a){var b=[],c=a.coordinates,d=-1,e=c.length,f,h,i;while(++d<e){f=c[d],h=-1,i=f.length,b.push("M");while(++h<i)b.push(g(f[h]),"L");b.pop()}return b.join("")},Polygon:function(a){var b=[],c=a.coordinates,d=-1,e=c.length,f,h,i;while(++d<e){f=c[d],h=-1;if((i=f.length-1)>0){b.push("M");while(++h<i)b.push(g(f[h]),"L");b[b.length-1]="Z"}}return b.join("")},MultiPolygon:function(a){var b=[],c=a.coordinates,d=-1,e=c.length,f,h,i,j,k,l;while(++d<e){f=c[d],h=-1,i=f.length;while(++h<i){j=f[h],k=-1;if((l=j.length-1)>0){b.push("M");while(++k<l)b.push(g(j[k]),"L");b[b.length-1]="Z"}}}return b.join("")},GeometryCollection:function(a){var b=[],c=a.geometries,d=-1,e=c.length;while(++d<e)b.push(h(c[d]));return b.join("")}}),i=f.area=b({FeatureCollection:function(a){var b=0,c=a.features,d=-1,e=c.length;while(++d<e)b+=i(c[d]);return b},Feature:function(a){return i(a.geometry)},Polygon:function(a){return j(a.coordinates)},MultiPolygon:function(a){var b=0,c=a.coordinates,d=-1,e=c.length;while(++d<e)b+=j(c[d]);return b},GeometryCollection:function(a){var b=0,c=a.geometries,d=-1,e=c.length;while(++d<e)b+=i(c[d]);return b}},0),l=f.centroid=b({Feature:function(a){return l(a.geometry)},Polygon:function(a){var b=k(a.coordinates);return[b[0]/b[2],b[1]/b[2]]},MultiPolygon:function(a){var b=0,c=a.coordinates,d,e=0,f=0,g=0,h=-1,i=c.length;while(++h<i)d=k(c[h]),e+=d[0],f+=d[1],g+=d[2];return[e/g,f/g]}});return f.projection=function(a){return e=a,f},f.pointRadius=function(b){return typeof b=="function"?a=b:(a=+b,d=c(a)),f},f},d3.geo.bounds=function(a){var b=Infinity,c=Infinity,e=-Infinity,f=-Infinity;return d(a,function(a,d){a<b&&(b=a),a>e&&(e=a),d<c&&(c=d),d>f&&(f=d)}),[[b,c],[e,f]]};var e={Feature:f,FeatureCollection:g,GeometryCollection:h,LineString:i,MultiLineString:j,MultiPoint:i,MultiPolygon:k,Point:l,Polygon:m};d3.geo.circle=function(){function g(){}function h(a){return f.distance(a)<e}function j(a){var b=-1,c=a.length,d=[],g,h,i,j,l;while(++b<c)l=f.distance(i=a[b]),l<e?(h&&d.push(p(h,i)((j-e)/(j-l))),d.push(i),g=h=null):(h=i,!g&&d.length&&(d.push(p(d[d.length-1],h)((e-j)/(l-j))),g=h)),j=l;return h&&d.length&&(l=f.distance(i=d[0]),d.push(p(h,i)((j-e)/(j-l)))),k(d)}function k(a){var b=0,c=a.length,d,e,g=c?[a[0]]:a,h,i=f.source();while(++b<c){h=f.source(a[b-1])(a[b]).coordinates;for(d=0,e=h.length;++d<e;)g.push(h[d])}return f.source(i),g}var c=[0,0],d=89.99,e=d*a,f=d3.geo.greatArc().target(Object);g.clip=function(a){return f.source(typeof c=="function"?c.apply(this,arguments):c),i(a)};var i=b({FeatureCollection:function(a){var b=a.features.map(i).filter(Object);return b&&(a=Object.create(a),a.features=b,a)},Feature:function(a){var b=i(a.geometry);return b&&(a=Object.create(a),a.geometry=b,a)},Point:function(a){return h(a.coordinates)&&a},MultiPoint:function(a){var b=a.coordinates.filter(h);return b.length&&{type:a.type,coordinates:b}},LineString:function(a){var b=j(a.coordinates);return b.length&&(a=Object.create(a),a.coordinates=b,a)},MultiLineString:function(a){var b=a.coordinates.map(j).filter(function(a){return a.length});return b.length&&(a=Object.create(a),a.coordinates=b,a)},Polygon:function(a){var b=a.coordinates.map(j);return b[0].length&&(a=Object.create(a),a.coordinates=b,a)},MultiPolygon:function(a){var b=a.coordinates.map(function(a){return a.map(j)}).filter(function(a){return a[0].length});return b.length&&(a=Object.create(a),a.coordinates=b,a)},GeometryCollection:function(a){var b=a.geometries.map(i).filter(Object);return b.length&&(a=Object.create(a),a.geometries=b,a)}});return g.origin=function(a){return arguments.length?(c=a,g):c},g.angle=function(b){return arguments.length?(e=(d=+b)*a,g):d},g.precision=function(a){return arguments.length?(f.precision(a),g):f.precision()},g},d3.geo.greatArc=function(){function e(){var a=typeof b=="function"?b.apply(this,arguments):b,e=typeof c=="function"?c.apply(this,arguments):c,f=p(a,e),g=d/f.d,h=0,i=[a];while((h+=g)<1)i.push(f(h));return i.push(e),{type:"LineString",coordinates:i}}var b=n,c=o,d=6*a;return e.distance=function(){var a=typeof b=="function"?b.apply(this,arguments):b,d=typeof c=="function"?c.apply(this,arguments):c;return p(a,d).d},e.source=function(a){return arguments.length?(b=a,e):b},e.target=function(a){return arguments.length?(c=a,e):c},e.precision=function(b){return arguments.length?(d=b*a,e):d/a},e},d3.geo.greatCircle=d3.geo.circle})();
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/d3.geom.js b/gstudio/static/gstudio/js/d3.geom.js new file mode 100644 index 0000000..d860c2b --- /dev/null +++ b/gstudio/static/gstudio/js/d3.geom.js @@ -0,0 +1,835 @@ +(function(){d3.geom = {}; +/** + * Computes a contour for a given input grid function using the <a + * href="http://en.wikipedia.org/wiki/Marching_squares">marching + * squares</a> algorithm. Returns the contour polygon as an array of points. + * + * @param grid a two-input function(x, y) that returns true for values + * inside the contour and false for values outside the contour. + * @param start an optional starting point [x, y] on the grid. + * @returns polygon [[x1, y1], [x2, y2], …] + */ +d3.geom.contour = function(grid, start) { + var s = start || d3_geom_contourStart(grid), // starting point + c = [], // contour polygon + x = s[0], // current x position + y = s[1], // current y position + dx = 0, // next x direction + dy = 0, // next y direction + pdx = NaN, // previous x direction + pdy = NaN, // previous y direction + i = 0; + + do { + // determine marching squares index + i = 0; + if (grid(x-1, y-1)) i += 1; + if (grid(x, y-1)) i += 2; + if (grid(x-1, y )) i += 4; + if (grid(x, y )) i += 8; + + // determine next direction + if (i === 6) { + dx = pdy === -1 ? -1 : 1; + dy = 0; + } else if (i === 9) { + dx = 0; + dy = pdx === 1 ? -1 : 1; + } else { + dx = d3_geom_contourDx[i]; + dy = d3_geom_contourDy[i]; + } + + // update contour polygon + if (dx != pdx && dy != pdy) { + c.push([x, y]); + pdx = dx; + pdy = dy; + } + + x += dx; + y += dy; + } while (s[0] != x || s[1] != y); + + return c; +}; + +// lookup tables for marching directions +var d3_geom_contourDx = [1, 0, 1, 1,-1, 0,-1, 1,0, 0,0,0,-1, 0,-1,NaN], + d3_geom_contourDy = [0,-1, 0, 0, 0,-1, 0, 0,1,-1,1,1, 0,-1, 0,NaN]; + +function d3_geom_contourStart(grid) { + var x = 0, + y = 0; + + // search for a starting point; begin at origin + // and proceed along outward-expanding diagonals + while (true) { + if (grid(x,y)) { + return [x,y]; + } + if (x === 0) { + x = y + 1; + y = 0; + } else { + x = x - 1; + y = y + 1; + } + } +} +/** + * Computes the 2D convex hull of a set of points using Graham's scanning + * algorithm. The algorithm has been implemented as described in Cormen, + * Leiserson, and Rivest's Introduction to Algorithms. The running time of + * this algorithm is O(n log n), where n is the number of input points. + * + * @param vertices [[x1, y1], [x2, y2], …] + * @returns polygon [[x1, y1], [x2, y2], …] + */ +d3.geom.hull = function(vertices) { + if (vertices.length < 3) return []; + + var len = vertices.length, + plen = len - 1, + points = [], + stack = [], + i, j, h = 0, x1, y1, x2, y2, u, v, a, sp; + + // find the starting ref point: leftmost point with the minimum y coord + for (i=1; i<len; ++i) { + if (vertices[i][1] < vertices[h][1]) { + h = i; + } else if (vertices[i][1] == vertices[h][1]) { + h = (vertices[i][0] < vertices[h][0] ? i : h); + } + } + + // calculate polar angles from ref point and sort + for (i=0; i<len; ++i) { + if (i === h) continue; + y1 = vertices[i][1] - vertices[h][1]; + x1 = vertices[i][0] - vertices[h][0]; + points.push({angle: Math.atan2(y1, x1), index: i}); + } + points.sort(function(a, b) { return a.angle - b.angle; }); + + // toss out duplicate angles + a = points[0].angle; + v = points[0].index; + u = 0; + for (i=1; i<plen; ++i) { + j = points[i].index; + if (a == points[i].angle) { + // keep angle for point most distant from the reference + x1 = vertices[v][0] - vertices[h][0]; + y1 = vertices[v][1] - vertices[h][1]; + x2 = vertices[j][0] - vertices[h][0]; + y2 = vertices[j][1] - vertices[h][1]; + if ((x1*x1 + y1*y1) >= (x2*x2 + y2*y2)) { + points[i].index = -1; + } else { + points[u].index = -1; + a = points[i].angle; + u = i; + v = j; + } + } else { + a = points[i].angle; + u = i; + v = j; + } + } + + // initialize the stack + stack.push(h); + for (i=0, j=0; i<2; ++j) { + if (points[j].index !== -1) { + stack.push(points[j].index); + i++; + } + } + sp = stack.length; + + // do graham's scan + for (; j<plen; ++j) { + if (points[j].index === -1) continue; // skip tossed out points + while (!d3_geom_hullCCW(stack[sp-2], stack[sp-1], points[j].index, vertices)) { + --sp; + } + stack[sp++] = points[j].index; + } + + // construct the hull + var poly = []; + for (i=0; i<sp; ++i) { + poly.push(vertices[stack[i]]); + } + return poly; +} + +// are three points in counter-clockwise order? +function d3_geom_hullCCW(i1, i2, i3, v) { + var t, a, b, c, d, e, f; + t = v[i1]; a = t[0]; b = t[1]; + t = v[i2]; c = t[0]; d = t[1]; + t = v[i3]; e = t[0]; f = t[1]; + return ((f-b)*(c-a) - (d-b)*(e-a)) > 0; +} +// Note: requires coordinates to be counterclockwise and convex! +d3.geom.polygon = function(coordinates) { + + coordinates.area = function() { + var i = 0, + n = coordinates.length, + a = coordinates[n - 1][0] * coordinates[0][1], + b = coordinates[n - 1][1] * coordinates[0][0]; + while (++i < n) { + a += coordinates[i - 1][0] * coordinates[i][1]; + b += coordinates[i - 1][1] * coordinates[i][0]; + } + return (b - a) * .5; + }; + + coordinates.centroid = function(k) { + var i = -1, + n = coordinates.length - 1, + x = 0, + y = 0, + a, + b, + c; + if (!arguments.length) k = -1 / (6 * coordinates.area()); + while (++i < n) { + a = coordinates[i]; + b = coordinates[i + 1]; + c = a[0] * b[1] - b[0] * a[1]; + x += (a[0] + b[0]) * c; + y += (a[1] + b[1]) * c; + } + return [x * k, y * k]; + }; + + // The Sutherland-Hodgman clipping algorithm. + coordinates.clip = function(subject) { + var input, + i = -1, + n = coordinates.length, + j, + m, + a = coordinates[n - 1], + b, + c, + d; + while (++i < n) { + input = subject.slice(); + subject.length = 0; + b = coordinates[i]; + c = input[(m = input.length) - 1]; + j = -1; + while (++j < m) { + d = input[j]; + if (d3_geom_polygonInside(d, a, b)) { + if (!d3_geom_polygonInside(c, a, b)) { + subject.push(d3_geom_polygonIntersect(c, d, a, b)); + } + subject.push(d); + } else if (d3_geom_polygonInside(c, a, b)) { + subject.push(d3_geom_polygonIntersect(c, d, a, b)); + } + c = d; + } + a = b; + } + return subject; + }; + + return coordinates; +}; + +function d3_geom_polygonInside(p, a, b) { + return (b[0] - a[0]) * (p[1] - a[1]) < (b[1] - a[1]) * (p[0] - a[0]); +} + +// Intersect two infinite lines cd and ab. +function d3_geom_polygonIntersect(c, d, a, b) { + var x1 = c[0], x2 = d[0], x3 = a[0], x4 = b[0], + y1 = c[1], y2 = d[1], y3 = a[1], y4 = b[1], + x13 = x1 - x3, + x21 = x2 - x1, + x43 = x4 - x3, + y13 = y1 - y3, + y21 = y2 - y1, + y43 = y4 - y3, + ua = (x43 * y13 - y43 * x13) / (y43 * x21 - x43 * y21); + return [x1 + ua * x21, y1 + ua * y21]; +} +// Adapted from Nicolas Garcia Belmonte's JIT implementation: +// http://blog.thejit.org/2010/02/12/voronoi-tessellation/ +// http://blog.thejit.org/assets/voronoijs/voronoi.js +// See lib/jit/LICENSE for details. + +// Notes: +// +// This implementation does not clip the returned polygons, so if you want to +// clip them to a particular shape you will need to do that either in SVG or by +// post-processing with d3.geom.polygon's clip method. +// +// If any vertices are coincident or have NaN positions, the behavior of this +// method is undefined. Most likely invalid polygons will be returned. You +// should filter invalid points, and consolidate coincident points, before +// computing the tessellation. + +/** + * @param vertices [[x1, y1], [x2, y2], …] + * @returns polygons [[[x1, y1], [x2, y2], …], …] + */ +d3.geom.voronoi = function(vertices) { + var polygons = vertices.map(function() { return []; }); + + d3_voronoi_tessellate(vertices, function(e) { + var s1, + s2, + x1, + x2, + y1, + y2; + if (e.a === 1 && e.b >= 0) { + s1 = e.ep.r; + s2 = e.ep.l; + } else { + s1 = e.ep.l; + s2 = e.ep.r; + } + if (e.a === 1) { + y1 = s1 ? s1.y : -1e6; + x1 = e.c - e.b * y1; + y2 = s2 ? s2.y : 1e6; + x2 = e.c - e.b * y2; + } else { + x1 = s1 ? s1.x : -1e6; + y1 = e.c - e.a * x1; + x2 = s2 ? s2.x : 1e6; + y2 = e.c - e.a * x2; + } + var v1 = [x1, y1], + v2 = [x2, y2]; + polygons[e.region.l.index].push(v1, v2); + polygons[e.region.r.index].push(v1, v2); + }); + + // Reconnect the polygon segments into counterclockwise loops. + return polygons.map(function(polygon, i) { + var cx = vertices[i][0], + cy = vertices[i][1]; + polygon.forEach(function(v) { + v.angle = Math.atan2(v[0] - cx, v[1] - cy); + }); + return polygon.sort(function(a, b) { + return a.angle - b.angle; + }).filter(function(d, i) { + return !i || (d.angle - polygon[i - 1].angle > 1e-10); + }); + }); +}; + +var d3_voronoi_opposite = {"l": "r", "r": "l"}; + +function d3_voronoi_tessellate(vertices, callback) { + + var Sites = { + list: vertices + .map(function(v, i) { + return { + index: i, + x: v[0], + y: v[1] + }; + }) + .sort(function(a, b) { + return a.y < b.y ? -1 + : a.y > b.y ? 1 + : a.x < b.x ? -1 + : a.x > b.x ? 1 + : 0; + }), + bottomSite: null + }; + + var EdgeList = { + list: [], + leftEnd: null, + rightEnd: null, + + init: function() { + EdgeList.leftEnd = EdgeList.createHalfEdge(null, "l"); + EdgeList.rightEnd = EdgeList.createHalfEdge(null, "l"); + EdgeList.leftEnd.r = EdgeList.rightEnd; + EdgeList.rightEnd.l = EdgeList.leftEnd; + EdgeList.list.unshift(EdgeList.leftEnd, EdgeList.rightEnd); + }, + + createHalfEdge: function(edge, side) { + return { + edge: edge, + side: side, + vertex: null, + "l": null, + "r": null + }; + }, + + insert: function(lb, he) { + he.l = lb; + he.r = lb.r; + lb.r.l = he; + lb.r = he; + }, + + leftBound: function(p) { + var he = EdgeList.leftEnd; + do { + he = he.r; + } while (he != EdgeList.rightEnd && Geom.rightOf(he, p)); + he = he.l; + return he; + }, + + del: function(he) { + he.l.r = he.r; + he.r.l = he.l; + he.edge = null; + }, + + right: function(he) { + return he.r; + }, + + left: function(he) { + return he.l; + }, + + leftRegion: function(he) { + return he.edge == null + ? Sites.bottomSite + : he.edge.region[he.side]; + }, + + rightRegion: function(he) { + return he.edge == null + ? Sites.bottomSite + : he.edge.region[d3_voronoi_opposite[he.side]]; + } + }; + + var Geom = { + + bisect: function(s1, s2) { + var newEdge = { + region: {"l": s1, "r": s2}, + ep: {"l": null, "r": null} + }; + + var dx = s2.x - s1.x, + dy = s2.y - s1.y, + adx = dx > 0 ? dx : -dx, + ady = dy > 0 ? dy : -dy; + + newEdge.c = s1.x * dx + s1.y * dy + + (dx * dx + dy * dy) * .5; + + if (adx > ady) { + newEdge.a = 1; + newEdge.b = dy / dx; + newEdge.c /= dx; + } else { + newEdge.b = 1; + newEdge.a = dx / dy; + newEdge.c /= dy; + } + + return newEdge; + }, + + intersect: function(el1, el2) { + var e1 = el1.edge, + e2 = el2.edge; + if (!e1 || !e2 || (e1.region.r == e2.region.r)) { + return null; + } + var d = (e1.a * e2.b) - (e1.b * e2.a); + if (Math.abs(d) < 1e-10) { + return null; + } + var xint = (e1.c * e2.b - e2.c * e1.b) / d, + yint = (e2.c * e1.a - e1.c * e2.a) / d, + e1r = e1.region.r, + e2r = e2.region.r, + el, + e; + if ((e1r.y < e2r.y) || + (e1r.y == e2r.y && e1r.x < e2r.x)) { + el = el1; + e = e1; + } else { + el = el2; + e = e2; + } + var rightOfSite = (xint >= e.region.r.x); + if ((rightOfSite && (el.side === "l")) || + (!rightOfSite && (el.side === "r"))) { + return null; + } + return { + x: xint, + y: yint + }; + }, + + rightOf: function(he, p) { + var e = he.edge, + topsite = e.region.r, + rightOfSite = (p.x > topsite.x); + + if (rightOfSite && (he.side === "l")) { + return 1; + } + if (!rightOfSite && (he.side === "r")) { + return 0; + } + if (e.a === 1) { + var dyp = p.y - topsite.y, + dxp = p.x - topsite.x, + fast = 0, + above = 0; + + if ((!rightOfSite && (e.b < 0)) || + (rightOfSite && (e.b >= 0))) { + above = fast = (dyp >= e.b * dxp); + } else { + above = ((p.x + p.y * e.b) > e.c); + if (e.b < 0) { + above = !above; + } + if (!above) { + fast = 1; + } + } + if (!fast) { + var dxs = topsite.x - e.region.l.x; + above = (e.b * (dxp * dxp - dyp * dyp)) < + (dxs * dyp * (1 + 2 * dxp / dxs + e.b * e.b)); + + if (e.b < 0) { + above = !above; + } + } + } else /* e.b == 1 */ { + var yl = e.c - e.a * p.x, + t1 = p.y - yl, + t2 = p.x - topsite.x, + t3 = yl - topsite.y; + + above = (t1 * t1) > (t2 * t2 + t3 * t3); + } + return he.side === "l" ? above : !above; + }, + + endPoint: function(edge, side, site) { + edge.ep[side] = site; + if (!edge.ep[d3_voronoi_opposite[side]]) return; + callback(edge); + }, + + distance: function(s, t) { + var dx = s.x - t.x, + dy = s.y - t.y; + return Math.sqrt(dx * dx + dy * dy); + } + }; + + var EventQueue = { + list: [], + + insert: function(he, site, offset) { + he.vertex = site; + he.ystar = site.y + offset; + for (var i=0, list=EventQueue.list, l=list.length; i<l; i++) { + var next = list[i]; + if (he.ystar > next.ystar || + (he.ystar == next.ystar && + site.x > next.vertex.x)) { + continue; + } else { + break; + } + } + list.splice(i, 0, he); + }, + + del: function(he) { + for (var i=0, ls=EventQueue.list, l=ls.length; i<l && (ls[i] != he); ++i) {} + ls.splice(i, 1); + }, + + empty: function() { return EventQueue.list.length === 0; }, + + nextEvent: function(he) { + for (var i=0, ls=EventQueue.list, l=ls.length; i<l; ++i) { + if (ls[i] == he) return ls[i+1]; + } + return null; + }, + + min: function() { + var elem = EventQueue.list[0]; + return { + x: elem.vertex.x, + y: elem.ystar + }; + }, + + extractMin: function() { + return EventQueue.list.shift(); + } + }; + + EdgeList.init(); + Sites.bottomSite = Sites.list.shift(); + + var newSite = Sites.list.shift(), newIntStar; + var lbnd, rbnd, llbnd, rrbnd, bisector; + var bot, top, temp, p, v; + var e, pm; + + while (true) { + if (!EventQueue.empty()) { + newIntStar = EventQueue.min(); + } + if (newSite && (EventQueue.empty() + || newSite.y < newIntStar.y + || (newSite.y == newIntStar.y + && newSite.x < newIntStar.x))) { //new site is smallest + lbnd = EdgeList.leftBound(newSite); + rbnd = EdgeList.right(lbnd); + bot = EdgeList.rightRegion(lbnd); + e = Geom.bisect(bot, newSite); + bisector = EdgeList.createHalfEdge(e, "l"); + EdgeList.insert(lbnd, bisector); + p = Geom.intersect(lbnd, bisector); + if (p) { + EventQueue.del(lbnd); + EventQueue.insert(lbnd, p, Geom.distance(p, newSite)); + } + lbnd = bisector; + bisector = EdgeList.createHalfEdge(e, "r"); + EdgeList.insert(lbnd, bisector); + p = Geom.intersect(bisector, rbnd); + if (p) { + EventQueue.insert(bisector, p, Geom.distance(p, newSite)); + } + newSite = Sites.list.shift(); + } else if (!EventQueue.empty()) { //intersection is smallest + lbnd = EventQueue.extractMin(); + llbnd = EdgeList.left(lbnd); + rbnd = EdgeList.right(lbnd); + rrbnd = EdgeList.right(rbnd); + bot = EdgeList.leftRegion(lbnd); + top = EdgeList.rightRegion(rbnd); + v = lbnd.vertex; + Geom.endPoint(lbnd.edge, lbnd.side, v); + Geom.endPoint(rbnd.edge, rbnd.side, v); + EdgeList.del(lbnd); + EventQueue.del(rbnd); + EdgeList.del(rbnd); + pm = "l"; + if (bot.y > top.y) { + temp = bot; + bot = top; + top = temp; + pm = "r"; + } + e = Geom.bisect(bot, top); + bisector = EdgeList.createHalfEdge(e, pm); + EdgeList.insert(llbnd, bisector); + Geom.endPoint(e, d3_voronoi_opposite[pm], v); + p = Geom.intersect(llbnd, bisector); + if (p) { + EventQueue.del(llbnd); + EventQueue.insert(llbnd, p, Geom.distance(p, bot)); + } + p = Geom.intersect(bisector, rrbnd); + if (p) { + EventQueue.insert(bisector, p, Geom.distance(p, bot)); + } + } else { + break; + } + }//end while + + for (lbnd = EdgeList.right(EdgeList.leftEnd); + lbnd != EdgeList.rightEnd; + lbnd = EdgeList.right(lbnd)) { + callback(lbnd.edge); + } +} +/** +* @param vertices [[x1, y1], [x2, y2], …] +* @returns triangles [[[x1, y1], [x2, y2], [x3, y3]], …] + */ +d3.geom.delaunay = function(vertices) { + var edges = vertices.map(function() { return []; }), + triangles = []; + + // Use the Voronoi tessellation to determine Delaunay edges. + d3_voronoi_tessellate(vertices, function(e) { + edges[e.region.l.index].push(vertices[e.region.r.index]); + }); + + // Reconnect the edges into counterclockwise triangles. + edges.forEach(function(edge, i) { + var v = vertices[i], + cx = v[0], + cy = v[1]; + edge.forEach(function(v) { + v.angle = Math.atan2(v[0] - cx, v[1] - cy); + }); + edge.sort(function(a, b) { + return a.angle - b.angle; + }); + for (var j = 0, m = edge.length - 1; j < m; j++) { + triangles.push([v, edge[j], edge[j + 1]]); + } + }); + + return triangles; +}; +// Constructs a new quadtree for the specified array of points. A quadtree is a +// two-dimensional recursive spatial subdivision. This implementation uses +// square partitions, dividing each square into four equally-sized squares. Each +// point exists in a unique node; if multiple points are in the same position, +// some points may be stored on internal nodes rather than leaf nodes. Quadtrees +// can be used to accelerate various spatial operations, such as the Barnes-Hut +// approximation for computing n-body forces, or collision detection. +d3.geom.quadtree = function(points, x1, y1, x2, y2) { + var p, + i = -1, + n = points.length; + + // Type conversion for deprecated API. + if (n && isNaN(points[0].x)) points = points.map(d3_geom_quadtreePoint); + + // Allow bounds to be specified explicitly. + if (arguments.length < 5) { + if (arguments.length === 3) { + y2 = x2 = y1; + y1 = x1; + } else { + x1 = y1 = Infinity; + x2 = y2 = -Infinity; + + // Compute bounds. + while (++i < n) { + p = points[i]; + if (p.x < x1) x1 = p.x; + if (p.y < y1) y1 = p.y; + if (p.x > x2) x2 = p.x; + if (p.y > y2) y2 = p.y; + } + + // Squarify the bounds. + var dx = x2 - x1, + dy = y2 - y1; + if (dx > dy) y2 = y1 + dx; + else x2 = x1 + dy; + } + } + + // Recursively inserts the specified point p at the node n or one of its + // descendants. The bounds are defined by [x1, x2] and [y1, y2]. + function insert(n, p, x1, y1, x2, y2) { + if (isNaN(p.x) || isNaN(p.y)) return; // ignore invalid points + if (n.leaf) { + var v = n.point; + if (v) { + // If the point at this leaf node is at the same position as the new + // point we are adding, we leave the point associated with the + // internal node while adding the new point to a child node. This + // avoids infinite recursion. + if ((Math.abs(v.x - p.x) + Math.abs(v.y - p.y)) < .01) { + insertChild(n, p, x1, y1, x2, y2); + } else { + n.point = null; + insertChild(n, v, x1, y1, x2, y2); + insertChild(n, p, x1, y1, x2, y2); + } + } else { + n.point = p; + } + } else { + insertChild(n, p, x1, y1, x2, y2); + } + } + + // Recursively inserts the specified point p into a descendant of node n. The + // bounds are defined by [x1, x2] and [y1, y2]. + function insertChild(n, p, x1, y1, x2, y2) { + // Compute the split point, and the quadrant in which to insert p. + var sx = (x1 + x2) * .5, + sy = (y1 + y2) * .5, + right = p.x >= sx, + bottom = p.y >= sy, + i = (bottom << 1) + right; + + // Recursively insert into the child node. + n.leaf = false; + n = n.nodes[i] || (n.nodes[i] = d3_geom_quadtreeNode()); + + // Update the bounds as we recurse. + if (right) x1 = sx; else x2 = sx; + if (bottom) y1 = sy; else y2 = sy; + insert(n, p, x1, y1, x2, y2); + } + + // Create the root node. + var root = d3_geom_quadtreeNode(); + + root.add = function(p) { + insert(root, p, x1, y1, x2, y2); + }; + + root.visit = function(f) { + d3_geom_quadtreeVisit(f, root, x1, y1, x2, y2); + }; + + // Insert all points. + points.forEach(root.add); + return root; +}; + +function d3_geom_quadtreeNode() { + return { + leaf: true, + nodes: [], + point: null + }; +} + +function d3_geom_quadtreeVisit(f, node, x1, y1, x2, y2) { + if (!f(node, x1, y1, x2, y2)) { + var sx = (x1 + x2) * .5, + sy = (y1 + y2) * .5, + children = node.nodes; + if (children[0]) d3_geom_quadtreeVisit(f, children[0], x1, y1, sx, sy); + if (children[1]) d3_geom_quadtreeVisit(f, children[1], sx, y1, x2, sy); + if (children[2]) d3_geom_quadtreeVisit(f, children[2], x1, sy, sx, y2); + if (children[3]) d3_geom_quadtreeVisit(f, children[3], sx, sy, x2, y2); + } +} + +function d3_geom_quadtreePoint(p) { + return { + x: p[0], + y: p[1] + }; +} +})(); diff --git a/gstudio/static/gstudio/js/d3.geom.min.js b/gstudio/static/gstudio/js/d3.geom.min.js new file mode 100644 index 0000000..2dc6395 --- /dev/null +++ b/gstudio/static/gstudio/js/d3.geom.min.js @@ -0,0 +1 @@ +(function(){function c(a){var b=0,c=0;for(;;){if(a(b,c))return[b,c];b===0?(b=c+1,c=0):(b-=1,c+=1)}}function d(a,b,c,d){var e,f,g,h,i,j,k;return e=d[a],f=e[0],g=e[1],e=d[b],h=e[0],i=e[1],e=d[c],j=e[0],k=e[1],(k-g)*(h-f)-(i-g)*(j-f)>0}function e(a,b,c){return(c[0]-b[0])*(a[1]-b[1])<(c[1]-b[1])*(a[0]-b[0])}function f(a,b,c,d){var e=a[0],f=b[0],g=c[0],h=d[0],i=a[1],j=b[1],k=c[1],l=d[1],m=e-g,n=f-e,o=h-g,p=i-k,q=j-i,r=l-k,s=(o*p-r*m)/(r*n-o*q);return[e+s*n,i+s*q]}function h(a,b){var c={list:a.map(function(a,b){return{index:b,x:a[0],y:a[1]}}).sort(function(a,b){return a.y<b.y?-1:a.y>b.y?1:a.x<b.x?-1:a.x>b.x?1:0}),bottomSite:null},d={list:[],leftEnd:null,rightEnd:null,init:function(){d.leftEnd=d.createHalfEdge(null,"l"),d.rightEnd=d.createHalfEdge(null,"l"),d.leftEnd.r=d.rightEnd,d.rightEnd.l=d.leftEnd,d.list.unshift(d.leftEnd,d.rightEnd)},createHalfEdge:function(a,b){return{edge:a,side:b,vertex:null,l:null,r:null}},insert:function(a,b){b.l=a,b.r=a.r,a.r.l=b,a.r=b},leftBound:function(a){var b=d.leftEnd;do b=b.r;while(b!=d.rightEnd&&e.rightOf(b,a));return b=b.l,b},del:function(a){a.l.r=a.r,a.r.l=a.l,a.edge=null},right:function(a){return a.r},left:function(a){return a.l},leftRegion:function(a){return a.edge==null?c.bottomSite:a.edge.region[a.side]},rightRegion:function(a){return a.edge==null?c.bottomSite:a.edge.region[g[a.side]]}},e={bisect:function(a,b){var c={region:{l:a,r:b},ep:{l:null,r:null}},d=b.x-a.x,e=b.y-a.y,f=d>0?d:-d,g=e>0?e:-e;return c.c=a.x*d+a.y*e+(d*d+e*e)*.5,f>g?(c.a=1,c.b=e/d,c.c/=d):(c.b=1,c.a=d/e,c.c/=e),c},intersect:function(a,b){var c=a.edge,d=b.edge;if(!c||!d||c.region.r==d.region.r)return null;var e=c.a*d.b-c.b*d.a;if(Math.abs(e)<1e-10)return null;var f=(c.c*d.b-d.c*c.b)/e,g=(d.c*c.a-c.c*d.a)/e,h=c.region.r,i=d.region.r,j,k;h.y<i.y||h.y==i.y&&h.x<i.x?(j=a,k=c):(j=b,k=d);var l=f>=k.region.r.x;return l&&j.side==="l"||!l&&j.side==="r"?null:{x:f,y:g}},rightOf:function(a,b){var c=a.edge,d=c.region.r,e=b.x>d.x;if(e&&a.side==="l")return 1;if(!e&&a.side==="r")return 0;if(c.a===1){var f=b.y-d.y,g=b.x-d.x,h=0,i=0;!e&&c.b<0||e&&c.b>=0?i=h=f>=c.b*g:(i=b.x+b.y*c.b>c.c,c.b<0&&(i=!i),i||(h=1));if(!h){var j=d.x-c.region.l.x;i=c.b*(g*g-f*f)<j*f*(1+2*g/j+c.b*c.b),c.b<0&&(i=!i)}}else{var k=c.c-c.a*b.x,l=b.y-k,m=b.x-d.x,n=k-d.y;i=l*l>m*m+n*n}return a.side==="l"?i:!i},endPoint:function(a,c,d){a.ep[c]=d;if(!a.ep[g[c]])return;b(a)},distance:function(a,b){var c=a.x-b.x,d=a.y-b.y;return Math.sqrt(c*c+d*d)}},f={list:[],insert:function(a,b,c){a.vertex=b,a.ystar=b.y+c;for(var d=0,e=f.list,g=e.length;d<g;d++){var h=e[d];if(a.ystar>h.ystar||a.ystar==h.ystar&&b.x>h.vertex.x)continue;break}e.splice(d,0,a)},del:function(a){for(var b=0,c=f.list,d=c.length;b<d&&c[b]!=a;++b);c.splice(b,1)},empty:function(){return f.list.length===0},nextEvent:function(a){for(var b=0,c=f.list,d=c.length;b<d;++b)if(c[b]==a)return c[b+1];return null},min:function(){var a=f.list[0];return{x:a.vertex.x,y:a.ystar}},extractMin:function(){return f.list.shift()}};d.init(),c.bottomSite=c.list.shift();var h=c.list.shift(),i,j,k,l,m,n,o,p,q,r,s,t,u;for(;;){f.empty()||(i=f.min());if(h&&(f.empty()||h.y<i.y||h.y==i.y&&h.x<i.x))j=d.leftBound(h),k=d.right(j),o=d.rightRegion(j),t=e.bisect(o,h),n=d.createHalfEdge(t,"l"),d.insert(j,n),r=e.intersect(j,n),r&&(f.del(j),f.insert(j,r,e.distance(r,h))),j=n,n=d.createHalfEdge(t,"r"),d.insert(j,n),r=e.intersect(n,k),r&&f.insert(n,r,e.distance(r,h)),h=c.list.shift();else if(!f.empty())j=f.extractMin(),l=d.left(j),k=d.right(j),m=d.right(k),o=d.leftRegion(j),p=d.rightRegion(k),s=j.vertex,e.endPoint(j.edge,j.side,s),e.endPoint(k.edge,k.side,s),d.del(j),f.del(k),d.del(k),u="l",o.y>p.y&&(q=o,o=p,p=q,u="r"),t=e.bisect(o,p),n=d.createHalfEdge(t,u),d.insert(l,n),e.endPoint(t,g[u],s),r=e.intersect(l,n),r&&(f.del(l),f.insert(l,r,e.distance(r,o))),r=e.intersect(n,m),r&&f.insert(n,r,e.distance(r,o));else break}for(j=d.right(d.leftEnd);j!=d.rightEnd;j=d.right(j))b(j.edge)}function i(){return{leaf:!0,nodes:[],point:null}}function j(a,b,c,d,e,f){if(!a(b,c,d,e,f)){var g=(c+e)*.5,h=(d+f)*.5,i=b.nodes;i[0]&&j(a,i[0],c,d,g,h),i[1]&&j(a,i[1],g,d,e,h),i[2]&&j(a,i[2],c,h,g,f),i[3]&&j(a,i[3],g,h,e,f)}}function k(a){return{x:a[0],y:a[1]}}d3.geom={},d3.geom.contour=function(d,e){var f=e||c(d),g=[],h=f[0],i=f[1],j=0,k=0,l=NaN,m=NaN,n=0;do n=0,d(h-1,i-1)&&(n+=1),d(h,i-1)&&(n+=2),d(h-1,i)&&(n+=4),d(h,i)&&(n+=8),n===6?(j=m===-1?-1:1,k=0):n===9?(j=0,k=l===1?-1:1):(j=a[n],k=b[n]),j!=l&&k!=m&&(g.push([h,i]),l=j,m=k),h+=j,i+=k;while(f[0]!=h||f[1]!=i);return g};var a=[1,0,1,1,-1,0,-1,1,0,0,0,0,-1,0,-1,NaN],b=[0,-1,0,0,0,-1,0,0,1,-1,1,1,0,-1,0,NaN];d3.geom.hull=function(a){if(a.length<3)return[];var b=a.length,c=b-1,e=[],f=[],g,h,i=0,j,k,l,m,n,o,p,q;for(g=1;g<b;++g)a[g][1]<a[i][1]?i=g:a[g][1]==a[i][1]&&(i=a[g][0]<a[i][0]?g:i);for(g=0;g<b;++g){if(g===i)continue;k=a[g][1]-a[i][1],j=a[g][0]-a[i][0],e.push({angle:Math.atan2(k,j),index:g})}e.sort(function(a,b){return a.angle-b.angle}),p=e[0].angle,o=e[0].index,n=0;for(g=1;g<c;++g)h=e[g].index,p==e[g].angle?(j=a[o][0]-a[i][0],k=a[o][1]-a[i][1],l=a[h][0]-a[i][0],m=a[h][1]-a[i][1],j*j+k*k>=l*l+m*m?e[g].index=-1:(e[n].index=-1,p=e[g].angle,n=g,o=h)):(p=e[g].angle,n=g,o=h);f.push(i);for(g=0,h=0;g<2;++h)e[h].index!==-1&&(f.push(e[h].index),g++);q=f.length;for(;h<c;++h){if(e[h].index===-1)continue;while(!d(f[q-2],f[q-1],e[h].index,a))--q;f[q++]=e[h].index}var r=[];for(g=0;g<q;++g)r.push(a[f[g]]);return r},d3.geom.polygon=function(a){return a.area=function(){var b=0,c=a.length,d=a[c-1][0]*a[0][1],e=a[c-1][1]*a[0][0];while(++b<c)d+=a[b-1][0]*a[b][1],e+=a[b-1][1]*a[b][0];return(e-d)*.5},a.centroid=function(b){var c=-1,d=a.length-1,e=0,f=0,g,h,i;arguments.length||(b=-1/(6*a.area()));while(++c<d)g=a[c],h=a[c+1],i=g[0]*h[1]-h[0]*g[1],e+=(g[0]+h[0])*i,f+=(g[1]+h[1])*i;return[e*b,f*b]},a.clip=function(b){var c,d=-1,g=a.length,h,i,j=a[g-1],k,l,m;while(++d<g){c=b.slice(),b.length=0,k=a[d],l=c[(i=c.length)-1],h=-1;while(++h<i)m=c[h],e(m,j,k)?(e(l,j,k)||b.push(f(l,m,j,k)),b.push(m)):e(l,j,k)&&b.push(f(l,m,j,k)),l=m;j=k}return b},a},d3.geom.voronoi=function(a){var b=a.map(function(){return[]});return h(a,function(a){var c,d,e,f,g,h;a.a===1&&a.b>=0?(c=a.ep.r,d=a.ep.l):(c=a.ep.l,d=a.ep.r),a.a===1?(g=c?c.y:-1e6,e=a.c-a.b*g,h=d?d.y:1e6,f=a.c-a.b*h):(e=c?c.x:-1e6,g=a.c-a.a*e,f=d?d.x:1e6,h=a.c-a.a*f);var i=[e,g],j=[f,h];b[a.region.l.index].push(i,j),b[a.region.r.index].push(i,j)}),b.map(function(b,c){var d=a[c][0],e=a[c][1];return b.forEach(function(a){a.angle=Math.atan2(a[0]-d,a[1]-e)}),b.sort(function(a,b){return a.angle-b.angle}).filter(function(a,c){return!c||a.angle-b[c-1].angle>1e-10})})};var g={l:"r",r:"l"};d3.geom.delaunay=function(a){var b=a.map(function(){return[]}),c=[];return h(a,function(c){b[c.region.l.index].push(a[c.region.r.index])}),b.forEach(function(b,d){var e=a[d],f=e[0],g=e[1];b.forEach(function(a){a.angle=Math.atan2(a[0]-f,a[1]-g)}),b.sort(function(a,b){return a.angle-b.angle});for(var h=0,i=b.length-1;h<i;h++)c.push([e,b[h],b[h+1]])}),c},d3.geom.quadtree=function(a,b,c,d,e){function n(a,b,c,d,e,f){if(isNaN(b.x)||isNaN(b.y))return;if(a.leaf){var g=a.point;g?Math.abs(g.x-b.x)+Math.abs(g.y-b.y)<.01?o(a,b,c,d,e,f):(a.point=null,o(a,g,c,d,e,f),o(a,b,c,d,e,f)):a.point=b}else o(a,b,c,d,e,f)}function o(a,b,c,d,e,f){var g=(c+e)*.5,h=(d+f)*.5,j=b.x>=g,k=b.y>=h,l=(k<<1)+j;a.leaf=!1,a=a.nodes[l]||(a.nodes[l]=i()),j?c=g:e=g,k?d=h:f=h,n(a,b,c,d,e,f)}var f,g=-1,h=a.length;h&&isNaN(a[0].x)&&(a=a.map(k));if(arguments.length<5)if(arguments.length===3)e=d=c,c=b;else{b=c=Infinity,d=e=-Infinity;while(++g<h)f=a[g],f.x<b&&(b=f.x),f.y<c&&(c=f.y),f.x>d&&(d=f.x),f.y>e&&(e=f.y);var l=d-b,m=e-c;l>m?e=c+l:d=b+m}var p=i();return p.add=function(a){n(p,a,b,c,d,e)},p.visit=function(a){j(a,p,b,c,d,e)},a.forEach(p.add),p}})();
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/d3.js b/gstudio/static/gstudio/js/d3.js new file mode 100644 index 0000000..e59d614 --- /dev/null +++ b/gstudio/static/gstudio/js/d3.js @@ -0,0 +1,4690 @@ +(function(){if (!Date.now) Date.now = function() { + return +new Date; +}; +try { + document.createElement("div").style.setProperty("opacity", 0, ""); +} catch (error) { + var d3_style_prototype = CSSStyleDeclaration.prototype, + d3_style_setProperty = d3_style_prototype.setProperty; + d3_style_prototype.setProperty = function(name, value, priority) { + d3_style_setProperty.call(this, name, value + "", priority); + }; +} +d3 = {version: "2.7.0"}; // semver +var d3_array = d3_arraySlice; // conversion for NodeLists + +function d3_arrayCopy(pseudoarray) { + var i = -1, n = pseudoarray.length, array = []; + while (++i < n) array.push(pseudoarray[i]); + return array; +} + +function d3_arraySlice(pseudoarray) { + return Array.prototype.slice.call(pseudoarray); +} + +try { + d3_array(document.documentElement.childNodes)[0].nodeType; +} catch(e) { + d3_array = d3_arrayCopy; +} + +var d3_arraySubclass = [].__proto__? + +// Until ECMAScript supports array subclassing, prototype injection works well. +function(array, prototype) { + array.__proto__ = prototype; +}: + +// And if your browser doesn't support __proto__, we'll use direct extension. +function(array, prototype) { + for (var property in prototype) array[property] = prototype[property]; +}; +function d3_this() { + return this; +} +d3.functor = function(v) { + return typeof v === "function" ? v : function() { return v; }; +}; +// Copies a variable number of methods from source to target. +d3.rebind = function(target, source) { + var i = 1, n = arguments.length, method; + while (++i < n) target[method = arguments[i]] = d3_rebind(target, source, source[method]); + return target; +}; + +// Method is assumed to be a standard D3 getter-setter: +// If passed with no arguments, gets the value. +// If passed with arguments, sets the value and returns the target. +function d3_rebind(target, source, method) { + return function() { + var value = method.apply(source, arguments); + return arguments.length ? target : value; + }; +} +d3.ascending = function(a, b) { + return a < b ? -1 : a > b ? 1 : a >= b ? 0 : NaN; +}; +d3.descending = function(a, b) { + return b < a ? -1 : b > a ? 1 : b >= a ? 0 : NaN; +}; +d3.mean = function(array, f) { + var n = array.length, + a, + m = 0, + i = -1, + j = 0; + if (arguments.length === 1) { + while (++i < n) if (d3_number(a = array[i])) m += (a - m) / ++j; + } else { + while (++i < n) if (d3_number(a = f.call(array, array[i], i))) m += (a - m) / ++j; + } + return j ? m : undefined; +}; +d3.median = function(array, f) { + if (arguments.length > 1) array = array.map(f); + array = array.filter(d3_number); + return array.length ? d3.quantile(array.sort(d3.ascending), .5) : undefined; +}; +d3.min = function(array, f) { + var i = -1, + n = array.length, + a, + b; + if (arguments.length === 1) { + while (++i < n && ((a = array[i]) == null || a != a)) a = undefined; + while (++i < n) if ((b = array[i]) != null && a > b) a = b; + } else { + while (++i < n && ((a = f.call(array, array[i], i)) == null || a != a)) a = undefined; + while (++i < n) if ((b = f.call(array, array[i], i)) != null && a > b) a = b; + } + return a; +}; +d3.max = function(array, f) { + var i = -1, + n = array.length, + a, + b; + if (arguments.length === 1) { + while (++i < n && ((a = array[i]) == null || a != a)) a = undefined; + while (++i < n) if ((b = array[i]) != null && b > a) a = b; + } else { + while (++i < n && ((a = f.call(array, array[i], i)) == null || a != a)) a = undefined; + while (++i < n) if ((b = f.call(array, array[i], i)) != null && b > a) a = b; + } + return a; +}; +d3.extent = function(array, f) { + var i = -1, + n = array.length, + a, + b, + c; + if (arguments.length === 1) { + while (++i < n && ((a = c = array[i]) == null || a != a)) a = c = undefined; + while (++i < n) if ((b = array[i]) != null) { + if (a > b) a = b; + if (c < b) c = b; + } + } else { + while (++i < n && ((a = c = f.call(array, array[i], i)) == null || a != a)) a = undefined; + while (++i < n) if ((b = f.call(array, array[i], i)) != null) { + if (a > b) a = b; + if (c < b) c = b; + } + } + return [a, c]; +}; +d3.random = { + normal: function(mean, deviation) { + if (arguments.length < 2) deviation = 1; + if (arguments.length < 1) mean = 0; + return function() { + var x, y, r; + do { + x = Math.random() * 2 - 1; + y = Math.random() * 2 - 1; + r = x * x + y * y; + } while (!r || r > 1); + return mean + deviation * x * Math.sqrt(-2 * Math.log(r) / r); + }; + } +}; +function d3_number(x) { + return x != null && !isNaN(x); +} +d3.sum = function(array, f) { + var s = 0, + n = array.length, + a, + i = -1; + + if (arguments.length === 1) { + while (++i < n) if (!isNaN(a = +array[i])) s += a; + } else { + while (++i < n) if (!isNaN(a = +f.call(array, array[i], i))) s += a; + } + + return s; +}; +// R-7 per <http://en.wikipedia.org/wiki/Quantile> +d3.quantile = function(values, p) { + var H = (values.length - 1) * p + 1, + h = Math.floor(H), + v = values[h - 1], + e = H - h; + return e ? v + e * (values[h] - v) : v; +}; +d3.transpose = function(matrix) { + return d3.zip.apply(d3, matrix); +}; +d3.zip = function() { + if (!(n = arguments.length)) return []; + for (var i = -1, m = d3.min(arguments, d3_zipLength), zips = new Array(m); ++i < m;) { + for (var j = -1, n, zip = zips[i] = new Array(n); ++j < n;) { + zip[j] = arguments[j][i]; + } + } + return zips; +}; + +function d3_zipLength(d) { + return d.length; +} +// Locate the insertion point for x in a to maintain sorted order. The +// arguments lo and hi may be used to specify a subset of the array which should +// be considered; by default the entire array is used. If x is already present +// in a, the insertion point will be before (to the left of) any existing +// entries. The return value is suitable for use as the first argument to +// `array.splice` assuming that a is already sorted. +// +// The returned insertion point i partitions the array a into two halves so that +// all v < x for v in a[lo:i] for the left side and all v >= x for v in a[i:hi] +// for the right side. +d3.bisectLeft = function(a, x, lo, hi) { + if (arguments.length < 3) lo = 0; + if (arguments.length < 4) hi = a.length; + while (lo < hi) { + var mid = (lo + hi) >> 1; + if (a[mid] < x) lo = mid + 1; + else hi = mid; + } + return lo; +}; + +// Similar to bisectLeft, but returns an insertion point which comes after (to +// the right of) any existing entries of x in a. +// +// The returned insertion point i partitions the array into two halves so that +// all v <= x for v in a[lo:i] for the left side and all v > x for v in a[i:hi] +// for the right side. +d3.bisect = +d3.bisectRight = function(a, x, lo, hi) { + if (arguments.length < 3) lo = 0; + if (arguments.length < 4) hi = a.length; + while (lo < hi) { + var mid = (lo + hi) >> 1; + if (x < a[mid]) hi = mid; + else lo = mid + 1; + } + return lo; +}; +d3.first = function(array, f) { + var i = 0, + n = array.length, + a = array[0], + b; + if (arguments.length === 1) f = d3.ascending; + while (++i < n) { + if (f.call(array, a, b = array[i]) > 0) { + a = b; + } + } + return a; +}; +d3.last = function(array, f) { + var i = 0, + n = array.length, + a = array[0], + b; + if (arguments.length === 1) f = d3.ascending; + while (++i < n) { + if (f.call(array, a, b = array[i]) <= 0) { + a = b; + } + } + return a; +}; +d3.nest = function() { + var nest = {}, + keys = [], + sortKeys = [], + sortValues, + rollup; + + function map(array, depth) { + if (depth >= keys.length) return rollup + ? rollup.call(nest, array) : (sortValues + ? array.sort(sortValues) + : array); + + var i = -1, + n = array.length, + key = keys[depth++], + keyValue, + object, + o = {}; + + while (++i < n) { + if ((keyValue = key(object = array[i])) in o) { + o[keyValue].push(object); + } else { + o[keyValue] = [object]; + } + } + + for (keyValue in o) { + o[keyValue] = map(o[keyValue], depth); + } + + return o; + } + + function entries(map, depth) { + if (depth >= keys.length) return map; + + var a = [], + sortKey = sortKeys[depth++], + key; + + for (key in map) { + a.push({key: key, values: entries(map[key], depth)}); + } + + if (sortKey) a.sort(function(a, b) { + return sortKey(a.key, b.key); + }); + + return a; + } + + nest.map = function(array) { + return map(array, 0); + }; + + nest.entries = function(array) { + return entries(map(array, 0), 0); + }; + + nest.key = function(d) { + keys.push(d); + return nest; + }; + + // Specifies the order for the most-recently specified key. + // Note: only applies to entries. Map keys are unordered! + nest.sortKeys = function(order) { + sortKeys[keys.length - 1] = order; + return nest; + }; + + // Specifies the order for leaf values. + // Applies to both maps and entries array. + nest.sortValues = function(order) { + sortValues = order; + return nest; + }; + + nest.rollup = function(f) { + rollup = f; + return nest; + }; + + return nest; +}; +d3.keys = function(map) { + var keys = []; + for (var key in map) keys.push(key); + return keys; +}; +d3.values = function(map) { + var values = []; + for (var key in map) values.push(map[key]); + return values; +}; +d3.entries = function(map) { + var entries = []; + for (var key in map) entries.push({key: key, value: map[key]}); + return entries; +}; +d3.permute = function(array, indexes) { + var permutes = [], + i = -1, + n = indexes.length; + while (++i < n) permutes[i] = array[indexes[i]]; + return permutes; +}; +d3.merge = function(arrays) { + return Array.prototype.concat.apply([], arrays); +}; +d3.split = function(array, f) { + var arrays = [], + values = [], + value, + i = -1, + n = array.length; + if (arguments.length < 2) f = d3_splitter; + while (++i < n) { + if (f.call(values, value = array[i], i)) { + values = []; + } else { + if (!values.length) arrays.push(values); + values.push(value); + } + } + return arrays; +}; + +function d3_splitter(d) { + return d == null; +} +function d3_collapse(s) { + return s.replace(/(^\s+)|(\s+$)/g, "").replace(/\s+/g, " "); +} +/** + * @param {number} start + * @param {number=} stop + * @param {number=} step + */ +d3.range = function(start, stop, step) { + if (arguments.length < 3) { + step = 1; + if (arguments.length < 2) { + stop = start; + start = 0; + } + } + if ((stop - start) / step == Infinity) throw new Error("infinite range"); + var range = [], + i = -1, + j; + if (step < 0) while ((j = start + step * ++i) > stop) range.push(j); + else while ((j = start + step * ++i) < stop) range.push(j); + return range; +}; +d3.requote = function(s) { + return s.replace(d3_requote_re, "\\$&"); +}; + +var d3_requote_re = /[\\\^\$\*\+\?\|\[\]\(\)\.\{\}]/g; +d3.round = function(x, n) { + return n + ? Math.round(x * Math.pow(10, n)) * Math.pow(10, -n) + : Math.round(x); +}; +d3.xhr = function(url, mime, callback) { + var req = new XMLHttpRequest; + if (arguments.length < 3) callback = mime; + else if (mime && req.overrideMimeType) req.overrideMimeType(mime); + req.open("GET", url, true); + req.onreadystatechange = function() { + if (req.readyState === 4) callback(req.status < 300 ? req : null); + }; + req.send(null); +}; +d3.text = function(url, mime, callback) { + function ready(req) { + callback(req && req.responseText); + } + if (arguments.length < 3) { + callback = mime; + mime = null; + } + d3.xhr(url, mime, ready); +}; +d3.json = function(url, callback) { + d3.text(url, "application/json", function(text) { + callback(text ? JSON.parse(text) : null); + }); +}; +d3.html = function(url, callback) { + d3.text(url, "text/html", function(text) { + if (text != null) { // Treat empty string as valid HTML. + var range = document.createRange(); + range.selectNode(document.body); + text = range.createContextualFragment(text); + } + callback(text); + }); +}; +d3.xml = function(url, mime, callback) { + function ready(req) { + callback(req && req.responseXML); + } + if (arguments.length < 3) { + callback = mime; + mime = null; + } + d3.xhr(url, mime, ready); +}; +var d3_nsPrefix = { + svg: "http://www.w3.org/2000/svg", + xhtml: "http://www.w3.org/1999/xhtml", + xlink: "http://www.w3.org/1999/xlink", + xml: "http://www.w3.org/XML/1998/namespace", + xmlns: "http://www.w3.org/2000/xmlns/" +}; + +d3.ns = { + prefix: d3_nsPrefix, + qualify: function(name) { + var i = name.indexOf(":"); + return i < 0 ? (name in d3_nsPrefix + ? {space: d3_nsPrefix[name], local: name} : name) + : {space: d3_nsPrefix[name.substring(0, i)], local: name.substring(i + 1)}; + } +}; +d3.dispatch = function() { + var dispatch = new d3_dispatch(), + i = -1, + n = arguments.length; + while (++i < n) dispatch[arguments[i]] = d3_dispatch_event(); + return dispatch; +}; + +function d3_dispatch() {} + +d3_dispatch.prototype.on = function(type, listener) { + var i = type.indexOf("."), + name = ""; + + // Extract optional namespace, e.g., "click.foo" + if (i > 0) { + name = type.substring(i + 1); + type = type.substring(0, i); + } + + return arguments.length < 2 + ? this[type].on(name) + : (this[type].on(name, listener), this); +}; + +function d3_dispatch_event() { + var listeners = [], + listenerByName = {}; + + function dispatch() { + var z = listeners, // defensive reference + i = -1, + n = z.length, + l; + while (++i < n) if (l = z[i].on) l.apply(this, arguments); + } + + dispatch.on = function(name, listener) { + var l, i; + + // return the current listener, if any + if (arguments.length < 2) return (l = listenerByName[name]) && l.on; + + // remove the old listener, if any (with copy-on-write) + if (l = listenerByName[name]) { + l.on = null; + listeners = listeners.slice(0, i = listeners.indexOf(l)).concat(listeners.slice(i + 1)); + delete listenerByName[name]; + } + + // add the new listener, if any + if (listener) { + listeners.push(listenerByName[name] = {on: listener}); + } + + return dispatch; + }; + + return dispatch; +}; +// TODO align +d3.format = function(specifier) { + var match = d3_format_re.exec(specifier), + fill = match[1] || " ", + sign = match[3] || "", + zfill = match[5], + width = +match[6], + comma = match[7], + precision = match[8], + type = match[9], + scale = 1, + suffix = "", + integer = false; + + if (precision) precision = +precision.substring(1); + + if (zfill) { + fill = "0"; // TODO align = "="; + if (comma) width -= Math.floor((width - 1) / 4); + } + + switch (type) { + case "n": comma = true; type = "g"; break; + case "%": scale = 100; suffix = "%"; type = "f"; break; + case "p": scale = 100; suffix = "%"; type = "r"; break; + case "d": integer = true; precision = 0; break; + case "s": scale = -1; type = "r"; break; + } + + // If no precision is specified for r, fallback to general notation. + if (type == "r" && !precision) type = "g"; + + type = d3_format_types[type] || d3_format_typeDefault; + + return function(value) { + + // Return the empty string for floats formatted as ints. + if (integer && (value % 1)) return ""; + + // Convert negative to positive, and record the sign prefix. + var negative = (value < 0) && (value = -value) ? "\u2212" : sign; + + // Apply the scale, computing it from the value's exponent for si format. + if (scale < 0) { + var prefix = d3.formatPrefix(value, precision); + value *= prefix.scale; + suffix = prefix.symbol; + } else { + value *= scale; + } + + // Convert to the desired precision. + value = type(value, precision); + + // If the fill character is 0, the sign and group is applied after the fill. + if (zfill) { + var length = value.length + negative.length; + if (length < width) value = new Array(width - length + 1).join(fill) + value; + if (comma) value = d3_format_group(value); + value = negative + value; + } + + // Otherwise (e.g., space-filling), the sign and group is applied before. + else { + if (comma) value = d3_format_group(value); + value = negative + value; + var length = value.length; + if (length < width) value = new Array(width - length + 1).join(fill) + value; + } + + return value + suffix; + }; +}; + +// [[fill]align][sign][#][0][width][,][.precision][type] +var d3_format_re = /(?:([^{])?([<>=^]))?([+\- ])?(#)?(0)?([0-9]+)?(,)?(\.[0-9]+)?([a-zA-Z%])?/; + +var d3_format_types = { + g: function(x, p) { return x.toPrecision(p); }, + e: function(x, p) { return x.toExponential(p); }, + f: function(x, p) { return x.toFixed(p); }, + r: function(x, p) { return d3.round(x, p = d3_format_precision(x, p)).toFixed(Math.max(0, Math.min(20, p))); } +}; + +function d3_format_precision(x, p) { + return p - (x ? 1 + Math.floor(Math.log(x + Math.pow(10, 1 + Math.floor(Math.log(x) / Math.LN10) - p)) / Math.LN10) : 1); +} + +function d3_format_typeDefault(x) { + return x + ""; +} + +// Apply comma grouping for thousands. +function d3_format_group(value) { + var i = value.lastIndexOf("."), + f = i >= 0 ? value.substring(i) : (i = value.length, ""), + t = []; + while (i > 0) t.push(value.substring(i -= 3, i + 3)); + return t.reverse().join(",") + f; +} +var d3_formatPrefixes = ["y","z","a","f","p","n","μ","m","","k","M","G","T","P","E","Z","Y"].map(d3_formatPrefix); + +d3.formatPrefix = function(value, precision) { + var i = 0; + if (value) { + if (value < 0) value *= -1; + if (precision) value = d3.round(value, d3_format_precision(value, precision)); + i = 1 + Math.floor(1e-12 + Math.log(value) / Math.LN10); + i = Math.max(-24, Math.min(24, Math.floor((i <= 0 ? i + 1 : i - 1) / 3) * 3)); + } + return d3_formatPrefixes[8 + i / 3]; +}; + +function d3_formatPrefix(d, i) { + return { + scale: Math.pow(10, (8 - i) * 3), + symbol: d + }; +} + +/* + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * - Redistributions of source code must retain the above copyright notice, this + * list of conditions and the following disclaimer. + * + * - Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * - Neither the name of the author nor the names of contributors may be used to + * endorse or promote products derived from this software without specific + * prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +var d3_ease_quad = d3_ease_poly(2), + d3_ease_cubic = d3_ease_poly(3); + +var d3_ease = { + linear: function() { return d3_ease_linear; }, + poly: d3_ease_poly, + quad: function() { return d3_ease_quad; }, + cubic: function() { return d3_ease_cubic; }, + sin: function() { return d3_ease_sin; }, + exp: function() { return d3_ease_exp; }, + circle: function() { return d3_ease_circle; }, + elastic: d3_ease_elastic, + back: d3_ease_back, + bounce: function() { return d3_ease_bounce; } +}; + +var d3_ease_mode = { + "in": function(f) { return f; }, + "out": d3_ease_reverse, + "in-out": d3_ease_reflect, + "out-in": function(f) { return d3_ease_reflect(d3_ease_reverse(f)); } +}; + +d3.ease = function(name) { + var i = name.indexOf("-"), + t = i >= 0 ? name.substring(0, i) : name, + m = i >= 0 ? name.substring(i + 1) : "in"; + return d3_ease_clamp(d3_ease_mode[m](d3_ease[t].apply(null, Array.prototype.slice.call(arguments, 1)))); +}; + +function d3_ease_clamp(f) { + return function(t) { + return t <= 0 ? 0 : t >= 1 ? 1 : f(t); + }; +} + +function d3_ease_reverse(f) { + return function(t) { + return 1 - f(1 - t); + }; +} + +function d3_ease_reflect(f) { + return function(t) { + return .5 * (t < .5 ? f(2 * t) : (2 - f(2 - 2 * t))); + }; +} + +function d3_ease_linear(t) { + return t; +} + +function d3_ease_poly(e) { + return function(t) { + return Math.pow(t, e); + } +} + +function d3_ease_sin(t) { + return 1 - Math.cos(t * Math.PI / 2); +} + +function d3_ease_exp(t) { + return Math.pow(2, 10 * (t - 1)); +} + +function d3_ease_circle(t) { + return 1 - Math.sqrt(1 - t * t); +} + +function d3_ease_elastic(a, p) { + var s; + if (arguments.length < 2) p = 0.45; + if (arguments.length < 1) { a = 1; s = p / 4; } + else s = p / (2 * Math.PI) * Math.asin(1 / a); + return function(t) { + return 1 + a * Math.pow(2, 10 * -t) * Math.sin((t - s) * 2 * Math.PI / p); + }; +} + +function d3_ease_back(s) { + if (!s) s = 1.70158; + return function(t) { + return t * t * ((s + 1) * t - s); + }; +} + +function d3_ease_bounce(t) { + return t < 1 / 2.75 ? 7.5625 * t * t + : t < 2 / 2.75 ? 7.5625 * (t -= 1.5 / 2.75) * t + .75 + : t < 2.5 / 2.75 ? 7.5625 * (t -= 2.25 / 2.75) * t + .9375 + : 7.5625 * (t -= 2.625 / 2.75) * t + .984375; +} +d3.event = null; + +function d3_eventCancel() { + d3.event.stopPropagation(); + d3.event.preventDefault(); +} +d3.interpolate = function(a, b) { + var i = d3.interpolators.length, f; + while (--i >= 0 && !(f = d3.interpolators[i](a, b))); + return f; +}; + +d3.interpolateNumber = function(a, b) { + b -= a; + return function(t) { return a + b * t; }; +}; + +d3.interpolateRound = function(a, b) { + b -= a; + return function(t) { return Math.round(a + b * t); }; +}; + +d3.interpolateString = function(a, b) { + var m, // current match + i, // current index + j, // current index (for coallescing) + s0 = 0, // start index of current string prefix + s1 = 0, // end index of current string prefix + s = [], // string constants and placeholders + q = [], // number interpolators + n, // q.length + o; + + // Reset our regular expression! + d3_interpolate_number.lastIndex = 0; + + // Find all numbers in b. + for (i = 0; m = d3_interpolate_number.exec(b); ++i) { + if (m.index) s.push(b.substring(s0, s1 = m.index)); + q.push({i: s.length, x: m[0]}); + s.push(null); + s0 = d3_interpolate_number.lastIndex; + } + if (s0 < b.length) s.push(b.substring(s0)); + + // Find all numbers in a. + for (i = 0, n = q.length; (m = d3_interpolate_number.exec(a)) && i < n; ++i) { + o = q[i]; + if (o.x == m[0]) { // The numbers match, so coallesce. + if (o.i) { + if (s[o.i + 1] == null) { // This match is followed by another number. + s[o.i - 1] += o.x; + s.splice(o.i, 1); + for (j = i + 1; j < n; ++j) q[j].i--; + } else { // This match is followed by a string, so coallesce twice. + s[o.i - 1] += o.x + s[o.i + 1]; + s.splice(o.i, 2); + for (j = i + 1; j < n; ++j) q[j].i -= 2; + } + } else { + if (s[o.i + 1] == null) { // This match is followed by another number. + s[o.i] = o.x; + } else { // This match is followed by a string, so coallesce twice. + s[o.i] = o.x + s[o.i + 1]; + s.splice(o.i + 1, 1); + for (j = i + 1; j < n; ++j) q[j].i--; + } + } + q.splice(i, 1); + n--; + i--; + } else { + o.x = d3.interpolateNumber(parseFloat(m[0]), parseFloat(o.x)); + } + } + + // Remove any numbers in b not found in a. + while (i < n) { + o = q.pop(); + if (s[o.i + 1] == null) { // This match is followed by another number. + s[o.i] = o.x; + } else { // This match is followed by a string, so coallesce twice. + s[o.i] = o.x + s[o.i + 1]; + s.splice(o.i + 1, 1); + } + n--; + } + + // Special optimization for only a single match. + if (s.length === 1) { + return s[0] == null ? q[0].x : function() { return b; }; + } + + // Otherwise, interpolate each of the numbers and rejoin the string. + return function(t) { + for (i = 0; i < n; ++i) s[(o = q[i]).i] = o.x(t); + return s.join(""); + }; +}; + +d3.interpolateTransform = function(a, b) { + return d3.interpolateString(d3.transform(a) + "", d3.transform(b) + ""); +}; + +d3.interpolateRgb = function(a, b) { + a = d3.rgb(a); + b = d3.rgb(b); + var ar = a.r, + ag = a.g, + ab = a.b, + br = b.r - ar, + bg = b.g - ag, + bb = b.b - ab; + return function(t) { + return "#" + + d3_rgb_hex(Math.round(ar + br * t)) + + d3_rgb_hex(Math.round(ag + bg * t)) + + d3_rgb_hex(Math.round(ab + bb * t)); + }; +}; + +// interpolates HSL space, but outputs RGB string (for compatibility) +d3.interpolateHsl = function(a, b) { + a = d3.hsl(a); + b = d3.hsl(b); + var h0 = a.h, + s0 = a.s, + l0 = a.l, + h1 = b.h - h0, + s1 = b.s - s0, + l1 = b.l - l0; + return function(t) { + return d3_hsl_rgb(h0 + h1 * t, s0 + s1 * t, l0 + l1 * t).toString(); + }; +}; + +d3.interpolateArray = function(a, b) { + var x = [], + c = [], + na = a.length, + nb = b.length, + n0 = Math.min(a.length, b.length), + i; + for (i = 0; i < n0; ++i) x.push(d3.interpolate(a[i], b[i])); + for (; i < na; ++i) c[i] = a[i]; + for (; i < nb; ++i) c[i] = b[i]; + return function(t) { + for (i = 0; i < n0; ++i) c[i] = x[i](t); + return c; + }; +}; + +d3.interpolateObject = function(a, b) { + var i = {}, + c = {}, + k; + for (k in a) { + if (k in b) { + i[k] = d3_interpolateByName(k)(a[k], b[k]); + } else { + c[k] = a[k]; + } + } + for (k in b) { + if (!(k in a)) { + c[k] = b[k]; + } + } + return function(t) { + for (k in i) c[k] = i[k](t); + return c; + }; +} + +var d3_interpolate_number = /[-+]?(?:\d*\.?\d+)(?:[eE][-+]?\d+)?/g; + +function d3_interpolateByName(n) { + return n == "transform" + ? d3.interpolateTransform + : d3.interpolate; +} + +d3.interpolators = [ + d3.interpolateObject, + function(a, b) { return (b instanceof Array) && d3.interpolateArray(a, b); }, + function(a, b) { return (typeof a === "string" || typeof b === "string") && d3.interpolateString(a + "", b + ""); }, + function(a, b) { return (typeof b === "string" ? b in d3_rgb_names || /^(#|rgb\(|hsl\()/.test(b) : b instanceof d3_Rgb || b instanceof d3_Hsl) && d3.interpolateRgb(a, b); }, + function(a, b) { return !isNaN(a = +a) && !isNaN(b = +b) && d3.interpolateNumber(a, b); } +]; +function d3_uninterpolateNumber(a, b) { + b = b - (a = +a) ? 1 / (b - a) : 0; + return function(x) { return (x - a) * b; }; +} + +function d3_uninterpolateClamp(a, b) { + b = b - (a = +a) ? 1 / (b - a) : 0; + return function(x) { return Math.max(0, Math.min(1, (x - a) * b)); }; +} +d3.rgb = function(r, g, b) { + return arguments.length === 1 + ? (r instanceof d3_Rgb ? d3_rgb(r.r, r.g, r.b) + : d3_rgb_parse("" + r, d3_rgb, d3_hsl_rgb)) + : d3_rgb(~~r, ~~g, ~~b); +}; + +function d3_rgb(r, g, b) { + return new d3_Rgb(r, g, b); +} + +function d3_Rgb(r, g, b) { + this.r = r; + this.g = g; + this.b = b; +} + +d3_Rgb.prototype.brighter = function(k) { + k = Math.pow(0.7, arguments.length ? k : 1); + var r = this.r, + g = this.g, + b = this.b, + i = 30; + if (!r && !g && !b) return d3_rgb(i, i, i); + if (r && r < i) r = i; + if (g && g < i) g = i; + if (b && b < i) b = i; + return d3_rgb( + Math.min(255, Math.floor(r / k)), + Math.min(255, Math.floor(g / k)), + Math.min(255, Math.floor(b / k))); +}; + +d3_Rgb.prototype.darker = function(k) { + k = Math.pow(0.7, arguments.length ? k : 1); + return d3_rgb( + Math.floor(k * this.r), + Math.floor(k * this.g), + Math.floor(k * this.b)); +}; + +d3_Rgb.prototype.hsl = function() { + return d3_rgb_hsl(this.r, this.g, this.b); +}; + +d3_Rgb.prototype.toString = function() { + return "#" + d3_rgb_hex(this.r) + d3_rgb_hex(this.g) + d3_rgb_hex(this.b); +}; + +function d3_rgb_hex(v) { + return v < 0x10 + ? "0" + Math.max(0, v).toString(16) + : Math.min(255, v).toString(16); +} + +function d3_rgb_parse(format, rgb, hsl) { + var r = 0, // red channel; int in [0, 255] + g = 0, // green channel; int in [0, 255] + b = 0, // blue channel; int in [0, 255] + m1, // CSS color specification match + m2, // CSS color specification type (e.g., rgb) + name; + + /* Handle hsl, rgb. */ + m1 = /([a-z]+)\((.*)\)/i.exec(format); + if (m1) { + m2 = m1[2].split(","); + switch (m1[1]) { + case "hsl": { + return hsl( + parseFloat(m2[0]), // degrees + parseFloat(m2[1]) / 100, // percentage + parseFloat(m2[2]) / 100 // percentage + ); + } + case "rgb": { + return rgb( + d3_rgb_parseNumber(m2[0]), + d3_rgb_parseNumber(m2[1]), + d3_rgb_parseNumber(m2[2]) + ); + } + } + } + + /* Named colors. */ + if (name = d3_rgb_names[format]) return rgb(name.r, name.g, name.b); + + /* Hexadecimal colors: #rgb and #rrggbb. */ + if (format != null && format.charAt(0) === "#") { + if (format.length === 4) { + r = format.charAt(1); r += r; + g = format.charAt(2); g += g; + b = format.charAt(3); b += b; + } else if (format.length === 7) { + r = format.substring(1, 3); + g = format.substring(3, 5); + b = format.substring(5, 7); + } + r = parseInt(r, 16); + g = parseInt(g, 16); + b = parseInt(b, 16); + } + + return rgb(r, g, b); +} + +function d3_rgb_hsl(r, g, b) { + var min = Math.min(r /= 255, g /= 255, b /= 255), + max = Math.max(r, g, b), + d = max - min, + h, + s, + l = (max + min) / 2; + if (d) { + s = l < .5 ? d / (max + min) : d / (2 - max - min); + if (r == max) h = (g - b) / d + (g < b ? 6 : 0); + else if (g == max) h = (b - r) / d + 2; + else h = (r - g) / d + 4; + h *= 60; + } else { + s = h = 0; + } + return d3_hsl(h, s, l); +} + +function d3_rgb_parseNumber(c) { // either integer or percentage + var f = parseFloat(c); + return c.charAt(c.length - 1) === "%" ? Math.round(f * 2.55) : f; +} + +var d3_rgb_names = { + aliceblue: "#f0f8ff", + antiquewhite: "#faebd7", + aqua: "#00ffff", + aquamarine: "#7fffd4", + azure: "#f0ffff", + beige: "#f5f5dc", + bisque: "#ffe4c4", + black: "#000000", + blanchedalmond: "#ffebcd", + blue: "#0000ff", + blueviolet: "#8a2be2", + brown: "#a52a2a", + burlywood: "#deb887", + cadetblue: "#5f9ea0", + chartreuse: "#7fff00", + chocolate: "#d2691e", + coral: "#ff7f50", + cornflowerblue: "#6495ed", + cornsilk: "#fff8dc", + crimson: "#dc143c", + cyan: "#00ffff", + darkblue: "#00008b", + darkcyan: "#008b8b", + darkgoldenrod: "#b8860b", + darkgray: "#a9a9a9", + darkgreen: "#006400", + darkgrey: "#a9a9a9", + darkkhaki: "#bdb76b", + darkmagenta: "#8b008b", + darkolivegreen: "#556b2f", + darkorange: "#ff8c00", + darkorchid: "#9932cc", + darkred: "#8b0000", + darksalmon: "#e9967a", + darkseagreen: "#8fbc8f", + darkslateblue: "#483d8b", + darkslategray: "#2f4f4f", + darkslategrey: "#2f4f4f", + darkturquoise: "#00ced1", + darkviolet: "#9400d3", + deeppink: "#ff1493", + deepskyblue: "#00bfff", + dimgray: "#696969", + dimgrey: "#696969", + dodgerblue: "#1e90ff", + firebrick: "#b22222", + floralwhite: "#fffaf0", + forestgreen: "#228b22", + fuchsia: "#ff00ff", + gainsboro: "#dcdcdc", + ghostwhite: "#f8f8ff", + gold: "#ffd700", + goldenrod: "#daa520", + gray: "#808080", + green: "#008000", + greenyellow: "#adff2f", + grey: "#808080", + honeydew: "#f0fff0", + hotpink: "#ff69b4", + indianred: "#cd5c5c", + indigo: "#4b0082", + ivory: "#fffff0", + khaki: "#f0e68c", + lavender: "#e6e6fa", + lavenderblush: "#fff0f5", + lawngreen: "#7cfc00", + lemonchiffon: "#fffacd", + lightblue: "#add8e6", + lightcoral: "#f08080", + lightcyan: "#e0ffff", + lightgoldenrodyellow: "#fafad2", + lightgray: "#d3d3d3", + lightgreen: "#90ee90", + lightgrey: "#d3d3d3", + lightpink: "#ffb6c1", + lightsalmon: "#ffa07a", + lightseagreen: "#20b2aa", + lightskyblue: "#87cefa", + lightslategray: "#778899", + lightslategrey: "#778899", + lightsteelblue: "#b0c4de", + lightyellow: "#ffffe0", + lime: "#00ff00", + limegreen: "#32cd32", + linen: "#faf0e6", + magenta: "#ff00ff", + maroon: "#800000", + mediumaquamarine: "#66cdaa", + mediumblue: "#0000cd", + mediumorchid: "#ba55d3", + mediumpurple: "#9370db", + mediumseagreen: "#3cb371", + mediumslateblue: "#7b68ee", + mediumspringgreen: "#00fa9a", + mediumturquoise: "#48d1cc", + mediumvioletred: "#c71585", + midnightblue: "#191970", + mintcream: "#f5fffa", + mistyrose: "#ffe4e1", + moccasin: "#ffe4b5", + navajowhite: "#ffdead", + navy: "#000080", + oldlace: "#fdf5e6", + olive: "#808000", + olivedrab: "#6b8e23", + orange: "#ffa500", + orangered: "#ff4500", + orchid: "#da70d6", + palegoldenrod: "#eee8aa", + palegreen: "#98fb98", + paleturquoise: "#afeeee", + palevioletred: "#db7093", + papayawhip: "#ffefd5", + peachpuff: "#ffdab9", + peru: "#cd853f", + pink: "#ffc0cb", + plum: "#dda0dd", + powderblue: "#b0e0e6", + purple: "#800080", + red: "#ff0000", + rosybrown: "#bc8f8f", + royalblue: "#4169e1", + saddlebrown: "#8b4513", + salmon: "#fa8072", + sandybrown: "#f4a460", + seagreen: "#2e8b57", + seashell: "#fff5ee", + sienna: "#a0522d", + silver: "#c0c0c0", + skyblue: "#87ceeb", + slateblue: "#6a5acd", + slategray: "#708090", + slategrey: "#708090", + snow: "#fffafa", + springgreen: "#00ff7f", + steelblue: "#4682b4", + tan: "#d2b48c", + teal: "#008080", + thistle: "#d8bfd8", + tomato: "#ff6347", + turquoise: "#40e0d0", + violet: "#ee82ee", + wheat: "#f5deb3", + white: "#ffffff", + whitesmoke: "#f5f5f5", + yellow: "#ffff00", + yellowgreen: "#9acd32" +}; + +for (var d3_rgb_name in d3_rgb_names) { + d3_rgb_names[d3_rgb_name] = d3_rgb_parse( + d3_rgb_names[d3_rgb_name], + d3_rgb, + d3_hsl_rgb); +} +d3.hsl = function(h, s, l) { + return arguments.length === 1 + ? (h instanceof d3_Hsl ? d3_hsl(h.h, h.s, h.l) + : d3_rgb_parse("" + h, d3_rgb_hsl, d3_hsl)) + : d3_hsl(+h, +s, +l); +}; + +function d3_hsl(h, s, l) { + return new d3_Hsl(h, s, l); +} + +function d3_Hsl(h, s, l) { + this.h = h; + this.s = s; + this.l = l; +} + +d3_Hsl.prototype.brighter = function(k) { + k = Math.pow(0.7, arguments.length ? k : 1); + return d3_hsl(this.h, this.s, this.l / k); +}; + +d3_Hsl.prototype.darker = function(k) { + k = Math.pow(0.7, arguments.length ? k : 1); + return d3_hsl(this.h, this.s, k * this.l); +}; + +d3_Hsl.prototype.rgb = function() { + return d3_hsl_rgb(this.h, this.s, this.l); +}; + +d3_Hsl.prototype.toString = function() { + return this.rgb().toString(); +}; + +function d3_hsl_rgb(h, s, l) { + var m1, + m2; + + /* Some simple corrections for h, s and l. */ + h = h % 360; if (h < 0) h += 360; + s = s < 0 ? 0 : s > 1 ? 1 : s; + l = l < 0 ? 0 : l > 1 ? 1 : l; + + /* From FvD 13.37, CSS Color Module Level 3 */ + m2 = l <= .5 ? l * (1 + s) : l + s - l * s; + m1 = 2 * l - m2; + + function v(h) { + if (h > 360) h -= 360; + else if (h < 0) h += 360; + if (h < 60) return m1 + (m2 - m1) * h / 60; + if (h < 180) return m2; + if (h < 240) return m1 + (m2 - m1) * (240 - h) / 60; + return m1; + } + + function vv(h) { + return Math.round(v(h) * 255); + } + + return d3_rgb(vv(h + 120), vv(h), vv(h - 120)); +} +function d3_selection(groups) { + d3_arraySubclass(groups, d3_selectionPrototype); + return groups; +} + +var d3_select = function(s, n) { return n.querySelector(s); }, + d3_selectAll = function(s, n) { return n.querySelectorAll(s); }, + d3_selectRoot = document.documentElement, + d3_selectMatcher = d3_selectRoot.matchesSelector || d3_selectRoot.webkitMatchesSelector || d3_selectRoot.mozMatchesSelector || d3_selectRoot.msMatchesSelector || d3_selectRoot.oMatchesSelector, + d3_selectMatches = function(n, s) { return d3_selectMatcher.call(n, s); }; + +// Prefer Sizzle, if available. +if (typeof Sizzle === "function") { + d3_select = function(s, n) { return Sizzle(s, n)[0]; }; + d3_selectAll = function(s, n) { return Sizzle.uniqueSort(Sizzle(s, n)); }; + d3_selectMatches = Sizzle.matchesSelector; +} + +var d3_selectionPrototype = []; + +d3.selection = function() { + return d3_selectionRoot; +}; + +d3.selection.prototype = d3_selectionPrototype; +d3_selectionPrototype.select = function(selector) { + var subgroups = [], + subgroup, + subnode, + group, + node; + + if (typeof selector !== "function") selector = d3_selection_selector(selector); + + for (var j = -1, m = this.length; ++j < m;) { + subgroups.push(subgroup = []); + subgroup.parentNode = (group = this[j]).parentNode; + for (var i = -1, n = group.length; ++i < n;) { + if (node = group[i]) { + subgroup.push(subnode = selector.call(node, node.__data__, i)); + if (subnode && "__data__" in node) subnode.__data__ = node.__data__; + } else { + subgroup.push(null); + } + } + } + + return d3_selection(subgroups); +}; + +function d3_selection_selector(selector) { + return function() { + return d3_select(selector, this); + }; +} +d3_selectionPrototype.selectAll = function(selector) { + var subgroups = [], + subgroup, + node; + + if (typeof selector !== "function") selector = d3_selection_selectorAll(selector); + + for (var j = -1, m = this.length; ++j < m;) { + for (var group = this[j], i = -1, n = group.length; ++i < n;) { + if (node = group[i]) { + subgroups.push(subgroup = d3_array(selector.call(node, node.__data__, i))); + subgroup.parentNode = node; + } + } + } + + return d3_selection(subgroups); +}; + +function d3_selection_selectorAll(selector) { + return function() { + return d3_selectAll(selector, this); + }; +} +d3_selectionPrototype.attr = function(name, value) { + name = d3.ns.qualify(name); + + // If no value is specified, return the first value. + if (arguments.length < 2) { + var node = this.node(); + return name.local + ? node.getAttributeNS(name.space, name.local) + : node.getAttribute(name); + } + + function attrNull() { + this.removeAttribute(name); + } + + function attrNullNS() { + this.removeAttributeNS(name.space, name.local); + } + + function attrConstant() { + this.setAttribute(name, value); + } + + function attrConstantNS() { + this.setAttributeNS(name.space, name.local, value); + } + + function attrFunction() { + var x = value.apply(this, arguments); + if (x == null) this.removeAttribute(name); + else this.setAttribute(name, x); + } + + function attrFunctionNS() { + var x = value.apply(this, arguments); + if (x == null) this.removeAttributeNS(name.space, name.local); + else this.setAttributeNS(name.space, name.local, x); + } + + return this.each(value == null + ? (name.local ? attrNullNS : attrNull) : (typeof value === "function" + ? (name.local ? attrFunctionNS : attrFunction) + : (name.local ? attrConstantNS : attrConstant))); +}; +d3_selectionPrototype.classed = function(name, value) { + var names = name.split(d3_selection_classedWhitespace), + n = names.length, + i = -1; + if (arguments.length > 1) { + while (++i < n) d3_selection_classed.call(this, names[i], value); + return this; + } else { + while (++i < n) if (!d3_selection_classed.call(this, names[i])) return false; + return true; + } +}; + +var d3_selection_classedWhitespace = /\s+/g; + +function d3_selection_classed(name, value) { + var re = new RegExp("(^|\\s+)" + d3.requote(name) + "(\\s+|$)", "g"); + + // If no value is specified, return the first value. + if (arguments.length < 2) { + var node = this.node(); + if (c = node.classList) return c.contains(name); + var c = node.className; + re.lastIndex = 0; + return re.test(c.baseVal != null ? c.baseVal : c); + } + + function classedAdd() { + if (c = this.classList) return c.add(name); + var c = this.className, + cb = c.baseVal != null, + cv = cb ? c.baseVal : c; + re.lastIndex = 0; + if (!re.test(cv)) { + cv = d3_collapse(cv + " " + name); + if (cb) c.baseVal = cv; + else this.className = cv; + } + } + + function classedRemove() { + if (c = this.classList) return c.remove(name); + var c = this.className, + cb = c.baseVal != null, + cv = cb ? c.baseVal : c; + cv = d3_collapse(cv.replace(re, " ")); + if (cb) c.baseVal = cv; + else this.className = cv; + } + + function classedFunction() { + (value.apply(this, arguments) + ? classedAdd + : classedRemove).call(this); + } + + return this.each(typeof value === "function" + ? classedFunction : value + ? classedAdd + : classedRemove); +} +d3_selectionPrototype.style = function(name, value, priority) { + if (arguments.length < 3) priority = ""; + + // If no value is specified, return the first value. + if (arguments.length < 2) return window + .getComputedStyle(this.node(), null) + .getPropertyValue(name); + + function styleNull() { + this.style.removeProperty(name); + } + + function styleConstant() { + this.style.setProperty(name, value, priority); + } + + function styleFunction() { + var x = value.apply(this, arguments); + if (x == null) this.style.removeProperty(name); + else this.style.setProperty(name, x, priority); + } + + return this.each(value == null + ? styleNull : (typeof value === "function" + ? styleFunction : styleConstant)); +}; +d3_selectionPrototype.property = function(name, value) { + + // If no value is specified, return the first value. + if (arguments.length < 2) return this.node()[name]; + + function propertyNull() { + delete this[name]; + } + + function propertyConstant() { + this[name] = value; + } + + function propertyFunction() { + var x = value.apply(this, arguments); + if (x == null) delete this[name]; + else this[name] = x; + } + + return this.each(value == null + ? propertyNull : (typeof value === "function" + ? propertyFunction : propertyConstant)); +}; +d3_selectionPrototype.text = function(value) { + return arguments.length < 1 ? this.node().textContent + : (this.each(typeof value === "function" + ? function() { this.textContent = value.apply(this, arguments); } + : function() { this.textContent = value; })); +}; +d3_selectionPrototype.html = function(value) { + return arguments.length < 1 ? this.node().innerHTML + : (this.each(typeof value === "function" + ? function() { this.innerHTML = value.apply(this, arguments); } + : function() { this.innerHTML = value; })); +}; +// TODO append(node)? +// TODO append(function)? +d3_selectionPrototype.append = function(name) { + name = d3.ns.qualify(name); + + function append() { + return this.appendChild(document.createElementNS(this.namespaceURI, name)); + } + + function appendNS() { + return this.appendChild(document.createElementNS(name.space, name.local)); + } + + return this.select(name.local ? appendNS : append); +}; +// TODO insert(node, function)? +// TODO insert(function, string)? +// TODO insert(function, function)? +d3_selectionPrototype.insert = function(name, before) { + name = d3.ns.qualify(name); + + function insert() { + return this.insertBefore( + document.createElementNS(this.namespaceURI, name), + d3_select(before, this)); + } + + function insertNS() { + return this.insertBefore( + document.createElementNS(name.space, name.local), + d3_select(before, this)); + } + + return this.select(name.local ? insertNS : insert); +}; +// TODO remove(selector)? +// TODO remove(node)? +// TODO remove(function)? +d3_selectionPrototype.remove = function() { + return this.each(function() { + var parent = this.parentNode; + if (parent) parent.removeChild(this); + }); +}; +// TODO data(null) for clearing data? +d3_selectionPrototype.data = function(data, join) { + var enter = [], + update = [], + exit = []; + + function bind(group, groupData) { + var i, + n = group.length, + m = groupData.length, + n0 = Math.min(n, m), + n1 = Math.max(n, m), + updateNodes = [], + enterNodes = [], + exitNodes = [], + node, + nodeData; + + if (join) { + var nodeByKey = {}, + keys = [], + key, + j = groupData.length; + + for (i = -1; ++i < n;) { + key = join.call(node = group[i], node.__data__, i); + if (key in nodeByKey) { + exitNodes[j++] = node; // duplicate key + } else { + nodeByKey[key] = node; + } + keys.push(key); + } + + for (i = -1; ++i < m;) { + node = nodeByKey[key = join.call(groupData, nodeData = groupData[i], i)]; + if (node) { + node.__data__ = nodeData; + updateNodes[i] = node; + enterNodes[i] = exitNodes[i] = null; + } else { + enterNodes[i] = d3_selection_dataNode(nodeData); + updateNodes[i] = exitNodes[i] = null; + } + delete nodeByKey[key]; + } + + for (i = -1; ++i < n;) { + if (keys[i] in nodeByKey) { + exitNodes[i] = group[i]; + } + } + } else { + for (i = -1; ++i < n0;) { + node = group[i]; + nodeData = groupData[i]; + if (node) { + node.__data__ = nodeData; + updateNodes[i] = node; + enterNodes[i] = exitNodes[i] = null; + } else { + enterNodes[i] = d3_selection_dataNode(nodeData); + updateNodes[i] = exitNodes[i] = null; + } + } + for (; i < m; ++i) { + enterNodes[i] = d3_selection_dataNode(groupData[i]); + updateNodes[i] = exitNodes[i] = null; + } + for (; i < n1; ++i) { + exitNodes[i] = group[i]; + enterNodes[i] = updateNodes[i] = null; + } + } + + enterNodes.update + = updateNodes; + + enterNodes.parentNode + = updateNodes.parentNode + = exitNodes.parentNode + = group.parentNode; + + enter.push(enterNodes); + update.push(updateNodes); + exit.push(exitNodes); + } + + var i = -1, + n = this.length, + group; + if (typeof data === "function") { + while (++i < n) { + bind(group = this[i], data.call(group, group.parentNode.__data__, i)); + } + } else { + while (++i < n) { + bind(group = this[i], data); + } + } + + var selection = d3_selection(update); + selection.enter = function() { return d3_selection_enter(enter); }; + selection.exit = function() { return d3_selection(exit); }; + return selection; +}; + +function d3_selection_dataNode(data) { + return {__data__: data}; +} +d3_selectionPrototype.filter = function(filter) { + var subgroups = [], + subgroup, + group, + node; + + if (typeof filter !== "function") filter = d3_selection_filter(filter); + + for (var j = 0, m = this.length; j < m; j++) { + subgroups.push(subgroup = []); + subgroup.parentNode = (group = this[j]).parentNode; + for (var i = 0, n = group.length; i < n; i++) { + if ((node = group[i]) && filter.call(node, node.__data__, i)) { + subgroup.push(node); + } + } + } + + return d3_selection(subgroups); +}; + +function d3_selection_filter(selector) { + return function() { + return d3_selectMatches(this, selector); + }; +} +d3_selectionPrototype.map = function(map) { + return this.each(function() { + this.__data__ = map.apply(this, arguments); + }); +}; +d3_selectionPrototype.order = function() { + for (var j = -1, m = this.length; ++j < m;) { + for (var group = this[j], i = group.length - 1, next = group[i], node; --i >= 0;) { + if (node = group[i]) { + if (next) next.parentNode.insertBefore(node, next); + next = node; + } + } + } + return this; +}; +d3_selectionPrototype.sort = function(comparator) { + comparator = d3_selection_sortComparator.apply(this, arguments); + for (var j = -1, m = this.length; ++j < m;) this[j].sort(comparator); + return this.order(); +}; + +function d3_selection_sortComparator(comparator) { + if (!arguments.length) comparator = d3.ascending; + return function(a, b) { + return comparator(a && a.__data__, b && b.__data__); + }; +} +// type can be namespaced, e.g., "click.foo" +// listener can be null for removal +d3_selectionPrototype.on = function(type, listener, capture) { + if (arguments.length < 3) capture = false; + + // parse the type specifier + var name = "__on" + type, i = type.indexOf("."); + if (i > 0) type = type.substring(0, i); + + // if called with only one argument, return the current listener + if (arguments.length < 2) return (i = this.node()[name]) && i._; + + // remove the old event listener, and add the new event listener + return this.each(function(d, i) { + var node = this; + + if (node[name]) node.removeEventListener(type, node[name], capture); + if (listener) node.addEventListener(type, node[name] = l, capture); + + // wrapped event listener that preserves i + function l(e) { + var o = d3.event; // Events can be reentrant (e.g., focus). + d3.event = e; + try { + listener.call(node, node.__data__, i); + } finally { + d3.event = o; + } + } + + // stash the unwrapped listener for retrieval + l._ = listener; + }); +}; +d3_selectionPrototype.each = function(callback) { + for (var j = -1, m = this.length; ++j < m;) { + for (var group = this[j], i = -1, n = group.length; ++i < n;) { + var node = group[i]; + if (node) callback.call(node, node.__data__, i, j); + } + } + return this; +}; +// +// Note: assigning to the arguments array simultaneously changes the value of +// the corresponding argument! +// +// TODO The `this` argument probably shouldn't be the first argument to the +// callback, anyway, since it's redundant. However, that will require a major +// version bump due to backwards compatibility, so I'm not changing it right +// away. +// +d3_selectionPrototype.call = function(callback) { + callback.apply(this, (arguments[0] = this, arguments)); + return this; +}; +d3_selectionPrototype.empty = function() { + return !this.node(); +}; +d3_selectionPrototype.node = function(callback) { + for (var j = 0, m = this.length; j < m; j++) { + for (var group = this[j], i = 0, n = group.length; i < n; i++) { + var node = group[i]; + if (node) return node; + } + } + return null; +}; +d3_selectionPrototype.transition = function() { + var subgroups = [], + subgroup, + node; + + for (var j = -1, m = this.length; ++j < m;) { + subgroups.push(subgroup = []); + for (var group = this[j], i = -1, n = group.length; ++i < n;) { + subgroup.push((node = group[i]) ? {node: node, delay: 0, duration: 250} : null); + } + } + + return d3_transition(subgroups, d3_transitionInheritId || ++d3_transitionId, Date.now()); +}; +var d3_selectionRoot = d3_selection([[document]]); + +d3_selectionRoot[0].parentNode = d3_selectRoot; + +// TODO fast singleton implementation! +// TODO select(function) +d3.select = function(selector) { + return typeof selector === "string" + ? d3_selectionRoot.select(selector) + : d3_selection([[selector]]); // assume node +}; + +// TODO selectAll(function) +d3.selectAll = function(selector) { + return typeof selector === "string" + ? d3_selectionRoot.selectAll(selector) + : d3_selection([d3_array(selector)]); // assume node[] +}; +function d3_selection_enter(selection) { + d3_arraySubclass(selection, d3_selection_enterPrototype); + return selection; +} + +var d3_selection_enterPrototype = []; + +d3_selection_enterPrototype.append = d3_selectionPrototype.append; +d3_selection_enterPrototype.insert = d3_selectionPrototype.insert; +d3_selection_enterPrototype.empty = d3_selectionPrototype.empty; +d3_selection_enterPrototype.node = d3_selectionPrototype.node; +d3_selection_enterPrototype.select = function(selector) { + var subgroups = [], + subgroup, + subnode, + upgroup, + group, + node; + + for (var j = -1, m = this.length; ++j < m;) { + upgroup = (group = this[j]).update; + subgroups.push(subgroup = []); + subgroup.parentNode = group.parentNode; + for (var i = -1, n = group.length; ++i < n;) { + if (node = group[i]) { + subgroup.push(upgroup[i] = subnode = selector.call(group.parentNode, node.__data__, i)); + subnode.__data__ = node.__data__; + } else { + subgroup.push(null); + } + } + } + + return d3_selection(subgroups); +}; +function d3_transition(groups, id, time) { + d3_arraySubclass(groups, d3_transitionPrototype); + + var tweens = {}, + event = d3.dispatch("start", "end"), + ease = d3_transitionEase; + + groups.id = id; + + groups.time = time; + + groups.tween = function(name, tween) { + if (arguments.length < 2) return tweens[name]; + if (tween == null) delete tweens[name]; + else tweens[name] = tween; + return groups; + }; + + groups.ease = function(value) { + if (!arguments.length) return ease; + ease = typeof value === "function" ? value : d3.ease.apply(d3, arguments); + return groups; + }; + + groups.each = function(type, listener) { + if (arguments.length < 2) return d3_transition_each.call(groups, type); + event.on(type, listener); + return groups; + }; + + d3.timer(function(elapsed) { + groups.each(function(d, i, j) { + var tweened = [], + node = this, + delay = groups[j][i].delay, + duration = groups[j][i].duration, + lock = node.__transition__ || (node.__transition__ = {active: 0, count: 0}); + + ++lock.count; + + delay <= elapsed ? start(elapsed) : d3.timer(start, delay, time); + + function start(elapsed) { + if (lock.active > id) return stop(); + lock.active = id; + + for (var tween in tweens) { + if (tween = tweens[tween].call(node, d, i)) { + tweened.push(tween); + } + } + + event.start.call(node, d, i); + if (!tick(elapsed)) d3.timer(tick, 0, time); + return 1; + } + + function tick(elapsed) { + if (lock.active !== id) return stop(); + + var t = (elapsed - delay) / duration, + e = ease(t), + n = tweened.length; + + while (n > 0) { + tweened[--n].call(node, e); + } + + if (t >= 1) { + stop(); + d3_transitionInheritId = id; + event.end.call(node, d, i); + d3_transitionInheritId = 0; + return 1; + } + } + + function stop() { + if (!--lock.count) delete node.__transition__; + return 1; + } + }); + return 1; + }, 0, time); + + return groups; +} + +var d3_transitionRemove = {}; + +function d3_transitionNull(d, i, a) { + return a != "" && d3_transitionRemove; +} + +function d3_transitionTween(name, b) { + var interpolate = d3_interpolateByName(name); + + function transitionFunction(d, i, a) { + var v = b.call(this, d, i); + return v == null + ? a != "" && d3_transitionRemove + : a != v && interpolate(a, v); + } + + function transitionString(d, i, a) { + return a != b && interpolate(a, b); + } + + return typeof b === "function" ? transitionFunction + : b == null ? d3_transitionNull + : (b += "", transitionString); +} + +var d3_transitionPrototype = [], + d3_transitionId = 0, + d3_transitionInheritId = 0, + d3_transitionEase = d3.ease("cubic-in-out"); + +d3_transitionPrototype.call = d3_selectionPrototype.call; + +d3.transition = function() { + return d3_selectionRoot.transition(); +}; + +d3.transition.prototype = d3_transitionPrototype; +d3_transitionPrototype.select = function(selector) { + var subgroups = [], + subgroup, + subnode, + node; + + if (typeof selector !== "function") selector = d3_selection_selector(selector); + + for (var j = -1, m = this.length; ++j < m;) { + subgroups.push(subgroup = []); + for (var group = this[j], i = -1, n = group.length; ++i < n;) { + if ((node = group[i]) && (subnode = selector.call(node.node, node.node.__data__, i))) { + if ("__data__" in node.node) subnode.__data__ = node.node.__data__; + subgroup.push({node: subnode, delay: node.delay, duration: node.duration}); + } else { + subgroup.push(null); + } + } + } + + return d3_transition(subgroups, this.id, this.time).ease(this.ease()); +}; +d3_transitionPrototype.selectAll = function(selector) { + var subgroups = [], + subgroup, + subnodes, + node; + + if (typeof selector !== "function") selector = d3_selection_selectorAll(selector); + + for (var j = -1, m = this.length; ++j < m;) { + for (var group = this[j], i = -1, n = group.length; ++i < n;) { + if (node = group[i]) { + subnodes = selector.call(node.node, node.node.__data__, i); + subgroups.push(subgroup = []); + for (var k = -1, o = subnodes.length; ++k < o;) { + subgroup.push({node: subnodes[k], delay: node.delay, duration: node.duration}); + } + } + } + } + + return d3_transition(subgroups, this.id, this.time).ease(this.ease()); +}; +d3_transitionPrototype.attr = function(name, value) { + return this.attrTween(name, d3_transitionTween(name, value)); +}; + +d3_transitionPrototype.attrTween = function(nameNS, tween) { + var name = d3.ns.qualify(nameNS); + + function attrTween(d, i) { + var f = tween.call(this, d, i, this.getAttribute(name)); + return f === d3_transitionRemove + ? (this.removeAttribute(name), null) + : f && function(t) { this.setAttribute(name, f(t)); }; + } + + function attrTweenNS(d, i) { + var f = tween.call(this, d, i, this.getAttributeNS(name.space, name.local)); + return f === d3_transitionRemove + ? (this.removeAttributeNS(name.space, name.local), null) + : f && function(t) { this.setAttributeNS(name.space, name.local, f(t)); }; + } + + return this.tween("attr." + nameNS, name.local ? attrTweenNS : attrTween); +}; +d3_transitionPrototype.style = function(name, value, priority) { + if (arguments.length < 3) priority = ""; + return this.styleTween(name, d3_transitionTween(name, value), priority); +}; + +d3_transitionPrototype.styleTween = function(name, tween, priority) { + if (arguments.length < 3) priority = ""; + return this.tween("style." + name, function(d, i) { + var f = tween.call(this, d, i, window.getComputedStyle(this, null).getPropertyValue(name)); + return f === d3_transitionRemove + ? (this.style.removeProperty(name), null) + : f && function(t) { this.style.setProperty(name, f(t), priority); }; + }); +}; +d3_transitionPrototype.text = function(value) { + return this.tween("text", function(d, i) { + this.textContent = typeof value === "function" + ? value.call(this, d, i) + : value; + }); +}; +d3_transitionPrototype.remove = function() { + return this.each("end", function() { + var p; + if (!this.__transition__ && (p = this.parentNode)) p.removeChild(this); + }); +}; +d3_transitionPrototype.delay = function(value) { + var groups = this; + return groups.each(typeof value === "function" + ? function(d, i, j) { groups[j][i].delay = +value.apply(this, arguments); } + : (value = +value, function(d, i, j) { groups[j][i].delay = value; })); +}; +d3_transitionPrototype.duration = function(value) { + var groups = this; + return groups.each(typeof value === "function" + ? function(d, i, j) { groups[j][i].duration = +value.apply(this, arguments); } + : (value = +value, function(d, i, j) { groups[j][i].duration = value; })); +}; +function d3_transition_each(callback) { + for (var j = 0, m = this.length; j < m; j++) { + for (var group = this[j], i = 0, n = group.length; i < n; i++) { + var node = group[i]; + if (node) callback.call(node = node.node, node.__data__, i, j); + } + } + return this; +} +d3_transitionPrototype.transition = function() { + return this.select(d3_this); +}; +var d3_timer_queue = null, + d3_timer_interval, // is an interval (or frame) active? + d3_timer_timeout; // is a timeout active? + +// The timer will continue to fire until callback returns true. +d3.timer = function(callback, delay, then) { + var found = false, + t0, + t1 = d3_timer_queue; + + if (arguments.length < 3) { + if (arguments.length < 2) delay = 0; + else if (!isFinite(delay)) return; + then = Date.now(); + } + + // See if the callback's already in the queue. + while (t1) { + if (t1.callback === callback) { + t1.then = then; + t1.delay = delay; + found = true; + break; + } + t0 = t1; + t1 = t1.next; + } + + // Otherwise, add the callback to the queue. + if (!found) d3_timer_queue = { + callback: callback, + then: then, + delay: delay, + next: d3_timer_queue + }; + + // Start animatin'! + if (!d3_timer_interval) { + d3_timer_timeout = clearTimeout(d3_timer_timeout); + d3_timer_interval = 1; + d3_timer_frame(d3_timer_step); + } +} + +function d3_timer_step() { + var elapsed, + now = Date.now(), + t1 = d3_timer_queue; + + while (t1) { + elapsed = now - t1.then; + if (elapsed >= t1.delay) t1.flush = t1.callback(elapsed); + t1 = t1.next; + } + + var delay = d3_timer_flush() - now; + if (delay > 24) { + if (isFinite(delay)) { + clearTimeout(d3_timer_timeout); + d3_timer_timeout = setTimeout(d3_timer_step, delay); + } + d3_timer_interval = 0; + } else { + d3_timer_interval = 1; + d3_timer_frame(d3_timer_step); + } +} + +d3.timer.flush = function() { + var elapsed, + now = Date.now(), + t1 = d3_timer_queue; + + while (t1) { + elapsed = now - t1.then; + if (!t1.delay) t1.flush = t1.callback(elapsed); + t1 = t1.next; + } + + d3_timer_flush(); +}; + +// Flush after callbacks, to avoid concurrent queue modification. +function d3_timer_flush() { + var t0 = null, + t1 = d3_timer_queue, + then = Infinity; + while (t1) { + if (t1.flush) { + t1 = t0 ? t0.next = t1.next : d3_timer_queue = t1.next; + } else { + then = Math.min(then, t1.then + t1.delay); + t1 = (t0 = t1).next; + } + } + return then; +} + +var d3_timer_frame = window.requestAnimationFrame + || window.webkitRequestAnimationFrame + || window.mozRequestAnimationFrame + || window.oRequestAnimationFrame + || window.msRequestAnimationFrame + || function(callback) { setTimeout(callback, 17); }; +d3.transform = function(string) { + d3_transformG.setAttribute("transform", string); + var t = d3_transformG.transform.baseVal.consolidate(); + return new d3_transform(t ? t.matrix : d3_transformIdentity); +}; + +// Compute x-scale and normalize the first row. +// Compute shear and make second row orthogonal to first. +// Compute y-scale and normalize the second row. +// Finally, compute the rotation. +function d3_transform(m) { + var r0 = [m.a, m.b], + r1 = [m.c, m.d], + kx = d3_transformNormalize(r0), + kz = d3_transformDot(r0, r1), + ky = d3_transformNormalize(d3_transformCombine(r1, r0, -kz)) || 0; + if (r0[0] * r1[1] < r1[0] * r0[1]) { + r0[0] *= -1; + r0[1] *= -1; + kx *= -1; + kz *= -1; + } + this.rotate = (kx ? Math.atan2(r0[1], r0[0]) : Math.atan2(-r1[0], r1[1])) * d3_transformDegrees; + this.translate = [m.e, m.f]; + this.scale = [kx, ky]; + this.skew = ky ? Math.atan2(kz, ky) * d3_transformDegrees : 0; +}; + +d3_transform.prototype.toString = function() { + return "translate(" + this.translate + + ")rotate(" + this.rotate + + ")skewX(" + this.skew + + ")scale(" + this.scale + + ")"; +}; + +function d3_transformDot(a, b) { + return a[0] * b[0] + a[1] * b[1]; +} + +function d3_transformNormalize(a) { + var k = Math.sqrt(d3_transformDot(a, a)); + if (k) { + a[0] /= k; + a[1] /= k; + } + return k; +} + +function d3_transformCombine(a, b, k) { + a[0] += k * b[0]; + a[1] += k * b[1]; + return a; +} + +var d3_transformG = document.createElementNS(d3.ns.prefix.svg, "g"), + d3_transformIdentity = {a: 1, b: 0, c: 0, d: 1, e: 0, f: 0}, + d3_transformDegrees = 180 / Math.PI; +function d3_noop() {} +d3.scale = {}; + +function d3_scaleExtent(domain) { + var start = domain[0], stop = domain[domain.length - 1]; + return start < stop ? [start, stop] : [stop, start]; +} + +function d3_scaleRange(scale) { + return scale.rangeExtent ? scale.rangeExtent() : d3_scaleExtent(scale.range()); +} +function d3_scale_nice(domain, nice) { + var i0 = 0, + i1 = domain.length - 1, + x0 = domain[i0], + x1 = domain[i1], + dx; + + if (x1 < x0) { + dx = i0; i0 = i1; i1 = dx; + dx = x0; x0 = x1; x1 = dx; + } + + if (dx = x1 - x0) { + nice = nice(dx); + domain[i0] = nice.floor(x0); + domain[i1] = nice.ceil(x1); + } + + return domain; +} + +function d3_scale_niceDefault() { + return Math; +} +d3.scale.linear = function() { + return d3_scale_linear([0, 1], [0, 1], d3.interpolate, false); +}; + +function d3_scale_linear(domain, range, interpolate, clamp) { + var output, + input; + + function rescale() { + var linear = domain.length == 2 ? d3_scale_bilinear : d3_scale_polylinear, + uninterpolate = clamp ? d3_uninterpolateClamp : d3_uninterpolateNumber; + output = linear(domain, range, uninterpolate, interpolate); + input = linear(range, domain, uninterpolate, d3.interpolate); + return scale; + } + + function scale(x) { + return output(x); + } + + // Note: requires range is coercible to number! + scale.invert = function(y) { + return input(y); + }; + + scale.domain = function(x) { + if (!arguments.length) return domain; + domain = x.map(Number); + return rescale(); + }; + + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + return rescale(); + }; + + scale.rangeRound = function(x) { + return scale.range(x).interpolate(d3.interpolateRound); + }; + + scale.clamp = function(x) { + if (!arguments.length) return clamp; + clamp = x; + return rescale(); + }; + + scale.interpolate = function(x) { + if (!arguments.length) return interpolate; + interpolate = x; + return rescale(); + }; + + scale.ticks = function(m) { + return d3_scale_linearTicks(domain, m); + }; + + scale.tickFormat = function(m) { + return d3_scale_linearTickFormat(domain, m); + }; + + scale.nice = function() { + d3_scale_nice(domain, d3_scale_linearNice); + return rescale(); + }; + + scale.copy = function() { + return d3_scale_linear(domain, range, interpolate, clamp); + }; + + return rescale(); +}; + +function d3_scale_linearRebind(scale, linear) { + return d3.rebind(scale, linear, "range", "rangeRound", "interpolate", "clamp"); +} + +function d3_scale_linearNice(dx) { + dx = Math.pow(10, Math.round(Math.log(dx) / Math.LN10) - 1); + return { + floor: function(x) { return Math.floor(x / dx) * dx; }, + ceil: function(x) { return Math.ceil(x / dx) * dx; } + }; +} + +// TODO Dates? Ugh. +function d3_scale_linearTickRange(domain, m) { + var extent = d3_scaleExtent(domain), + span = extent[1] - extent[0], + step = Math.pow(10, Math.floor(Math.log(span / m) / Math.LN10)), + err = m / span * step; + + // Filter ticks to get closer to the desired count. + if (err <= .15) step *= 10; + else if (err <= .35) step *= 5; + else if (err <= .75) step *= 2; + + // Round start and stop values to step interval. + extent[0] = Math.ceil(extent[0] / step) * step; + extent[1] = Math.floor(extent[1] / step) * step + step * .5; // inclusive + extent[2] = step; + return extent; +} + +function d3_scale_linearTicks(domain, m) { + return d3.range.apply(d3, d3_scale_linearTickRange(domain, m)); +} + +function d3_scale_linearTickFormat(domain, m) { + return d3.format(",." + Math.max(0, -Math.floor(Math.log(d3_scale_linearTickRange(domain, m)[2]) / Math.LN10 + .01)) + "f"); +} +function d3_scale_bilinear(domain, range, uninterpolate, interpolate) { + var u = uninterpolate(domain[0], domain[1]), + i = interpolate(range[0], range[1]); + return function(x) { + return i(u(x)); + }; +} +function d3_scale_polylinear(domain, range, uninterpolate, interpolate) { + var u = [], + i = [], + j = 0, + n = domain.length; + + while (++j < n) { + u.push(uninterpolate(domain[j - 1], domain[j])); + i.push(interpolate(range[j - 1], range[j])); + } + + return function(x) { + var j = d3.bisect(domain, x, 1, domain.length - 1) - 1; + return i[j](u[j](x)); + }; +} +d3.scale.log = function() { + return d3_scale_log(d3.scale.linear(), d3_scale_logp); +}; + +function d3_scale_log(linear, log) { + var pow = log.pow; + + function scale(x) { + return linear(log(x)); + } + + scale.invert = function(x) { + return pow(linear.invert(x)); + }; + + scale.domain = function(x) { + if (!arguments.length) return linear.domain().map(pow); + log = x[0] < 0 ? d3_scale_logn : d3_scale_logp; + pow = log.pow; + linear.domain(x.map(log)); + return scale; + }; + + scale.nice = function() { + linear.domain(d3_scale_nice(linear.domain(), d3_scale_niceDefault)); + return scale; + }; + + scale.ticks = function() { + var extent = d3_scaleExtent(linear.domain()), + ticks = []; + if (extent.every(isFinite)) { + var i = Math.floor(extent[0]), + j = Math.ceil(extent[1]), + u = pow(extent[0]), + v = pow(extent[1]); + if (log === d3_scale_logn) { + ticks.push(pow(i)); + for (; i++ < j;) for (var k = 9; k > 0; k--) ticks.push(pow(i) * k); + } else { + for (; i < j; i++) for (var k = 1; k < 10; k++) ticks.push(pow(i) * k); + ticks.push(pow(i)); + } + for (i = 0; ticks[i] < u; i++) {} // strip small values + for (j = ticks.length; ticks[j - 1] > v; j--) {} // strip big values + ticks = ticks.slice(i, j); + } + return ticks; + }; + + scale.tickFormat = function(n, format) { + if (arguments.length < 2) format = d3_scale_logFormat; + if (arguments.length < 1) return format; + var k = n / scale.ticks().length, + f = log === d3_scale_logn ? (e = -1e-12, Math.floor) : (e = 1e-12, Math.ceil), + e; + return function(d) { + return d / pow(f(log(d) + e)) < k ? format(d) : ""; + }; + }; + + scale.copy = function() { + return d3_scale_log(linear.copy(), log); + }; + + return d3_scale_linearRebind(scale, linear); +}; + +var d3_scale_logFormat = d3.format(".0e"); + +function d3_scale_logp(x) { + return Math.log(x) / Math.LN10; +} + +function d3_scale_logn(x) { + return -Math.log(-x) / Math.LN10; +} + +d3_scale_logp.pow = function(x) { + return Math.pow(10, x); +}; + +d3_scale_logn.pow = function(x) { + return -Math.pow(10, -x); +}; +d3.scale.pow = function() { + return d3_scale_pow(d3.scale.linear(), 1); +}; + +function d3_scale_pow(linear, exponent) { + var powp = d3_scale_powPow(exponent), + powb = d3_scale_powPow(1 / exponent); + + function scale(x) { + return linear(powp(x)); + } + + scale.invert = function(x) { + return powb(linear.invert(x)); + }; + + scale.domain = function(x) { + if (!arguments.length) return linear.domain().map(powb); + linear.domain(x.map(powp)); + return scale; + }; + + scale.ticks = function(m) { + return d3_scale_linearTicks(scale.domain(), m); + }; + + scale.tickFormat = function(m) { + return d3_scale_linearTickFormat(scale.domain(), m); + }; + + scale.nice = function() { + return scale.domain(d3_scale_nice(scale.domain(), d3_scale_linearNice)); + }; + + scale.exponent = function(x) { + if (!arguments.length) return exponent; + var domain = scale.domain(); + powp = d3_scale_powPow(exponent = x); + powb = d3_scale_powPow(1 / exponent); + return scale.domain(domain); + }; + + scale.copy = function() { + return d3_scale_pow(linear.copy(), exponent); + }; + + return d3_scale_linearRebind(scale, linear); +}; + +function d3_scale_powPow(e) { + return function(x) { + return x < 0 ? -Math.pow(-x, e) : Math.pow(x, e); + }; +} +d3.scale.sqrt = function() { + return d3.scale.pow().exponent(.5); +}; +d3.scale.ordinal = function() { + return d3_scale_ordinal([], {t: "range", x: []}); +}; + +function d3_scale_ordinal(domain, ranger) { + var index, + range, + rangeBand; + + function scale(x) { + return range[((index[x] || (index[x] = domain.push(x))) - 1) % range.length]; + } + + function steps(start, step) { + return d3.range(domain.length).map(function(i) { return start + step * i; }); + } + + scale.domain = function(x) { + if (!arguments.length) return domain; + domain = []; + index = {}; + var i = -1, n = x.length, xi; + while (++i < n) if (!index[xi = x[i]]) index[xi] = domain.push(xi); + return scale[ranger.t](ranger.x, ranger.p); + }; + + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + rangeBand = 0; + ranger = {t: "range", x: x}; + return scale; + }; + + scale.rangePoints = function(x, padding) { + if (arguments.length < 2) padding = 0; + var start = x[0], + stop = x[1], + step = (stop - start) / (domain.length - 1 + padding); + range = steps(domain.length < 2 ? (start + stop) / 2 : start + step * padding / 2, step); + rangeBand = 0; + ranger = {t: "rangePoints", x: x, p: padding}; + return scale; + }; + + scale.rangeBands = function(x, padding) { + if (arguments.length < 2) padding = 0; + var start = x[0], + stop = x[1], + step = (stop - start) / (domain.length + padding); + range = steps(start + step * padding, step); + rangeBand = step * (1 - padding); + ranger = {t: "rangeBands", x: x, p: padding}; + return scale; + }; + + scale.rangeRoundBands = function(x, padding) { + if (arguments.length < 2) padding = 0; + var start = x[0], + stop = x[1], + step = Math.floor((stop - start) / (domain.length + padding)); + range = steps(start + Math.round((stop - start - (domain.length - padding) * step) / 2), step); + rangeBand = Math.round(step * (1 - padding)); + ranger = {t: "rangeRoundBands", x: x, p: padding}; + return scale; + }; + + scale.rangeBand = function() { + return rangeBand; + }; + + scale.rangeExtent = function() { + return ranger.x; + }; + + scale.copy = function() { + return d3_scale_ordinal(domain, ranger); + }; + + return scale.domain(domain); +}; +/* + * This product includes color specifications and designs developed by Cynthia + * Brewer (http://colorbrewer.org/). See lib/colorbrewer for more information. + */ + +d3.scale.category10 = function() { + return d3.scale.ordinal().range(d3_category10); +}; + +d3.scale.category20 = function() { + return d3.scale.ordinal().range(d3_category20); +}; + +d3.scale.category20b = function() { + return d3.scale.ordinal().range(d3_category20b); +}; + +d3.scale.category20c = function() { + return d3.scale.ordinal().range(d3_category20c); +}; + +var d3_category10 = [ + "#1f77b4", "#ff7f0e", "#2ca02c", "#d62728", "#9467bd", + "#8c564b", "#e377c2", "#7f7f7f", "#bcbd22", "#17becf" +]; + +var d3_category20 = [ + "#1f77b4", "#aec7e8", + "#ff7f0e", "#ffbb78", + "#2ca02c", "#98df8a", + "#d62728", "#ff9896", + "#9467bd", "#c5b0d5", + "#8c564b", "#c49c94", + "#e377c2", "#f7b6d2", + "#7f7f7f", "#c7c7c7", + "#bcbd22", "#dbdb8d", + "#17becf", "#9edae5" +]; + +var d3_category20b = [ + "#393b79", "#5254a3", "#6b6ecf", "#9c9ede", + "#637939", "#8ca252", "#b5cf6b", "#cedb9c", + "#8c6d31", "#bd9e39", "#e7ba52", "#e7cb94", + "#843c39", "#ad494a", "#d6616b", "#e7969c", + "#7b4173", "#a55194", "#ce6dbd", "#de9ed6" +]; + +var d3_category20c = [ + "#3182bd", "#6baed6", "#9ecae1", "#c6dbef", + "#e6550d", "#fd8d3c", "#fdae6b", "#fdd0a2", + "#31a354", "#74c476", "#a1d99b", "#c7e9c0", + "#756bb1", "#9e9ac8", "#bcbddc", "#dadaeb", + "#636363", "#969696", "#bdbdbd", "#d9d9d9" +]; +d3.scale.quantile = function() { + return d3_scale_quantile([], []); +}; + +function d3_scale_quantile(domain, range) { + var thresholds; + + function rescale() { + var k = 0, + n = domain.length, + q = range.length; + thresholds = []; + while (++k < q) thresholds[k - 1] = d3.quantile(domain, k / q); + return scale; + } + + function scale(x) { + if (isNaN(x = +x)) return NaN; + return range[d3.bisect(thresholds, x)]; + } + + scale.domain = function(x) { + if (!arguments.length) return domain; + domain = x.filter(function(d) { return !isNaN(d); }).sort(d3.ascending); + return rescale(); + }; + + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + return rescale(); + }; + + scale.quantiles = function() { + return thresholds; + }; + + scale.copy = function() { + return d3_scale_quantile(domain, range); // copy on write! + }; + + return rescale(); +}; +d3.scale.quantize = function() { + return d3_scale_quantize(0, 1, [0, 1]); +}; + +function d3_scale_quantize(x0, x1, range) { + var kx, i; + + function scale(x) { + return range[Math.max(0, Math.min(i, Math.floor(kx * (x - x0))))]; + } + + function rescale() { + kx = range.length / (x1 - x0); + i = range.length - 1; + return scale; + } + + scale.domain = function(x) { + if (!arguments.length) return [x0, x1]; + x0 = +x[0]; + x1 = +x[x.length - 1]; + return rescale(); + }; + + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + return rescale(); + }; + + scale.copy = function() { + return d3_scale_quantize(x0, x1, range); // copy on write + }; + + return rescale(); +}; +d3.svg = {}; +d3.svg.arc = function() { + var innerRadius = d3_svg_arcInnerRadius, + outerRadius = d3_svg_arcOuterRadius, + startAngle = d3_svg_arcStartAngle, + endAngle = d3_svg_arcEndAngle; + + function arc() { + var r0 = innerRadius.apply(this, arguments), + r1 = outerRadius.apply(this, arguments), + a0 = startAngle.apply(this, arguments) + d3_svg_arcOffset, + a1 = endAngle.apply(this, arguments) + d3_svg_arcOffset, + da = (a1 < a0 && (da = a0, a0 = a1, a1 = da), a1 - a0), + df = da < Math.PI ? "0" : "1", + c0 = Math.cos(a0), + s0 = Math.sin(a0), + c1 = Math.cos(a1), + s1 = Math.sin(a1); + return da >= d3_svg_arcMax + ? (r0 + ? "M0," + r1 + + "A" + r1 + "," + r1 + " 0 1,1 0," + (-r1) + + "A" + r1 + "," + r1 + " 0 1,1 0," + r1 + + "M0," + r0 + + "A" + r0 + "," + r0 + " 0 1,0 0," + (-r0) + + "A" + r0 + "," + r0 + " 0 1,0 0," + r0 + + "Z" + : "M0," + r1 + + "A" + r1 + "," + r1 + " 0 1,1 0," + (-r1) + + "A" + r1 + "," + r1 + " 0 1,1 0," + r1 + + "Z") + : (r0 + ? "M" + r1 * c0 + "," + r1 * s0 + + "A" + r1 + "," + r1 + " 0 " + df + ",1 " + r1 * c1 + "," + r1 * s1 + + "L" + r0 * c1 + "," + r0 * s1 + + "A" + r0 + "," + r0 + " 0 " + df + ",0 " + r0 * c0 + "," + r0 * s0 + + "Z" + : "M" + r1 * c0 + "," + r1 * s0 + + "A" + r1 + "," + r1 + " 0 " + df + ",1 " + r1 * c1 + "," + r1 * s1 + + "L0,0" + + "Z"); + } + + arc.innerRadius = function(v) { + if (!arguments.length) return innerRadius; + innerRadius = d3.functor(v); + return arc; + }; + + arc.outerRadius = function(v) { + if (!arguments.length) return outerRadius; + outerRadius = d3.functor(v); + return arc; + }; + + arc.startAngle = function(v) { + if (!arguments.length) return startAngle; + startAngle = d3.functor(v); + return arc; + }; + + arc.endAngle = function(v) { + if (!arguments.length) return endAngle; + endAngle = d3.functor(v); + return arc; + }; + + arc.centroid = function() { + var r = (innerRadius.apply(this, arguments) + + outerRadius.apply(this, arguments)) / 2, + a = (startAngle.apply(this, arguments) + + endAngle.apply(this, arguments)) / 2 + d3_svg_arcOffset; + return [Math.cos(a) * r, Math.sin(a) * r]; + }; + + return arc; +}; + +var d3_svg_arcOffset = -Math.PI / 2, + d3_svg_arcMax = 2 * Math.PI - 1e-6; + +function d3_svg_arcInnerRadius(d) { + return d.innerRadius; +} + +function d3_svg_arcOuterRadius(d) { + return d.outerRadius; +} + +function d3_svg_arcStartAngle(d) { + return d.startAngle; +} + +function d3_svg_arcEndAngle(d) { + return d.endAngle; +} +function d3_svg_line(projection) { + var x = d3_svg_lineX, + y = d3_svg_lineY, + interpolate = "linear", + interpolator = d3_svg_lineInterpolators[interpolate], + tension = .7; + + function line(d) { + return d.length < 1 ? null : "M" + interpolator(projection(d3_svg_linePoints(this, d, x, y)), tension); + } + + line.x = function(v) { + if (!arguments.length) return x; + x = v; + return line; + }; + + line.y = function(v) { + if (!arguments.length) return y; + y = v; + return line; + }; + + line.interpolate = function(v) { + if (!arguments.length) return interpolate; + interpolator = d3_svg_lineInterpolators[interpolate = v]; + return line; + }; + + line.tension = function(v) { + if (!arguments.length) return tension; + tension = v; + return line; + }; + + return line; +} + +d3.svg.line = function() { + return d3_svg_line(Object); +}; + +// Converts the specified array of data into an array of points +// (x-y tuples), by evaluating the specified `x` and `y` functions on each +// data point. The `this` context of the evaluated functions is the specified +// "self" object; each function is passed the current datum and index. +function d3_svg_linePoints(self, d, x, y) { + var points = [], + i = -1, + n = d.length, + fx = typeof x === "function", + fy = typeof y === "function", + value; + if (fx && fy) { + while (++i < n) points.push([ + x.call(self, value = d[i], i), + y.call(self, value, i) + ]); + } else if (fx) { + while (++i < n) points.push([x.call(self, d[i], i), y]); + } else if (fy) { + while (++i < n) points.push([x, y.call(self, d[i], i)]); + } else { + while (++i < n) points.push([x, y]); + } + return points; +} + +// The default `x` property, which references d[0]. +function d3_svg_lineX(d) { + return d[0]; +} + +// The default `y` property, which references d[1]. +function d3_svg_lineY(d) { + return d[1]; +} + +// The various interpolators supported by the `line` class. +var d3_svg_lineInterpolators = { + "linear": d3_svg_lineLinear, + "step-before": d3_svg_lineStepBefore, + "step-after": d3_svg_lineStepAfter, + "basis": d3_svg_lineBasis, + "basis-open": d3_svg_lineBasisOpen, + "basis-closed": d3_svg_lineBasisClosed, + "bundle": d3_svg_lineBundle, + "cardinal": d3_svg_lineCardinal, + "cardinal-open": d3_svg_lineCardinalOpen, + "cardinal-closed": d3_svg_lineCardinalClosed, + "monotone": d3_svg_lineMonotone +}; + +// Linear interpolation; generates "L" commands. +function d3_svg_lineLinear(points) { + var i = 0, + n = points.length, + p = points[0], + path = [p[0], ",", p[1]]; + while (++i < n) path.push("L", (p = points[i])[0], ",", p[1]); + return path.join(""); +} + +// Step interpolation; generates "H" and "V" commands. +function d3_svg_lineStepBefore(points) { + var i = 0, + n = points.length, + p = points[0], + path = [p[0], ",", p[1]]; + while (++i < n) path.push("V", (p = points[i])[1], "H", p[0]); + return path.join(""); +} + +// Step interpolation; generates "H" and "V" commands. +function d3_svg_lineStepAfter(points) { + var i = 0, + n = points.length, + p = points[0], + path = [p[0], ",", p[1]]; + while (++i < n) path.push("H", (p = points[i])[0], "V", p[1]); + return path.join(""); +} + +// Open cardinal spline interpolation; generates "C" commands. +function d3_svg_lineCardinalOpen(points, tension) { + return points.length < 4 + ? d3_svg_lineLinear(points) + : points[1] + d3_svg_lineHermite(points.slice(1, points.length - 1), + d3_svg_lineCardinalTangents(points, tension)); +} + +// Closed cardinal spline interpolation; generates "C" commands. +function d3_svg_lineCardinalClosed(points, tension) { + return points.length < 3 + ? d3_svg_lineLinear(points) + : points[0] + d3_svg_lineHermite((points.push(points[0]), points), + d3_svg_lineCardinalTangents([points[points.length - 2]] + .concat(points, [points[1]]), tension)); +} + +// Cardinal spline interpolation; generates "C" commands. +function d3_svg_lineCardinal(points, tension, closed) { + return points.length < 3 + ? d3_svg_lineLinear(points) + : points[0] + d3_svg_lineHermite(points, + d3_svg_lineCardinalTangents(points, tension)); +} + +// Hermite spline construction; generates "C" commands. +function d3_svg_lineHermite(points, tangents) { + if (tangents.length < 1 + || (points.length != tangents.length + && points.length != tangents.length + 2)) { + return d3_svg_lineLinear(points); + } + + var quad = points.length != tangents.length, + path = "", + p0 = points[0], + p = points[1], + t0 = tangents[0], + t = t0, + pi = 1; + + if (quad) { + path += "Q" + (p[0] - t0[0] * 2 / 3) + "," + (p[1] - t0[1] * 2 / 3) + + "," + p[0] + "," + p[1]; + p0 = points[1]; + pi = 2; + } + + if (tangents.length > 1) { + t = tangents[1]; + p = points[pi]; + pi++; + path += "C" + (p0[0] + t0[0]) + "," + (p0[1] + t0[1]) + + "," + (p[0] - t[0]) + "," + (p[1] - t[1]) + + "," + p[0] + "," + p[1]; + for (var i = 2; i < tangents.length; i++, pi++) { + p = points[pi]; + t = tangents[i]; + path += "S" + (p[0] - t[0]) + "," + (p[1] - t[1]) + + "," + p[0] + "," + p[1]; + } + } + + if (quad) { + var lp = points[pi]; + path += "Q" + (p[0] + t[0] * 2 / 3) + "," + (p[1] + t[1] * 2 / 3) + + "," + lp[0] + "," + lp[1]; + } + + return path; +} + +// Generates tangents for a cardinal spline. +function d3_svg_lineCardinalTangents(points, tension) { + var tangents = [], + a = (1 - tension) / 2, + p0, + p1 = points[0], + p2 = points[1], + i = 1, + n = points.length; + while (++i < n) { + p0 = p1; + p1 = p2; + p2 = points[i]; + tangents.push([a * (p2[0] - p0[0]), a * (p2[1] - p0[1])]); + } + return tangents; +} + +// B-spline interpolation; generates "C" commands. +function d3_svg_lineBasis(points) { + if (points.length < 3) return d3_svg_lineLinear(points); + var i = 1, + n = points.length, + pi = points[0], + x0 = pi[0], + y0 = pi[1], + px = [x0, x0, x0, (pi = points[1])[0]], + py = [y0, y0, y0, pi[1]], + path = [x0, ",", y0]; + d3_svg_lineBasisBezier(path, px, py); + while (++i < n) { + pi = points[i]; + px.shift(); px.push(pi[0]); + py.shift(); py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + i = -1; + while (++i < 2) { + px.shift(); px.push(pi[0]); + py.shift(); py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + return path.join(""); +} + +// Open B-spline interpolation; generates "C" commands. +function d3_svg_lineBasisOpen(points) { + if (points.length < 4) return d3_svg_lineLinear(points); + var path = [], + i = -1, + n = points.length, + pi, + px = [0], + py = [0]; + while (++i < 3) { + pi = points[i]; + px.push(pi[0]); + py.push(pi[1]); + } + path.push(d3_svg_lineDot4(d3_svg_lineBasisBezier3, px) + + "," + d3_svg_lineDot4(d3_svg_lineBasisBezier3, py)); + --i; while (++i < n) { + pi = points[i]; + px.shift(); px.push(pi[0]); + py.shift(); py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + return path.join(""); +} + +// Closed B-spline interpolation; generates "C" commands. +function d3_svg_lineBasisClosed(points) { + var path, + i = -1, + n = points.length, + m = n + 4, + pi, + px = [], + py = []; + while (++i < 4) { + pi = points[i % n]; + px.push(pi[0]); + py.push(pi[1]); + } + path = [ + d3_svg_lineDot4(d3_svg_lineBasisBezier3, px), ",", + d3_svg_lineDot4(d3_svg_lineBasisBezier3, py) + ]; + --i; while (++i < m) { + pi = points[i % n]; + px.shift(); px.push(pi[0]); + py.shift(); py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + return path.join(""); +} + +function d3_svg_lineBundle(points, tension) { + var n = points.length - 1, + x0 = points[0][0], + y0 = points[0][1], + dx = points[n][0] - x0, + dy = points[n][1] - y0, + i = -1, + p, + t; + while (++i <= n) { + p = points[i]; + t = i / n; + p[0] = tension * p[0] + (1 - tension) * (x0 + t * dx); + p[1] = tension * p[1] + (1 - tension) * (y0 + t * dy); + } + return d3_svg_lineBasis(points); +} + +// Returns the dot product of the given four-element vectors. +function d3_svg_lineDot4(a, b) { + return a[0] * b[0] + a[1] * b[1] + a[2] * b[2] + a[3] * b[3]; +} + +// Matrix to transform basis (b-spline) control points to bezier +// control points. Derived from FvD 11.2.8. +var d3_svg_lineBasisBezier1 = [0, 2/3, 1/3, 0], + d3_svg_lineBasisBezier2 = [0, 1/3, 2/3, 0], + d3_svg_lineBasisBezier3 = [0, 1/6, 2/3, 1/6]; + +// Pushes a "C" Bézier curve onto the specified path array, given the +// two specified four-element arrays which define the control points. +function d3_svg_lineBasisBezier(path, x, y) { + path.push( + "C", d3_svg_lineDot4(d3_svg_lineBasisBezier1, x), + ",", d3_svg_lineDot4(d3_svg_lineBasisBezier1, y), + ",", d3_svg_lineDot4(d3_svg_lineBasisBezier2, x), + ",", d3_svg_lineDot4(d3_svg_lineBasisBezier2, y), + ",", d3_svg_lineDot4(d3_svg_lineBasisBezier3, x), + ",", d3_svg_lineDot4(d3_svg_lineBasisBezier3, y)); +} + +// Computes the slope from points p0 to p1. +function d3_svg_lineSlope(p0, p1) { + return (p1[1] - p0[1]) / (p1[0] - p0[0]); +} + +// Compute three-point differences for the given points. +// http://en.wikipedia.org/wiki/Cubic_Hermite_spline#Finite_difference +function d3_svg_lineFiniteDifferences(points) { + var i = 0, + j = points.length - 1, + m = [], + p0 = points[0], + p1 = points[1], + d = m[0] = d3_svg_lineSlope(p0, p1); + while (++i < j) { + m[i] = d + (d = d3_svg_lineSlope(p0 = p1, p1 = points[i + 1])); + } + m[i] = d; + return m; +} + +// Interpolates the given points using Fritsch-Carlson Monotone cubic Hermite +// interpolation. Returns an array of tangent vectors. For details, see +// http://en.wikipedia.org/wiki/Monotone_cubic_interpolation +function d3_svg_lineMonotoneTangents(points) { + var tangents = [], + d, + a, + b, + s, + m = d3_svg_lineFiniteDifferences(points), + i = -1, + j = points.length - 1; + + // The first two steps are done by computing finite-differences: + // 1. Compute the slopes of the secant lines between successive points. + // 2. Initialize the tangents at every point as the average of the secants. + + // Then, for each segment… + while (++i < j) { + d = d3_svg_lineSlope(points[i], points[i + 1]); + + // 3. If two successive yk = y{k + 1} are equal (i.e., d is zero), then set + // mk = m{k + 1} = 0 as the spline connecting these points must be flat to + // preserve monotonicity. Ignore step 4 and 5 for those k. + + if (Math.abs(d) < 1e-6) { + m[i] = m[i + 1] = 0; + } else { + // 4. Let ak = mk / dk and bk = m{k + 1} / dk. + a = m[i] / d; + b = m[i + 1] / d; + + // 5. Prevent overshoot and ensure monotonicity by restricting the + // magnitude of vector <ak, bk> to a circle of radius 3. + s = a * a + b * b; + if (s > 9) { + s = d * 3 / Math.sqrt(s); + m[i] = s * a; + m[i + 1] = s * b; + } + } + } + + // Compute the normalized tangent vector from the slopes. Note that if x is + // not monotonic, it's possible that the slope will be infinite, so we protect + // against NaN by setting the coordinate to zero. + i = -1; while (++i <= j) { + s = (points[Math.min(j, i + 1)][0] - points[Math.max(0, i - 1)][0]) + / (6 * (1 + m[i] * m[i])); + tangents.push([s || 0, m[i] * s || 0]); + } + + return tangents; +} + +function d3_svg_lineMonotone(points) { + return points.length < 3 + ? d3_svg_lineLinear(points) + : points[0] + + d3_svg_lineHermite(points, d3_svg_lineMonotoneTangents(points)); +} +d3.svg.line.radial = function() { + var line = d3_svg_line(d3_svg_lineRadial); + line.radius = line.x, delete line.x; + line.angle = line.y, delete line.y; + return line; +}; + +function d3_svg_lineRadial(points) { + var point, + i = -1, + n = points.length, + r, + a; + while (++i < n) { + point = points[i]; + r = point[0]; + a = point[1] + d3_svg_arcOffset; + point[0] = r * Math.cos(a); + point[1] = r * Math.sin(a); + } + return points; +} +function d3_svg_area(projection) { + var x0 = d3_svg_lineX, + x1 = d3_svg_lineX, + y0 = 0, + y1 = d3_svg_lineY, + interpolate, + i0, + i1, + tension = .7; + + function area(d) { + if (d.length < 1) return null; + var points0 = d3_svg_linePoints(this, d, x0, y0), + points1 = d3_svg_linePoints(this, d, x0 === x1 ? d3_svg_areaX(points0) : x1, y0 === y1 ? d3_svg_areaY(points0) : y1); + return "M" + i0(projection(points1), tension) + + "L" + i1(projection(points0.reverse()), tension) + + "Z"; + } + + area.x = function(x) { + if (!arguments.length) return x1; + x0 = x1 = x; + return area; + }; + + area.x0 = function(x) { + if (!arguments.length) return x0; + x0 = x; + return area; + }; + + area.x1 = function(x) { + if (!arguments.length) return x1; + x1 = x; + return area; + }; + + area.y = function(y) { + if (!arguments.length) return y1; + y0 = y1 = y; + return area; + }; + + area.y0 = function(y) { + if (!arguments.length) return y0; + y0 = y; + return area; + }; + + area.y1 = function(y) { + if (!arguments.length) return y1; + y1 = y; + return area; + }; + + area.interpolate = function(x) { + if (!arguments.length) return interpolate; + i0 = d3_svg_lineInterpolators[interpolate = x]; + i1 = i0.reverse || i0; + return area; + }; + + area.tension = function(x) { + if (!arguments.length) return tension; + tension = x; + return area; + }; + + return area.interpolate("linear"); +} + +d3_svg_lineStepBefore.reverse = d3_svg_lineStepAfter; +d3_svg_lineStepAfter.reverse = d3_svg_lineStepBefore; + +d3.svg.area = function() { + return d3_svg_area(Object); +}; + +function d3_svg_areaX(points) { + return function(d, i) { + return points[i][0]; + }; +} + +function d3_svg_areaY(points) { + return function(d, i) { + return points[i][1]; + }; +} +d3.svg.area.radial = function() { + var area = d3_svg_area(d3_svg_lineRadial); + area.radius = area.x, delete area.x; + area.innerRadius = area.x0, delete area.x0; + area.outerRadius = area.x1, delete area.x1; + area.angle = area.y, delete area.y; + area.startAngle = area.y0, delete area.y0; + area.endAngle = area.y1, delete area.y1; + return area; +}; +d3.svg.chord = function() { + var source = d3_svg_chordSource, + target = d3_svg_chordTarget, + radius = d3_svg_chordRadius, + startAngle = d3_svg_arcStartAngle, + endAngle = d3_svg_arcEndAngle; + + // TODO Allow control point to be customized. + + function chord(d, i) { + var s = subgroup(this, source, d, i), + t = subgroup(this, target, d, i); + return "M" + s.p0 + + arc(s.r, s.p1) + (equals(s, t) + ? curve(s.r, s.p1, s.r, s.p0) + : curve(s.r, s.p1, t.r, t.p0) + + arc(t.r, t.p1) + + curve(t.r, t.p1, s.r, s.p0)) + + "Z"; + } + + function subgroup(self, f, d, i) { + var subgroup = f.call(self, d, i), + r = radius.call(self, subgroup, i), + a0 = startAngle.call(self, subgroup, i) + d3_svg_arcOffset, + a1 = endAngle.call(self, subgroup, i) + d3_svg_arcOffset; + return { + r: r, + a0: a0, + a1: a1, + p0: [r * Math.cos(a0), r * Math.sin(a0)], + p1: [r * Math.cos(a1), r * Math.sin(a1)] + }; + } + + function equals(a, b) { + return a.a0 == b.a0 && a.a1 == b.a1; + } + + function arc(r, p) { + return "A" + r + "," + r + " 0 0,1 " + p; + } + + function curve(r0, p0, r1, p1) { + return "Q 0,0 " + p1; + } + + chord.radius = function(v) { + if (!arguments.length) return radius; + radius = d3.functor(v); + return chord; + }; + + chord.source = function(v) { + if (!arguments.length) return source; + source = d3.functor(v); + return chord; + }; + + chord.target = function(v) { + if (!arguments.length) return target; + target = d3.functor(v); + return chord; + }; + + chord.startAngle = function(v) { + if (!arguments.length) return startAngle; + startAngle = d3.functor(v); + return chord; + }; + + chord.endAngle = function(v) { + if (!arguments.length) return endAngle; + endAngle = d3.functor(v); + return chord; + }; + + return chord; +}; + +function d3_svg_chordSource(d) { + return d.source; +} + +function d3_svg_chordTarget(d) { + return d.target; +} + +function d3_svg_chordRadius(d) { + return d.radius; +} + +function d3_svg_chordStartAngle(d) { + return d.startAngle; +} + +function d3_svg_chordEndAngle(d) { + return d.endAngle; +} +d3.svg.diagonal = function() { + var source = d3_svg_chordSource, + target = d3_svg_chordTarget, + projection = d3_svg_diagonalProjection; + + function diagonal(d, i) { + var p0 = source.call(this, d, i), + p3 = target.call(this, d, i), + m = (p0.y + p3.y) / 2, + p = [p0, {x: p0.x, y: m}, {x: p3.x, y: m}, p3]; + p = p.map(projection); + return "M" + p[0] + "C" + p[1] + " " + p[2] + " " + p[3]; + } + + diagonal.source = function(x) { + if (!arguments.length) return source; + source = d3.functor(x); + return diagonal; + }; + + diagonal.target = function(x) { + if (!arguments.length) return target; + target = d3.functor(x); + return diagonal; + }; + + diagonal.projection = function(x) { + if (!arguments.length) return projection; + projection = x; + return diagonal; + }; + + return diagonal; +}; + +function d3_svg_diagonalProjection(d) { + return [d.x, d.y]; +} +d3.svg.diagonal.radial = function() { + var diagonal = d3.svg.diagonal(), + projection = d3_svg_diagonalProjection, + projection_ = diagonal.projection; + + diagonal.projection = function(x) { + return arguments.length + ? projection_(d3_svg_diagonalRadialProjection(projection = x)) + : projection; + }; + + return diagonal; +}; + +function d3_svg_diagonalRadialProjection(projection) { + return function() { + var d = projection.apply(this, arguments), + r = d[0], + a = d[1] + d3_svg_arcOffset; + return [r * Math.cos(a), r * Math.sin(a)]; + }; +} +d3.svg.mouse = function(container) { + return d3_svg_mousePoint(container, d3.event); +}; + +// https://bugs.webkit.org/show_bug.cgi?id=44083 +var d3_mouse_bug44083 = /WebKit/.test(navigator.userAgent) ? -1 : 0; + +function d3_svg_mousePoint(container, e) { + var point = (container.ownerSVGElement || container).createSVGPoint(); + if ((d3_mouse_bug44083 < 0) && (window.scrollX || window.scrollY)) { + var svg = d3.select(document.body) + .append("svg") + .style("position", "absolute") + .style("top", 0) + .style("left", 0); + var ctm = svg[0][0].getScreenCTM(); + d3_mouse_bug44083 = !(ctm.f || ctm.e); + svg.remove(); + } + if (d3_mouse_bug44083) { + point.x = e.pageX; + point.y = e.pageY; + } else { + point.x = e.clientX; + point.y = e.clientY; + } + point = point.matrixTransform(container.getScreenCTM().inverse()); + return [point.x, point.y]; +}; +d3.svg.touches = function(container, touches) { + if (arguments.length < 2) touches = d3.event.touches; + + return touches ? d3_array(touches).map(function(touch) { + var point = d3_svg_mousePoint(container, touch); + point.identifier = touch.identifier; + return point; + }) : []; +}; +d3.svg.symbol = function() { + var type = d3_svg_symbolType, + size = d3_svg_symbolSize; + + function symbol(d, i) { + return (d3_svg_symbols[type.call(this, d, i)] + || d3_svg_symbols.circle) + (size.call(this, d, i)); + } + + symbol.type = function(x) { + if (!arguments.length) return type; + type = d3.functor(x); + return symbol; + }; + + // size of symbol in square pixels + symbol.size = function(x) { + if (!arguments.length) return size; + size = d3.functor(x); + return symbol; + }; + + return symbol; +}; + +function d3_svg_symbolSize() { + return 64; +} + +function d3_svg_symbolType() { + return "circle"; +} + +// TODO cross-diagonal? +var d3_svg_symbols = { + "circle": function(size) { + var r = Math.sqrt(size / Math.PI); + return "M0," + r + + "A" + r + "," + r + " 0 1,1 0," + (-r) + + "A" + r + "," + r + " 0 1,1 0," + r + + "Z"; + }, + "cross": function(size) { + var r = Math.sqrt(size / 5) / 2; + return "M" + -3 * r + "," + -r + + "H" + -r + + "V" + -3 * r + + "H" + r + + "V" + -r + + "H" + 3 * r + + "V" + r + + "H" + r + + "V" + 3 * r + + "H" + -r + + "V" + r + + "H" + -3 * r + + "Z"; + }, + "diamond": function(size) { + var ry = Math.sqrt(size / (2 * d3_svg_symbolTan30)), + rx = ry * d3_svg_symbolTan30; + return "M0," + -ry + + "L" + rx + ",0" + + " 0," + ry + + " " + -rx + ",0" + + "Z"; + }, + "square": function(size) { + var r = Math.sqrt(size) / 2; + return "M" + -r + "," + -r + + "L" + r + "," + -r + + " " + r + "," + r + + " " + -r + "," + r + + "Z"; + }, + "triangle-down": function(size) { + var rx = Math.sqrt(size / d3_svg_symbolSqrt3), + ry = rx * d3_svg_symbolSqrt3 / 2; + return "M0," + ry + + "L" + rx +"," + -ry + + " " + -rx + "," + -ry + + "Z"; + }, + "triangle-up": function(size) { + var rx = Math.sqrt(size / d3_svg_symbolSqrt3), + ry = rx * d3_svg_symbolSqrt3 / 2; + return "M0," + -ry + + "L" + rx +"," + ry + + " " + -rx + "," + ry + + "Z"; + } +}; + +d3.svg.symbolTypes = d3.keys(d3_svg_symbols); + +var d3_svg_symbolSqrt3 = Math.sqrt(3), + d3_svg_symbolTan30 = Math.tan(30 * Math.PI / 180); +d3.svg.axis = function() { + var scale = d3.scale.linear(), + orient = "bottom", + tickMajorSize = 6, + tickMinorSize = 6, + tickEndSize = 6, + tickPadding = 3, + tickArguments_ = [10], + tickFormat_, + tickSubdivide = 0; + + function axis(selection) { + selection.each(function(d, i, j) { + var g = d3.select(this); + + // If selection is a transition, create subtransitions. + var transition = selection.delay ? function(o) { + var id = d3_transitionInheritId; + try { + d3_transitionInheritId = selection.id; + return o.transition() + .delay(selection[j][i].delay) + .duration(selection[j][i].duration) + .ease(selection.ease()); + } finally { + d3_transitionInheritId = id; + } + } : Object; + + // Ticks, or domain values for ordinal scales. + var ticks = scale.ticks ? scale.ticks.apply(scale, tickArguments_) : scale.domain(), + tickFormat = tickFormat_ == null ? (scale.tickFormat ? scale.tickFormat.apply(scale, tickArguments_) : String) : tickFormat_; + + // Minor ticks. + var subticks = d3_svg_axisSubdivide(scale, ticks, tickSubdivide), + subtick = g.selectAll(".minor").data(subticks, String), + subtickEnter = subtick.enter().insert("line", "g").attr("class", "tick minor").style("opacity", 1e-6), + subtickExit = transition(subtick.exit()).style("opacity", 1e-6).remove(), + subtickUpdate = transition(subtick).style("opacity", 1); + + // Major ticks. + var tick = g.selectAll("g").data(ticks, String), + tickEnter = tick.enter().insert("g", "path").style("opacity", 1e-6), + tickExit = transition(tick.exit()).style("opacity", 1e-6).remove(), + tickUpdate = transition(tick).style("opacity", 1), + tickTransform; + + // Domain. + var range = d3_scaleRange(scale), + path = g.selectAll(".domain").data([0]), + pathEnter = path.enter().append("path").attr("class", "domain"), + pathUpdate = transition(path); + + // Stash a snapshot of the new scale, and retrieve the old snapshot. + var scale1 = scale.copy(), + scale0 = this.__chart__ || scale1; + this.__chart__ = scale1; + + tickEnter.append("line").attr("class", "tick"); + tickEnter.append("text"); + tickUpdate.select("text").text(tickFormat); + + switch (orient) { + case "bottom": { + tickTransform = d3_svg_axisX; + subtickUpdate.attr("x2", 0).attr("y2", tickMinorSize); + tickUpdate.select("line").attr("x2", 0).attr("y2", tickMajorSize); + tickUpdate.select("text").attr("x", 0).attr("y", Math.max(tickMajorSize, 0) + tickPadding).attr("dy", ".71em").attr("text-anchor", "middle"); + pathUpdate.attr("d", "M" + range[0] + "," + tickEndSize + "V0H" + range[1] + "V" + tickEndSize); + break; + } + case "top": { + tickTransform = d3_svg_axisX; + subtickUpdate.attr("x2", 0).attr("y2", -tickMinorSize); + tickUpdate.select("line").attr("x2", 0).attr("y2", -tickMajorSize); + tickUpdate.select("text").attr("x", 0).attr("y", -(Math.max(tickMajorSize, 0) + tickPadding)).attr("dy", "0em").attr("text-anchor", "middle"); + pathUpdate.attr("d", "M" + range[0] + "," + -tickEndSize + "V0H" + range[1] + "V" + -tickEndSize); + break; + } + case "left": { + tickTransform = d3_svg_axisY; + subtickUpdate.attr("x2", -tickMinorSize).attr("y2", 0); + tickUpdate.select("line").attr("x2", -tickMajorSize).attr("y2", 0); + tickUpdate.select("text").attr("x", -(Math.max(tickMajorSize, 0) + tickPadding)).attr("y", 0).attr("dy", ".32em").attr("text-anchor", "end"); + pathUpdate.attr("d", "M" + -tickEndSize + "," + range[0] + "H0V" + range[1] + "H" + -tickEndSize); + break; + } + case "right": { + tickTransform = d3_svg_axisY; + subtickUpdate.attr("x2", tickMinorSize).attr("y2", 0); + tickUpdate.select("line").attr("x2", tickMajorSize).attr("y2", 0); + tickUpdate.select("text").attr("x", Math.max(tickMajorSize, 0) + tickPadding).attr("y", 0).attr("dy", ".32em").attr("text-anchor", "start"); + pathUpdate.attr("d", "M" + tickEndSize + "," + range[0] + "H0V" + range[1] + "H" + tickEndSize); + break; + } + } + + // For quantitative scales: + // - enter new ticks from the old scale + // - exit old ticks to the new scale + if (scale.ticks) { + tickEnter.call(tickTransform, scale0); + tickUpdate.call(tickTransform, scale1); + tickExit.call(tickTransform, scale1); + subtickEnter.call(tickTransform, scale0); + subtickUpdate.call(tickTransform, scale1); + subtickExit.call(tickTransform, scale1); + } + + // For ordinal scales: + // - any entering ticks are undefined in the old scale + // - any exiting ticks are undefined in the new scale + // Therefore, we only need to transition updating ticks. + else { + var dx = scale1.rangeBand() / 2, x = function(d) { return scale1(d) + dx; }; + tickEnter.call(tickTransform, x); + tickUpdate.call(tickTransform, x); + } + }); + } + + axis.scale = function(x) { + if (!arguments.length) return scale; + scale = x; + return axis; + }; + + axis.orient = function(x) { + if (!arguments.length) return orient; + orient = x; + return axis; + }; + + axis.ticks = function() { + if (!arguments.length) return tickArguments_; + tickArguments_ = arguments; + return axis; + }; + + axis.tickFormat = function(x) { + if (!arguments.length) return tickFormat_; + tickFormat_ = x; + return axis; + }; + + axis.tickSize = function(x, y, z) { + if (!arguments.length) return tickMajorSize; + var n = arguments.length - 1; + tickMajorSize = +x; + tickMinorSize = n > 1 ? +y : tickMajorSize; + tickEndSize = n > 0 ? +arguments[n] : tickMajorSize; + return axis; + }; + + axis.tickPadding = function(x) { + if (!arguments.length) return tickPadding; + tickPadding = +x; + return axis; + }; + + axis.tickSubdivide = function(x) { + if (!arguments.length) return tickSubdivide; + tickSubdivide = +x; + return axis; + }; + + return axis; +}; + +function d3_svg_axisX(selection, x) { + selection.attr("transform", function(d) { return "translate(" + x(d) + ",0)"; }); +} + +function d3_svg_axisY(selection, y) { + selection.attr("transform", function(d) { return "translate(0," + y(d) + ")"; }); +} + +function d3_svg_axisSubdivide(scale, ticks, m) { + subticks = []; + if (m && ticks.length > 1) { + var extent = d3_scaleExtent(scale.domain()), + subticks, + i = -1, + n = ticks.length, + d = (ticks[1] - ticks[0]) / ++m, + j, + v; + while (++i < n) { + for (j = m; --j > 0;) { + if ((v = +ticks[i] - j * d) >= extent[0]) { + subticks.push(v); + } + } + } + for (--i, j = 0; ++j < m && (v = +ticks[i] + j * d) < extent[1];) { + subticks.push(v); + } + } + return subticks; +} +d3.svg.brush = function() { + var event = d3.dispatch("brushstart", "brush", "brushend"), + x, // x-scale, optional + y, // y-scale, optional + extent = [[0, 0], [0, 0]]; // [x0, y0], [x1, y1] + + function brush(g) { + var resizes = x && y ? ["n", "e", "s", "w", "nw", "ne", "se", "sw"] + : x ? ["e", "w"] + : y ? ["n", "s"] + : []; + + g.each(function() { + var g = d3.select(this).on("mousedown.brush", down), + bg = g.selectAll(".background").data([,]), + fg = g.selectAll(".extent").data([,]), + tz = g.selectAll(".resize").data(resizes, String), + e; + + // An invisible, mouseable area for starting a new brush. + bg.enter().append("rect") + .attr("class", "background") + .style("visibility", "hidden") + .style("pointer-events", "all") + .style("cursor", "crosshair"); + + // The visible brush extent; style this as you like! + fg.enter().append("rect") + .attr("class", "extent") + .style("cursor", "move"); + + // More invisible rects for resizing the extent. + tz.enter().append("rect") + .attr("class", function(d) { return "resize " + d; }) + .attr("width", 6) + .attr("height", 6) + .style("visibility", "hidden") + .style("pointer-events", brush.empty() ? "none" : "all") + .style("cursor", function(d) { return d3_svg_brushCursor[d]; }); + + // Remove any superfluous resizers. + tz.exit().remove(); + + // Initialize the background to fill the defined range. + // If the range isn't defined, you can post-process. + if (x) { + e = d3_scaleRange(x); + bg.attr("x", e[0]).attr("width", e[1] - e[0]); + d3_svg_brushRedrawX(g, extent); + } + if (y) { + e = d3_scaleRange(y); + bg.attr("y", e[0]).attr("height", e[1] - e[0]); + d3_svg_brushRedrawY(g, extent); + } + }); + } + + function down() { + var target = d3.select(d3.event.target); + + // Store some global state for the duration of the brush gesture. + d3_svg_brush = brush; + d3_svg_brushTarget = this; + d3_svg_brushExtent = extent; + d3_svg_brushOffset = d3.svg.mouse(d3_svg_brushTarget); + + // If the extent was clicked on, drag rather than brush; + // store the offset between the mouse and extent origin instead. + if (d3_svg_brushDrag = target.classed("extent")) { + d3_svg_brushOffset[0] = extent[0][0] - d3_svg_brushOffset[0]; + d3_svg_brushOffset[1] = extent[0][1] - d3_svg_brushOffset[1]; + } + + // If a resizer was clicked on, record which side is to be resized. + // Also, set the offset to the opposite side. + else if (target.classed("resize")) { + d3_svg_brushResize = d3.event.target.__data__; + d3_svg_brushOffset[0] = extent[+/w$/.test(d3_svg_brushResize)][0]; + d3_svg_brushOffset[1] = extent[+/^n/.test(d3_svg_brushResize)][1]; + } + + // If the ALT key is down when starting a brush, the center is at the mouse. + else if (d3.event.altKey) { + d3_svg_brushCenter = d3_svg_brushOffset.slice(); + } + + // Restrict which dimensions are resized. + d3_svg_brushX = !/^(n|s)$/.test(d3_svg_brushResize) && x; + d3_svg_brushY = !/^(e|w)$/.test(d3_svg_brushResize) && y; + + // Notify listeners. + d3_svg_brushDispatch = dispatcher(this, arguments); + d3_svg_brushDispatch("brushstart"); + d3_svg_brushMove(); + d3_eventCancel(); + } + + function dispatcher(that, argumentz) { + return function(type) { + var e = d3.event; + try { + d3.event = {type: type, target: brush}; + event[type].apply(that, argumentz); + } finally { + d3.event = e; + } + }; + } + + brush.x = function(z) { + if (!arguments.length) return x; + x = z; + return brush; + }; + + brush.y = function(z) { + if (!arguments.length) return y; + y = z; + return brush; + }; + + brush.extent = function(z) { + var x0, x1, y0, y1, t; + + // Invert the pixel extent to data-space. + if (!arguments.length) { + if (x) { + x0 = extent[0][0], x1 = extent[1][0]; + if (x.invert) x0 = x.invert(x0), x1 = x.invert(x1); + if (x1 < x0) t = x0, x0 = x1, x1 = t; + } + if (y) { + y0 = extent[0][1], y1 = extent[1][1]; + if (y.invert) y0 = y.invert(y0), y1 = y.invert(y1); + if (y1 < y0) t = y0, y0 = y1, y1 = t; + } + return x && y ? [[x0, y0], [x1, y1]] : x ? [x0, x1] : y && [y0, y1]; + } + + // Scale the data-space extent to pixels. + if (x) { + x0 = z[0], x1 = z[1]; + if (y) x0 = x0[0], x1 = x1[0]; + if (x.invert) x0 = x(x0), x1 = x(x1); + if (x1 < x0) t = x0, x0 = x1, x1 = t; + extent[0][0] = x0, extent[1][0] = x1; + } + if (y) { + y0 = z[0], y1 = z[1]; + if (x) y0 = y0[1], y1 = y1[1]; + if (y.invert) y0 = y(y0), y1 = y(y1); + if (y1 < y0) t = y0, y0 = y1, y1 = t; + extent[0][1] = y0, extent[1][1] = y1; + } + + return brush; + }; + + brush.clear = function() { + extent[0][0] = + extent[0][1] = + extent[1][0] = + extent[1][1] = 0; + return brush; + }; + + brush.empty = function() { + return (x && extent[0][0] === extent[1][0]) + || (y && extent[0][1] === extent[1][1]); + }; + + d3.select(window) + .on("mousemove.brush", d3_svg_brushMove) + .on("mouseup.brush", d3_svg_brushUp) + .on("keydown.brush", d3_svg_brushKeydown) + .on("keyup.brush", d3_svg_brushKeyup); + + return d3.rebind(brush, event, "on"); +}; + +var d3_svg_brush, + d3_svg_brushDispatch, + d3_svg_brushTarget, + d3_svg_brushX, + d3_svg_brushY, + d3_svg_brushExtent, + d3_svg_brushDrag, + d3_svg_brushResize, + d3_svg_brushCenter, + d3_svg_brushOffset; + +function d3_svg_brushRedrawX(g, extent) { + g.select(".extent").attr("x", extent[0][0]); + g.selectAll(".n,.s,.w,.nw,.sw").attr("x", extent[0][0] - 2); + g.selectAll(".e,.ne,.se").attr("x", extent[1][0] - 3); + g.selectAll(".extent,.n,.s").attr("width", extent[1][0] - extent[0][0]); +} + +function d3_svg_brushRedrawY(g, extent) { + g.select(".extent").attr("y", extent[0][1]); + g.selectAll(".n,.e,.w,.nw,.ne").attr("y", extent[0][1] - 3); + g.selectAll(".s,.se,.sw").attr("y", extent[1][1] - 4); + g.selectAll(".extent,.e,.w").attr("height", extent[1][1] - extent[0][1]); +} + +function d3_svg_brushKeydown() { + if (d3.event.keyCode == 32 && d3_svg_brushTarget && !d3_svg_brushDrag) { + d3_svg_brushCenter = null; + d3_svg_brushOffset[0] -= d3_svg_brushExtent[1][0]; + d3_svg_brushOffset[1] -= d3_svg_brushExtent[1][1]; + d3_svg_brushDrag = 2; + d3_eventCancel(); + } +} + +function d3_svg_brushKeyup() { + if (d3.event.keyCode == 32 && d3_svg_brushDrag == 2) { + d3_svg_brushOffset[0] += d3_svg_brushExtent[1][0]; + d3_svg_brushOffset[1] += d3_svg_brushExtent[1][1]; + d3_svg_brushDrag = 0; + d3_eventCancel(); + } +} + +function d3_svg_brushMove() { + if (d3_svg_brushOffset) { + var mouse = d3.svg.mouse(d3_svg_brushTarget), + g = d3.select(d3_svg_brushTarget); + + if (!d3_svg_brushDrag) { + + // If needed, determine the center from the current extent. + if (d3.event.altKey) { + if (!d3_svg_brushCenter) { + d3_svg_brushCenter = [ + (d3_svg_brushExtent[0][0] + d3_svg_brushExtent[1][0]) / 2, + (d3_svg_brushExtent[0][1] + d3_svg_brushExtent[1][1]) / 2 + ]; + } + + // Update the offset, for when the ALT key is released. + d3_svg_brushOffset[0] = d3_svg_brushExtent[+(mouse[0] < d3_svg_brushCenter[0])][0]; + d3_svg_brushOffset[1] = d3_svg_brushExtent[+(mouse[1] < d3_svg_brushCenter[1])][1]; + } + + // When the ALT key is released, we clear the center. + else d3_svg_brushCenter = null; + } + + // Update the brush extent for each dimension. + if (d3_svg_brushX) { + d3_svg_brushMove1(mouse, d3_svg_brushX, 0); + d3_svg_brushRedrawX(g, d3_svg_brushExtent); + } + if (d3_svg_brushY) { + d3_svg_brushMove1(mouse, d3_svg_brushY, 1); + d3_svg_brushRedrawY(g, d3_svg_brushExtent); + } + + // Notify listeners. + d3_svg_brushDispatch("brush"); + } +} + +function d3_svg_brushMove1(mouse, scale, i) { + var range = d3_scaleRange(scale), + r0 = range[0], + r1 = range[1], + offset = d3_svg_brushOffset[i], + size = d3_svg_brushExtent[1][i] - d3_svg_brushExtent[0][i], + min, + max; + + // When dragging, reduce the range by the extent size and offset. + if (d3_svg_brushDrag) { + r0 -= offset; + r1 -= size + offset; + } + + // Clamp the mouse so that the extent fits within the range extent. + min = Math.max(r0, Math.min(r1, mouse[i])); + + // Compute the new extent bounds. + if (d3_svg_brushDrag) { + max = (min += offset) + size; + } else { + + // If the ALT key is pressed, then preserve the center of the extent. + if (d3_svg_brushCenter) offset = Math.max(r0, Math.min(r1, 2 * d3_svg_brushCenter[i] - min)); + + // Compute the min and max of the offset and mouse. + if (offset < min) { + max = min; + min = offset; + } else { + max = offset; + } + } + + // Update the stored bounds. + d3_svg_brushExtent[0][i] = min; + d3_svg_brushExtent[1][i] = max; +} + +function d3_svg_brushUp() { + if (d3_svg_brushOffset) { + d3_svg_brushMove(); + d3.select(d3_svg_brushTarget).selectAll(".resize").style("pointer-events", d3_svg_brush.empty() ? "none" : "all"); + d3_svg_brushDispatch("brushend"); + d3_svg_brush = + d3_svg_brushDispatch = + d3_svg_brushTarget = + d3_svg_brushX = + d3_svg_brushY = + d3_svg_brushExtent = + d3_svg_brushDrag = + d3_svg_brushResize = + d3_svg_brushCenter = + d3_svg_brushOffset = null; + d3_eventCancel(); + } +} + +var d3_svg_brushCursor = { + n: "ns-resize", + e: "ew-resize", + s: "ns-resize", + w: "ew-resize", + nw: "nwse-resize", + ne: "nesw-resize", + se: "nwse-resize", + sw: "nesw-resize" +}; +d3.behavior = {}; +// TODO Track touch points by identifier. + +d3.behavior.drag = function() { + var event = d3.dispatch("drag", "dragstart", "dragend"), + origin = null; + + function drag() { + this + .on("mousedown.drag", mousedown) + .on("touchstart.drag", mousedown); + + d3.select(window) + .on("mousemove.drag", d3_behavior_dragMove) + .on("touchmove.drag", d3_behavior_dragMove) + .on("mouseup.drag", d3_behavior_dragUp, true) + .on("touchend.drag", d3_behavior_dragUp, true) + .on("click.drag", d3_behavior_dragClick, true); + } + + // snapshot the local context for subsequent dispatch + function start() { + d3_behavior_dragEvent = event; + d3_behavior_dragEventTarget = d3.event.target; + d3_behavior_dragTarget = this; + d3_behavior_dragArguments = arguments; + d3_behavior_dragOrigin = d3_behavior_dragPoint(); + if (origin) { + d3_behavior_dragOffset = origin.apply(d3_behavior_dragTarget, d3_behavior_dragArguments); + d3_behavior_dragOffset = [d3_behavior_dragOffset.x - d3_behavior_dragOrigin[0], d3_behavior_dragOffset.y - d3_behavior_dragOrigin[1]]; + } else { + d3_behavior_dragOffset = [0, 0]; + } + d3_behavior_dragMoved = 0; + } + + function mousedown() { + start.apply(this, arguments); + d3_behavior_dragDispatch("dragstart"); + } + + drag.origin = function(x) { + if (!arguments.length) return origin; + origin = x; + return drag; + }; + + return d3.rebind(drag, event, "on"); +}; + +var d3_behavior_dragEvent, + d3_behavior_dragEventTarget, + d3_behavior_dragTarget, + d3_behavior_dragArguments, + d3_behavior_dragOffset, + d3_behavior_dragOrigin, + d3_behavior_dragMoved; + +function d3_behavior_dragDispatch(type) { + var p = d3_behavior_dragPoint(), + o = d3.event, + e = d3.event = {type: type}; + + if (p) { + e.x = p[0] + d3_behavior_dragOffset[0]; + e.y = p[1] + d3_behavior_dragOffset[1]; + e.dx = p[0] - d3_behavior_dragOrigin[0]; + e.dy = p[1] - d3_behavior_dragOrigin[1]; + d3_behavior_dragMoved |= e.dx | e.dy; + d3_behavior_dragOrigin = p; + } + + try { + d3_behavior_dragEvent[type].apply(d3_behavior_dragTarget, d3_behavior_dragArguments); + } finally { + d3.event = o; + } + + o.stopPropagation(); + o.preventDefault(); +} + +function d3_behavior_dragPoint() { + var p = d3_behavior_dragTarget.parentNode, + t = d3.event.changedTouches; + return p && (t + ? d3.svg.touches(p, t)[0] + : d3.svg.mouse(p)); +} + +function d3_behavior_dragMove() { + if (!d3_behavior_dragTarget) return; + var parent = d3_behavior_dragTarget.parentNode; + + // O NOES! The drag element was removed from the DOM. + if (!parent) return d3_behavior_dragUp(); + + d3_behavior_dragDispatch("drag"); + d3_eventCancel(); +} + +function d3_behavior_dragUp() { + if (!d3_behavior_dragTarget) return; + d3_behavior_dragDispatch("dragend"); + + // If the node was moved, prevent the mouseup from propagating. + // Also prevent the subsequent click from propagating (e.g., for anchors). + if (d3_behavior_dragMoved) { + d3_eventCancel(); + d3_behavior_dragMoved = d3.event.target === d3_behavior_dragEventTarget; + } + + d3_behavior_dragEvent = + d3_behavior_dragEventTarget = + d3_behavior_dragTarget = + d3_behavior_dragArguments = + d3_behavior_dragOffset = + d3_behavior_dragOrigin = null; +} + +function d3_behavior_dragClick() { + if (d3_behavior_dragMoved) { + d3_eventCancel(); + d3_behavior_dragMoved = 0; + } +} +// TODO unbind zoom behavior? +d3.behavior.zoom = function() { + var xyz = [0, 0, 0], + event = d3.dispatch("zoom"), + extent = d3_behavior_zoomInfiniteExtent; + + function zoom() { + this + .on("mousedown.zoom", mousedown) + .on("mousewheel.zoom", mousewheel) + .on("DOMMouseScroll.zoom", mousewheel) + .on("dblclick.zoom", dblclick) + .on("touchstart.zoom", touchstart); + + d3.select(window) + .on("mousemove.zoom", d3_behavior_zoomMousemove) + .on("mouseup.zoom", d3_behavior_zoomMouseup) + .on("touchmove.zoom", d3_behavior_zoomTouchmove) + .on("touchend.zoom", d3_behavior_zoomTouchup) + .on("click.zoom", d3_behavior_zoomClick, true); + } + + // snapshot the local context for subsequent dispatch + function start() { + d3_behavior_zoomXyz = xyz; + d3_behavior_zoomExtent = extent; + d3_behavior_zoomDispatch = event.zoom; + d3_behavior_zoomEventTarget = d3.event.target; + d3_behavior_zoomTarget = this; + d3_behavior_zoomArguments = arguments; + } + + function mousedown() { + start.apply(this, arguments); + d3_behavior_zoomPanning = d3_behavior_zoomLocation(d3.svg.mouse(d3_behavior_zoomTarget)); + d3_behavior_zoomMoved = 0; + d3.event.preventDefault(); + window.focus(); + } + + // store starting mouse location + function mousewheel() { + start.apply(this, arguments); + if (!d3_behavior_zoomZooming) d3_behavior_zoomZooming = d3_behavior_zoomLocation(d3.svg.mouse(d3_behavior_zoomTarget)); + d3_behavior_zoomTo(d3_behavior_zoomDelta() + xyz[2], d3.svg.mouse(d3_behavior_zoomTarget), d3_behavior_zoomZooming); + } + + function dblclick() { + start.apply(this, arguments); + var mouse = d3.svg.mouse(d3_behavior_zoomTarget); + d3_behavior_zoomTo(d3.event.shiftKey ? Math.ceil(xyz[2] - 1) : Math.floor(xyz[2] + 1), mouse, d3_behavior_zoomLocation(mouse)); + } + + // doubletap detection + function touchstart() { + start.apply(this, arguments); + var touches = d3_behavior_zoomTouchup(), + touch, + now = Date.now(); + if ((touches.length === 1) && (now - d3_behavior_zoomLast < 300)) { + d3_behavior_zoomTo(1 + Math.floor(xyz[2]), touch = touches[0], d3_behavior_zoomLocations[touch.identifier]); + } + d3_behavior_zoomLast = now; + } + + zoom.extent = function(x) { + if (!arguments.length) return extent; + extent = x == null ? d3_behavior_zoomInfiniteExtent : x; + return zoom; + }; + + return d3.rebind(zoom, event, "on"); +}; + +var d3_behavior_zoomDiv, + d3_behavior_zoomPanning, + d3_behavior_zoomZooming, + d3_behavior_zoomLocations = {}, // identifier -> location + d3_behavior_zoomLast = 0, + d3_behavior_zoomXyz, + d3_behavior_zoomExtent, + d3_behavior_zoomDispatch, + d3_behavior_zoomEventTarget, + d3_behavior_zoomTarget, + d3_behavior_zoomArguments, + d3_behavior_zoomMoved; + +function d3_behavior_zoomLocation(point) { + return [ + point[0] - d3_behavior_zoomXyz[0], + point[1] - d3_behavior_zoomXyz[1], + d3_behavior_zoomXyz[2] + ]; +} + +// detect the pixels that would be scrolled by this wheel event +function d3_behavior_zoomDelta() { + + // mousewheel events are totally broken! + // https://bugs.webkit.org/show_bug.cgi?id=40441 + // not only that, but Chrome and Safari differ in re. to acceleration! + if (!d3_behavior_zoomDiv) { + d3_behavior_zoomDiv = d3.select("body").append("div") + .style("visibility", "hidden") + .style("top", 0) + .style("height", 0) + .style("width", 0) + .style("overflow-y", "scroll") + .append("div") + .style("height", "2000px") + .node().parentNode; + } + + var e = d3.event, delta; + try { + d3_behavior_zoomDiv.scrollTop = 1000; + d3_behavior_zoomDiv.dispatchEvent(e); + delta = 1000 - d3_behavior_zoomDiv.scrollTop; + } catch (error) { + delta = e.wheelDelta || (-e.detail * 5); + } + + return delta * .005; +} + +// Note: Since we don't rotate, it's possible for the touches to become +// slightly detached from their original positions. Thus, we recompute the +// touch points on touchend as well as touchstart! +function d3_behavior_zoomTouchup() { + var touches = d3.svg.touches(d3_behavior_zoomTarget), + i = -1, + n = touches.length, + touch; + while (++i < n) d3_behavior_zoomLocations[(touch = touches[i]).identifier] = d3_behavior_zoomLocation(touch); + return touches; +} + +function d3_behavior_zoomTouchmove() { + var touches = d3.svg.touches(d3_behavior_zoomTarget); + switch (touches.length) { + + // single-touch pan + case 1: { + var touch = touches[0]; + d3_behavior_zoomTo(d3_behavior_zoomXyz[2], touch, d3_behavior_zoomLocations[touch.identifier]); + break; + } + + // double-touch pan + zoom + case 2: { + var p0 = touches[0], + p1 = touches[1], + p2 = [(p0[0] + p1[0]) / 2, (p0[1] + p1[1]) / 2], + l0 = d3_behavior_zoomLocations[p0.identifier], + l1 = d3_behavior_zoomLocations[p1.identifier], + l2 = [(l0[0] + l1[0]) / 2, (l0[1] + l1[1]) / 2, l0[2]]; + d3_behavior_zoomTo(Math.log(d3.event.scale) / Math.LN2 + l0[2], p2, l2); + break; + } + } +} + +function d3_behavior_zoomMousemove() { + d3_behavior_zoomZooming = null; + if (d3_behavior_zoomPanning) { + d3_behavior_zoomMoved = 1; + d3_behavior_zoomTo(d3_behavior_zoomXyz[2], d3.svg.mouse(d3_behavior_zoomTarget), d3_behavior_zoomPanning); + } +} + +function d3_behavior_zoomMouseup() { + if (d3_behavior_zoomPanning) { + if (d3_behavior_zoomMoved) { + d3_eventCancel(); + d3_behavior_zoomMoved = d3_behavior_zoomEventTarget === d3.event.target; + } + + d3_behavior_zoomXyz = + d3_behavior_zoomExtent = + d3_behavior_zoomDispatch = + d3_behavior_zoomEventTarget = + d3_behavior_zoomTarget = + d3_behavior_zoomArguments = + d3_behavior_zoomPanning = null; + } +} + +function d3_behavior_zoomClick() { + if (d3_behavior_zoomMoved) { + d3_eventCancel(); + d3_behavior_zoomMoved = 0; + } +} + +function d3_behavior_zoomTo(z, x0, x1) { + z = d3_behavior_zoomExtentClamp(z, 2); + var j = Math.pow(2, d3_behavior_zoomXyz[2]), + k = Math.pow(2, z), + K = Math.pow(2, (d3_behavior_zoomXyz[2] = z) - x1[2]), + x_ = d3_behavior_zoomXyz[0], + y_ = d3_behavior_zoomXyz[1], + x = d3_behavior_zoomXyz[0] = d3_behavior_zoomExtentClamp((x0[0] - x1[0] * K), 0, k), + y = d3_behavior_zoomXyz[1] = d3_behavior_zoomExtentClamp((x0[1] - x1[1] * K), 1, k), + o = d3.event; // Events can be reentrant (e.g., focus). + + d3.event = { + scale: k, + translate: [x, y], + transform: function(sx, sy) { + if (sx) transform(sx, x_, x); + if (sy) transform(sy, y_, y); + } + }; + + function transform(scale, a, b) { + scale.domain(scale.range().map(function(v) { return scale.invert(((v - b) * j) / k + a); })); + } + + try { + d3_behavior_zoomDispatch.apply(d3_behavior_zoomTarget, d3_behavior_zoomArguments); + } finally { + d3.event = o; + } + + o.preventDefault(); +} + +var d3_behavior_zoomInfiniteExtent = [ + [-Infinity, Infinity], + [-Infinity, Infinity], + [-Infinity, Infinity] +]; + +function d3_behavior_zoomExtentClamp(x, i, k) { + var range = d3_behavior_zoomExtent[i], + r0 = range[0], + r1 = range[1]; + return arguments.length === 3 + ? Math.max(r1 * (r1 === Infinity ? -Infinity : 1 / k - 1), + Math.min(r0 === -Infinity ? Infinity : r0, x / k)) * k + : Math.max(r0, Math.min(r1, x)); +} +})(); diff --git a/gstudio/static/gstudio/js/d3.layout.js b/gstudio/static/gstudio/js/d3.layout.js new file mode 100644 index 0000000..30ba791 --- /dev/null +++ b/gstudio/static/gstudio/js/d3.layout.js @@ -0,0 +1,1891 @@ +(function(){d3.layout = {}; +// Implements hierarchical edge bundling using Holten's algorithm. For each +// input link, a path is computed that travels through the tree, up the parent +// hierarchy to the least common ancestor, and then back down to the destination +// node. Each path is simply an array of nodes. +d3.layout.bundle = function() { + return function(links) { + var paths = [], + i = -1, + n = links.length; + while (++i < n) paths.push(d3_layout_bundlePath(links[i])); + return paths; + }; +}; + +function d3_layout_bundlePath(link) { + var start = link.source, + end = link.target, + lca = d3_layout_bundleLeastCommonAncestor(start, end), + points = [start]; + while (start !== lca) { + start = start.parent; + points.push(start); + } + var k = points.length; + while (end !== lca) { + points.splice(k, 0, end); + end = end.parent; + } + return points; +} + +function d3_layout_bundleAncestors(node) { + var ancestors = [], + parent = node.parent; + while (parent != null) { + ancestors.push(node); + node = parent; + parent = parent.parent; + } + ancestors.push(node); + return ancestors; +} + +function d3_layout_bundleLeastCommonAncestor(a, b) { + if (a === b) return a; + var aNodes = d3_layout_bundleAncestors(a), + bNodes = d3_layout_bundleAncestors(b), + aNode = aNodes.pop(), + bNode = bNodes.pop(), + sharedNode = null; + while (aNode === bNode) { + sharedNode = aNode; + aNode = aNodes.pop(); + bNode = bNodes.pop(); + } + return sharedNode; +} +d3.layout.chord = function() { + var chord = {}, + chords, + groups, + matrix, + n, + padding = 0, + sortGroups, + sortSubgroups, + sortChords; + + function relayout() { + var subgroups = {}, + groupSums = [], + groupIndex = d3.range(n), + subgroupIndex = [], + k, + x, + x0, + i, + j; + + chords = []; + groups = []; + + // Compute the sum. + k = 0, i = -1; while (++i < n) { + x = 0, j = -1; while (++j < n) { + x += matrix[i][j]; + } + groupSums.push(x); + subgroupIndex.push(d3.range(n)); + k += x; + } + + // Sort groups… + if (sortGroups) { + groupIndex.sort(function(a, b) { + return sortGroups(groupSums[a], groupSums[b]); + }); + } + + // Sort subgroups… + if (sortSubgroups) { + subgroupIndex.forEach(function(d, i) { + d.sort(function(a, b) { + return sortSubgroups(matrix[i][a], matrix[i][b]); + }); + }); + } + + // Convert the sum to scaling factor for [0, 2pi]. + // TODO Allow start and end angle to be specified. + // TODO Allow padding to be specified as percentage? + k = (2 * Math.PI - padding * n) / k; + + // Compute the start and end angle for each group and subgroup. + // Note: Opera has a bug reordering object literal properties! + x = 0, i = -1; while (++i < n) { + x0 = x, j = -1; while (++j < n) { + var di = groupIndex[i], + dj = subgroupIndex[di][j], + v = matrix[di][dj], + a0 = x, + a1 = x += v * k; + subgroups[di + "-" + dj] = { + index: di, + subindex: dj, + startAngle: a0, + endAngle: a1, + value: v + }; + } + groups.push({ + index: di, + startAngle: x0, + endAngle: x, + value: (x - x0) / k + }); + x += padding; + } + + // Generate chords for each (non-empty) subgroup-subgroup link. + i = -1; while (++i < n) { + j = i - 1; while (++j < n) { + var source = subgroups[i + "-" + j], + target = subgroups[j + "-" + i]; + if (source.value || target.value) { + chords.push(source.value < target.value + ? {source: target, target: source} + : {source: source, target: target}); + } + } + } + + if (sortChords) resort(); + } + + function resort() { + chords.sort(function(a, b) { + return sortChords( + (a.source.value + a.target.value) / 2, + (b.source.value + b.target.value) / 2); + }); + } + + chord.matrix = function(x) { + if (!arguments.length) return matrix; + n = (matrix = x) && matrix.length; + chords = groups = null; + return chord; + }; + + chord.padding = function(x) { + if (!arguments.length) return padding; + padding = x; + chords = groups = null; + return chord; + }; + + chord.sortGroups = function(x) { + if (!arguments.length) return sortGroups; + sortGroups = x; + chords = groups = null; + return chord; + }; + + chord.sortSubgroups = function(x) { + if (!arguments.length) return sortSubgroups; + sortSubgroups = x; + chords = null; + return chord; + }; + + chord.sortChords = function(x) { + if (!arguments.length) return sortChords; + sortChords = x; + if (chords) resort(); + return chord; + }; + + chord.chords = function() { + if (!chords) relayout(); + return chords; + }; + + chord.groups = function() { + if (!groups) relayout(); + return groups; + }; + + return chord; +}; +// A rudimentary force layout using Gauss-Seidel. +d3.layout.force = function() { + var force = {}, + event = d3.dispatch("tick"), + size = [1, 1], + drag, + alpha, + friction = .9, + linkDistance = d3_layout_forceLinkDistance, + linkStrength = d3_layout_forceLinkStrength, + charge = -30, + gravity = .1, + theta = .8, + interval, + nodes = [], + links = [], + distances, + strengths, + charges; + + function repulse(node) { + return function(quad, x1, y1, x2, y2) { + if (quad.point !== node) { + var dx = quad.cx - node.x, + dy = quad.cy - node.y, + dn = 1 / Math.sqrt(dx * dx + dy * dy); + + /* Barnes-Hut criterion. */ + if ((x2 - x1) * dn < theta) { + var k = quad.charge * dn * dn; + node.px -= dx * k; + node.py -= dy * k; + return true; + } + + if (quad.point && isFinite(dn)) { + var k = quad.pointCharge * dn * dn; + node.px -= dx * k; + node.py -= dy * k; + } + } + return !quad.charge; + }; + } + + function tick() { + var n = nodes.length, + m = links.length, + q, + i, // current index + o, // current object + s, // current source + t, // current target + l, // current distance + k, // current force + x, // x-distance + y; // y-distance + + // gauss-seidel relaxation for links + for (i = 0; i < m; ++i) { + o = links[i]; + s = o.source; + t = o.target; + x = t.x - s.x; + y = t.y - s.y; + if (l = (x * x + y * y)) { + l = alpha * strengths[i] * ((l = Math.sqrt(l)) - distances[i]) / l; + x *= l; + y *= l; + t.x -= x * (k = s.weight / (t.weight + s.weight)); + t.y -= y * k; + s.x += x * (k = 1 - k); + s.y += y * k; + } + } + + // apply gravity forces + if (k = alpha * gravity) { + x = size[0] / 2; + y = size[1] / 2; + i = -1; if (k) while (++i < n) { + o = nodes[i]; + o.x += (x - o.x) * k; + o.y += (y - o.y) * k; + } + } + + // compute quadtree center of mass and apply charge forces + if (charge) { + d3_layout_forceAccumulate(q = d3.geom.quadtree(nodes), alpha, charges); + i = -1; while (++i < n) { + if (!(o = nodes[i]).fixed) { + q.visit(repulse(o)); + } + } + } + + // position verlet integration + i = -1; while (++i < n) { + o = nodes[i]; + if (o.fixed) { + o.x = o.px; + o.y = o.py; + } else { + o.x -= (o.px - (o.px = o.x)) * friction; + o.y -= (o.py - (o.py = o.y)) * friction; + } + } + + event.tick({type: "tick", alpha: alpha}); + + // simulated annealing, basically + return (alpha *= .99) < .005; + } + + force.nodes = function(x) { + if (!arguments.length) return nodes; + nodes = x; + return force; + }; + + force.links = function(x) { + if (!arguments.length) return links; + links = x; + return force; + }; + + force.size = function(x) { + if (!arguments.length) return size; + size = x; + return force; + }; + + force.linkDistance = function(x) { + if (!arguments.length) return linkDistance; + linkDistance = d3.functor(x); + return force; + }; + + // For backwards-compatibility. + force.distance = force.linkDistance; + + force.linkStrength = function(x) { + if (!arguments.length) return linkStrength; + linkStrength = d3.functor(x); + return force; + }; + + force.friction = function(x) { + if (!arguments.length) return friction; + friction = x; + return force; + }; + + force.charge = function(x) { + if (!arguments.length) return charge; + charge = typeof x === "function" ? x : +x; + return force; + }; + + force.gravity = function(x) { + if (!arguments.length) return gravity; + gravity = x; + return force; + }; + + force.theta = function(x) { + if (!arguments.length) return theta; + theta = x; + return force; + }; + + force.start = function() { + var i, + j, + n = nodes.length, + m = links.length, + w = size[0], + h = size[1], + neighbors, + o; + + for (i = 0; i < n; ++i) { + (o = nodes[i]).index = i; + o.weight = 0; + } + + distances = []; + strengths = []; + for (i = 0; i < m; ++i) { + o = links[i]; + if (typeof o.source == "number") o.source = nodes[o.source]; + if (typeof o.target == "number") o.target = nodes[o.target]; + distances[i] = linkDistance.call(this, o, i); + strengths[i] = linkStrength.call(this, o, i); + ++o.source.weight; + ++o.target.weight; + } + + for (i = 0; i < n; ++i) { + o = nodes[i]; + if (isNaN(o.x)) o.x = position("x", w); + if (isNaN(o.y)) o.y = position("y", h); + if (isNaN(o.px)) o.px = o.x; + if (isNaN(o.py)) o.py = o.y; + } + + charges = []; + if (typeof charge === "function") { + for (i = 0; i < n; ++i) { + charges[i] = +charge.call(this, nodes[i], i); + } + } else { + for (i = 0; i < n; ++i) { + charges[i] = charge; + } + } + + // initialize node position based on first neighbor + function position(dimension, size) { + var neighbors = neighbor(i), + j = -1, + m = neighbors.length, + x; + while (++j < m) if (!isNaN(x = neighbors[j][dimension])) return x; + return Math.random() * size; + } + + // initialize neighbors lazily + function neighbor() { + if (!neighbors) { + neighbors = []; + for (j = 0; j < n; ++j) { + neighbors[j] = []; + } + for (j = 0; j < m; ++j) { + var o = links[j]; + neighbors[o.source.index].push(o.target); + neighbors[o.target.index].push(o.source); + } + } + return neighbors[i]; + } + + return force.resume(); + }; + + force.resume = function() { + alpha = .1; + d3.timer(tick); + return force; + }; + + force.stop = function() { + alpha = 0; + return force; + }; + + // use `node.call(force.drag)` to make nodes draggable + force.drag = function() { + if (!drag) drag = d3.behavior.drag() + .origin(Object) + .on("dragstart", dragstart) + .on("drag", d3_layout_forceDrag) + .on("dragend", d3_layout_forceDragEnd); + + this.on("mouseover.force", d3_layout_forceDragOver) + .on("mouseout.force", d3_layout_forceDragOut) + .call(drag); + }; + + function dragstart(d) { + d3_layout_forceDragOver(d3_layout_forceDragNode = d); + d3_layout_forceDragForce = force; + } + + return d3.rebind(force, event, "on"); +}; + +var d3_layout_forceDragForce, + d3_layout_forceDragNode; + +function d3_layout_forceDragOver(d) { + d.fixed |= 2; +} + +function d3_layout_forceDragOut(d) { + if (d !== d3_layout_forceDragNode) d.fixed &= 1; +} + +function d3_layout_forceDragEnd() { + d3_layout_forceDrag(); + d3_layout_forceDragNode.fixed &= 1; + d3_layout_forceDragForce = d3_layout_forceDragNode = null; +} + +function d3_layout_forceDrag() { + d3_layout_forceDragNode.px = d3.event.x; + d3_layout_forceDragNode.py = d3.event.y; + d3_layout_forceDragForce.resume(); // restart annealing +} + +function d3_layout_forceAccumulate(quad, alpha, charges) { + var cx = 0, + cy = 0; + quad.charge = 0; + if (!quad.leaf) { + var nodes = quad.nodes, + n = nodes.length, + i = -1, + c; + while (++i < n) { + c = nodes[i]; + if (c == null) continue; + d3_layout_forceAccumulate(c, alpha, charges); + quad.charge += c.charge; + cx += c.charge * c.cx; + cy += c.charge * c.cy; + } + } + if (quad.point) { + // jitter internal nodes that are coincident + if (!quad.leaf) { + quad.point.x += Math.random() - .5; + quad.point.y += Math.random() - .5; + } + var k = alpha * charges[quad.point.index]; + quad.charge += quad.pointCharge = k; + cx += k * quad.point.x; + cy += k * quad.point.y; + } + quad.cx = cx / quad.charge; + quad.cy = cy / quad.charge; +} + +function d3_layout_forceLinkDistance(link) { + return 20; +} + +function d3_layout_forceLinkStrength(link) { + return 1; +} +d3.layout.partition = function() { + var hierarchy = d3.layout.hierarchy(), + size = [1, 1]; // width, height + + function position(node, x, dx, dy) { + var children = node.children; + node.x = x; + node.y = node.depth * dy; + node.dx = dx; + node.dy = dy; + if (children && (n = children.length)) { + var i = -1, + n, + c, + d; + dx = node.value ? dx / node.value : 0; + while (++i < n) { + position(c = children[i], x, d = c.value * dx, dy); + x += d; + } + } + } + + function depth(node) { + var children = node.children, + d = 0; + if (children && (n = children.length)) { + var i = -1, + n; + while (++i < n) d = Math.max(d, depth(children[i])); + } + return 1 + d; + } + + function partition(d, i) { + var nodes = hierarchy.call(this, d, i); + position(nodes[0], 0, size[0], size[1] / depth(nodes[0])); + return nodes; + } + + partition.size = function(x) { + if (!arguments.length) return size; + size = x; + return partition; + }; + + return d3_layout_hierarchyRebind(partition, hierarchy); +}; +d3.layout.pie = function() { + var value = Number, + sort = d3_layout_pieSortByValue, + startAngle = 0, + endAngle = 2 * Math.PI; + + function pie(data, i) { + + // Compute the numeric values for each data element. + var values = data.map(function(d, i) { return +value.call(pie, d, i); }); + + // Compute the start angle. + var a = +(typeof startAngle === "function" + ? startAngle.apply(this, arguments) + : startAngle); + + // Compute the angular scale factor: from value to radians. + var k = ((typeof endAngle === "function" + ? endAngle.apply(this, arguments) + : endAngle) - startAngle) + / d3.sum(values); + + // Optionally sort the data. + var index = d3.range(data.length); + if (sort != null) index.sort(sort === d3_layout_pieSortByValue + ? function(i, j) { return values[j] - values[i]; } + : function(i, j) { return sort(data[i], data[j]); }); + + // Compute the arcs! + var arcs = index.map(function(i) { + return { + data: data[i], + value: d = values[i], + startAngle: a, + endAngle: a += d * k + }; + }); + + // Return the arcs in the original data's order. + return data.map(function(d, i) { + return arcs[index[i]]; + }); + } + + /** + * Specifies the value function *x*, which returns a nonnegative numeric value + * for each datum. The default value function is `Number`. The value function + * is passed two arguments: the current datum and the current index. + */ + pie.value = function(x) { + if (!arguments.length) return value; + value = x; + return pie; + }; + + /** + * Specifies a sort comparison operator *x*. The comparator is passed two data + * elements from the data array, a and b; it returns a negative value if a is + * less than b, a positive value if a is greater than b, and zero if a equals + * b. + */ + pie.sort = function(x) { + if (!arguments.length) return sort; + sort = x; + return pie; + }; + + /** + * Specifies the overall start angle of the pie chart. Defaults to 0. The + * start angle can be specified either as a constant or as a function; in the + * case of a function, it is evaluated once per array (as opposed to per + * element). + */ + pie.startAngle = function(x) { + if (!arguments.length) return startAngle; + startAngle = x; + return pie; + }; + + /** + * Specifies the overall end angle of the pie chart. Defaults to 2π. The + * end angle can be specified either as a constant or as a function; in the + * case of a function, it is evaluated once per array (as opposed to per + * element). + */ + pie.endAngle = function(x) { + if (!arguments.length) return endAngle; + endAngle = x; + return pie; + }; + + return pie; +}; + +var d3_layout_pieSortByValue = {}; +// data is two-dimensional array of x,y; we populate y0 +d3.layout.stack = function() { + var values = Object, + order = d3_layout_stackOrders["default"], + offset = d3_layout_stackOffsets["zero"], + out = d3_layout_stackOut, + x = d3_layout_stackX, + y = d3_layout_stackY; + + function stack(data, index) { + + // Convert series to canonical two-dimensional representation. + var series = data.map(function(d, i) { + return values.call(stack, d, i); + }); + + // Convert each series to canonical [[x,y]] representation. + var points = series.map(function(d, i) { + return d.map(function(v, i) { + return [x.call(stack, v, i), y.call(stack, v, i)]; + }); + }); + + // Compute the order of series, and permute them. + var orders = order.call(stack, points, index); + series = d3.permute(series, orders); + points = d3.permute(points, orders); + + // Compute the baseline… + var offsets = offset.call(stack, points, index); + + // And propagate it to other series. + var n = series.length, + m = series[0].length, + i, + j, + o; + for (j = 0; j < m; ++j) { + out.call(stack, series[0][j], o = offsets[j], points[0][j][1]); + for (i = 1; i < n; ++i) { + out.call(stack, series[i][j], o += points[i - 1][j][1], points[i][j][1]); + } + } + + return data; + } + + stack.values = function(x) { + if (!arguments.length) return values; + values = x; + return stack; + }; + + stack.order = function(x) { + if (!arguments.length) return order; + order = typeof x === "function" ? x : d3_layout_stackOrders[x]; + return stack; + }; + + stack.offset = function(x) { + if (!arguments.length) return offset; + offset = typeof x === "function" ? x : d3_layout_stackOffsets[x]; + return stack; + }; + + stack.x = function(z) { + if (!arguments.length) return x; + x = z; + return stack; + }; + + stack.y = function(z) { + if (!arguments.length) return y; + y = z; + return stack; + }; + + stack.out = function(z) { + if (!arguments.length) return out; + out = z; + return stack; + }; + + return stack; +} + +function d3_layout_stackX(d) { + return d.x; +} + +function d3_layout_stackY(d) { + return d.y; +} + +function d3_layout_stackOut(d, y0, y) { + d.y0 = y0; + d.y = y; +} + +var d3_layout_stackOrders = { + + "inside-out": function(data) { + var n = data.length, + i, + j, + max = data.map(d3_layout_stackMaxIndex), + sums = data.map(d3_layout_stackReduceSum), + index = d3.range(n).sort(function(a, b) { return max[a] - max[b]; }), + top = 0, + bottom = 0, + tops = [], + bottoms = []; + for (i = 0; i < n; ++i) { + j = index[i]; + if (top < bottom) { + top += sums[j]; + tops.push(j); + } else { + bottom += sums[j]; + bottoms.push(j); + } + } + return bottoms.reverse().concat(tops); + }, + + "reverse": function(data) { + return d3.range(data.length).reverse(); + }, + + "default": function(data) { + return d3.range(data.length); + } + +}; + +var d3_layout_stackOffsets = { + + "silhouette": function(data) { + var n = data.length, + m = data[0].length, + sums = [], + max = 0, + i, + j, + o, + y0 = []; + for (j = 0; j < m; ++j) { + for (i = 0, o = 0; i < n; i++) o += data[i][j][1]; + if (o > max) max = o; + sums.push(o); + } + for (j = 0; j < m; ++j) { + y0[j] = (max - sums[j]) / 2; + } + return y0; + }, + + "wiggle": function(data) { + var n = data.length, + x = data[0], + m = x.length, + max = 0, + i, + j, + k, + s1, + s2, + s3, + dx, + o, + o0, + y0 = []; + y0[0] = o = o0 = 0; + for (j = 1; j < m; ++j) { + for (i = 0, s1 = 0; i < n; ++i) s1 += data[i][j][1]; + for (i = 0, s2 = 0, dx = x[j][0] - x[j - 1][0]; i < n; ++i) { + for (k = 0, s3 = (data[i][j][1] - data[i][j - 1][1]) / (2 * dx); k < i; ++k) { + s3 += (data[k][j][1] - data[k][j - 1][1]) / dx; + } + s2 += s3 * data[i][j][1]; + } + y0[j] = o -= s1 ? s2 / s1 * dx : 0; + if (o < o0) o0 = o; + } + for (j = 0; j < m; ++j) y0[j] -= o0; + return y0; + }, + + "expand": function(data) { + var n = data.length, + m = data[0].length, + k = 1 / n, + i, + j, + o, + y0 = []; + for (j = 0; j < m; ++j) { + for (i = 0, o = 0; i < n; i++) o += data[i][j][1]; + if (o) for (i = 0; i < n; i++) data[i][j][1] /= o; + else for (i = 0; i < n; i++) data[i][j][1] = k; + } + for (j = 0; j < m; ++j) y0[j] = 0; + return y0; + }, + + "zero": function(data) { + var j = -1, + m = data[0].length, + y0 = []; + while (++j < m) y0[j] = 0; + return y0; + } + +}; + +function d3_layout_stackMaxIndex(array) { + var i = 1, + j = 0, + v = array[0][1], + k, + n = array.length; + for (; i < n; ++i) { + if ((k = array[i][1]) > v) { + j = i; + v = k; + } + } + return j; +} + +function d3_layout_stackReduceSum(d) { + return d.reduce(d3_layout_stackSum, 0); +} + +function d3_layout_stackSum(p, d) { + return p + d[1]; +} +d3.layout.histogram = function() { + var frequency = true, + valuer = Number, + ranger = d3_layout_histogramRange, + binner = d3_layout_histogramBinSturges; + + function histogram(data, i) { + var bins = [], + values = data.map(valuer, this), + range = ranger.call(this, values, i), + thresholds = binner.call(this, range, values, i), + bin, + i = -1, + n = values.length, + m = thresholds.length - 1, + k = frequency ? 1 : 1 / n, + x; + + // Initialize the bins. + while (++i < m) { + bin = bins[i] = []; + bin.dx = thresholds[i + 1] - (bin.x = thresholds[i]); + bin.y = 0; + } + + // Fill the bins, ignoring values outside the range. + i = -1; while(++i < n) { + x = values[i]; + if ((x >= range[0]) && (x <= range[1])) { + bin = bins[d3.bisect(thresholds, x, 1, m) - 1]; + bin.y += k; + bin.push(data[i]); + } + } + + return bins; + } + + // Specifies how to extract a value from the associated data. The default + // value function is `Number`, which is equivalent to the identity function. + histogram.value = function(x) { + if (!arguments.length) return valuer; + valuer = x; + return histogram; + }; + + // Specifies the range of the histogram. Values outside the specified range + // will be ignored. The argument `x` may be specified either as a two-element + // array representing the minimum and maximum value of the range, or as a + // function that returns the range given the array of values and the current + // index `i`. The default range is the extent (minimum and maximum) of the + // values. + histogram.range = function(x) { + if (!arguments.length) return ranger; + ranger = d3.functor(x); + return histogram; + }; + + // Specifies how to bin values in the histogram. The argument `x` may be + // specified as a number, in which case the range of values will be split + // uniformly into the given number of bins. Or, `x` may be an array of + // threshold values, defining the bins; the specified array must contain the + // rightmost (upper) value, thus specifying n + 1 values for n bins. Or, `x` + // may be a function which is evaluated, being passed the range, the array of + // values, and the current index `i`, returning an array of thresholds. The + // default bin function will divide the values into uniform bins using + // Sturges' formula. + histogram.bins = function(x) { + if (!arguments.length) return binner; + binner = typeof x === "number" + ? function(range) { return d3_layout_histogramBinFixed(range, x); } + : d3.functor(x); + return histogram; + }; + + // Specifies whether the histogram's `y` value is a count (frequency) or a + // probability (density). The default value is true. + histogram.frequency = function(x) { + if (!arguments.length) return frequency; + frequency = !!x; + return histogram; + }; + + return histogram; +}; + +function d3_layout_histogramBinSturges(range, values) { + return d3_layout_histogramBinFixed(range, Math.ceil(Math.log(values.length) / Math.LN2 + 1)); +} + +function d3_layout_histogramBinFixed(range, n) { + var x = -1, + b = +range[0], + m = (range[1] - b) / n, + f = []; + while (++x <= n) f[x] = m * x + b; + return f; +} + +function d3_layout_histogramRange(values) { + return [d3.min(values), d3.max(values)]; +} +d3.layout.hierarchy = function() { + var sort = d3_layout_hierarchySort, + children = d3_layout_hierarchyChildren, + value = d3_layout_hierarchyValue; + + // Recursively compute the node depth and value. + // Also converts the data representation into a standard hierarchy structure. + function recurse(data, depth, nodes) { + var childs = children.call(hierarchy, data, depth), + node = d3_layout_hierarchyInline ? data : {data: data}; + node.depth = depth; + nodes.push(node); + if (childs && (n = childs.length)) { + var i = -1, + n, + c = node.children = [], + v = 0, + j = depth + 1; + while (++i < n) { + d = recurse(childs[i], j, nodes); + d.parent = node; + c.push(d); + v += d.value; + } + if (sort) c.sort(sort); + if (value) node.value = v; + } else if (value) { + node.value = +value.call(hierarchy, data, depth) || 0; + } + return node; + } + + // Recursively re-evaluates the node value. + function revalue(node, depth) { + var children = node.children, + v = 0; + if (children && (n = children.length)) { + var i = -1, + n, + j = depth + 1; + while (++i < n) v += revalue(children[i], j); + } else if (value) { + v = +value.call(hierarchy, d3_layout_hierarchyInline ? node : node.data, depth) || 0; + } + if (value) node.value = v; + return v; + } + + function hierarchy(d) { + var nodes = []; + recurse(d, 0, nodes); + return nodes; + } + + hierarchy.sort = function(x) { + if (!arguments.length) return sort; + sort = x; + return hierarchy; + }; + + hierarchy.children = function(x) { + if (!arguments.length) return children; + children = x; + return hierarchy; + }; + + hierarchy.value = function(x) { + if (!arguments.length) return value; + value = x; + return hierarchy; + }; + + // Re-evaluates the `value` property for the specified hierarchy. + hierarchy.revalue = function(root) { + revalue(root, 0); + return root; + }; + + return hierarchy; +}; + +// A method assignment helper for hierarchy subclasses. +function d3_layout_hierarchyRebind(object, hierarchy) { + d3.rebind(object, hierarchy, "sort", "children", "value"); + + // Add an alias for links, for convenience. + object.links = d3_layout_hierarchyLinks; + + // If the new API is used, enabling inlining. + object.nodes = function(d) { + d3_layout_hierarchyInline = true; + return (object.nodes = object)(d); + }; + + return object; +} + +function d3_layout_hierarchyChildren(d) { + return d.children; +} + +function d3_layout_hierarchyValue(d) { + return d.value; +} + +function d3_layout_hierarchySort(a, b) { + return b.value - a.value; +} + +// Returns an array source+target objects for the specified nodes. +function d3_layout_hierarchyLinks(nodes) { + return d3.merge(nodes.map(function(parent) { + return (parent.children || []).map(function(child) { + return {source: parent, target: child}; + }); + })); +} + +// For backwards-compatibility, don't enable inlining by default. +var d3_layout_hierarchyInline = false; +d3.layout.pack = function() { + var hierarchy = d3.layout.hierarchy().sort(d3_layout_packSort), + size = [1, 1]; + + function pack(d, i) { + var nodes = hierarchy.call(this, d, i), + root = nodes[0]; + + // Recursively compute the layout. + root.x = 0; + root.y = 0; + d3_layout_packTree(root); + + // Scale the layout to fit the requested size. + var w = size[0], + h = size[1], + k = 1 / Math.max(2 * root.r / w, 2 * root.r / h); + d3_layout_packTransform(root, w / 2, h / 2, k); + + return nodes; + } + + pack.size = function(x) { + if (!arguments.length) return size; + size = x; + return pack; + }; + + return d3_layout_hierarchyRebind(pack, hierarchy); +}; + +function d3_layout_packSort(a, b) { + return a.value - b.value; +} + +function d3_layout_packInsert(a, b) { + var c = a._pack_next; + a._pack_next = b; + b._pack_prev = a; + b._pack_next = c; + c._pack_prev = b; +} + +function d3_layout_packSplice(a, b) { + a._pack_next = b; + b._pack_prev = a; +} + +function d3_layout_packIntersects(a, b) { + var dx = b.x - a.x, + dy = b.y - a.y, + dr = a.r + b.r; + return (dr * dr - dx * dx - dy * dy) > .001; // within epsilon +} + +function d3_layout_packCircle(nodes) { + var xMin = Infinity, + xMax = -Infinity, + yMin = Infinity, + yMax = -Infinity, + n = nodes.length, + a, b, c, j, k; + + function bound(node) { + xMin = Math.min(node.x - node.r, xMin); + xMax = Math.max(node.x + node.r, xMax); + yMin = Math.min(node.y - node.r, yMin); + yMax = Math.max(node.y + node.r, yMax); + } + + // Create node links. + nodes.forEach(d3_layout_packLink); + + // Create first node. + a = nodes[0]; + a.x = -a.r; + a.y = 0; + bound(a); + + // Create second node. + if (n > 1) { + b = nodes[1]; + b.x = b.r; + b.y = 0; + bound(b); + + // Create third node and build chain. + if (n > 2) { + c = nodes[2]; + d3_layout_packPlace(a, b, c); + bound(c); + d3_layout_packInsert(a, c); + a._pack_prev = c; + d3_layout_packInsert(c, b); + b = a._pack_next; + + // Now iterate through the rest. + for (var i = 3; i < n; i++) { + d3_layout_packPlace(a, b, c = nodes[i]); + + // Search for the closest intersection. + var isect = 0, s1 = 1, s2 = 1; + for (j = b._pack_next; j !== b; j = j._pack_next, s1++) { + if (d3_layout_packIntersects(j, c)) { + isect = 1; + break; + } + } + if (isect == 1) { + for (k = a._pack_prev; k !== j._pack_prev; k = k._pack_prev, s2++) { + if (d3_layout_packIntersects(k, c)) { + if (s2 < s1) { + isect = -1; + j = k; + } + break; + } + } + } + + // Update node chain. + if (isect == 0) { + d3_layout_packInsert(a, c); + b = c; + bound(c); + } else if (isect > 0) { + d3_layout_packSplice(a, j); + b = j; + i--; + } else { // isect < 0 + d3_layout_packSplice(j, b); + a = j; + i--; + } + } + } + } + + // Re-center the circles and return the encompassing radius. + var cx = (xMin + xMax) / 2, + cy = (yMin + yMax) / 2, + cr = 0; + for (var i = 0; i < n; i++) { + var node = nodes[i]; + node.x -= cx; + node.y -= cy; + cr = Math.max(cr, node.r + Math.sqrt(node.x * node.x + node.y * node.y)); + } + + // Remove node links. + nodes.forEach(d3_layout_packUnlink); + + return cr; +} + +function d3_layout_packLink(node) { + node._pack_next = node._pack_prev = node; +} + +function d3_layout_packUnlink(node) { + delete node._pack_next; + delete node._pack_prev; +} + +function d3_layout_packTree(node) { + var children = node.children; + if (children && children.length) { + children.forEach(d3_layout_packTree); + node.r = d3_layout_packCircle(children); + } else { + node.r = Math.sqrt(node.value); + } +} + +function d3_layout_packTransform(node, x, y, k) { + var children = node.children; + node.x = (x += k * node.x); + node.y = (y += k * node.y); + node.r *= k; + if (children) { + var i = -1, n = children.length; + while (++i < n) d3_layout_packTransform(children[i], x, y, k); + } +} + +function d3_layout_packPlace(a, b, c) { + var db = a.r + c.r, + dx = b.x - a.x, + dy = b.y - a.y; + if (db && (dx || dy)) { + var da = b.r + c.r, + dc = Math.sqrt(dx * dx + dy * dy), + cos = Math.max(-1, Math.min(1, (db * db + dc * dc - da * da) / (2 * db * dc))), + theta = Math.acos(cos), + x = cos * (db /= dc), + y = Math.sin(theta) * db; + c.x = a.x + x * dx + y * dy; + c.y = a.y + x * dy - y * dx; + } else { + c.x = a.x + db; + c.y = a.y; + } +} +// Implements a hierarchical layout using the cluster (or dendogram) algorithm. +d3.layout.cluster = function() { + var hierarchy = d3.layout.hierarchy().sort(null).value(null), + separation = d3_layout_treeSeparation, + size = [1, 1]; // width, height + + function cluster(d, i) { + var nodes = hierarchy.call(this, d, i), + root = nodes[0], + previousNode, + x = 0, + kx, + ky; + + // First walk, computing the initial x & y values. + d3_layout_treeVisitAfter(root, function(node) { + var children = node.children; + if (children && children.length) { + node.x = d3_layout_clusterX(children); + node.y = d3_layout_clusterY(children); + } else { + node.x = previousNode ? x += separation(node, previousNode) : 0; + node.y = 0; + previousNode = node; + } + }); + + // Compute the left-most, right-most, and depth-most nodes for extents. + var left = d3_layout_clusterLeft(root), + right = d3_layout_clusterRight(root), + x0 = left.x - separation(left, right) / 2, + x1 = right.x + separation(right, left) / 2; + + // Second walk, normalizing x & y to the desired size. + d3_layout_treeVisitAfter(root, function(node) { + node.x = (node.x - x0) / (x1 - x0) * size[0]; + node.y = (1 - node.y / root.y) * size[1]; + }); + + return nodes; + } + + cluster.separation = function(x) { + if (!arguments.length) return separation; + separation = x; + return cluster; + }; + + cluster.size = function(x) { + if (!arguments.length) return size; + size = x; + return cluster; + }; + + return d3_layout_hierarchyRebind(cluster, hierarchy); +}; + +function d3_layout_clusterY(children) { + return 1 + d3.max(children, function(child) { + return child.y; + }); +} + +function d3_layout_clusterX(children) { + return children.reduce(function(x, child) { + return x + child.x; + }, 0) / children.length; +} + +function d3_layout_clusterLeft(node) { + var children = node.children; + return children && children.length ? d3_layout_clusterLeft(children[0]) : node; +} + +function d3_layout_clusterRight(node) { + var children = node.children, n; + return children && (n = children.length) ? d3_layout_clusterRight(children[n - 1]) : node; +} +// Node-link tree diagram using the Reingold-Tilford "tidy" algorithm +d3.layout.tree = function() { + var hierarchy = d3.layout.hierarchy().sort(null).value(null), + separation = d3_layout_treeSeparation, + size = [1, 1]; // width, height + + function tree(d, i) { + var nodes = hierarchy.call(this, d, i), + root = nodes[0]; + + function firstWalk(node, previousSibling) { + var children = node.children, + layout = node._tree; + if (children && (n = children.length)) { + var n, + firstChild = children[0], + previousChild, + ancestor = firstChild, + child, + i = -1; + while (++i < n) { + child = children[i]; + firstWalk(child, previousChild); + ancestor = apportion(child, previousChild, ancestor); + previousChild = child; + } + d3_layout_treeShift(node); + var midpoint = .5 * (firstChild._tree.prelim + child._tree.prelim); + if (previousSibling) { + layout.prelim = previousSibling._tree.prelim + separation(node, previousSibling); + layout.mod = layout.prelim - midpoint; + } else { + layout.prelim = midpoint; + } + } else { + if (previousSibling) { + layout.prelim = previousSibling._tree.prelim + separation(node, previousSibling); + } + } + } + + function secondWalk(node, x) { + node.x = node._tree.prelim + x; + var children = node.children; + if (children && (n = children.length)) { + var i = -1, + n; + x += node._tree.mod; + while (++i < n) { + secondWalk(children[i], x); + } + } + } + + function apportion(node, previousSibling, ancestor) { + if (previousSibling) { + var vip = node, + vop = node, + vim = previousSibling, + vom = node.parent.children[0], + sip = vip._tree.mod, + sop = vop._tree.mod, + sim = vim._tree.mod, + som = vom._tree.mod, + shift; + while (vim = d3_layout_treeRight(vim), vip = d3_layout_treeLeft(vip), vim && vip) { + vom = d3_layout_treeLeft(vom); + vop = d3_layout_treeRight(vop); + vop._tree.ancestor = node; + shift = vim._tree.prelim + sim - vip._tree.prelim - sip + separation(vim, vip); + if (shift > 0) { + d3_layout_treeMove(d3_layout_treeAncestor(vim, node, ancestor), node, shift); + sip += shift; + sop += shift; + } + sim += vim._tree.mod; + sip += vip._tree.mod; + som += vom._tree.mod; + sop += vop._tree.mod; + } + if (vim && !d3_layout_treeRight(vop)) { + vop._tree.thread = vim; + vop._tree.mod += sim - sop; + } + if (vip && !d3_layout_treeLeft(vom)) { + vom._tree.thread = vip; + vom._tree.mod += sip - som; + ancestor = node; + } + } + return ancestor; + } + + // Initialize temporary layout variables. + d3_layout_treeVisitAfter(root, function(node, previousSibling) { + node._tree = { + ancestor: node, + prelim: 0, + mod: 0, + change: 0, + shift: 0, + number: previousSibling ? previousSibling._tree.number + 1 : 0 + }; + }); + + // Compute the layout using Buchheim et al.'s algorithm. + firstWalk(root); + secondWalk(root, -root._tree.prelim); + + // Compute the left-most, right-most, and depth-most nodes for extents. + var left = d3_layout_treeSearch(root, d3_layout_treeLeftmost), + right = d3_layout_treeSearch(root, d3_layout_treeRightmost), + deep = d3_layout_treeSearch(root, d3_layout_treeDeepest), + x0 = left.x - separation(left, right) / 2, + x1 = right.x + separation(right, left) / 2, + y1 = deep.depth || 1; + + // Clear temporary layout variables; transform x and y. + d3_layout_treeVisitAfter(root, function(node) { + node.x = (node.x - x0) / (x1 - x0) * size[0]; + node.y = node.depth / y1 * size[1]; + delete node._tree; + }); + + return nodes; + } + + tree.separation = function(x) { + if (!arguments.length) return separation; + separation = x; + return tree; + }; + + tree.size = function(x) { + if (!arguments.length) return size; + size = x; + return tree; + }; + + return d3_layout_hierarchyRebind(tree, hierarchy); +}; + +function d3_layout_treeSeparation(a, b) { + return a.parent == b.parent ? 1 : 2; +} + +// function d3_layout_treeSeparationRadial(a, b) { +// return (a.parent == b.parent ? 1 : 2) / a.depth; +// } + +function d3_layout_treeLeft(node) { + var children = node.children; + return children && children.length ? children[0] : node._tree.thread; +} + +function d3_layout_treeRight(node) { + var children = node.children, + n; + return children && (n = children.length) ? children[n - 1] : node._tree.thread; +} + +function d3_layout_treeSearch(node, compare) { + var children = node.children; + if (children && (n = children.length)) { + var child, + n, + i = -1; + while (++i < n) { + if (compare(child = d3_layout_treeSearch(children[i], compare), node) > 0) { + node = child; + } + } + } + return node; +} + +function d3_layout_treeRightmost(a, b) { + return a.x - b.x; +} + +function d3_layout_treeLeftmost(a, b) { + return b.x - a.x; +} + +function d3_layout_treeDeepest(a, b) { + return a.depth - b.depth; +} + +function d3_layout_treeVisitAfter(node, callback) { + function visit(node, previousSibling) { + var children = node.children; + if (children && (n = children.length)) { + var child, + previousChild = null, + i = -1, + n; + while (++i < n) { + child = children[i]; + visit(child, previousChild); + previousChild = child; + } + } + callback(node, previousSibling); + } + visit(node, null); +} + +function d3_layout_treeShift(node) { + var shift = 0, + change = 0, + children = node.children, + i = children.length, + child; + while (--i >= 0) { + child = children[i]._tree; + child.prelim += shift; + child.mod += shift; + shift += child.shift + (change += child.change); + } +} + +function d3_layout_treeMove(ancestor, node, shift) { + ancestor = ancestor._tree; + node = node._tree; + var change = shift / (node.number - ancestor.number); + ancestor.change += change; + node.change -= change; + node.shift += shift; + node.prelim += shift; + node.mod += shift; +} + +function d3_layout_treeAncestor(vim, node, ancestor) { + return vim._tree.ancestor.parent == node.parent + ? vim._tree.ancestor + : ancestor; +} +// Squarified Treemaps by Mark Bruls, Kees Huizing, and Jarke J. van Wijk +// Modified to support a target aspect ratio by Jeff Heer +d3.layout.treemap = function() { + var hierarchy = d3.layout.hierarchy(), + round = Math.round, + size = [1, 1], // width, height + padding = null, + pad = d3_layout_treemapPadNull, + sticky = false, + stickies, + ratio = 0.5 * (1 + Math.sqrt(5)); // golden ratio + + // Compute the area for each child based on value & scale. + function scale(children, k) { + var i = -1, + n = children.length, + child, + area; + while (++i < n) { + area = (child = children[i]).value * (k < 0 ? 0 : k); + child.area = isNaN(area) || area <= 0 ? 0 : area; + } + } + + // Recursively arranges the specified node's children into squarified rows. + function squarify(node) { + var children = node.children; + if (children && children.length) { + var rect = pad(node), + row = [], + remaining = children.slice(), // copy-on-write + child, + best = Infinity, // the best row score so far + score, // the current row score + u = Math.min(rect.dx, rect.dy), // initial orientation + n; + scale(remaining, rect.dx * rect.dy / node.value); + row.area = 0; + while ((n = remaining.length) > 0) { + row.push(child = remaining[n - 1]); + row.area += child.area; + if ((score = worst(row, u)) <= best) { // continue with this orientation + remaining.pop(); + best = score; + } else { // abort, and try a different orientation + row.area -= row.pop().area; + position(row, u, rect, false); + u = Math.min(rect.dx, rect.dy); + row.length = row.area = 0; + best = Infinity; + } + } + if (row.length) { + position(row, u, rect, true); + row.length = row.area = 0; + } + children.forEach(squarify); + } + } + + // Recursively resizes the specified node's children into existing rows. + // Preserves the existing layout! + function stickify(node) { + var children = node.children; + if (children && children.length) { + var rect = pad(node), + remaining = children.slice(), // copy-on-write + child, + row = []; + scale(remaining, rect.dx * rect.dy / node.value); + row.area = 0; + while (child = remaining.pop()) { + row.push(child); + row.area += child.area; + if (child.z != null) { + position(row, child.z ? rect.dx : rect.dy, rect, !remaining.length); + row.length = row.area = 0; + } + } + children.forEach(stickify); + } + } + + // Computes the score for the specified row, as the worst aspect ratio. + function worst(row, u) { + var s = row.area, + r, + rmax = 0, + rmin = Infinity, + i = -1, + n = row.length; + while (++i < n) { + if (!(r = row[i].area)) continue; + if (r < rmin) rmin = r; + if (r > rmax) rmax = r; + } + s *= s; + u *= u; + return s + ? Math.max((u * rmax * ratio) / s, s / (u * rmin * ratio)) + : Infinity; + } + + // Positions the specified row of nodes. Modifies `rect`. + function position(row, u, rect, flush) { + var i = -1, + n = row.length, + x = rect.x, + y = rect.y, + v = u ? round(row.area / u) : 0, + o; + if (u == rect.dx) { // horizontal subdivision + if (flush || v > rect.dy) v = v ? rect.dy : 0; // over+underflow + while (++i < n) { + o = row[i]; + o.x = x; + o.y = y; + o.dy = v; + x += o.dx = v ? round(o.area / v) : 0; + } + o.z = true; + o.dx += rect.x + rect.dx - x; // rounding error + rect.y += v; + rect.dy -= v; + } else { // vertical subdivision + if (flush || v > rect.dx) v = v ? rect.dx : 0; // over+underflow + while (++i < n) { + o = row[i]; + o.x = x; + o.y = y; + o.dx = v; + y += o.dy = v ? round(o.area / v) : 0; + } + o.z = false; + o.dy += rect.y + rect.dy - y; // rounding error + rect.x += v; + rect.dx -= v; + } + } + + function treemap(d) { + var nodes = stickies || hierarchy(d), + root = nodes[0]; + root.x = 0; + root.y = 0; + root.dx = size[0]; + root.dy = size[1]; + if (stickies) hierarchy.revalue(root); + scale([root], root.dx * root.dy / root.value); + (stickies ? stickify : squarify)(root); + if (sticky) stickies = nodes; + return nodes; + } + + treemap.size = function(x) { + if (!arguments.length) return size; + size = x; + return treemap; + }; + + treemap.padding = function(x) { + if (!arguments.length) return padding; + + function padFunction(node) { + var p = x.call(treemap, node, node.depth); + return p == null + ? d3_layout_treemapPadNull(node) + : d3_layout_treemapPad(node, typeof p === "number" ? [p, p, p, p] : p); + } + + function padConstant(node) { + return d3_layout_treemapPad(node, x); + } + + var type; + pad = (padding = x) == null ? d3_layout_treemapPadNull + : (type = typeof x) === "function" ? padFunction + : type === "number" ? (x = [x, x, x, x], padConstant) + : padConstant; + return treemap; + }; + + treemap.round = function(x) { + if (!arguments.length) return round != Number; + round = x ? Math.round : Number; + return treemap; + }; + + treemap.sticky = function(x) { + if (!arguments.length) return sticky; + sticky = x; + stickies = null; + return treemap; + }; + + treemap.ratio = function(x) { + if (!arguments.length) return ratio; + ratio = x; + return treemap; + }; + + return d3_layout_hierarchyRebind(treemap, hierarchy); +}; + +function d3_layout_treemapPadNull(node) { + return {x: node.x, y: node.y, dx: node.dx, dy: node.dy}; +} + +function d3_layout_treemapPad(node, padding) { + var x = node.x + padding[3], + y = node.y + padding[0], + dx = node.dx - padding[1] - padding[3], + dy = node.dy - padding[0] - padding[2]; + if (dx < 0) { x += dx / 2; dx = 0; } + if (dy < 0) { y += dy / 2; dy = 0; } + return {x: x, y: y, dx: dx, dy: dy}; +} +})(); diff --git a/gstudio/static/gstudio/js/d3.layout.min.js b/gstudio/static/gstudio/js/d3.layout.min.js new file mode 100644 index 0000000..a6a893e --- /dev/null +++ b/gstudio/static/gstudio/js/d3.layout.min.js @@ -0,0 +1 @@ +(function(){function a(a){var b=a.source,d=a.target,e=c(b,d),f=[b];while(b!==e)b=b.parent,f.push(b);var g=f.length;while(d!==e)f.splice(g,0,d),d=d.parent;return f}function b(a){var b=[],c=a.parent;while(c!=null)b.push(a),a=c,c=c.parent;return b.push(a),b}function c(a,c){if(a===c)return a;var d=b(a),e=b(c),f=d.pop(),g=e.pop(),h=null;while(f===g)h=f,f=d.pop(),g=e.pop();return h}function g(a){a.fixed|=2}function h(a){a!==f&&(a.fixed&=1)}function i(){j(),f.fixed&=1,e=f=null}function j(){f.px=d3.event.x,f.py=d3.event.y,e.resume()}function k(a,b,c){var d=0,e=0;a.charge=0;if(!a.leaf){var f=a.nodes,g=f.length,h=-1,i;while(++h<g){i=f[h];if(i==null)continue;k(i,b,c),a.charge+=i.charge,d+=i.charge*i.cx,e+=i.charge*i.cy}}if(a.point){a.leaf||(a.point.x+=Math.random()-.5,a.point.y+=Math.random()-.5);var j=b*c[a.point.index];a.charge+=a.pointCharge=j,d+=j*a.point.x,e+=j*a.point.y}a.cx=d/a.charge,a.cy=e/a.charge}function l(a){return 20}function m(a){return 1}function o(a){return a.x}function p(a){return a.y}function q(a,b,c){a.y0=b,a.y=c}function t(a){var b=1,c=0,d=a[0][1],e,f=a.length;for(;b<f;++b)(e=a[b][1])>d&&(c=b,d=e);return c}function u(a){return a.reduce(v,0)}function v(a,b){return a+b[1]}function w(a,b){return x(a,Math.ceil(Math.log(b.length)/Math.LN2+1))}function x(a,b){var c=-1,d=+a[0],e=(a[1]-d)/b,f=[];while(++c<=b)f[c]=e*c+d;return f}function y(a){return[d3.min(a),d3.max(a)]}function z(a,b){return d3.rebind(a,b,"sort","children","value"),a.links=D,a.nodes=function(b){return E=!0,(a.nodes=a)(b)},a}function A(a){return a.children}function B(a){return a.value}function C(a,b){return b.value-a.value}function D(a){return d3.merge(a.map(function(a){return(a.children||[]).map(function(b){return{source:a,target:b}})}))}function F(a,b){return a.value-b.value}function G(a,b){var c=a._pack_next;a._pack_next=b,b._pack_prev=a,b._pack_next=c,c._pack_prev=b}function H(a,b){a._pack_next=b,b._pack_prev=a}function I(a,b){var c=b.x-a.x,d=b.y-a.y,e=a.r+b.r;return e*e-c*c-d*d>.001}function J(a){function l(a){b=Math.min(a.x-a.r,b),c=Math.max(a.x+a.r,c),d=Math.min(a.y-a.r,d),e=Math.max(a.y+a.r,e)}var b=Infinity,c=-Infinity,d=Infinity,e=-Infinity,f=a.length,g,h,i,j,k;a.forEach(K),g=a[0],g.x=-g.r,g.y=0,l(g);if(f>1){h=a[1],h.x=h.r,h.y=0,l(h);if(f>2){i=a[2],O(g,h,i),l(i),G(g,i),g._pack_prev=i,G(i,h),h=g._pack_next;for(var m=3;m<f;m++){O(g,h,i=a[m]);var n=0,o=1,p=1;for(j=h._pack_next;j!==h;j=j._pack_next,o++)if(I(j,i)){n=1;break}if(n==1)for(k=g._pack_prev;k!==j._pack_prev;k=k._pack_prev,p++)if(I(k,i)){p<o&&(n=-1,j=k);break}n==0?(G(g,i),h=i,l(i)):n>0?(H(g,j),h=j,m--):(H(j,h),g=j,m--)}}}var q=(b+c)/2,r=(d+e)/2,s=0;for(var m=0;m<f;m++){var t=a[m];t.x-=q,t.y-=r,s=Math.max(s,t.r+Math.sqrt(t.x*t.x+t.y*t.y))}return a.forEach(L),s}function K(a){a._pack_next=a._pack_prev=a}function L(a){delete a._pack_next,delete a._pack_prev}function M(a){var b=a.children;b&&b.length?(b.forEach(M),a.r=J(b)):a.r=Math.sqrt(a.value)}function N(a,b,c,d){var e=a.children;a.x=b+=d*a.x,a.y=c+=d*a.y,a.r*=d;if(e){var f=-1,g=e.length;while(++f<g)N(e[f],b,c,d)}}function O(a,b,c){var d=a.r+c.r,e=b.x-a.x,f=b.y-a.y;if(d&&(e||f)){var g=b.r+c.r,h=Math.sqrt(e*e+f*f),i=Math.max(-1,Math.min(1,(d*d+h*h-g*g)/(2*d*h))),j=Math.acos(i),k=i*(d/=h),l=Math.sin(j)*d;c.x=a.x+k*e+l*f,c.y=a.y+k*f-l*e}else c.x=a.x+d,c.y=a.y}function P(a){return 1+d3.max(a,function(a){return a.y})}function Q(a){return a.reduce(function(a,b){return a+b.x},0)/a.length}function R(a){var b=a.children;return b&&b.length?R(b[0]):a}function S(a){var b=a.children,c;return b&&(c=b.length)?S(b[c-1]):a}function T(a,b){return a.parent==b.parent?1:2}function U(a){var b=a.children;return b&&b.length?b[0]:a._tree.thread}function V(a){var b=a.children,c;return b&&(c=b.length)?b[c-1]:a._tree.thread}function W(a,b){var c=a.children;if(c&&(e=c.length)){var d,e,f=-1;while(++f<e)b(d=W(c[f],b),a)>0&&(a=d)}return a}function X(a,b){return a.x-b.x}function Y(a,b){return b.x-a.x}function Z(a,b){return a.depth-b.depth}function $(a,b){function c(a,d){var e=a.children;if(e&&(i=e.length)){var f,g=null,h=-1,i;while(++h<i)f=e[h],c(f,g),g=f}b(a,d)}c(a,null)}function _(a){var b=0,c=0,d=a.children,e=d.length,f;while(--e>=0)f=d[e]._tree,f.prelim+=b,f.mod+=b,b+=f.shift+(c+=f.change)}function ba(a,b,c){a=a._tree,b=b._tree;var d=c/(b.number-a.number);a.change+=d,b.change-=d,b.shift+=c,b.prelim+=c,b.mod+=c}function bb(a,b,c){return a._tree.ancestor.parent==b.parent?a._tree.ancestor:c}function bc(a){return{x:a.x,y:a.y,dx:a.dx,dy:a.dy}}function bd(a,b){var c=a.x+b[3],d=a.y+b[0],e=a.dx-b[1]-b[3],f=a.dy-b[0]-b[2];return e<0&&(c+=e/2,e=0),f<0&&(d+=f/2,f=0),{x:c,y:d,dx:e,dy:f}}d3.layout={},d3.layout.bundle=function(){return function(b){var c=[],d=-1,e=b.length;while(++d<e)c.push(a(b[d]));return c}},d3.layout.chord=function(){function j(){var a={},j=[],l=d3.range(e),m=[],n,o,p,q,r;b=[],c=[],n=0,q=-1;while(++q<e){o=0,r=-1;while(++r<e)o+=d[q][r];j.push(o),m.push(d3.range(e)),n+=o}g&&l.sort(function(a,b){return g(j[a],j[b])}),h&&m.forEach(function(a,b){a.sort(function(a,c){return h(d[b][a],d[b][c])})}),n=(2*Math.PI-f*e)/n,o=0,q=-1;while(++q<e){p=o,r=-1;while(++r<e){var s=l[q],t=m[s][r],u=d[s][t],v=o,w=o+=u*n;a[s+"-"+t]={index:s,subindex:t,startAngle:v,endAngle:w,value:u}}c.push({index:s,startAngle:p,endAngle:o,value:(o-p)/n}),o+=f}q=-1;while(++q<e){r=q-1;while(++r<e){var x=a[q+"-"+r],y=a[r+"-"+q];(x.value||y.value)&&b.push(x.value<y.value?{source:y,target:x}:{source:x,target:y})}}i&&k()}function k(){b.sort(function(a,b){return i((a.source.value+a.target.value)/2,(b.source.value+b.target.value)/2)})}var a={},b,c,d,e,f=0,g,h,i;return a.matrix=function(f){return arguments.length?(e=(d=f)&&d.length,b=c=null,a):d},a.padding=function(d){return arguments.length?(f=d,b=c=null,a):f},a.sortGroups=function(d){return arguments.length?(g=d,b=c=null,a):g},a.sortSubgroups=function(c){return arguments.length?(h=c,b=null,a):h},a.sortChords=function(c){return arguments.length?(i=c,b&&k(),a):i},a.chords=function(){return b||j(),b},a.groups=function(){return c||j(),c},a},d3.layout.force=function(){function A(a){return function(b,c,d,e,f){if(b.point!==a){var g=b.cx-a.x,h=b.cy-a.y,i=1/Math.sqrt(g*g+h*h);if((e-c)*i<t){var j=b.charge*i*i;return a.px-=g*j,a.py-=h*j,!0}if(b.point&&isFinite(i)){var j=b.pointCharge*i*i;a.px-=g*j,a.py-=h*j}}return!b.charge}}function B(){var a=v.length,d=w.length,e,f,g,h,i,j,l,m,p;for(f=0;f<d;++f){g=w[f],h=g.source,i=g.target,m=i.x-h.x,p=i.y-h.y;if(j=m*m+p*p)j=n*y[f]*((j=Math.sqrt(j))-x[f])/j,m*=j,p*=j,i.x-=m*(l=h.weight/(i.weight+h.weight)),i.y-=p*l,h.x+=m*(l=1-l),h.y+=p*l}if(l=n*s){m=c[0]/2,p=c[1]/2,f=-1;if(l)while(++f<a)g=v[f],g.x+=(m-g.x)*l,g.y+=(p-g.y)*l}if(r){k(e=d3.geom.quadtree(v),n,z),f=-1;while(++f<a)(g=v[f]).fixed||e.visit(A(g))}f=-1;while(++f<a)g=v[f],g.fixed?(g.x=g.px,g.y=g.py):(g.x-=(g.px-(g.px=g.x))*o,g.y-=(g.py-(g.py=g.y))*o);return b.tick({type:"tick",alpha:n}),(n*=.99)<.005}function C(b){g(f=b),e=a}var a={},b=d3.dispatch("tick"),c=[1,1],d,n,o=.9,p=l,q=m,r=-30,s=.1,t=.8,u,v=[],w=[],x,y,z;return a.nodes=function(b){return arguments.length?(v=b,a):v},a.links=function(b){return arguments.length?(w=b,a):w},a.size=function(b){return arguments.length?(c=b,a):c},a.linkDistance=function(b){return arguments.length?(p=d3.functor(b),a):p},a.distance=a.linkDistance,a.linkStrength=function(b){return arguments.length?(q=d3.functor(b),a):q},a.friction=function(b){return arguments.length?(o=b,a):o},a.charge=function(b){return arguments.length?(r=typeof b=="function"?b:+b,a):r},a.gravity=function(b){return arguments.length?(s=b,a):s},a.theta=function(b){return arguments.length?(t=b,a):t},a.start=function(){function k(a,c){var d=l(b),e=-1,f=d.length,g;while(++e<f)if(!isNaN(g=d[e][a]))return g;return Math.random()*c}function l(){if(!i){i=[];for(d=0;d<e;++d)i[d]=[];for(d=0;d<f;++d){var a=w[d];i[a.source.index].push(a.target),i[a.target.index].push(a.source)}}return i[b]}var b,d,e=v.length,f=w.length,g=c[0],h=c[1],i,j;for(b=0;b<e;++b)(j=v[b]).index=b,j.weight=0;x=[],y=[];for(b=0;b<f;++b)j=w[b],typeof j.source=="number"&&(j.source=v[j.source]),typeof j.target=="number"&&(j.target=v[j.target]),x[b]=p.call(this,j,b),y[b]=q.call(this,j,b),++j.source.weight,++j.target.weight;for(b=0;b<e;++b)j=v[b],isNaN(j.x)&&(j.x=k("x",g)),isNaN(j.y)&&(j.y=k("y",h)),isNaN(j.px)&&(j.px=j.x),isNaN(j.py)&&(j.py=j.y);z=[];if(typeof r=="function")for(b=0;b<e;++b)z[b]=+r.call(this,v[b],b);else for(b=0;b<e;++b)z[b]=r;return a.resume()},a.resume=function(){return n=.1,d3.timer(B),a},a.stop=function(){return n=0,a},a.drag=function(){d||(d=d3.behavior.drag().origin(Object).on("dragstart",C).on("drag",j).on("dragend",i)),this.on("mouseover.force",g).on("mouseout.force",h).call(d)},d3.rebind(a,b,"on")};var e,f;d3.layout.partition=function(){function c(a,b,d,e){var f=a.children;a.x=b,a.y=a.depth*e,a.dx=d,a.dy=e;if(f&&(h=f.length)){var g=-1,h,i,j;d=a.value?d/a.value:0;while(++g<h)c(i=f[g],b,j=i.value*d,e),b+=j}}function d(a){var b=a.children,c=0;if(b&&(f=b.length)){var e=-1,f;while(++e<f)c=Math.max(c,d(b[e]))}return 1+c}function e(e,f){var g=a.call(this,e,f);return c(g[0],0,b[0],b[1]/d(g[0])),g}var a=d3.layout.hierarchy(),b=[1,1];return e.size=function(a){return arguments.length?(b=a,e):b},z(e,a)},d3.layout.pie=function(){function f(g,h){var i=g.map(function(b,c){return+a.call(f,b,c)}),j=+(typeof c=="function"?c.apply(this,arguments):c),k=((typeof e=="function"?e.apply(this,arguments):e)-c)/d3.sum(i),l=d3.range(g.length);b!=null&&l.sort(b===n?function(a,b){return i[b]-i[a]}:function(a,c){return b(g[a],g[c])});var m=l.map(function(a){return{data:g[a],value:d=i[a],startAngle:j,endAngle:j+=d*k}});return g.map(function(a,b){return m[l[b]]})}var a=Number,b=n,c=0,e=2*Math.PI;return f.value=function(b){return arguments.length?(a=b,f):a},f.sort=function(a){return arguments.length?(b=a,f):b},f.startAngle=function(a){return arguments.length?(c=a,f):c},f.endAngle=function(a){return arguments.length?(e=a,f):e},f};var n={};d3.layout.stack=function(){function g(h,i){var j=h.map(function(b,c){return a.call(g,b,c)}),k=j.map(function(a,b){return a.map(function(a,b){return[e.call(g,a,b),f.call(g,a,b)]})}),l=b.call(g,k,i);j=d3.permute(j,l),k=d3.permute(k,l);var m=c.call(g,k,i),n=j.length,o=j[0].length,p,q,r;for(q=0;q<o;++q){d.call(g,j[0][q],r=m[q],k[0][q][1]);for(p=1;p<n;++p)d.call(g,j[p][q],r+=k[p-1][q][1],k[p][q][1])}return h}var a=Object,b=r["default"],c=s.zero,d=q,e=o,f=p;return g.values=function(b){return arguments.length?(a=b,g):a},g.order=function(a){return arguments.length?(b=typeof a=="function"?a:r[a],g):b},g.offset=function(a){return arguments.length?(c=typeof a=="function"?a:s[a],g):c},g.x=function(a){return arguments.length?(e=a,g):e},g.y=function(a){return arguments.length?(f=a,g):f},g.out=function(a){return arguments.length?(d=a,g):d},g};var r={"inside-out":function(a){var b=a.length,c,d,e=a.map(t),f=a.map(u),g=d3.range(b).sort(function(a,b){return e[a]-e[b]}),h=0,i=0,j=[],k=[];for(c=0;c<b;++c)d=g[c],h<i?(h+=f[d],j.push(d)):(i+=f[d],k.push(d));return k.reverse().concat(j)},reverse:function(a){return d3.range(a.length).reverse()},"default":function(a){return d3.range(a.length)}},s={silhouette:function(a){var b=a.length,c=a[0].length,d=[],e=0,f,g,h,i=[];for(g=0;g<c;++g){for(f=0,h=0;f<b;f++)h+=a[f][g][1];h>e&&(e=h),d.push(h)}for(g=0;g<c;++g)i[g]=(e-d[g])/2;return i},wiggle:function(a){var b=a.length,c=a[0],d=c.length,e=0,f,g,h,i,j,k,l,m,n,o=[];o[0]=m=n=0;for(g=1;g<d;++g){for(f=0,i=0;f<b;++f)i+=a[f][g][1];for(f=0,j=0,l=c[g][0]-c[g-1][0];f<b;++f){for(h=0,k=(a[f][g][1]-a[f][g-1][1])/(2*l);h<f;++h)k+=(a[h][g][1]-a[h][g-1][1])/l;j+=k*a[f][g][1]}o[g]=m-=i?j/i*l:0,m<n&&(n=m)}for(g=0;g<d;++g)o[g]-=n;return o},expand:function(a){var b=a.length,c=a[0].length,d=1/b,e,f,g,h=[];for(f=0;f<c;++f){for(e=0,g=0;e<b;e++)g+=a[e][f][1];if(g)for(e=0;e<b;e++)a[e][f][1]/=g;else for(e=0;e<b;e++)a[e][f][1]=d}for(f=0;f<c;++f)h[f]=0;return h},zero:function(a){var b=-1,c=a[0].length,d=[];while(++b<c)d[b]=0;return d}};d3.layout.histogram=function(){function e(e,f){var g=[],h=e.map(b,this),i=c.call(this,h,f),j=d.call(this,i,h,f),k,f=-1,l=h.length,m=j.length-1,n=a?1:1/l,o;while(++f<m)k=g[f]=[],k.dx=j[f+1]-(k.x=j[f]),k.y=0;f=-1;while(++f<l)o=h[f],o>=i[0]&&o<=i[1]&&(k=g[d3.bisect(j,o,1,m)-1],k.y+=n,k.push(e[f]));return g}var a=!0,b=Number,c=y,d=w;return e.value=function(a){return arguments.length?(b=a,e):b},e.range=function(a){return arguments.length?(c=d3.functor(a),e):c},e.bins=function(a){return arguments.length?(d=typeof a=="number"?function(b){return x(b,a)}:d3.functor(a),e):d},e.frequency=function(b){return arguments.length?(a=!!b,e):a},e},d3.layout.hierarchy=function(){function e(f,h,i){var j=b.call(g,f,h),k=E?f:{data:f};k.depth=h,i.push(k);if(j&&(m=j.length)){var l=-1,m,n=k.children=[],o=0,p=h+1;while(++l<m)d=e(j[l],p,i),d.parent=k,n.push(d),o+=d.value;a&&n.sort(a),c&&(k.value=o)}else c&&(k.value=+c.call(g,f,h)||0);return k}function f(a,b){var d=a.children,e=0;if(d&&(i=d.length)){var h=-1,i,j=b+1;while(++h<i)e+=f(d[h],j)}else c&&(e=+c.call(g,E?a:a.data,b)||0);return c&&(a.value=e),e}function g(a){var b=[];return e(a,0,b),b}var a=C,b=A,c=B;return g.sort=function(b){return arguments.length?(a=b,g):a},g.children=function(a){return arguments.length?(b=a,g):b},g.value=function(a){return arguments.length?(c=a,g):c},g.revalue=function(a){return f(a,0),a},g};var E=!1;d3.layout.pack=function(){function c(c,d){var e=a.call(this,c,d),f=e[0];f.x=0,f.y=0,M(f);var g=b[0],h=b[1],i=1/Math.max(2*f.r/g,2*f.r/h);return N(f,g/2,h/2,i),e}var a=d3.layout.hierarchy().sort(F),b=[1,1];return c.size=function(a){return arguments.length?(b=a,c):b},z(c,a)},d3.layout.cluster=function(){function d(d,e){var f=a.call(this,d,e),g=f[0],h,i=0,j,k;$(g,function(a){var c=a.children;c&&c.length?(a.x=Q(c),a.y=P(c)):(a.x=h?i+=b(a,h):0,a.y=0,h=a)});var l=R(g),m=S(g),n=l.x-b(l,m)/2,o=m.x+b(m,l)/2;return $(g,function(a){a.x=(a.x-n)/(o-n)*c[0],a.y=(1-a.y/g.y)*c[1]}),f}var a=d3.layout.hierarchy().sort(null).value(null),b=T,c=[1,1];return d.separation=function(a){return arguments.length?(b=a,d):b},d.size=function(a){return arguments.length?(c=a,d):c},z(d,a)},d3.layout.tree=function(){function d(d,e){function h(a,c){var d=a.children,e=a._tree;if(d&&(f=d.length)){var f,g=d[0],i,k=g,l,m=-1;while(++m<f)l=d[m],h(l,i),k=j(l,i,k),i=l;_(a);var n=.5*(g._tree.prelim+l._tree.prelim);c?(e.prelim=c._tree.prelim+b(a,c),e.mod=e.prelim-n):e.prelim=n}else c&&(e.prelim=c._tree.prelim+b(a,c))}function i(a,b){a.x=a._tree.prelim+b;var c=a.children;if(c&&(e=c.length)){var d=-1,e;b+=a._tree.mod;while(++d<e)i(c[d],b)}}function j(a,c,d){if(c){var e=a,f=a,g=c,h=a.parent.children[0],i=e._tree.mod,j=f._tree.mod,k=g._tree.mod,l=h._tree.mod,m;while(g=V(g),e=U(e),g&&e)h=U(h),f=V(f),f._tree.ancestor=a,m=g._tree.prelim+k-e._tree.prelim-i+b(g,e),m>0&&(ba(bb(g,a,d),a,m),i+=m,j+=m),k+=g._tree.mod,i+=e._tree.mod,l+=h._tree.mod,j+=f._tree.mod;g&&!V(f)&&(f._tree.thread=g,f._tree.mod+=k-j),e&&!U(h)&&(h._tree.thread=e,h._tree.mod+=i-l,d=a)}return d}var f=a.call(this,d,e),g=f[0];$(g,function(a,b){a._tree={ancestor:a,prelim:0,mod:0,change:0,shift:0,number:b?b._tree.number+1:0}}),h(g),i(g,-g._tree.prelim);var k=W(g,Y),l=W(g,X),m=W(g,Z),n=k.x-b(k,l)/2,o=l.x+b(l,k)/2,p=m.depth||1;return $(g,function(a){a.x=(a.x-n)/(o-n)*c[0],a.y=a.depth/p*c[1],delete a._tree}),f}var a=d3.layout.hierarchy().sort(null).value(null),b=T,c=[1,1];return d.separation=function(a){return arguments.length?(b=a,d):b},d.size=function(a){return arguments.length?(c=a,d):c},z(d,a)},d3.layout.treemap=function(){function i(a,b){var c=-1,d=a.length,e,f;while(++c<d)f=(e=a[c]).value*(b<0?0:b),e.area=isNaN(f)||f<=0?0:f}function j(a){var b=a.children;if(b&&b.length){var c=e(a),d=[],f=b.slice(),g,h=Infinity,k,n=Math.min(c.dx,c.dy),o;i(f,c.dx*c.dy/a.value),d.area=0;while((o=f.length)>0)d.push(g=f[o-1]),d.area+=g.area,(k=l(d,n))<=h?(f.pop(),h=k):(d.area-=d.pop().area,m(d,n,c,!1),n=Math.min(c.dx,c.dy),d.length=d.area=0,h=Infinity);d.length&&(m(d,n,c,!0),d.length=d.area=0),b.forEach(j)}}function k(a){var b=a.children;if(b&&b.length){var c=e(a),d=b.slice(),f,g=[];i(d,c.dx*c.dy/a.value),g.area=0;while(f=d.pop())g.push(f),g.area+=f.area,f.z!=null&&(m(g,f.z?c.dx:c.dy,c,!d.length),g.length=g.area=0);b.forEach(k)}}function l(a,b){var c=a.area,d,e=0,f=Infinity,g=-1,i=a.length;while(++g<i){if(!(d=a[g].area))continue;d<f&&(f=d),d>e&&(e=d)}return c*=c,b*=b,c?Math.max(b*e*h/c,c/(b*f*h)):Infinity}function m(a,c,d,e){var f=-1,g=a.length,h=d.x,i=d.y,j=c?b(a.area/c):0,k;if(c==d.dx){if(e||j>d.dy)j=j?d.dy:0;while(++f<g)k=a[f],k.x=h,k.y=i,k.dy=j,h+=k.dx=j?b(k.area/j):0;k.z=!0,k.dx+=d.x+d.dx-h,d.y+=j,d.dy-=j}else{if(e||j>d.dx)j=j?d.dx:0;while(++f<g)k=a[f],k.x=h,k.y=i,k.dx=j,i+=k.dy=j?b(k.area/j):0;k.z=!1,k.dy+=d.y+d.dy-i,d.x+=j,d.dx-=j}}function n(b){var d=g||a(b),e=d[0];return e.x=0,e.y=0,e.dx=c[0],e.dy=c[1],g&&a.revalue(e),i([e],e.dx*e.dy/e.value),(g?k:j)(e),f&&(g=d),d}var a=d3.layout.hierarchy(),b=Math.round,c=[1,1],d=null,e=bc,f=!1,g,h=.5*(1+Math.sqrt(5));return n.size=function(a){return arguments.length?(c=a,n):c},n.padding=function(a){function b(b){var c=a.call(n,b,b.depth);return c==null?bc(b):bd(b,typeof c=="number"?[c,c,c,c]:c)}function c(b){return bd(b,a)}if(!arguments.length)return d;var f;return e=(d=a)==null?bc:(f=typeof a)==="function"?b:f==="number"?(a=[a,a,a,a],c):c,n},n.round=function(a){return arguments.length?(b=a?Math.round:Number,n):b!=Number},n.sticky=function(a){return arguments.length?(f=a,g=null,n):f},n.ratio=function(a){return arguments.length?(h=a,n):h},z(n,a)}})();
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/d3.min.js b/gstudio/static/gstudio/js/d3.min.js new file mode 100644 index 0000000..c6e12d4 --- /dev/null +++ b/gstudio/static/gstudio/js/d3.min.js @@ -0,0 +1,2 @@ +(function(){function e(a){var b=-1,c=a.length,d=[];while(++b<c)d.push(a[b]);return d}function f(a){return Array.prototype.slice.call(a)}function i(){return this}function j(a,b,c){return function(){var d=c.apply(b,arguments);return arguments.length?a:d}}function k(a){return a!=null&&!isNaN(a)}function l(a){return a.length}function m(a){return a==null}function n(a){return a.replace(/(^\s+)|(\s+$)/g,"").replace(/\s+/g," ")}function q(){}function r(){function c(){var b=a,c=-1,d=b.length,e;while(++c<d)(e=b[c].on)&&e.apply(this,arguments)}var a=[],b={};return c.on=function(d,e){var f,g;if(arguments.length<2)return(f=b[d])&&f.on;if(f=b[d])f.on=null,a=a.slice(0,g=a.indexOf(f)).concat(a.slice(g+1)),delete b[d];return e&&a.push(b[d]={on:e}),c},c}function u(a,b){return b-(a?1+Math.floor(Math.log(a+Math.pow(10,1+Math.floor(Math.log(a)/Math.LN10)-b))/Math.LN10):1)}function v(a){return a+""}function w(a){var b=a.lastIndexOf("."),c=b>=0?a.substring(b):(b=a.length,""),d=[];while(b>0)d.push(a.substring(b-=3,b+3));return d.reverse().join(",")+c}function y(a,b){return{scale:Math.pow(10,(8-b)*3),symbol:a}}function D(a){return function(b){return b<=0?0:b>=1?1:a(b)}}function E(a){return function(b){return 1-a(1-b)}}function F(a){return function(b){return.5*(b<.5?a(2*b):2-a(2-2*b))}}function G(a){return a}function H(a){return function(b){return Math.pow(b,a)}}function I(a){return 1-Math.cos(a*Math.PI/2)}function J(a){return Math.pow(2,10*(a-1))}function K(a){return 1-Math.sqrt(1-a*a)}function L(a,b){var c;return arguments.length<2&&(b=.45),arguments.length<1?(a=1,c=b/4):c=b/(2*Math.PI)*Math.asin(1/a),function(d){return 1+a*Math.pow(2,10*-d)*Math.sin((d-c)*2*Math.PI/b)}}function M(a){return a||(a=1.70158),function(b){return b*b*((a+1)*b-a)}}function N(a){return a<1/2.75?7.5625*a*a:a<2/2.75?7.5625*(a-=1.5/2.75)*a+.75:a<2.5/2.75?7.5625*(a-=2.25/2.75)*a+.9375:7.5625*(a-=2.625/2.75)*a+.984375}function O(){d3.event.stopPropagation(),d3.event.preventDefault()}function Q(a){return a=="transform"?d3.interpolateTransform:d3.interpolate}function R(a,b){return b=b-(a=+a)?1/(b-a):0,function(c){return(c-a)*b}}function S(a,b){return b=b-(a=+a)?1/(b-a):0,function(c){return Math.max(0,Math.min(1,(c-a)*b))}}function T(a,b,c){return new U(a,b,c)}function U(a,b,c){this.r=a,this.g=b,this.b=c}function V(a){return a<16?"0"+Math.max(0,a).toString(16):Math.min(255,a).toString(16)}function W(a,b,c){var d=0,e=0,f=0,g,h,i;g=/([a-z]+)\((.*)\)/i.exec(a);if(g){h=g[2].split(",");switch(g[1]){case"hsl":return c(parseFloat(h[0]),parseFloat(h[1])/100,parseFloat(h[2])/100);case"rgb":return b(Y(h[0]),Y(h[1]),Y(h[2]))}}return(i=Z[a])?b(i.r,i.g,i.b):(a!=null&&a.charAt(0)==="#"&&(a.length===4?(d=a.charAt(1),d+=d,e=a.charAt(2),e+=e,f=a.charAt(3),f+=f):a.length===7&&(d=a.substring(1,3),e=a.substring(3,5),f=a.substring(5,7)),d=parseInt(d,16),e=parseInt(e,16),f=parseInt(f,16)),b(d,e,f))}function X(a,b,c){var d=Math.min(a/=255,b/=255,c/=255),e=Math.max(a,b,c),f=e-d,g,h,i=(e+d)/2;return f?(h=i<.5?f/(e+d):f/(2-e-d),a==e?g=(b-c)/f+(b<c?6:0):b==e?g=(c-a)/f+2:g=(a-b)/f+4,g*=60):h=g=0,_(g,h,i)}function Y(a){var b=parseFloat(a);return a.charAt(a.length-1)==="%"?Math.round(b*2.55):b}function _(a,b,c){return new ba(a,b,c)}function ba(a,b,c){this.h=a,this.s=b,this.l=c}function bb(a,b,c){function f(a){return a>360?a-=360:a<0&&(a+=360),a<60?d+(e-d)*a/60:a<180?e:a<240?d+(e-d)*(240-a)/60:d}function g(a){return Math.round(f(a)*255)}var d,e;return a%=360,a<0&&(a+=360),b=b<0?0:b>1?1:b,c=c<0?0:c>1?1:c,e=c<=.5?c*(1+b):c+b-c*b,d=2*c-e,T(g(a+120),g(a),g(a-120))}function bc(a){return h(a,bi),a}function bj(a){return function(){return bd(a,this)}}function bk(a){return function(){return be(a,this)}}function bm(a,b){function f(){if(b=this.classList)return b.add(a);var b=this.className,d=b.baseVal!=null,e=d?b.baseVal:b;c.lastIndex=0,c.test(e)||(e=n(e+" "+a),d?b.baseVal=e:this.className=e)}function g(){if(b=this.classList)return b.remove(a);var b=this.className,d=b.baseVal!=null,e=d?b.baseVal:b;e=n(e.replace(c," ")),d?b.baseVal=e:this.className=e}function h(){(b.apply(this,arguments)?f:g).call(this)}var c=new RegExp("(^|\\s+)"+d3.requote(a)+"(\\s+|$)","g");if(arguments.length<2){var d=this.node();if(e=d.classList)return e.contains(a);var e=d.className;return c.lastIndex=0,c.test(e.baseVal!=null?e.baseVal:e)}return this.each(typeof b=="function"?h:b?f:g)}function bn(a){return{__data__:a}}function bo(a){return function(){return bh(this,a)}}function bp(a){return arguments.length||(a=d3.ascending),function(b,c){return a(b&&b.__data__,c&&c.__data__)}}function br(a){return h(a,bs),a}function bt(a,b,c){h(a,bx);var d={},e=d3.dispatch("start","end"),f=bA;return a.id=b,a.time=c,a.tween=function(b,c){return arguments.length<2?d[b]:(c==null?delete d[b]:d[b]=c,a)},a.ease=function(b){return arguments.length?(f=typeof b=="function"?b:d3.ease.apply(d3,arguments),a):f},a.each=function(b,c){return arguments.length<2?bB.call(a,b):(e.on(b,c),a)},d3.timer(function(g){return a.each(function(h,i,j){function p(a){if(o.active>b)return r();o.active=b;for(var f in d)(f=d[f].call(l,h,i))&&k.push(f);return e.start.call(l,h,i),q(a)||d3.timer(q,0,c),1}function q(a){if(o.active!==b)return r();var c=(a-m)/n,d=f(c),g=k.length;while(g>0)k[--g].call(l,d);if(c>=1)return r(),bz=b,e.end.call(l,h,i),bz=0,1}function r(){return--o.count||delete l.__transition__,1}var k=[],l=this,m=a[j][i].delay,n=a[j][i].duration,o=l.__transition__||(l.__transition__={active:0,count:0});++o.count,m<=g?p(g):d3.timer(p,m,c)}),1},0,c),a}function bv(a,b,c){return c!=""&&bu}function bw(a,b){function d(a,d,e){var f=b.call(this,a,d);return f==null?e!=""&&bu:e!=f&&c(e,f)}function e(a,d,e){return e!=b&&c(e,b)}var c=Q(a);return typeof b=="function"?d:b==null?bv:(b+="",e)}function bB(a){for(var b=0,c=this.length;b<c;b++)for(var d=this[b],e=0,f=d.length;e<f;e++){var g=d[e];g&&a.call(g=g.node,g.__data__,e,b)}return this}function bF(){var a,b=Date.now(),c=bC;while(c)a=b-c.then,a>=c.delay&&(c.flush=c.callback(a)),c=c.next;var d=bG()-b;d>24?(isFinite(d)&&(clearTimeout(bE),bE=setTimeout(bF,d)),bD=0):(bD=1,bH(bF))}function bG(){var a=null,b=bC,c=Infinity;while(b)b.flush?b=a?a.next=b.next:bC=b.next:(c=Math.min(c,b.then+b.delay),b=(a=b).next);return c}function bI(a){var b=[a.a,a.b],c=[a.c,a.d],d=bK(b),e=bJ(b,c),f=bK(bL(c,b,-e))||0;b[0]*c[1]<c[0]*b[1]&&(b[0]*=-1,b[1]*=-1,d*=-1,e*=-1),this.rotate=(d?Math.atan2(b[1],b[0]):Math.atan2(-c[0],c[1]))*bO,this.translate=[a.e,a.f],this.scale=[d,f],this.skew=f?Math.atan2(e,f)*bO:0}function bJ(a,b){return a[0]*b[0]+a[1]*b[1]}function bK(a){var b=Math.sqrt(bJ(a,a));return b&&(a[0]/=b,a[1]/=b),b}function bL(a,b,c){return a[0]+=c*b[0],a[1]+=c*b[1],a}function bP(){}function bQ(a){var b=a[0],c=a[a.length-1];return b<c?[b,c]:[c,b]}function bR(a){return a.rangeExtent?a.rangeExtent():bQ(a.range())}function bS(a,b){var c=0,d=a.length-1,e=a[c],f=a[d],g;f<e&&(g=c,c=d,d=g,g=e,e=f,f=g);if(g=f-e)b=b(g),a[c]=b.floor(e),a[d]=b.ceil(f);return a}function bT(){return Math}function bU(a,b,c,d){function g(){var g=a.length==2?b$:b_,i=d?S:R;return e=g(a,b,i,c),f=g(b,a,i,d3.interpolate),h}function h(a){return e(a)}var e,f;return h.invert=function(a){return f(a)},h.domain=function(b){return arguments.length?(a=b.map(Number),g()):a},h.range=function(a){return arguments.length?(b=a,g()):b},h.rangeRound=function(a){return h.range(a).interpolate(d3.interpolateRound)},h.clamp=function(a){return arguments.length?(d=a,g()):d},h.interpolate=function(a){return arguments.length?(c=a,g()):c},h.ticks=function(b){return bY(a,b)},h.tickFormat=function(b){return bZ(a,b)},h.nice=function(){return bS(a,bW),g()},h.copy=function(){return bU(a,b,c,d)},g()}function bV(a,b){return d3.rebind(a,b,"range","rangeRound","interpolate","clamp")}function bW(a){return a=Math.pow(10,Math.round(Math.log(a)/Math.LN10)-1),{floor:function(b){return Math.floor(b/a)*a},ceil:function(b){return Math.ceil(b/a)*a}}}function bX(a,b){var c=bQ(a),d=c[1]-c[0],e=Math.pow(10,Math.floor(Math.log(d/b)/Math.LN10)),f=b/d*e;return f<=.15?e*=10:f<=.35?e*=5:f<=.75&&(e*=2),c[0]=Math.ceil(c[0]/e)*e,c[1]=Math.floor(c[1]/e)*e+e*.5,c[2]=e,c}function bY(a,b){return d3.range.apply(d3,bX(a,b))}function bZ(a,b){return d3.format(",."+Math.max(0,-Math.floor(Math.log(bX(a,b)[2])/Math.LN10+.01))+"f")}function b$(a,b,c,d){var e=c(a[0],a[1]),f=d(b[0],b[1]);return function(a){return f(e(a))}}function b_(a,b,c,d){var e=[],f=[],g=0,h=a.length;while(++g<h)e.push(c(a[g-1],a[g])),f.push(d(b[g-1],b[g]));return function(b){var c=d3.bisect(a,b,1,a.length-1)-1;return f[c](e[c](b))}}function ca(a,b){function d(c){return a(b(c))}var c=b.pow;return d.invert=function(b){return c(a.invert(b))},d.domain=function(e){return arguments.length?(b=e[0]<0?cd:cc,c=b.pow,a.domain(e.map(b)),d):a.domain().map(c)},d.nice=function(){return a.domain(bS(a.domain(),bT)),d},d.ticks=function(){var d=bQ(a.domain()),e=[];if(d.every(isFinite)){var f=Math.floor(d[0]),g=Math.ceil(d[1]),h=c(d[0]),i=c(d[1]);if(b===cd){e.push(c(f));for(;f++<g;)for(var j=9;j>0;j--)e.push(c(f)*j)}else{for(;f<g;f++)for(var j=1;j<10;j++)e.push(c(f)*j);e.push(c(f))}for(f=0;e[f]<h;f++);for(g=e.length;e[g-1]>i;g--);e=e.slice(f,g)}return e},d.tickFormat=function(a,e){arguments.length<2&&(e=cb);if(arguments.length<1)return e;var f=a/d.ticks().length,g=b===cd?(h=-1e-12,Math.floor):(h=1e-12,Math.ceil),h;return function(a){return a/c(g(b(a)+h))<f?e(a):""}},d.copy=function(){return ca(a.copy(),b)},bV(d,a)}function cc(a){return Math.log(a)/Math.LN10}function cd(a){return-Math.log(-a)/Math.LN10}function ce(a,b){function e(b){return a(c(b))}var c=cf(b),d=cf(1/b);return e.invert=function(b){return d(a.invert(b))},e.domain=function(b){return arguments.length?(a.domain(b.map(c)),e):a.domain().map(d)},e.ticks=function(a){return bY(e.domain(),a)},e.tickFormat=function(a){return bZ(e.domain(),a)},e.nice=function(){return e.domain(bS(e.domain(),bW))},e.exponent=function(a){if(!arguments.length)return b;var f=e.domain();return c=cf(b=a),d=cf(1/b),e.domain(f)},e.copy=function(){return ce(a.copy(),b)},bV(e,a)}function cf(a){return function(b){return b<0?-Math.pow(-b,a):Math.pow(b,a)}}function cg(a,b){function f(b){return d[((c[b]||(c[b]=a.push(b)))-1)%d.length]}function g(b,c){return d3.range(a.length).map(function(a){return b+c*a})}var c,d,e;return f.domain=function(d){if(!arguments.length)return a;a=[],c={};var e=-1,g=d.length,h;while(++e<g)c[h=d[e]]||(c[h]=a.push(h));return f[b.t](b.x,b.p)},f.range=function(a){return arguments.length?(d=a,e=0,b={t:"range",x:a},f):d},f.rangePoints=function(c,h){arguments.length<2&&(h=0);var i=c[0],j=c[1],k=(j-i)/(a.length-1+h);return d=g(a.length<2?(i+j)/2:i+k*h/2,k),e=0,b={t:"rangePoints",x:c,p:h},f},f.rangeBands=function(c,h){arguments.length<2&&(h=0);var i=c[0],j=c[1],k=(j-i)/(a.length+h);return d=g(i+k*h,k),e=k*(1-h),b={t:"rangeBands",x:c,p:h},f},f.rangeRoundBands=function(c,h){arguments.length<2&&(h=0);var i=c[0],j=c[1],k=Math.floor((j-i)/(a.length+h));return d=g(i+Math.round((j-i-(a.length-h)*k)/2),k),e=Math.round(k*(1-h)),b={t:"rangeRoundBands",x:c,p:h},f},f.rangeBand=function(){return e},f.rangeExtent=function(){return b.x},f.copy=function(){return cg(a,b)},f.domain(a)}function cl(a,b){function d(){var d=0,f=a.length,g=b.length;c=[];while(++d<g)c[d-1]=d3.quantile(a,d/g);return e}function e(a){return isNaN(a=+a)?NaN:b[d3.bisect(c,a)]}var c;return e.domain=function(b){return arguments.length?(a=b.filter(function(a){return!isNaN(a)}).sort(d3.ascending),d()):a},e.range=function(a){return arguments.length?(b=a,d()):b},e.quantiles=function(){return c},e.copy=function(){return cl(a,b)},d()}function cm(a,b,c){function f(b){return c[Math.max(0,Math.min(e,Math.floor(d*(b-a))))]}function g(){return d=c.length/(b-a),e=c.length-1,f}var d,e;return f.domain=function(c){return arguments.length?(a=+c[0],b=+c[c.length-1],g()):[a,b]},f.range=function(a){return arguments.length?(c=a,g()):c},f.copy=function(){return cm(a,b,c)},g()}function cp(a){return a.innerRadius}function cq(a){return a.outerRadius}function cr(a){return a.startAngle}function cs(a){return a.endAngle}function ct(a){function g(d){return d.length<1?null:"M"+e(a(cu(this,d,b,c)),f)}var b=cv,c=cw,d="linear",e=cx[d],f=.7;return g.x=function(a){return arguments.length?(b=a,g):b},g.y=function(a){return arguments.length?(c=a,g):c},g.interpolate=function(a){return arguments.length?(e=cx[d=a],g):d},g.tension=function(a){return arguments.length?(f=a,g):f},g}function cu(a,b,c,d){var e=[],f=-1,g=b.length,h=typeof c=="function",i=typeof d=="function",j;if(h&&i)while(++f<g)e.push([c.call(a,j=b[f],f),d.call(a,j,f)]);else if(h)while(++f<g)e.push([c.call(a,b[f],f),d]);else if(i)while(++f<g)e.push([c,d.call(a,b[f],f)]);else while(++f<g)e.push([c,d]);return e}function cv(a){return a[0]}function cw(a){return a[1]}function cy(a){var b=0,c=a.length,d=a[0],e=[d[0],",",d[1]];while(++b<c)e.push("L",(d=a[b])[0],",",d[1]);return e.join("")}function cz(a){var b=0,c=a.length,d=a[0],e=[d[0],",",d[1]];while(++b<c)e.push("V",(d=a[b])[1],"H",d[0]);return e.join("")}function cA(a){var b=0,c=a.length,d=a[0],e=[d[0],",",d[1]];while(++b<c)e.push("H",(d=a[b])[0],"V",d[1]);return e.join("")}function cB(a,b){return a.length<4?cy(a):a[1]+cE(a.slice(1,a.length-1),cF(a,b))}function cC(a,b){return a.length<3?cy(a):a[0]+cE((a.push(a[0]),a),cF([a[a.length-2]].concat(a,[a[1]]),b))}function cD(a,b,c){return a.length<3?cy(a):a[0]+cE(a,cF(a,b))}function cE(a,b){if(b.length<1||a.length!=b.length&&a.length!=b.length+2)return cy(a);var c=a.length!=b.length,d="",e=a[0],f=a[1],g=b[0],h=g,i=1;c&&(d+="Q"+(f[0]-g[0]*2/3)+","+(f[1]-g[1]*2/3)+","+f[0]+","+f[1],e=a[1],i=2);if(b.length>1){h=b[1],f=a[i],i++,d+="C"+(e[0]+g[0])+","+(e[1]+g[1])+","+(f[0]-h[0])+","+(f[1]-h[1])+","+f[0]+","+f[1];for(var j=2;j<b.length;j++,i++)f=a[i],h=b[j],d+="S"+(f[0]-h[0])+","+(f[1]-h[1])+","+f[0]+","+f[1]}if(c){var k=a[i];d+="Q"+(f[0]+h[0]*2/3)+","+(f[1]+h[1]*2/3)+","+k[0]+","+k[1]}return d}function cF(a,b){var c=[],d=(1-b)/2,e,f=a[0],g=a[1],h=1,i=a.length;while(++h<i)e=f,f=g,g=a[h],c.push([d*(g[0]-e[0]),d*(g[1]-e[1])]);return c}function cG(a){if(a.length<3)return cy(a);var b=1,c=a.length,d=a[0],e=d[0],f=d[1],g=[e,e,e,(d=a[1])[0]],h=[f,f,f,d[1]],i=[e,",",f];cO(i,g,h);while(++b<c)d=a[b],g.shift(),g.push(d[0]),h.shift(),h.push(d[1]),cO(i,g,h);b=-1;while(++b<2)g.shift(),g.push(d[0]),h.shift(),h.push(d[1]),cO(i,g,h);return i.join("")}function cH(a){if(a.length<4)return cy(a);var b=[],c=-1,d=a.length,e,f=[0],g=[0];while(++c<3)e=a[c],f.push(e[0]),g.push(e[1]);b.push(cK(cN,f)+","+cK(cN,g)),--c;while(++c<d)e=a[c],f.shift(),f.push(e[0]),g.shift(),g.push(e[1]),cO(b,f,g);return b.join("")}function cI(a){var b,c=-1,d=a.length,e=d+4,f,g=[],h=[];while(++c<4)f=a[c%d],g.push(f[0]),h.push(f[1]);b=[cK(cN,g),",",cK(cN,h)],--c;while(++c<e)f=a[c%d],g.shift(),g.push(f[0]),h.shift(),h.push(f[1]),cO(b,g,h);return b.join("")}function cJ(a,b){var c=a.length-1,d=a[0][0],e=a[0][1],f=a[c][0]-d,g=a[c][1]-e,h=-1,i,j;while(++h<=c)i=a[h],j=h/c,i[0]=b*i[0]+(1-b)*(d+j*f),i[1]=b*i[1]+(1-b)*(e+j*g);return cG(a)}function cK(a,b){return a[0]*b[0]+a[1]*b[1]+a[2]*b[2]+a[3]*b[3]}function cO(a,b,c){a.push("C",cK(cL,b),",",cK(cL,c),",",cK(cM,b),",",cK(cM,c),",",cK(cN,b),",",cK(cN,c))}function cP(a,b){return(b[1]-a[1])/(b[0]-a[0])}function cQ(a){var b=0,c=a.length-1,d=[],e=a[0],f=a[1],g=d[0]=cP(e,f);while(++b<c)d[b]=g+(g=cP(e=f,f=a[b+1]));return d[b]=g,d}function cR(a){var b=[],c,d,e,f,g=cQ(a),h=-1,i=a.length-1;while(++h<i)c=cP(a[h],a[h+1]),Math.abs(c)<1e-6?g[h]=g[h+1]=0:(d=g[h]/c,e=g[h+1]/c,f=d*d+e*e,f>9&&(f=c*3/Math.sqrt(f),g[h]=f*d,g[h+1]=f*e));h=-1;while(++h<=i)f=(a[Math.min(i,h+1)][0]-a[Math.max(0,h-1)][0])/(6*(1+g[h]*g[h])),b.push([f||0,g[h]*f||0]);return b}function cS(a){return a.length<3?cy(a):a[0]+cE(a,cR(a))}function cT(a){var b,c=-1,d=a.length,e,f;while(++c<d)b=a[c],e=b[0],f=b[1]+cn,b[0]=e*Math.cos(f),b[1]=e*Math.sin(f);return a}function cU(a){function j(f){if(f.length<1)return null;var j=cu(this,f,b,d),k=cu(this,f,b===c?cV(j):c,d===e?cW(j):e);return"M"+g(a(k),i)+"L"+h(a(j.reverse()),i)+"Z"}var b=cv,c=cv,d=0,e=cw,f,g,h,i=.7;return j.x=function(a){return arguments.length?(b=c=a,j):c},j.x0=function(a){return arguments.length?(b=a,j):b},j.x1=function(a){return arguments.length?(c=a,j):c},j.y=function(a){return arguments.length?(d=e=a,j):e},j.y0=function(a){return arguments.length?(d=a,j):d},j.y1=function(a){return arguments.length?(e=a,j):e},j.interpolate=function(a){return arguments.length?(g=cx[f=a],h=g.reverse||g,j):f},j.tension=function(a){return arguments.length?(i=a,j):i},j.interpolate("linear")}function cV(a){return function(b,c){return a[c][0]}}function cW(a){return function(b,c){return a[c][1]}}function cX(a){return a.source}function cY(a){return a.target}function cZ(a){return a.radius}function c$(a){return a.startAngle}function c_(a){return a.endAngle}function da(a){return[a.x,a.y]}function db(a){return function(){var b=a.apply(this,arguments),c=b[0],d=b[1]+cn;return[c*Math.cos(d),c*Math.sin(d)]}}function dd(a,b){var c=(a.ownerSVGElement||a).createSVGPoint();if(dc<0&&(window.scrollX||window.scrollY)){var d=d3.select(document.body).append("svg").style("position","absolute").style("top",0).style("left",0),e=d[0][0].getScreenCTM();dc=!e.f&&!e.e,d.remove()}return dc?(c.x=b.pageX,c.y=b.pageY):(c.x=b.clientX,c.y=b.clientY),c=c.matrixTransform(a.getScreenCTM().inverse()),[c.x,c.y]}function de(){return 64}function df(){return"circle"}function dj(a,b){a.attr("transform",function(a){return"translate("+b(a)+",0)"})}function dk(a,b){a.attr("transform",function(a){return"translate(0,"+b(a)+")"})}function dl(a,b,c){e=[];if(c&&b.length>1){var d=bQ(a.domain()),e,f=-1,g=b.length,h=(b[1]-b[0])/++c,i,j;while(++f<g)for(i=c;--i>0;)(j=+b[f]-i*h)>=d[0]&&e.push(j);for(--f,i=0;++i<c&&(j=+b[f]+i*h)<d[1];)e.push(j)}return e}function dx(a,b){a.select(".extent").attr("x",b[0][0]),a.selectAll(".n,.s,.w,.nw,.sw").attr("x",b[0][0]-2),a.selectAll(".e,.ne,.se").attr("x",b[1][0]-3),a.selectAll(".extent,.n,.s").attr("width",b[1][0]-b[0][0])}function dy(a,b){a.select(".extent").attr("y",b[0][1]),a.selectAll(".n,.e,.w,.nw,.ne").attr("y",b[0][1]-3),a.selectAll(".s,.se,.sw").attr("y",b[1][1]-4),a.selectAll(".extent,.e,.w").attr("height",b[1][1]-b[0][1])}function dz(){d3.event.keyCode==32&&dp&&!dt&&(dv=null,dw[0]-=ds[1][0],dw[1]-=ds[1][1],dt=2,O())}function dA(){d3.event.keyCode==32&&dt==2&&(dw[0]+=ds[1][0],dw[1]+=ds[1][1],dt=0,O())}function dB(){if(dw){var a=d3.svg.mouse(dp),b=d3.select(dp);dt||(d3.event.altKey?(dv||(dv=[(ds[0][0]+ds[1][0])/2,(ds[0][1]+ds[1][1])/2]),dw[0]=ds[+(a[0]<dv[0])][0],dw[1]=ds[+(a[1]<dv[1])][1]):dv=null),dq&&(dC(a,dq,0),dx(b,ds)),dr&&(dC(a,dr,1),dy(b,ds)),dn("brush")}}function dC(a,b,c){var d=bR(b),e=d[0],f=d[1],g=dw[c],h=ds[1][c]-ds[0][c],i,j;dt&&(e-=g,f-=h+g),i=Math.max(e,Math.min(f,a[c])),dt?j=(i+=g)+h:(dv&&(g=Math.max(e,Math.min(f,2*dv[c]-i))),g<i?(j=i,i=g):j=g),ds[0][c]=i,ds[1][c]=j}function dD(){dw&&(dB(),d3.select(dp).selectAll(".resize").style("pointer-events",dm.empty()?"none":"all"),dn("brushend"),dm=dn=dp=dq=dr=ds=dt=du=dv=dw=null,O())}function dM(a){var b=dN(),c=d3.event,d=d3.event={type:a};b&&(d.x=b[0]+dJ[0],d.y=b[1]+dJ[1],d.dx=b[0]-dK[0],d.dy=b[1]-dK[1],dL|=d.dx|d.dy,dK=b);try{dF[a].apply(dH,dI)}finally{d3.event=c}c.stopPropagation(),c.preventDefault()}function dN(){var a=dH.parentNode,b=d3.event.changedTouches;return a&&(b?d3.svg.touches(a,b)[0]:d3.svg.mouse(a))}function dO(){if(!dH)return;var a=dH.parentNode;if(!a)return dP();dM("drag"),O()}function dP(){if(!dH)return;dM("dragend"),dL&&(O(),dL=d3.event.target===dG),dF=dG=dH=dI=dJ=dK=null}function dQ(){dL&&(O(),dL=0)}function eb(a){return[a[0]-dW[0],a[1]-dW[1],dW[2]]}function ec(){dR||(dR=d3.select("body").append("div").style("visibility","hidden").style("top",0).style("height",0).style("width",0).style("overflow-y","scroll").append("div").style("height","2000px").node().parentNode);var a=d3.event,b;try{dR.scrollTop=1e3,dR.dispatchEvent(a),b=1e3-dR.scrollTop}catch(c){b=a.wheelDelta||-a.detail*5}return b*.005}function ed(){var a=d3.svg.touches(d$),b=-1,c=a.length,d;while(++b<c)dU[(d=a[b]).identifier]=eb(d);return a}function ee(){var a=d3.svg.touches(d$);switch(a.length){case 1:var b=a[0];ei(dW[2],b,dU[b.identifier]);break;case 2:var c=a[0],d=a[1],e=[(c[0]+d[0])/2,(c[1]+d[1])/2],f=dU[c.identifier],g=dU[d.identifier],h=[(f[0]+g[0])/2,(f[1]+g[1])/2,f[2]];ei(Math.log(d3.event.scale)/Math.LN2+f[2],e,h)}}function ef(){dT=null,dS&&(ea=1,ei(dW[2],d3.svg.mouse(d$),dS))}function eg(){dS&&(ea&&(O(),ea=dZ===d3.event.target),dW=dX=dY=dZ=d$=d_=dS=null)}function eh(){ea&&(O(),ea=0)}function ei(a,b,c){function l(a,b,c){a.domain(a.range().map(function(f){return a.invert((f-c)*d/e+b)}))}a=ek(a,2);var d=Math.pow(2,dW[2]),e=Math.pow(2,a),f=Math.pow(2,(dW[2]=a)-c[2]),g=dW[0],h=dW[1],i=dW[0]=ek(b[0]-c[0]*f,0,e),j=dW[1]=ek(b[1]-c[1]*f,1,e),k=d3.event;d3.event={scale:e,translate:[i,j],transform:function(a,b){a&&l(a,g,i),b&&l(b,h,j)}};try{dY.apply(d$,d_)}finally{d3.event=k}k.preventDefault()}function ek(a,b,c){var d=dX[b],e=d[0],f=d[1];return arguments.length===3?Math.max(f*(f===Infinity?-Infinity:1/c-1),Math.min(e===-Infinity?Infinity:e,a/c))*c:Math.max(e,Math.min(f,a))}Date.now||(Date.now=function(){return+(new Date)});try{document.createElement("div").style.setProperty("opacity",0,"")}catch(a){var b=CSSStyleDeclaration.prototype,c=b.setProperty;b.setProperty=function(a,b,d){c.call(this,a,b+"",d)}}d3={version:"2.7.0"};var d=f;try{d(document.documentElement.childNodes)[0].nodeType}catch(g){d=e}var h=[].__proto__?function(a,b){a.__proto__=b}:function(a,b){for(var c in b)a[c]=b[c]};d3.functor=function(a){return typeof a=="function"?a:function(){return a}},d3.rebind=function(a,b){var c=1,d=arguments.length,e;while(++c<d)a[e=arguments[c]]=j(a,b,b[e]);return a},d3.ascending=function(a,b){return a<b?-1:a>b?1:a>=b?0:NaN},d3.descending=function(a,b){return b<a?-1:b>a?1:b>=a?0:NaN},d3.mean=function(a,b){var c=a.length,d,e=0,f=-1,g=0;if(arguments.length===1)while(++f<c)k(d=a[f])&&(e+=(d-e)/++g);else while(++f<c)k(d=b.call(a,a[f],f))&&(e+=(d-e)/++g);return g?e:undefined},d3.median=function(a,b){return arguments.length>1&&(a=a.map(b)),a=a.filter(k),a.length?d3.quantile(a.sort(d3.ascending),.5):undefined},d3.min=function(a,b){var c=-1,d=a.length,e,f;if(arguments.length===1){while(++c<d&&((e=a[c])==null||e!=e))e=undefined;while(++c<d)(f=a[c])!=null&&e>f&&(e=f)}else{while(++c<d&&((e=b.call(a,a[c],c))==null||e!=e))e=undefined;while(++c<d)(f=b.call(a,a[c],c))!=null&&e>f&&(e=f)}return e},d3.max=function(a,b){var c=-1,d=a.length,e,f;if(arguments.length===1){while(++c<d&&((e=a[c])==null||e!=e))e=undefined;while(++c<d)(f=a[c])!=null&&f>e&&(e=f)}else{while(++c<d&&((e=b.call(a,a[c],c))==null||e!=e))e=undefined;while(++c<d)(f=b.call(a,a[c],c))!=null&&f>e&&(e=f)}return e},d3.extent=function(a,b){var c=-1,d=a.length,e,f,g;if(arguments.length===1){while(++c<d&&((e=g=a[c])==null||e!=e))e=g=undefined;while(++c<d)(f=a[c])!=null&&(e>f&&(e=f),g<f&&(g=f))}else{while(++c<d&&((e=g=b.call(a,a[c],c))==null||e!=e))e=undefined;while(++c<d)(f=b.call(a,a[c],c))!=null&&(e>f&&(e=f),g<f&&(g=f))}return[e,g]},d3.random={normal:function(a,b){return arguments.length<2&&(b=1),arguments.length<1&&(a=0),function(){var c,d,e;do c=Math.random()*2-1,d=Math.random()*2-1,e=c*c+d*d;while(!e||e>1);return a+b*c*Math.sqrt(-2*Math.log(e)/e)}}},d3.sum=function(a,b){var c=0,d=a.length,e,f=-1;if(arguments.length===1)while(++f<d)isNaN(e=+a[f])||(c+=e);else while(++f<d)isNaN(e=+b.call(a,a[f],f))||(c+=e);return c},d3.quantile=function(a,b){var c=(a.length-1)*b+1,d=Math.floor(c),e=a[d-1],f=c-d;return f?e+f*(a[d]-e):e},d3.transpose=function(a){return d3.zip.apply(d3,a)},d3.zip=function(){if(!(e=arguments.length))return[];for(var a=-1,b=d3.min(arguments,l),c=new Array(b);++a<b;)for(var d=-1,e,f=c[a]=new Array(e);++d<e;)f[d]=arguments[d][a];return c},d3.bisectLeft=function(a,b,c,d){arguments.length<3&&(c=0),arguments.length<4&&(d=a.length);while(c<d){var e=c+d>>1;a[e]<b?c=e+1:d=e}return c},d3.bisect=d3.bisectRight=function(a,b,c,d){arguments.length<3&&(c=0),arguments.length<4&&(d=a.length);while(c<d){var e=c+d>>1;b<a[e]?d=e:c=e+1}return c},d3.first=function(a,b){var c=0,d=a.length,e=a[0],f;arguments.length===1&&(b=d3.ascending);while(++c<d)b.call(a,e,f=a[c])>0&&(e=f);return e},d3.last=function(a,b){var c=0,d=a.length,e=a[0],f;arguments.length===1&&(b=d3.ascending);while(++c<d)b.call(a,e,f=a[c])<=0&&(e=f);return e},d3.nest=function(){function f(c,g){if(g>=b.length)return e?e.call(a,c):d?c.sort(d):c;var h=-1,i=c.length,j=b[g++],k,l,m={};while(++h<i)(k=j(l=c[h]))in m?m[k].push(l):m[k]=[l];for(k in m)m[k]=f(m[k],g);return m}function g(a,d){if(d>=b.length)return a;var e=[],f=c[d++],h;for(h in a)e.push({key:h,values:g(a[h],d)});return f&&e.sort(function(a,b){return f(a.key,b.key)}),e}var a={},b=[],c=[],d,e;return a.map=function(a){return f(a,0)},a.entries=function(a){return g(f(a,0),0)},a.key=function(c){return b.push(c),a},a.sortKeys=function(d){return c[b.length-1]=d,a},a.sortValues=function(b){return d=b,a},a.rollup=function(b){return e=b,a},a},d3.keys=function(a){var b=[];for(var c in a)b.push(c);return b},d3.values=function(a){var b=[];for(var c in a)b.push(a[c]);return b},d3.entries=function(a){var b=[];for(var c in a)b.push({key:c,value:a[c]});return b},d3.permute=function(a,b){var c=[],d=-1,e=b.length;while(++d<e)c[d]=a[b[d]];return c},d3.merge=function(a){return Array.prototype.concat.apply([],a)},d3.split=function(a,b){var c=[],d=[],e,f=-1,g=a.length;arguments.length<2&&(b=m);while(++f<g)b.call(d,e=a[f],f)?d=[]:(d.length||c.push(d),d.push(e));return c},d3.range=function(a,b,c){arguments.length<3&&(c=1,arguments.length<2&&(b=a,a=0));if((b-a)/c==Infinity)throw new Error("infinite range");var d=[],e=-1,f;if(c<0)while((f=a+c*++e)>b)d.push(f);else while((f=a+c*++e)<b)d.push(f);return d},d3.requote=function(a){return a.replace(o,"\\$&")};var o=/[\\\^\$\*\+\?\|\[\]\(\)\.\{\}]/g;d3.round=function(a,b){return b?Math.round(a*Math.pow(10,b))*Math.pow(10,-b):Math.round(a)},d3.xhr=function(a,b,c){var d=new XMLHttpRequest;arguments.length<3?c=b:b&&d.overrideMimeType&&d.overrideMimeType(b),d.open("GET",a,!0),d.onreadystatechange=function(){d.readyState===4&&c(d.status<300?d:null)},d.send(null)},d3.text=function(a,b,c){function d(a){c(a&&a.responseText)}arguments.length<3&&(c=b,b=null),d3.xhr(a,b,d)},d3.json=function(a,b){d3.text(a,"application/json",function(a){b(a?JSON.parse(a):null)})},d3.html=function(a,b){d3.text(a,"text/html",function(a){if(a!=null){var c=document.createRange();c.selectNode(document.body),a=c.createContextualFragment(a)}b(a)})},d3.xml=function(a,b,c){function d(a){c(a&&a.responseXML)}arguments.length<3&&(c=b,b=null),d3.xhr(a,b,d)};var p={svg:"http://www.w3.org/2000/svg",xhtml:"http://www.w3.org/1999/xhtml",xlink:"http://www.w3.org/1999/xlink",xml:"http://www.w3.org/XML/1998/namespace",xmlns:"http://www.w3.org/2000/xmlns/"};d3.ns={prefix:p,qualify:function(a){var b=a.indexOf(":");return b<0?a in p?{space:p[a],local:a}:a:{space:p[a.substring(0,b)],local:a.substring(b+1)}}},d3.dispatch=function(){var a=new q,b=-1,c=arguments.length;while(++b<c)a[arguments[b]]=r();return a},q.prototype.on=function(a,b){var c=a.indexOf("."),d="";return c>0&&(d=a.substring(c+1),a=a.substring(0,c)),arguments.length<2?this[a].on(d):(this[a].on(d,b),this)},d3.format=function(a){var b=s.exec(a),c=b[1]||" ",d=b[3]||"",e=b[5],f=+b[6],g=b[7],h=b[8],i=b[9],j=1,k="",l=!1;h&&(h=+h.substring(1)),e&&(c="0",g&&(f-=Math.floor((f-1)/4)));switch(i){case"n":g=!0,i="g";break;case"%":j=100,k="%",i="f";break;case"p":j=100,k="%",i="r";break;case"d":l=!0,h=0;break;case"s":j=-1,i="r"}return i=="r"&&!h&&(i="g"),i=t[i]||v,function(a){if(l&&a%1)return"";var b=a<0&&(a=-a)?"−":d;if(j<0){var m=d3.formatPrefix(a,h);a*=m.scale,k=m.symbol}else a*=j;a=i(a,h);if(e){var n=a.length+b.length;n<f&&(a=(new Array(f-n+1)).join(c)+a),g&&(a=w(a)),a=b+a}else{g&&(a=w(a)),a=b+a;var n=a.length;n<f&&(a=(new Array(f-n+1)).join(c)+a)}return a+k}};var s=/(?:([^{])?([<>=^]))?([+\- ])?(#)?(0)?([0-9]+)?(,)?(\.[0-9]+)?([a-zA-Z%])?/,t={g:function(a,b){return a.toPrecision(b)},e:function(a,b){return a.toExponential(b)},f:function(a,b){return a.toFixed(b)},r:function(a,b){return d3.round(a,b=u(a,b)).toFixed(Math.max(0,Math.min(20,b)))}},x=["y","z","a","f","p","n","μ","m","","k","M","G","T","P","E","Z","Y"].map(y);d3.formatPrefix=function(a,b){var c=0;return a&&(a<0&&(a*=-1),b&&(a=d3.round(a,u(a,b))),c=1+Math.floor(1e-12+Math.log(a)/Math.LN10),c=Math.max(-24,Math.min(24,Math.floor((c<=0?c+1:c-1)/3)*3))),x[8+c/3]};var z=H(2),A=H(3),B={linear:function(){return G},poly:H,quad:function(){return z},cubic:function(){return A},sin:function(){return I},exp:function(){return J},circle:function(){return K},elastic:L,back:M,bounce:function(){return N}},C={"in":function(a){return a},out:E,"in-out":F,"out-in":function(a){return F(E(a))}};d3.ease=function(a){var b=a.indexOf("-"),c=b>=0?a.substring(0,b):a,d=b>=0?a.substring(b+1):"in";return D(C[d](B[c].apply(null,Array.prototype.slice.call(arguments,1))))},d3.event=null,d3.interpolate=function(a,b){var c=d3.interpolators.length,d;while(--c>=0&&!(d=d3.interpolators[c](a,b)));return d},d3.interpolateNumber=function(a,b){return b-=a,function(c){return a+b*c}},d3.interpolateRound=function(a,b){return b-=a,function(c){return Math.round(a+b*c)}},d3.interpolateString=function(a,b){var c,d,e,f=0,g=0,h=[],i=[],j,k;P.lastIndex=0;for(d=0;c=P.exec(b);++d)c.index&&h.push(b.substring(f,g=c.index)),i.push({i:h.length,x:c[0]}),h.push(null),f=P.lastIndex;f<b.length&&h.push(b.substring(f));for(d=0,j=i.length;(c=P.exec(a))&&d<j;++d){k=i[d];if(k.x==c[0]){if(k.i)if(h[k.i+1]==null){h[k.i-1]+=k.x,h.splice(k.i,1);for(e=d+1;e<j;++e)i[e].i--}else{h[k.i-1]+=k.x+h[k.i+1],h.splice(k.i,2);for(e=d+1;e<j;++e)i[e].i-=2}else if(h[k.i+1]==null)h[k.i]=k.x;else{h[k.i]=k.x+h[k.i+1],h.splice(k.i+1,1);for(e=d+1;e<j;++e)i[e].i--}i.splice(d,1),j--,d--}else k.x=d3.interpolateNumber(parseFloat(c[0]),parseFloat(k.x))}while(d<j)k=i.pop(),h[k.i+1]==null?h[k.i]=k.x:(h[k.i]=k.x+h[k.i+1],h.splice(k.i+1,1)),j--;return h.length===1?h[0]==null?i[0].x:function(){return b}:function(a){for(d=0;d<j;++d)h[(k=i[d]).i]=k.x(a);return h.join("")}},d3.interpolateTransform=function(a,b){return d3.interpolateString(d3.transform(a)+"",d3.transform(b)+"")},d3.interpolateRgb=function(a,b){a=d3.rgb(a),b=d3.rgb(b);var c=a.r,d=a.g,e=a.b,f=b.r-c,g=b.g-d,h=b.b-e;return function(a){return"#"+V(Math.round(c+f*a))+V(Math.round(d+g*a))+V(Math.round(e+h*a))}},d3.interpolateHsl=function(a,b){a=d3.hsl(a),b=d3.hsl(b);var c=a.h,d=a.s,e=a.l,f=b.h-c,g=b.s-d,h=b.l-e;return function(a){return bb(c+f*a,d+g*a,e+h*a).toString()}},d3.interpolateArray=function(a,b){var c=[],d=[],e=a.length,f=b.length,g=Math.min(a.length,b.length),h;for(h=0;h<g;++h)c.push(d3.interpolate(a[h],b[h]));for(;h<e;++h)d[h]=a[h];for(;h<f;++h)d[h]=b[h];return function(a){for(h=0;h<g;++h)d[h]=c[h](a);return d}},d3.interpolateObject=function(a,b){var c={},d={},e;for(e in a)e in b?c[e]=Q(e)(a[e],b[e]):d[e]=a[e];for(e in b)e in a||(d[e]=b[e]);return function(a){for(e in c)d[e]=c[e](a);return d}};var P=/[-+]?(?:\d*\.?\d+)(?:[eE][-+]?\d+)?/g;d3.interpolators=[d3.interpolateObject,function(a,b){return b instanceof Array&&d3.interpolateArray(a,b)},function(a,b){return(typeof a=="string"||typeof b=="string")&&d3.interpolateString(a+"",b+"")},function(a,b){return(typeof b=="string"?b in Z||/^(#|rgb\(|hsl\()/.test(b):b instanceof U||b instanceof ba)&&d3.interpolateRgb(a,b)},function(a,b){return!isNaN(a=+a)&&!isNaN(b=+b)&&d3.interpolateNumber(a,b)}],d3.rgb=function(a,b,c){return arguments.length===1?a instanceof U?T(a.r,a.g,a.b):W(""+a,T,bb):T(~~a,~~b,~~c)},U.prototype.brighter=function(a){a=Math.pow(.7,arguments.length?a:1);var b=this.r,c=this.g,d=this.b,e=30;return!b&&!c&&!d?T(e,e,e):(b&&b<e&&(b=e),c&&c<e&&(c=e),d&&d<e&&(d=e),T(Math.min(255,Math.floor(b/a)),Math.min(255,Math.floor(c/a)),Math.min(255,Math.floor(d/a))))},U.prototype.darker=function(a){return a=Math.pow(.7,arguments.length?a:1),T(Math.floor(a*this.r),Math.floor(a*this.g),Math.floor(a*this.b))},U.prototype.hsl=function(){return X(this.r,this.g,this.b)},U.prototype.toString=function(){return"#"+V(this.r)+V(this.g)+V(this.b)};var Z={aliceblue:"#f0f8ff",antiquewhite:"#faebd7",aqua:"#00ffff",aquamarine:"#7fffd4",azure:"#f0ffff",beige:"#f5f5dc",bisque:"#ffe4c4",black:"#000000",blanchedalmond:"#ffebcd",blue:"#0000ff",blueviolet:"#8a2be2",brown:"#a52a2a",burlywood:"#deb887",cadetblue:"#5f9ea0",chartreuse:"#7fff00",chocolate:"#d2691e",coral:"#ff7f50",cornflowerblue:"#6495ed",cornsilk:"#fff8dc",crimson:"#dc143c",cyan:"#00ffff",darkblue:"#00008b",darkcyan:"#008b8b",darkgoldenrod:"#b8860b",darkgray:"#a9a9a9",darkgreen:"#006400",darkgrey:"#a9a9a9",darkkhaki:"#bdb76b",darkmagenta:"#8b008b",darkolivegreen:"#556b2f",darkorange:"#ff8c00",darkorchid:"#9932cc",darkred:"#8b0000",darksalmon:"#e9967a",darkseagreen:"#8fbc8f" +,darkslateblue:"#483d8b",darkslategray:"#2f4f4f",darkslategrey:"#2f4f4f",darkturquoise:"#00ced1",darkviolet:"#9400d3",deeppink:"#ff1493",deepskyblue:"#00bfff",dimgray:"#696969",dimgrey:"#696969",dodgerblue:"#1e90ff",firebrick:"#b22222",floralwhite:"#fffaf0",forestgreen:"#228b22",fuchsia:"#ff00ff",gainsboro:"#dcdcdc",ghostwhite:"#f8f8ff",gold:"#ffd700",goldenrod:"#daa520",gray:"#808080",green:"#008000",greenyellow:"#adff2f",grey:"#808080",honeydew:"#f0fff0",hotpink:"#ff69b4",indianred:"#cd5c5c",indigo:"#4b0082",ivory:"#fffff0",khaki:"#f0e68c",lavender:"#e6e6fa",lavenderblush:"#fff0f5",lawngreen:"#7cfc00",lemonchiffon:"#fffacd",lightblue:"#add8e6",lightcoral:"#f08080",lightcyan:"#e0ffff",lightgoldenrodyellow:"#fafad2",lightgray:"#d3d3d3",lightgreen:"#90ee90",lightgrey:"#d3d3d3",lightpink:"#ffb6c1",lightsalmon:"#ffa07a",lightseagreen:"#20b2aa",lightskyblue:"#87cefa",lightslategray:"#778899",lightslategrey:"#778899",lightsteelblue:"#b0c4de",lightyellow:"#ffffe0",lime:"#00ff00",limegreen:"#32cd32",linen:"#faf0e6",magenta:"#ff00ff",maroon:"#800000",mediumaquamarine:"#66cdaa",mediumblue:"#0000cd",mediumorchid:"#ba55d3",mediumpurple:"#9370db",mediumseagreen:"#3cb371",mediumslateblue:"#7b68ee",mediumspringgreen:"#00fa9a",mediumturquoise:"#48d1cc",mediumvioletred:"#c71585",midnightblue:"#191970",mintcream:"#f5fffa",mistyrose:"#ffe4e1",moccasin:"#ffe4b5",navajowhite:"#ffdead",navy:"#000080",oldlace:"#fdf5e6",olive:"#808000",olivedrab:"#6b8e23",orange:"#ffa500",orangered:"#ff4500",orchid:"#da70d6",palegoldenrod:"#eee8aa",palegreen:"#98fb98",paleturquoise:"#afeeee",palevioletred:"#db7093",papayawhip:"#ffefd5",peachpuff:"#ffdab9",peru:"#cd853f",pink:"#ffc0cb",plum:"#dda0dd",powderblue:"#b0e0e6",purple:"#800080",red:"#ff0000",rosybrown:"#bc8f8f",royalblue:"#4169e1",saddlebrown:"#8b4513",salmon:"#fa8072",sandybrown:"#f4a460",seagreen:"#2e8b57",seashell:"#fff5ee",sienna:"#a0522d",silver:"#c0c0c0",skyblue:"#87ceeb",slateblue:"#6a5acd",slategray:"#708090",slategrey:"#708090",snow:"#fffafa",springgreen:"#00ff7f",steelblue:"#4682b4",tan:"#d2b48c",teal:"#008080",thistle:"#d8bfd8",tomato:"#ff6347",turquoise:"#40e0d0",violet:"#ee82ee",wheat:"#f5deb3",white:"#ffffff",whitesmoke:"#f5f5f5",yellow:"#ffff00",yellowgreen:"#9acd32"};for(var $ in Z)Z[$]=W(Z[$],T,bb);d3.hsl=function(a,b,c){return arguments.length===1?a instanceof ba?_(a.h,a.s,a.l):W(""+a,X,_):_(+a,+b,+c)},ba.prototype.brighter=function(a){return a=Math.pow(.7,arguments.length?a:1),_(this.h,this.s,this.l/a)},ba.prototype.darker=function(a){return a=Math.pow(.7,arguments.length?a:1),_(this.h,this.s,a*this.l)},ba.prototype.rgb=function(){return bb(this.h,this.s,this.l)},ba.prototype.toString=function(){return this.rgb().toString()};var bd=function(a,b){return b.querySelector(a)},be=function(a,b){return b.querySelectorAll(a)},bf=document.documentElement,bg=bf.matchesSelector||bf.webkitMatchesSelector||bf.mozMatchesSelector||bf.msMatchesSelector||bf.oMatchesSelector,bh=function(a,b){return bg.call(a,b)};typeof Sizzle=="function"&&(bd=function(a,b){return Sizzle(a,b)[0]},be=function(a,b){return Sizzle.uniqueSort(Sizzle(a,b))},bh=Sizzle.matchesSelector);var bi=[];d3.selection=function(){return bq},d3.selection.prototype=bi,bi.select=function(a){var b=[],c,d,e,f;typeof a!="function"&&(a=bj(a));for(var g=-1,h=this.length;++g<h;){b.push(c=[]),c.parentNode=(e=this[g]).parentNode;for(var i=-1,j=e.length;++i<j;)(f=e[i])?(c.push(d=a.call(f,f.__data__,i)),d&&"__data__"in f&&(d.__data__=f.__data__)):c.push(null)}return bc(b)},bi.selectAll=function(a){var b=[],c,e;typeof a!="function"&&(a=bk(a));for(var f=-1,g=this.length;++f<g;)for(var h=this[f],i=-1,j=h.length;++i<j;)if(e=h[i])b.push(c=d(a.call(e,e.__data__,i))),c.parentNode=e;return bc(b)},bi.attr=function(a,b){function d(){this.removeAttribute(a)}function e(){this.removeAttributeNS(a.space,a.local)}function f(){this.setAttribute(a,b)}function g(){this.setAttributeNS(a.space,a.local,b)}function h(){var c=b.apply(this,arguments);c==null?this.removeAttribute(a):this.setAttribute(a,c)}function i(){var c=b.apply(this,arguments);c==null?this.removeAttributeNS(a.space,a.local):this.setAttributeNS(a.space,a.local,c)}a=d3.ns.qualify(a);if(arguments.length<2){var c=this.node();return a.local?c.getAttributeNS(a.space,a.local):c.getAttribute(a)}return this.each(b==null?a.local?e:d:typeof b=="function"?a.local?i:h:a.local?g:f)},bi.classed=function(a,b){var c=a.split(bl),d=c.length,e=-1;if(arguments.length>1){while(++e<d)bm.call(this,c[e],b);return this}while(++e<d)if(!bm.call(this,c[e]))return!1;return!0};var bl=/\s+/g;bi.style=function(a,b,c){function d(){this.style.removeProperty(a)}function e(){this.style.setProperty(a,b,c)}function f(){var d=b.apply(this,arguments);d==null?this.style.removeProperty(a):this.style.setProperty(a,d,c)}return arguments.length<3&&(c=""),arguments.length<2?window.getComputedStyle(this.node(),null).getPropertyValue(a):this.each(b==null?d:typeof b=="function"?f:e)},bi.property=function(a,b){function c(){delete this[a]}function d(){this[a]=b}function e(){var c=b.apply(this,arguments);c==null?delete this[a]:this[a]=c}return arguments.length<2?this.node()[a]:this.each(b==null?c:typeof b=="function"?e:d)},bi.text=function(a){return arguments.length<1?this.node().textContent:this.each(typeof a=="function"?function(){this.textContent=a.apply(this,arguments)}:function(){this.textContent=a})},bi.html=function(a){return arguments.length<1?this.node().innerHTML:this.each(typeof a=="function"?function(){this.innerHTML=a.apply(this,arguments)}:function(){this.innerHTML=a})},bi.append=function(a){function b(){return this.appendChild(document.createElementNS(this.namespaceURI,a))}function c(){return this.appendChild(document.createElementNS(a.space,a.local))}return a=d3.ns.qualify(a),this.select(a.local?c:b)},bi.insert=function(a,b){function c(){return this.insertBefore(document.createElementNS(this.namespaceURI,a),bd(b,this))}function d(){return this.insertBefore(document.createElementNS(a.space,a.local),bd(b,this))}return a=d3.ns.qualify(a),this.select(a.local?d:c)},bi.remove=function(){return this.each(function(){var a=this.parentNode;a&&a.removeChild(this)})},bi.data=function(a,b){function f(a,f){var g,h=a.length,i=f.length,j=Math.min(h,i),k=Math.max(h,i),l=[],m=[],n=[],o,p;if(b){var q={},r=[],s,t=f.length;for(g=-1;++g<h;)s=b.call(o=a[g],o.__data__,g),s in q?n[t++]=o:q[s]=o,r.push(s);for(g=-1;++g<i;)o=q[s=b.call(f,p=f[g],g)],o?(o.__data__=p,l[g]=o,m[g]=n[g]=null):(m[g]=bn(p),l[g]=n[g]=null),delete q[s];for(g=-1;++g<h;)r[g]in q&&(n[g]=a[g])}else{for(g=-1;++g<j;)o=a[g],p=f[g],o?(o.__data__=p,l[g]=o,m[g]=n[g]=null):(m[g]=bn(p),l[g]=n[g]=null);for(;g<i;++g)m[g]=bn(f[g]),l[g]=n[g]=null;for(;g<k;++g)n[g]=a[g],m[g]=l[g]=null}m.update=l,m.parentNode=l.parentNode=n.parentNode=a.parentNode,c.push(m),d.push(l),e.push(n)}var c=[],d=[],e=[],g=-1,h=this.length,i;if(typeof a=="function")while(++g<h)f(i=this[g],a.call(i,i.parentNode.__data__,g));else while(++g<h)f(i=this[g],a);var j=bc(d);return j.enter=function(){return br(c)},j.exit=function(){return bc(e)},j},bi.filter=function(a){var b=[],c,d,e;typeof a!="function"&&(a=bo(a));for(var f=0,g=this.length;f<g;f++){b.push(c=[]),c.parentNode=(d=this[f]).parentNode;for(var h=0,i=d.length;h<i;h++)(e=d[h])&&a.call(e,e.__data__,h)&&c.push(e)}return bc(b)},bi.map=function(a){return this.each(function(){this.__data__=a.apply(this,arguments)})},bi.order=function(){for(var a=-1,b=this.length;++a<b;)for(var c=this[a],d=c.length-1,e=c[d],f;--d>=0;)if(f=c[d])e&&e.parentNode.insertBefore(f,e),e=f;return this},bi.sort=function(a){a=bp.apply(this,arguments);for(var b=-1,c=this.length;++b<c;)this[b].sort(a);return this.order()},bi.on=function(a,b,c){arguments.length<3&&(c=!1);var d="__on"+a,e=a.indexOf(".");return e>0&&(a=a.substring(0,e)),arguments.length<2?(e=this.node()[d])&&e._:this.each(function(e,f){function h(a){var c=d3.event;d3.event=a;try{b.call(g,g.__data__,f)}finally{d3.event=c}}var g=this;g[d]&&g.removeEventListener(a,g[d],c),b&&g.addEventListener(a,g[d]=h,c),h._=b})},bi.each=function(a){for(var b=-1,c=this.length;++b<c;)for(var d=this[b],e=-1,f=d.length;++e<f;){var g=d[e];g&&a.call(g,g.__data__,e,b)}return this},bi.call=function(a){return a.apply(this,(arguments[0]=this,arguments)),this},bi.empty=function(){return!this.node()},bi.node=function(a){for(var b=0,c=this.length;b<c;b++)for(var d=this[b],e=0,f=d.length;e<f;e++){var g=d[e];if(g)return g}return null},bi.transition=function(){var a=[],b,c;for(var d=-1,e=this.length;++d<e;){a.push(b=[]);for(var f=this[d],g=-1,h=f.length;++g<h;)b.push((c=f[g])?{node:c,delay:0,duration:250}:null)}return bt(a,bz||++by,Date.now())};var bq=bc([[document]]);bq[0].parentNode=bf,d3.select=function(a){return typeof a=="string"?bq.select(a):bc([[a]])},d3.selectAll=function(a){return typeof a=="string"?bq.selectAll(a):bc([d(a)])};var bs=[];bs.append=bi.append,bs.insert=bi.insert,bs.empty=bi.empty,bs.node=bi.node,bs.select=function(a){var b=[],c,d,e,f,g;for(var h=-1,i=this.length;++h<i;){e=(f=this[h]).update,b.push(c=[]),c.parentNode=f.parentNode;for(var j=-1,k=f.length;++j<k;)(g=f[j])?(c.push(e[j]=d=a.call(f.parentNode,g.__data__,j)),d.__data__=g.__data__):c.push(null)}return bc(b)};var bu={},bx=[],by=0,bz=0,bA=d3.ease("cubic-in-out");bx.call=bi.call,d3.transition=function(){return bq.transition()},d3.transition.prototype=bx,bx.select=function(a){var b=[],c,d,e;typeof a!="function"&&(a=bj(a));for(var f=-1,g=this.length;++f<g;){b.push(c=[]);for(var h=this[f],i=-1,j=h.length;++i<j;)(e=h[i])&&(d=a.call(e.node,e.node.__data__,i))?("__data__"in e.node&&(d.__data__=e.node.__data__),c.push({node:d,delay:e.delay,duration:e.duration})):c.push(null)}return bt(b,this.id,this.time).ease(this.ease())},bx.selectAll=function(a){var b=[],c,d,e;typeof a!="function"&&(a=bk(a));for(var f=-1,g=this.length;++f<g;)for(var h=this[f],i=-1,j=h.length;++i<j;)if(e=h[i]){d=a.call(e.node,e.node.__data__,i),b.push(c=[]);for(var k=-1,l=d.length;++k<l;)c.push({node:d[k],delay:e.delay,duration:e.duration})}return bt(b,this.id,this.time).ease(this.ease())},bx.attr=function(a,b){return this.attrTween(a,bw(a,b))},bx.attrTween=function(a,b){function d(a,d){var e=b.call(this,a,d,this.getAttribute(c));return e===bu?(this.removeAttribute(c),null):e&&function(a){this.setAttribute(c,e(a))}}function e(a,d){var e=b.call(this,a,d,this.getAttributeNS(c.space,c.local));return e===bu?(this.removeAttributeNS(c.space,c.local),null):e&&function(a){this.setAttributeNS(c.space,c.local,e(a))}}var c=d3.ns.qualify(a);return this.tween("attr."+a,c.local?e:d)},bx.style=function(a,b,c){return arguments.length<3&&(c=""),this.styleTween(a,bw(a,b),c)},bx.styleTween=function(a,b,c){return arguments.length<3&&(c=""),this.tween("style."+a,function(d,e){var f=b.call(this,d,e,window.getComputedStyle(this,null).getPropertyValue(a));return f===bu?(this.style.removeProperty(a),null):f&&function(b){this.style.setProperty(a,f(b),c)}})},bx.text=function(a){return this.tween("text",function(b,c){this.textContent=typeof a=="function"?a.call(this,b,c):a})},bx.remove=function(){return this.each("end",function(){var a;!this.__transition__&&(a=this.parentNode)&&a.removeChild(this)})},bx.delay=function(a){var b=this;return b.each(typeof a=="function"?function(c,d,e){b[e][d].delay=+a.apply(this,arguments)}:(a=+a,function(c,d,e){b[e][d].delay=a}))},bx.duration=function(a){var b=this;return b.each(typeof a=="function"?function(c,d,e){b[e][d].duration=+a.apply(this,arguments)}:(a=+a,function(c,d,e){b[e][d].duration=a}))},bx.transition=function(){return this.select(i)};var bC=null,bD,bE;d3.timer=function(a,b,c){var d=!1,e,f=bC;if(arguments.length<3){if(arguments.length<2)b=0;else if(!isFinite(b))return;c=Date.now()}while(f){if(f.callback===a){f.then=c,f.delay=b,d=!0;break}e=f,f=f.next}d||(bC={callback:a,then:c,delay:b,next:bC}),bD||(bE=clearTimeout(bE),bD=1,bH(bF))},d3.timer.flush=function(){var a,b=Date.now(),c=bC;while(c)a=b-c.then,c.delay||(c.flush=c.callback(a)),c=c.next;bG()};var bH=window.requestAnimationFrame||window.webkitRequestAnimationFrame||window.mozRequestAnimationFrame||window.oRequestAnimationFrame||window.msRequestAnimationFrame||function(a){setTimeout(a,17)};d3.transform=function(a){bM.setAttribute("transform",a);var b=bM.transform.baseVal.consolidate();return new bI(b?b.matrix:bN)},bI.prototype.toString=function(){return"translate("+this.translate+")rotate("+this.rotate+")skewX("+this.skew+")scale("+this.scale+")"};var bM=document.createElementNS(d3.ns.prefix.svg,"g"),bN={a:1,b:0,c:0,d:1,e:0,f:0},bO=180/Math.PI;d3.scale={},d3.scale.linear=function(){return bU([0,1],[0,1],d3.interpolate,!1)},d3.scale.log=function(){return ca(d3.scale.linear(),cc)};var cb=d3.format(".0e");cc.pow=function(a){return Math.pow(10,a)},cd.pow=function(a){return-Math.pow(10,-a)},d3.scale.pow=function(){return ce(d3.scale.linear(),1)},d3.scale.sqrt=function(){return d3.scale.pow().exponent(.5)},d3.scale.ordinal=function(){return cg([],{t:"range",x:[]})},d3.scale.category10=function(){return d3.scale.ordinal().range(ch)},d3.scale.category20=function(){return d3.scale.ordinal().range(ci)},d3.scale.category20b=function(){return d3.scale.ordinal().range(cj)},d3.scale.category20c=function(){return d3.scale.ordinal().range(ck)};var ch=["#1f77b4","#ff7f0e","#2ca02c","#d62728","#9467bd","#8c564b","#e377c2","#7f7f7f","#bcbd22","#17becf"],ci=["#1f77b4","#aec7e8","#ff7f0e","#ffbb78","#2ca02c","#98df8a","#d62728","#ff9896","#9467bd","#c5b0d5","#8c564b","#c49c94","#e377c2","#f7b6d2","#7f7f7f","#c7c7c7","#bcbd22","#dbdb8d","#17becf","#9edae5"],cj=["#393b79","#5254a3","#6b6ecf","#9c9ede","#637939","#8ca252","#b5cf6b","#cedb9c","#8c6d31","#bd9e39","#e7ba52","#e7cb94","#843c39","#ad494a","#d6616b","#e7969c","#7b4173","#a55194","#ce6dbd","#de9ed6"],ck=["#3182bd","#6baed6","#9ecae1","#c6dbef","#e6550d","#fd8d3c","#fdae6b","#fdd0a2","#31a354","#74c476","#a1d99b","#c7e9c0","#756bb1","#9e9ac8","#bcbddc","#dadaeb","#636363","#969696","#bdbdbd","#d9d9d9"];d3.scale.quantile=function(){return cl([],[])},d3.scale.quantize=function(){return cm(0,1,[0,1])},d3.svg={},d3.svg.arc=function(){function e(){var e=a.apply(this,arguments),f=b.apply(this,arguments),g=c.apply(this,arguments)+cn,h=d.apply(this,arguments)+cn,i=(h<g&&(i=g,g=h,h=i),h-g),j=i<Math.PI?"0":"1",k=Math.cos(g),l=Math.sin(g),m=Math.cos(h),n=Math.sin(h);return i>=co?e?"M0,"+f+"A"+f+","+f+" 0 1,1 0,"+ -f+"A"+f+","+f+" 0 1,1 0,"+f+"M0,"+e+"A"+e+","+e+" 0 1,0 0,"+ -e+"A"+e+","+e+" 0 1,0 0,"+e+"Z":"M0,"+f+"A"+f+","+f+" 0 1,1 0,"+ -f+"A"+f+","+f+" 0 1,1 0,"+f+"Z":e?"M"+f*k+","+f*l+"A"+f+","+f+" 0 "+j+",1 "+f*m+","+f*n+"L"+e*m+","+e*n+"A"+e+","+e+" 0 "+j+",0 "+e*k+","+e*l+"Z":"M"+f*k+","+f*l+"A"+f+","+f+" 0 "+j+",1 "+f*m+","+f*n+"L0,0"+"Z"}var a=cp,b=cq,c=cr,d=cs;return e.innerRadius=function(b){return arguments.length?(a=d3.functor(b),e):a},e.outerRadius=function(a){return arguments.length?(b=d3.functor(a),e):b},e.startAngle=function(a){return arguments.length?(c=d3.functor(a),e):c},e.endAngle=function(a){return arguments.length?(d=d3.functor(a),e):d},e.centroid=function(){var e=(a.apply(this,arguments)+b.apply(this,arguments))/2,f=(c.apply(this,arguments)+d.apply(this,arguments))/2+cn;return[Math.cos(f)*e,Math.sin(f)*e]},e};var cn=-Math.PI/2,co=2*Math.PI-1e-6;d3.svg.line=function(){return ct(Object)};var cx={linear:cy,"step-before":cz,"step-after":cA,basis:cG,"basis-open":cH,"basis-closed":cI,bundle:cJ,cardinal:cD,"cardinal-open":cB,"cardinal-closed":cC,monotone:cS},cL=[0,2/3,1/3,0],cM=[0,1/3,2/3,0],cN=[0,1/6,2/3,1/6];d3.svg.line.radial=function(){var a=ct(cT);return a.radius=a.x,delete a.x,a.angle=a.y,delete a.y,a},cz.reverse=cA,cA.reverse=cz,d3.svg.area=function(){return cU(Object)},d3.svg.area.radial=function(){var a=cU(cT);return a.radius=a.x,delete a.x,a.innerRadius=a.x0,delete a.x0,a.outerRadius=a.x1,delete a.x1,a.angle=a.y,delete a.y,a.startAngle=a.y0,delete a.y0,a.endAngle=a.y1,delete a.y1,a},d3.svg.chord=function(){function f(c,d){var e=g(this,a,c,d),f=g(this,b,c,d);return"M"+e.p0+i(e.r,e.p1)+(h(e,f)?j(e.r,e.p1,e.r,e.p0):j(e.r,e.p1,f.r,f.p0)+i(f.r,f.p1)+j(f.r,f.p1,e.r,e.p0))+"Z"}function g(a,b,f,g){var h=b.call(a,f,g),i=c.call(a,h,g),j=d.call(a,h,g)+cn,k=e.call(a,h,g)+cn;return{r:i,a0:j,a1:k,p0:[i*Math.cos(j),i*Math.sin(j)],p1:[i*Math.cos(k),i*Math.sin(k)]}}function h(a,b){return a.a0==b.a0&&a.a1==b.a1}function i(a,b){return"A"+a+","+a+" 0 0,1 "+b}function j(a,b,c,d){return"Q 0,0 "+d}var a=cX,b=cY,c=cZ,d=cr,e=cs;return f.radius=function(a){return arguments.length?(c=d3.functor(a),f):c},f.source=function(b){return arguments.length?(a=d3.functor(b),f):a},f.target=function(a){return arguments.length?(b=d3.functor(a),f):b},f.startAngle=function(a){return arguments.length?(d=d3.functor(a),f):d},f.endAngle=function(a){return arguments.length?(e=d3.functor(a),f):e},f},d3.svg.diagonal=function(){function d(d,e){var f=a.call(this,d,e),g=b.call(this,d,e),h=(f.y+g.y)/2,i=[f,{x:f.x,y:h},{x:g.x,y:h},g];return i=i.map(c),"M"+i[0]+"C"+i[1]+" "+i[2]+" "+i[3]}var a=cX,b=cY,c=da;return d.source=function(b){return arguments.length?(a=d3.functor(b),d):a},d.target=function(a){return arguments.length?(b=d3.functor(a),d):b},d.projection=function(a){return arguments.length?(c=a,d):c},d},d3.svg.diagonal.radial=function(){var a=d3.svg.diagonal(),b=da,c=a.projection;return a.projection=function(a){return arguments.length?c(db(b=a)):b},a},d3.svg.mouse=function(a){return dd(a,d3.event)};var dc=/WebKit/.test(navigator.userAgent)?-1:0;d3.svg.touches=function(a,b){return arguments.length<2&&(b=d3.event.touches),b?d(b).map(function(b){var c=dd(a,b);return c.identifier=b.identifier,c}):[]},d3.svg.symbol=function(){function c(c,d){return(dg[a.call(this,c,d)]||dg.circle)(b.call(this,c,d))}var a=df,b=de;return c.type=function(b){return arguments.length?(a=d3.functor(b),c):a},c.size=function(a){return arguments.length?(b=d3.functor(a),c):b},c};var dg={circle:function(a){var b=Math.sqrt(a/Math.PI);return"M0,"+b+"A"+b+","+b+" 0 1,1 0,"+ -b+"A"+b+","+b+" 0 1,1 0,"+b+"Z"},cross:function(a){var b=Math.sqrt(a/5)/2;return"M"+ -3*b+","+ -b+"H"+ -b+"V"+ -3*b+"H"+b+"V"+ -b+"H"+3*b+"V"+b+"H"+b+"V"+3*b+"H"+ -b+"V"+b+"H"+ -3*b+"Z"},diamond:function(a){var b=Math.sqrt(a/(2*di)),c=b*di;return"M0,"+ -b+"L"+c+",0"+" 0,"+b+" "+ -c+",0"+"Z"},square:function(a){var b=Math.sqrt(a)/2;return"M"+ -b+","+ -b+"L"+b+","+ -b+" "+b+","+b+" "+ -b+","+b+"Z"},"triangle-down":function(a){var b=Math.sqrt(a/dh),c=b*dh/2;return"M0,"+c+"L"+b+","+ -c+" "+ -b+","+ -c+"Z"},"triangle-up":function(a){var b=Math.sqrt(a/dh),c=b*dh/2;return"M0,"+ -c+"L"+b+","+c+" "+ -b+","+c+"Z"}};d3.svg.symbolTypes=d3.keys(dg);var dh=Math.sqrt(3),di=Math.tan(30*Math.PI/180);d3.svg.axis=function(){function j(j){j.each(function(k,l,m){var n=d3.select(this),o=j.delay?function(a){var b=bz;try{return bz=j.id,a.transition().delay(j[m][l].delay).duration(j[m][l].duration).ease(j.ease())}finally{bz=b}}:Object,p=a.ticks?a.ticks.apply(a,g):a.domain(),q=h==null?a.tickFormat?a.tickFormat.apply(a,g):String:h,r=dl(a,p,i),s=n.selectAll(".minor").data(r,String),t=s.enter().insert("line","g").attr("class","tick minor").style("opacity",1e-6),u=o(s.exit()).style("opacity",1e-6).remove(),v=o(s).style("opacity",1),w=n.selectAll("g").data(p,String),x=w.enter().insert("g","path").style("opacity",1e-6),y=o(w.exit()).style("opacity",1e-6).remove(),z=o(w).style("opacity",1),A,B=bR(a),C=n.selectAll(".domain").data([0]),D=C.enter().append("path").attr("class","domain"),E=o(C),F=a.copy(),G=this.__chart__||F;this.__chart__=F,x.append("line").attr("class","tick"),x.append("text"),z.select("text").text(q);switch(b){case"bottom":A=dj,v.attr("x2",0).attr("y2",d),z.select("line").attr("x2",0).attr("y2",c),z.select("text").attr("x",0).attr("y",Math.max(c,0)+f).attr("dy",".71em").attr("text-anchor","middle"),E.attr("d","M"+B[0]+","+e+"V0H"+B[1]+"V"+e);break;case"top":A=dj,v.attr("x2",0).attr("y2",-d),z.select("line").attr("x2",0).attr("y2",-c),z.select("text").attr("x",0).attr("y",-(Math.max(c,0)+f)).attr("dy","0em").attr("text-anchor","middle"),E.attr("d","M"+B[0]+","+ -e+"V0H"+B[1]+"V"+ -e);break;case"left":A=dk,v.attr("x2",-d).attr("y2",0),z.select("line").attr("x2",-c).attr("y2",0),z.select("text").attr("x",-(Math.max(c,0)+f)).attr("y",0).attr("dy",".32em").attr("text-anchor","end"),E.attr("d","M"+ -e+","+B[0]+"H0V"+B[1]+"H"+ -e);break;case"right":A=dk,v.attr("x2",d).attr("y2",0),z.select("line").attr("x2",c).attr("y2",0),z.select("text").attr("x",Math.max(c,0)+f).attr("y",0).attr("dy",".32em").attr("text-anchor","start"),E.attr("d","M"+e+","+B[0]+"H0V"+B[1]+"H"+e)}if(a.ticks)x.call(A,G),z.call(A,F),y.call(A,F),t.call(A,G),v.call(A,F),u.call(A,F);else{var H=F.rangeBand()/2,I=function(a){return F(a)+H};x.call(A,I),z.call(A,I)}})}var a=d3.scale.linear(),b="bottom",c=6,d=6,e=6,f=3,g=[10],h,i=0;return j.scale=function(b){return arguments.length?(a=b,j):a},j.orient=function(a){return arguments.length?(b=a,j):b},j.ticks=function(){return arguments.length?(g=arguments,j):g},j.tickFormat=function(a){return arguments.length?(h=a,j):h},j.tickSize=function(a,b,f){if(!arguments.length)return c;var g=arguments.length-1;return c=+a,d=g>1?+b:c,e=g>0?+arguments[g]:c,j},j.tickPadding=function(a){return arguments.length?(f=+a,j):f},j.tickSubdivide=function(a){return arguments.length?(i=+a,j):i},j},d3.svg.brush=function(){function e(a){var g=b&&c?["n","e","s","w","nw","ne","se","sw"]:b?["e","w"]:c?["n","s"]:[];a.each(function(){var a=d3.select(this).on("mousedown.brush",f),h=a.selectAll(".background").data([,]),i=a.selectAll(".extent").data([,]),j=a.selectAll(".resize").data(g,String),k;h.enter().append("rect").attr("class","background").style("visibility","hidden").style("pointer-events","all").style("cursor","crosshair"),i.enter().append("rect").attr("class","extent").style("cursor","move"),j.enter().append("rect").attr("class",function(a){return"resize "+a}).attr("width",6).attr("height",6).style("visibility","hidden").style("pointer-events",e.empty()?"none":"all").style("cursor",function(a){return dE[a]}),j.exit().remove(),b&&(k=bR(b),h.attr("x",k[0]).attr("width",k[1]-k[0]),dx(a,d)),c&&(k=bR(c),h.attr("y",k[0]).attr("height",k[1]-k[0]),dy(a,d))})}function f(){var a=d3.select(d3.event.target);dm=e,dp=this,ds=d,dw=d3.svg.mouse(dp),(dt=a.classed("extent"))?(dw[0]=d[0][0]-dw[0],dw[1]=d[0][1]-dw[1]):a.classed("resize")?(du=d3.event.target.__data__,dw[0]=d[+/w$/.test(du)][0],dw[1]=d[+/^n/.test(du)][1]):d3.event.altKey&&(dv=dw.slice()),dq=!/^(n|s)$/.test(du)&&b,dr=!/^(e|w)$/.test(du)&&c,dn=g(this,arguments),dn("brushstart"),dB(),O()}function g(b,c){return function(d){var f=d3.event;try{d3.event={type:d,target:e},a[d].apply(b,c)}finally{d3.event=f}}}var a=d3.dispatch("brushstart","brush","brushend"),b,c,d=[[0,0],[0,0]];return e.x=function(a){return arguments.length?(b=a,e):b},e.y=function(a){return arguments.length?(c=a,e):c},e.extent=function(a){var f,g,h,i,j;return arguments.length?(b&&(f=a[0],g=a[1],c&&(f=f[0],g=g[0]),b.invert&&(f=b(f),g=b(g)),g<f&&(j=f,f=g,g=j),d[0][0]=f,d[1][0]=g),c&&(h=a[0],i=a[1],b&&(h=h[1],i=i[1]),c.invert&&(h=c(h),i=c(i)),i<h&&(j=h,h=i,i=j),d[0][1]=h,d[1][1]=i),e):(b&&(f=d[0][0],g=d[1][0],b.invert&&(f=b.invert(f),g=b.invert(g)),g<f&&(j=f,f=g,g=j)),c&&(h=d[0][1],i=d[1][1],c.invert&&(h=c.invert(h),i=c.invert(i)),i<h&&(j=h,h=i,i=j)),b&&c?[[f,h],[g,i]]:b?[f,g]:c&&[h,i])},e.clear=function(){return d[0][0]=d[0][1]=d[1][0]=d[1][1]=0,e},e.empty=function(){return b&&d[0][0]===d[1][0]||c&&d[0][1]===d[1][1]},d3.select(window).on("mousemove.brush",dB).on("mouseup.brush",dD).on("keydown.brush",dz).on("keyup.brush",dA),d3.rebind(e,a,"on")};var dm,dn,dp,dq,dr,ds,dt,du,dv,dw,dE={n:"ns-resize",e:"ew-resize",s:"ns-resize",w:"ew-resize",nw:"nwse-resize",ne:"nesw-resize",se:"nwse-resize",sw:"nesw-resize"};d3.behavior={},d3.behavior.drag=function(){function c(){this.on("mousedown.drag",e).on("touchstart.drag",e),d3.select(window).on("mousemove.drag",dO).on("touchmove.drag",dO).on("mouseup.drag",dP,!0).on("touchend.drag",dP,!0).on("click.drag",dQ,!0)}function d(){dF=a,dG=d3.event.target,dH=this,dI=arguments,dK=dN(),b?(dJ=b.apply(dH,dI),dJ=[dJ.x-dK[0],dJ.y-dK[1]]):dJ=[0,0],dL=0}function e(){d.apply(this,arguments),dM("dragstart")}var a=d3.dispatch("drag","dragstart","dragend"),b=null;return c.origin=function(a){return arguments.length?(b=a,c):b},d3.rebind(c,a,"on")};var dF,dG,dH,dI,dJ,dK,dL;d3.behavior.zoom=function(){function d(){this.on("mousedown.zoom",f).on("mousewheel.zoom",g).on("DOMMouseScroll.zoom",g).on("dblclick.zoom",h).on("touchstart.zoom",i),d3.select(window).on("mousemove.zoom",ef).on("mouseup.zoom",eg).on("touchmove.zoom",ee).on("touchend.zoom",ed).on("click.zoom",eh,!0)}function e(){dW=a,dX=c,dY=b.zoom,dZ=d3.event.target,d$=this,d_=arguments}function f(){e.apply(this,arguments),dS=eb(d3.svg.mouse(d$)),ea=0,d3.event.preventDefault(),window.focus()}function g(){e.apply(this,arguments),dT||(dT=eb(d3.svg.mouse(d$))),ei(ec()+a[2],d3.svg.mouse(d$),dT)}function h(){e.apply(this,arguments);var b=d3.svg.mouse(d$);ei(d3.event.shiftKey?Math.ceil(a[2]-1):Math.floor(a[2]+1),b,eb(b))}function i(){e.apply(this,arguments);var b=ed(),c,d=Date.now();b.length===1&&d-dV<300&&ei(1+Math.floor(a[2]),c=b[0],dU[c.identifier]),dV=d}var a=[0,0,0],b=d3.dispatch("zoom"),c=ej;return d.extent=function(a){return arguments.length?(c=a==null?ej:a,d):c},d3.rebind(d,b,"on")};var dR,dS,dT,dU={},dV=0,dW,dX,dY,dZ,d$,d_,ea,ej=[[-Infinity,Infinity],[-Infinity,Infinity],[-Infinity,Infinity]]})();
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/d3.time.js b/gstudio/static/gstudio/js/d3.time.js new file mode 100644 index 0000000..4c1cda4 --- /dev/null +++ b/gstudio/static/gstudio/js/d3.time.js @@ -0,0 +1,687 @@ +(function(){d3.time = {}; + +var d3_time = Date; +d3.time.format = function(template) { + var n = template.length; + + function format(date) { + var string = [], + i = -1, + j = 0, + c, + f; + while (++i < n) { + if (template.charCodeAt(i) == 37) { + string.push( + template.substring(j, i), + (f = d3_time_formats[c = template.charAt(++i)]) + ? f(date) : c); + j = i + 1; + } + } + string.push(template.substring(j, i)); + return string.join(""); + } + + format.parse = function(string) { + var date = new d3_time(1900, 0, 1), + i = d3_time_parse(date, template, string, 0); + if (i != string.length) return null; + if (date.hour12) { + var hours = date.getHours() % 12; + date.setHours(date.hour12pm ? hours + 12 : hours); + } + delete date.hour12; + delete date.hour12pm; + return date; + }; + + format.toString = function() { + return template; + }; + + return format; +}; + +function d3_time_parse(date, template, string, j) { + var c, + p, + i = 0, + n = template.length, + m = string.length; + while (i < n) { + if (j >= m) return -1; + c = template.charCodeAt(i++); + if (c == 37) { + p = d3_time_parsers[template.charAt(i++)]; + if (!p || ((j = p(date, string, j)) < 0)) return -1; + } else if (c != string.charCodeAt(j++)) { + return -1; + } + } + return j; +} + +var d3_time_zfill2 = d3.format("02d"), + d3_time_zfill3 = d3.format("03d"), + d3_time_zfill4 = d3.format("04d"), + d3_time_sfill2 = d3.format("2d"); + +var d3_time_formats = { + a: function(d) { return d3_time_weekdays[d.getDay()].substring(0, 3); }, + A: function(d) { return d3_time_weekdays[d.getDay()]; }, + b: function(d) { return d3_time_months[d.getMonth()].substring(0, 3); }, + B: function(d) { return d3_time_months[d.getMonth()]; }, + c: d3.time.format("%a %b %e %H:%M:%S %Y"), + d: function(d) { return d3_time_zfill2(d.getDate()); }, + e: function(d) { return d3_time_sfill2(d.getDate()); }, + H: function(d) { return d3_time_zfill2(d.getHours()); }, + I: function(d) { return d3_time_zfill2(d.getHours() % 12 || 12); }, + j: d3_time_dayOfYear, + L: function(d) { return d3_time_zfill3(d.getMilliseconds()); }, + m: function(d) { return d3_time_zfill2(d.getMonth() + 1); }, + M: function(d) { return d3_time_zfill2(d.getMinutes()); }, + p: function(d) { return d.getHours() >= 12 ? "PM" : "AM"; }, + S: function(d) { return d3_time_zfill2(d.getSeconds()); }, + U: d3_time_weekNumberSunday, + w: function(d) { return d.getDay(); }, + W: d3_time_weekNumberMonday, + x: d3.time.format("%m/%d/%y"), + X: d3.time.format("%H:%M:%S"), + y: function(d) { return d3_time_zfill2(d.getFullYear() % 100); }, + Y: function(d) { return d3_time_zfill4(d.getFullYear() % 10000); }, + Z: d3_time_zone, + "%": function(d) { return "%"; } +}; + +var d3_time_parsers = { + a: d3_time_parseWeekdayAbbrev, + A: d3_time_parseWeekday, + b: d3_time_parseMonthAbbrev, + B: d3_time_parseMonth, + c: d3_time_parseLocaleFull, + d: d3_time_parseDay, + e: d3_time_parseDay, + H: d3_time_parseHour24, + I: d3_time_parseHour12, + // j: function(d, s, i) { /*TODO day of year [001,366] */ return i; }, + L: d3_time_parseMilliseconds, + m: d3_time_parseMonthNumber, + M: d3_time_parseMinutes, + p: d3_time_parseAmPm, + S: d3_time_parseSeconds, + // U: function(d, s, i) { /*TODO week number (sunday) [00,53] */ return i; }, + // w: function(d, s, i) { /*TODO weekday [0,6] */ return i; }, + // W: function(d, s, i) { /*TODO week number (monday) [00,53] */ return i; }, + x: d3_time_parseLocaleDate, + X: d3_time_parseLocaleTime, + y: d3_time_parseYear, + Y: d3_time_parseFullYear + // , + // Z: function(d, s, i) { /*TODO time zone */ return i; }, + // "%": function(d, s, i) { /*TODO literal % */ return i; } +}; + +// Note: weekday is validated, but does not set the date. +function d3_time_parseWeekdayAbbrev(date, string, i) { + return string.substring(i, i += 3).toLowerCase() in d3_time_weekdayAbbrevLookup ? i : -1; +} + +var d3_time_weekdayAbbrevLookup = { + sun: 3, + mon: 3, + tue: 3, + wed: 3, + thu: 3, + fri: 3, + sat: 3 +}; + +// Note: weekday is validated, but does not set the date. +function d3_time_parseWeekday(date, string, i) { + d3_time_weekdayRe.lastIndex = 0; + var n = d3_time_weekdayRe.exec(string.substring(i, i + 10)); + return n ? i += n[0].length : -1; +} + +var d3_time_weekdayRe = /^(?:Sunday|Monday|Tuesday|Wednesday|Thursday|Friday|Saturday)/ig; + +var d3_time_weekdays = [ + "Sunday", + "Monday", + "Tuesday", + "Wednesday", + "Thursday", + "Friday", + "Saturday" +]; + +function d3_time_parseMonthAbbrev(date, string, i) { + var n = d3_time_monthAbbrevLookup[string.substring(i, i += 3).toLowerCase()]; + return n == null ? -1 : (date.setMonth(n), i); +} + +var d3_time_monthAbbrevLookup = { + jan: 0, + feb: 1, + mar: 2, + apr: 3, + may: 4, + jun: 5, + jul: 6, + aug: 7, + sep: 8, + oct: 9, + nov: 10, + dec: 11 +}; + +function d3_time_parseMonth(date, string, i) { + d3_time_monthRe.lastIndex = 0; + var n = d3_time_monthRe.exec(string.substring(i, i + 12)); + return n ? (date.setMonth(d3_time_monthLookup[n[0].toLowerCase()]), i += n[0].length) : -1; +} + +var d3_time_monthRe = /^(?:January|February|March|April|May|June|July|August|September|October|November|December)/ig; + +var d3_time_monthLookup = { + january: 0, + february: 1, + march: 2, + april: 3, + may: 4, + june: 5, + july: 6, + august: 7, + september: 8, + october: 9, + november: 10, + december: 11 +}; + +var d3_time_months = [ + "January", + "February", + "March", + "April", + "May", + "June", + "July", + "August", + "September", + "October", + "November", + "December" +]; + +function d3_time_parseLocaleFull(date, string, i) { + return d3_time_parse(date, d3_time_formats.c.toString(), string, i); +} + +function d3_time_parseLocaleDate(date, string, i) { + return d3_time_parse(date, d3_time_formats.x.toString(), string, i); +} + +function d3_time_parseLocaleTime(date, string, i) { + return d3_time_parse(date, d3_time_formats.X.toString(), string, i); +} + +function d3_time_parseFullYear(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 4)); + return n ? (date.setFullYear(n[0]), i += n[0].length) : -1; +} + +function d3_time_parseYear(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.setFullYear(d3_time_century() + +n[0]), i += n[0].length) : -1; +} + +function d3_time_century() { + return ~~(new Date().getFullYear() / 1000) * 1000; +} + +function d3_time_parseMonthNumber(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.setMonth(n[0] - 1), i += n[0].length) : -1; +} + +function d3_time_parseDay(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.setDate(+n[0]), i += n[0].length) : -1; +} + +// Note: we don't validate that the hour is in the range [0,23]. +function d3_time_parseHour24(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.setHours(+n[0]), i += n[0].length) : -1; +} + +// Note: we don't validate that the hour is in the range [1,12]. +function d3_time_parseHour12(date, string, i) { + date.hour12 = true; + return d3_time_parseHour24(date, string, i); +} + +function d3_time_parseMinutes(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.setMinutes(+n[0]), i += n[0].length) : -1; +} + +function d3_time_parseSeconds(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.setSeconds(+n[0]), i += n[0].length) : -1; +} + +function d3_time_parseMilliseconds(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 3)); + return n ? (date.setMilliseconds(+n[0]), i += n[0].length) : -1; +} + +// Note: we don't look at the next directive. +var d3_time_numberRe = /\s*\d+/; + +function d3_time_parseAmPm(date, string, i) { + var n = d3_time_amPmLookup[string.substring(i, i += 2).toLowerCase()]; + return n == null ? -1 : (date.hour12pm = n, i); +} + +var d3_time_amPmLookup = { + am: 0, + pm: 1 +}; + +function d3_time_year(d) { + return new d3_time(d.getFullYear(), 0, 1); +} + +function d3_time_daysElapsed(d0, d1) { + return ~~((d1 - d0) / 864e5 - (d1.getTimezoneOffset() - d0.getTimezoneOffset()) / 1440); +} + +function d3_time_dayOfYear(d) { + return d3_time_zfill3(1 + d3_time_daysElapsed(d3_time_year(d), d)); +} + +function d3_time_weekNumberSunday(d) { + var d0 = d3_time_year(d); + return d3_time_zfill2(~~((d3_time_daysElapsed(d0, d) + d0.getDay()) / 7)); +} + +function d3_time_weekNumberMonday(d) { + var d0 = d3_time_year(d); + return d3_time_zfill2(~~((d3_time_daysElapsed(d0, d) + (d0.getDay() + 6) % 7) / 7)); +} + +// TODO table of time zone offset names? +function d3_time_zone(d) { + var z = d.getTimezoneOffset(), + zs = z > 0 ? "-" : "+", + zh = ~~(Math.abs(z) / 60), + zm = Math.abs(z) % 60; + return zs + d3_time_zfill2(zh) + d3_time_zfill2(zm); +} +d3.time.format.utc = function(template) { + var local = d3.time.format(template); + + function format(date) { + try { + d3_time = d3_time_format_utc; + var utc = new d3_time(); + utc._ = date; + return local(utc); + } finally { + d3_time = Date; + } + } + + format.parse = function(string) { + try { + d3_time = d3_time_format_utc; + var date = local.parse(string); + return date && date._; + } finally { + d3_time = Date; + } + }; + + format.toString = local.toString; + + return format; +}; + +function d3_time_format_utc() { + this._ = new Date(Date.UTC.apply(this, arguments)); +} + +d3_time_format_utc.prototype = { + getDate: function() { return this._.getUTCDate(); }, + getDay: function() { return this._.getUTCDay(); }, + getFullYear: function() { return this._.getUTCFullYear(); }, + getHours: function() { return this._.getUTCHours(); }, + getMilliseconds: function() { return this._.getUTCMilliseconds(); }, + getMinutes: function() { return this._.getUTCMinutes(); }, + getMonth: function() { return this._.getUTCMonth(); }, + getSeconds: function() { return this._.getUTCSeconds(); }, + getTimezoneOffset: function() { return 0; }, + valueOf: function() { return this._.getTime(); }, + setDate: function(x) { this._.setUTCDate(x); }, + setDay: function(x) { this._.setUTCDay(x); }, + setFullYear: function(x) { this._.setUTCFullYear(x); }, + setHours: function(x) { this._.setUTCHours(x); }, + setMilliseconds: function(x) { this._.setUTCMilliseconds(x); }, + setMinutes: function(x) { this._.setUTCMinutes(x); }, + setMonth: function(x) { this._.setUTCMonth(x); }, + setSeconds: function(x) { this._.setUTCSeconds(x); } +}; +var d3_time_formatIso = d3.time.format.utc("%Y-%m-%dT%H:%M:%S.%LZ"); + +d3.time.format.iso = Date.prototype.toISOString ? d3_time_formatIsoNative : d3_time_formatIso; + +function d3_time_formatIsoNative(date) { + return date.toISOString(); +} + +d3_time_formatIsoNative.parse = function(string) { + return new Date(string); +}; + +d3_time_formatIsoNative.toString = d3_time_formatIso.toString; +function d3_time_range(floor, step, number) { + return function(t0, t1, dt) { + var time = floor(t0), times = []; + if (time < t0) step(time); + if (dt > 1) { + while (time < t1) { + var date = new Date(+time); + if (!(number(date) % dt)) times.push(date); + step(time); + } + } else { + while (time < t1) times.push(new Date(+time)), step(time); + } + return times; + }; +} +d3.time.second = function(date) { + return new Date(~~(date / 1e3) * 1e3); +}; + +d3.time.second.utc = d3.time.second; +d3.time.seconds = d3_time_range(d3.time.second, function(date) { + date.setTime(date.getTime() + 1e3); +}, function(date) { + return date.getSeconds(); +}); + +d3.time.seconds.utc = d3.time.seconds; +d3.time.minute = function(date) { + return new Date(~~(date / 6e4) * 6e4); +}; + +d3.time.minute.utc = d3.time.minute;d3.time.minutes = d3_time_range(d3.time.minute, d3_time_minutesStep, function(date) { + return date.getMinutes(); +}); + +d3.time.minutes.utc = d3_time_range(d3.time.minute, d3_time_minutesStep, function(date) { + return date.getUTCMinutes(); +}); + +function d3_time_minutesStep(date) { + date.setTime(date.getTime() + 6e4); // assumes no leap seconds +} +d3.time.hour = function(date) { + var offset = date.getTimezoneOffset() / 60; + return new Date((~~(date / 36e5 - offset) + offset) * 36e5); +}; + +d3.time.hour.utc = function(date) { + return new Date(~~(date / 36e5) * 36e5); +}; +d3.time.hours = d3_time_range(d3.time.hour, d3_time_hoursStep, function(date) { + return date.getHours(); +}); + +d3.time.hours.utc = d3_time_range(d3.time.hour.utc, d3_time_hoursStep, function(date) { + return date.getUTCHours(); +}); + +function d3_time_hoursStep(date) { + date.setTime(date.getTime() + 36e5); +} +d3.time.day = function(date) { + return new Date(date.getFullYear(), date.getMonth(), date.getDate()); +}; + +d3.time.day.utc = function(date) { + return new Date(~~(date / 864e5) * 864e5); +}; +d3.time.days = d3_time_range(d3.time.day, function(date) { + date.setDate(date.getDate() + 1); +}, function(date) { + return date.getDate() - 1; +}); + +d3.time.days.utc = d3_time_range(d3.time.day.utc, function(date) { + date.setUTCDate(date.getUTCDate() + 1); +}, function(date) { + return date.getUTCDate() - 1; +}); +d3.time.week = function(date) { + (date = d3.time.day(date)).setDate(date.getDate() - date.getDay()); + return date; +}; + +d3.time.week.utc = function(date) { + (date = d3.time.day.utc(date)).setUTCDate(date.getUTCDate() - date.getUTCDay()); + return date; +}; +d3.time.weeks = d3_time_range(d3.time.week, function(date) { + date.setDate(date.getDate() + 7); +}, function(date) { + return ~~((date - new Date(date.getFullYear(), 0, 1)) / 6048e5); +}); + +d3.time.weeks.utc = d3_time_range(d3.time.week.utc, function(date) { + date.setUTCDate(date.getUTCDate() + 7); +}, function(date) { + return ~~((date - Date.UTC(date.getUTCFullYear(), 0, 1)) / 6048e5); +}); +d3.time.month = function(date) { + return new Date(date.getFullYear(), date.getMonth(), 1); +}; + +d3.time.month.utc = function(date) { + return new Date(Date.UTC(date.getUTCFullYear(), date.getUTCMonth(), 1)); +}; +d3.time.months = d3_time_range(d3.time.month, function(date) { + date.setMonth(date.getMonth() + 1); +}, function(date) { + return date.getMonth(); +}); + +d3.time.months.utc = d3_time_range(d3.time.month.utc, function(date) { + date.setUTCMonth(date.getUTCMonth() + 1); +}, function(date) { + return date.getUTCMonth(); +}); +d3.time.year = function(date) { + return new Date(date.getFullYear(), 0, 1); +}; + +d3.time.year.utc = function(date) { + return new Date(Date.UTC(date.getUTCFullYear(), 0, 1)); +}; +d3.time.years = d3_time_range(d3.time.year, function(date) { + date.setFullYear(date.getFullYear() + 1); +}, function(date) { + return date.getFullYear(); +}); + +d3.time.years.utc = d3_time_range(d3.time.year.utc, function(date) { + date.setUTCFullYear(date.getUTCFullYear() + 1); +}, function(date) { + return date.getUTCFullYear(); +}); +// TODO nice +function d3_time_scale(linear, methods, format) { + + function scale(x) { + return linear(x); + } + + scale.invert = function(x) { + return d3_time_scaleDate(linear.invert(x)); + }; + + scale.domain = function(x) { + if (!arguments.length) return linear.domain().map(d3_time_scaleDate); + linear.domain(x); + return scale; + }; + + scale.ticks = function(m, k) { + var extent = d3_time_scaleExtent(scale.domain()); + if (typeof m !== "function") { + var span = extent[1] - extent[0], + target = span / m, + i = d3.bisect(d3_time_scaleSteps, target, 1, d3_time_scaleSteps.length - 1); + if (Math.log(target / d3_time_scaleSteps[i - 1]) < Math.log(d3_time_scaleSteps[i] / target)) --i; + m = methods[i]; + k = m[1]; + m = m[0]; + } + return m(extent[0], extent[1], k); + }; + + scale.tickFormat = function() { + return format; + }; + + scale.copy = function() { + return d3_time_scale(linear.copy(), methods, format); + }; + + // TOOD expose d3_scale_linear_rebind? + return d3.rebind(scale, linear, "range", "rangeRound", "interpolate", "clamp"); +} + +// TODO expose d3_scaleExtent? +function d3_time_scaleExtent(domain) { + var start = domain[0], stop = domain[domain.length - 1]; + return start < stop ? [start, stop] : [stop, start]; +} + +function d3_time_scaleDate(t) { + return new Date(t); +} + +function d3_time_scaleFormat(formats) { + return function(date) { + var i = formats.length - 1, f = formats[i]; + while (!f[1](date)) f = formats[--i]; + return f[0](date); + }; +} + +var d3_time_scaleSteps = [ + 1e3, // 1-second + 5e3, // 5-second + 15e3, // 15-second + 3e4, // 30-second + 6e4, // 1-minute + 3e5, // 5-minute + 9e5, // 15-minute + 18e5, // 30-minute + 36e5, // 1-hour + 108e5, // 3-hour + 216e5, // 6-hour + 432e5, // 12-hour + 864e5, // 1-day + 1728e5, // 2-day + 6048e5, // 1-week + 1728e6, // 1-month + 7776e6, // 3-month + 31536e6 // 1-year +]; + +var d3_time_scaleLocalMethods = [ + [d3.time.seconds, 1], + [d3.time.seconds, 5], + [d3.time.seconds, 15], + [d3.time.seconds, 30], + [d3.time.minutes, 1], + [d3.time.minutes, 5], + [d3.time.minutes, 15], + [d3.time.minutes, 30], + [d3.time.hours, 1], + [d3.time.hours, 3], + [d3.time.hours, 6], + [d3.time.hours, 12], + [d3.time.days, 1], + [d3.time.days, 2], + [d3.time.weeks, 1], + [d3.time.months, 1], + [d3.time.months, 3], + [d3.time.years, 1] +]; + +var d3_time_scaleLocalFormats = [ + [d3.time.format("%Y"), function(d) { return true; }], + [d3.time.format("%B"), function(d) { return d.getMonth(); }], + [d3.time.format("%b %d"), function(d) { return d.getDate() != 1; }], + [d3.time.format("%a %d"), function(d) { return d.getDay() && d.getDate() != 1; }], + [d3.time.format("%I %p"), function(d) { return d.getHours(); }], + [d3.time.format("%I:%M"), function(d) { return d.getMinutes(); }], + [d3.time.format(":%S"), function(d) { return d.getSeconds() || d.getMilliseconds(); }] +]; + +var d3_time_scaleLocalFormat = d3_time_scaleFormat(d3_time_scaleLocalFormats); + +d3.time.scale = function() { + return d3_time_scale(d3.scale.linear(), d3_time_scaleLocalMethods, d3_time_scaleLocalFormat); +}; +var d3_time_scaleUTCMethods = [ + [d3.time.seconds.utc, 1], + [d3.time.seconds.utc, 5], + [d3.time.seconds.utc, 15], + [d3.time.seconds.utc, 30], + [d3.time.minutes.utc, 1], + [d3.time.minutes.utc, 5], + [d3.time.minutes.utc, 15], + [d3.time.minutes.utc, 30], + [d3.time.hours.utc, 1], + [d3.time.hours.utc, 3], + [d3.time.hours.utc, 6], + [d3.time.hours.utc, 12], + [d3.time.days.utc, 1], + [d3.time.days.utc, 2], + [d3.time.weeks.utc, 1], + [d3.time.months.utc, 1], + [d3.time.months.utc, 3], + [d3.time.years.utc, 1] +]; + +var d3_time_scaleUTCFormats = [ + [d3.time.format.utc("%Y"), function(d) { return true; }], + [d3.time.format.utc("%B"), function(d) { return d.getUTCMonth(); }], + [d3.time.format.utc("%b %d"), function(d) { return d.getUTCDate() != 1; }], + [d3.time.format.utc("%a %d"), function(d) { return d.getUTCDay() && d.getUTCDate() != 1; }], + [d3.time.format.utc("%I %p"), function(d) { return d.getUTCHours(); }], + [d3.time.format.utc("%I:%M"), function(d) { return d.getUTCMinutes(); }], + [d3.time.format.utc(":%S"), function(d) { return d.getUTCSeconds() || d.getUTCMilliseconds(); }] +]; + +var d3_time_scaleUTCFormat = d3_time_scaleFormat(d3_time_scaleUTCFormats); + +d3.time.scale.utc = function() { + return d3_time_scale(d3.scale.linear(), d3_time_scaleUTCMethods, d3_time_scaleUTCFormat); +}; +})(); diff --git a/gstudio/static/gstudio/js/d3.time.min.js b/gstudio/static/gstudio/js/d3.time.min.js new file mode 100644 index 0000000..387a50c --- /dev/null +++ b/gstudio/static/gstudio/js/d3.time.min.js @@ -0,0 +1 @@ +(function(){function b(a,b,c,d){var e,f,g=0,i=b.length,j=c.length;while(g<i){if(d>=j)return-1;e=b.charCodeAt(g++);if(e==37){f=h[b.charAt(g++)];if(!f||(d=f(a,c,d))<0)return-1}else if(e!=c.charCodeAt(d++))return-1}return d}function i(a,b,c){return b.substring(c,c+=3).toLowerCase()in j?c:-1}function k(a,b,c){l.lastIndex=0;var d=l.exec(b.substring(c,c+10));return d?c+=d[0].length:-1}function n(a,b,c){var d=o[b.substring(c,c+=3).toLowerCase()];return d==null?-1:(a.setMonth(d),c)}function p(a,b,c){q.lastIndex=0;var d=q.exec(b.substring(c,c+12));return d?(a.setMonth(r[d[0].toLowerCase()]),c+=d[0].length):-1}function t(a,c,d){return b(a,g.c.toString(),c,d)}function u(a,c,d){return b(a,g.x.toString(),c,d)}function v(a,c,d){return b(a,g.X.toString(),c,d)}function w(a,b,c){G.lastIndex=0;var d=G.exec(b.substring(c,c+4));return d?(a.setFullYear(d[0]),c+=d[0].length):-1}function x(a,b,c){G.lastIndex=0;var d=G.exec(b.substring(c,c+2));return d?(a.setFullYear(y()+ +d[0]),c+=d[0].length):-1}function y(){return~~((new Date).getFullYear()/1e3)*1e3}function z(a,b,c){G.lastIndex=0;var d=G.exec(b.substring(c,c+2));return d?(a.setMonth(d[0]-1),c+=d[0].length):-1}function A(a,b,c){G.lastIndex=0;var d=G.exec(b.substring(c,c+2));return d?(a.setDate(+d[0]),c+=d[0].length):-1}function B(a,b,c){G.lastIndex=0;var d=G.exec(b.substring(c,c+2));return d?(a.setHours(+d[0]),c+=d[0].length):-1}function C(a,b,c){return a.hour12=!0,B(a,b,c)}function D(a,b,c){G.lastIndex=0;var d=G.exec(b.substring(c,c+2));return d?(a.setMinutes(+d[0]),c+=d[0].length):-1}function E(a,b,c){G.lastIndex=0;var d=G.exec(b.substring(c,c+2));return d?(a.setSeconds(+d[0]),c+=d[0].length):-1}function F(a,b,c){G.lastIndex=0;var d=G.exec(b.substring(c,c+3));return d?(a.setMilliseconds(+d[0]),c+=d[0].length):-1}function H(a,b,c){var d=I[b.substring(c,c+=2).toLowerCase()];return d==null?-1:(a.hour12pm=d,c)}function J(b){return new a(b.getFullYear(),0,1)}function K(a,b){return~~((b-a)/864e5-(b.getTimezoneOffset()-a.getTimezoneOffset())/1440)}function L(a){return d(1+K(J(a),a))}function M(a){var b=J(a);return c(~~((K(b,a)+b.getDay())/7))}function N(a){var b=J(a);return c(~~((K(b,a)+(b.getDay()+6)%7)/7))}function O(a){var b=a.getTimezoneOffset(),d=b>0?"-":"+",e=~~(Math.abs(b)/60),f=Math.abs(b)%60;return d+c(e)+c(f)}function P(){this._=new Date(Date.UTC.apply(this,arguments))}function R(a){return a.toISOString()}function S(a,b,c){return function(d,e,f){var g=a(d),h=[];g<d&&b(g);if(f>1)while(g<e){var i=new Date(+g);c(i)%f||h.push(i),b(g)}else while(g<e)h.push(new Date(+g)),b(g);return h}}function T(a){a.setTime(a.getTime()+6e4)}function U(a){a.setTime(a.getTime()+36e5)}function V(a,b,c){function d(b){return a(b)}return d.invert=function(b){return X(a.invert(b))},d.domain=function(b){return arguments.length?(a.domain(b),d):a.domain().map(X)},d.ticks=function(a,c){var e=W(d.domain());if(typeof a!="function"){var f=e[1]-e[0],g=f/a,h=d3.bisect(Z,g,1,Z.length-1);Math.log(g/Z[h-1])<Math.log(Z[h]/g)&&--h,a=b[h],c=a[1],a=a[0]}return a(e[0],e[1],c)},d.tickFormat=function(){return c},d.copy=function(){return V(a.copy(),b,c)},d3.rebind(d,a,"range","rangeRound","interpolate","clamp")}function W(a){var b=a[0],c=a[a.length-1];return b<c?[b,c]:[c,b]}function X(a){return new Date(a)}function Y(a){return function(b){var c=a.length-1,d=a[c];while(!d[1](b))d=a[--c];return d[0](b)}}d3.time={};var a=Date;d3.time.format=function(c){function e(a){var b=[],e=-1,f=0,h,i;while(++e<d)c.charCodeAt(e)==37&&(b.push(c.substring(f,e),(i=g[h=c.charAt(++e)])?i(a):h),f=e+1);return b.push(c.substring(f,e)),b.join("")}var d=c.length;return e.parse=function(d){var e=new a(1900,0,1),f=b(e,c,d,0);if(f!=d.length)return null;if(e.hour12){var g=e.getHours()%12;e.setHours(e.hour12pm?g+12:g)}return delete e.hour12,delete e.hour12pm,e},e.toString=function(){return c},e};var c=d3.format("02d"),d=d3.format("03d"),e=d3.format("04d"),f=d3.format("2d"),g={a:function(a){return m[a.getDay()].substring(0,3)},A:function(a){return m[a.getDay()]},b:function(a){return s[a.getMonth()].substring(0,3)},B:function(a){return s[a.getMonth()]},c:d3.time.format("%a %b %e %H:%M:%S %Y"),d:function(a){return c(a.getDate())},e:function(a){return f(a.getDate())},H:function(a){return c(a.getHours())},I:function(a){return c(a.getHours()%12||12)},j:L,L:function(a){return d(a.getMilliseconds())},m:function(a){return c(a.getMonth()+1)},M:function(a){return c(a.getMinutes())},p:function(a){return a.getHours()>=12?"PM":"AM"},S:function(a){return c(a.getSeconds())},U:M,w:function(a){return a.getDay()},W:N,x:d3.time.format("%m/%d/%y"),X:d3.time.format("%H:%M:%S"),y:function(a){return c(a.getFullYear()%100)},Y:function(a){return e(a.getFullYear()%1e4)},Z:O,"%":function(a){return"%"}},h={a:i,A:k,b:n,B:p,c:t,d:A,e:A,H:B,I:C,L:F,m:z,M:D,p:H,S:E,x:u,X:v,y:x,Y:w},j={sun:3,mon:3,tue:3,wed:3,thu:3,fri:3,sat:3},l=/^(?:Sunday|Monday|Tuesday|Wednesday|Thursday|Friday|Saturday)/ig,m=["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],o={jan:0,feb:1,mar:2,apr:3,may:4,jun:5,jul:6,aug:7,sep:8,oct:9,nov:10,dec:11},q=/^(?:January|February|March|April|May|June|July|August|September|October|November|December)/ig,r={january:0,february:1,march:2,april:3,may:4,june:5,july:6,august:7,september:8,october:9,november:10,december:11},s=["January","February","March","April","May","June","July","August","September","October","November","December"],G=/\s*\d+/,I={am:0,pm:1};d3.time.format.utc=function(b){function d(b){try{a=P;var d=new a;return d._=b,c(d)}finally{a=Date}}var c=d3.time.format(b);return d.parse=function(b){try{a=P;var d=c.parse(b);return d&&d._}finally{a=Date}},d.toString=c.toString,d},P.prototype={getDate:function(){return this._.getUTCDate()},getDay:function(){return this._.getUTCDay()},getFullYear:function(){return this._.getUTCFullYear()},getHours:function(){return this._.getUTCHours()},getMilliseconds:function(){return this._.getUTCMilliseconds()},getMinutes:function(){return this._.getUTCMinutes()},getMonth:function(){return this._.getUTCMonth()},getSeconds:function(){return this._.getUTCSeconds()},getTimezoneOffset:function(){return 0},valueOf:function(){return this._.getTime()},setDate:function(a){this._.setUTCDate(a)},setDay:function(a){this._.setUTCDay(a)},setFullYear:function(a){this._.setUTCFullYear(a)},setHours:function(a){this._.setUTCHours(a)},setMilliseconds:function(a){this._.setUTCMilliseconds(a)},setMinutes:function(a){this._.setUTCMinutes(a)},setMonth:function(a){this._.setUTCMonth(a)},setSeconds:function(a){this._.setUTCSeconds(a)}};var Q=d3.time.format.utc("%Y-%m-%dT%H:%M:%S.%LZ");d3.time.format.iso=Date.prototype.toISOString?R:Q,R.parse=function(a){return new Date(a)},R.toString=Q.toString,d3.time.second=function(a){return new Date(~~(a/1e3)*1e3)},d3.time.second.utc=d3.time.second,d3.time.seconds=S(d3.time.second,function(a){a.setTime(a.getTime()+1e3)},function(a){return a.getSeconds()}),d3.time.seconds.utc=d3.time.seconds,d3.time.minute=function(a){return new Date(~~(a/6e4)*6e4)},d3.time.minute.utc=d3.time.minute,d3.time.minutes=S(d3.time.minute,T,function(a){return a.getMinutes()}),d3.time.minutes.utc=S(d3.time.minute,T,function(a){return a.getUTCMinutes()}),d3.time.hour=function(a){var b=a.getTimezoneOffset()/60;return new Date((~~(a/36e5-b)+b)*36e5)},d3.time.hour.utc=function(a){return new Date(~~(a/36e5)*36e5)},d3.time.hours=S(d3.time.hour,U,function(a){return a.getHours()}),d3.time.hours.utc=S(d3.time.hour.utc,U,function(a){return a.getUTCHours()}),d3.time.day=function(a){return new Date(a.getFullYear(),a.getMonth(),a.getDate())},d3.time.day.utc=function(a){return new Date(~~(a/864e5)*864e5)},d3.time.days=S(d3.time.day,function(a){a.setDate(a.getDate()+1)},function(a){return a.getDate()-1}),d3.time.days.utc=S(d3.time.day.utc,function(a){a.setUTCDate(a.getUTCDate()+1)},function(a){return a.getUTCDate()-1}),d3.time.week=function(a){return(a=d3.time.day(a)).setDate(a.getDate()-a.getDay()),a},d3.time.week.utc=function(a){return(a=d3.time.day.utc(a)).setUTCDate(a.getUTCDate()-a.getUTCDay()),a},d3.time.weeks=S(d3.time.week,function(a){a.setDate(a.getDate()+7)},function(a){return~~((a-new Date(a.getFullYear(),0,1))/6048e5)}),d3.time.weeks.utc=S(d3.time.week.utc,function(a){a.setUTCDate(a.getUTCDate()+7)},function(a){return~~((a-Date.UTC(a.getUTCFullYear(),0,1))/6048e5)}),d3.time.month=function(a){return new Date(a.getFullYear(),a.getMonth(),1)},d3.time.month.utc=function(a){return new Date(Date.UTC(a.getUTCFullYear(),a.getUTCMonth(),1))},d3.time.months=S(d3.time.month,function(a){a.setMonth(a.getMonth()+1)},function(a){return a.getMonth()}),d3.time.months.utc=S(d3.time.month.utc,function(a){a.setUTCMonth(a.getUTCMonth()+1)},function(a){return a.getUTCMonth()}),d3.time.year=function(a){return new Date(a.getFullYear(),0,1)},d3.time.year.utc=function(a){return new Date(Date.UTC(a.getUTCFullYear(),0,1))},d3.time.years=S(d3.time.year,function(a){a.setFullYear(a.getFullYear()+1)},function(a){return a.getFullYear()}),d3.time.years.utc=S(d3.time.year.utc,function(a){a.setUTCFullYear(a.getUTCFullYear()+1)},function(a){return a.getUTCFullYear()});var Z=[1e3,5e3,15e3,3e4,6e4,3e5,9e5,18e5,36e5,108e5,216e5,432e5,864e5,1728e5,6048e5,1728e6,7776e6,31536e6],$=[[d3.time.seconds,1],[d3.time.seconds,5],[d3.time.seconds,15],[d3.time.seconds,30],[d3.time.minutes,1],[d3.time.minutes,5],[d3.time.minutes,15],[d3.time.minutes,30],[d3.time.hours,1],[d3.time.hours,3],[d3.time.hours,6],[d3.time.hours,12],[d3.time.days,1],[d3.time.days,2],[d3.time.weeks,1],[d3.time.months,1],[d3.time.months,3],[d3.time.years,1]],_=[[d3.time.format("%Y"),function(a){return!0}],[d3.time.format("%B"),function(a){return a.getMonth()}],[d3.time.format("%b %d"),function(a){return a.getDate()!=1}],[d3.time.format("%a %d"),function(a){return a.getDay()&&a.getDate()!=1}],[d3.time.format("%I %p"),function(a){return a.getHours()}],[d3.time.format("%I:%M"),function(a){return a.getMinutes()}],[d3.time.format(":%S"),function(a){return a.getSeconds()||a.getMilliseconds()}]],ba=Y(_);d3.time.scale=function(){return V(d3.scale.linear(),$,ba)};var bb=[[d3.time.seconds.utc,1],[d3.time.seconds.utc,5],[d3.time.seconds.utc,15],[d3.time.seconds.utc,30],[d3.time.minutes.utc,1],[d3.time.minutes.utc,5],[d3.time.minutes.utc,15],[d3.time.minutes.utc,30],[d3.time.hours.utc,1],[d3.time.hours.utc,3],[d3.time.hours.utc,6],[d3.time.hours.utc,12],[d3.time.days.utc,1],[d3.time.days.utc,2],[d3.time.weeks.utc,1],[d3.time.months.utc,1],[d3.time.months.utc,3],[d3.time.years.utc,1]],bc=[[d3.time.format.utc("%Y"),function(a){return!0}],[d3.time.format.utc("%B"),function(a){return a.getUTCMonth()}],[d3.time.format.utc("%b %d"),function(a){return a.getUTCDate()!=1}],[d3.time.format.utc("%a %d"),function(a){return a.getUTCDay()&&a.getUTCDate()!=1}],[d3.time.format.utc("%I %p"),function(a){return a.getUTCHours()}],[d3.time.format.utc("%I:%M"),function(a){return a.getUTCMinutes()}],[d3.time.format.utc(":%S"),function(a){return a.getUTCSeconds()||a.getUTCMilliseconds()}]],bd=Y(bc);d3.time.scale.utc=function(){return V(d3.scale.linear(),bb,bd)}})();
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/egonet.json b/gstudio/static/gstudio/js/egonet.json new file mode 100644 index 0000000..27277a3 --- /dev/null +++ b/gstudio/static/gstudio/js/egonet.json @@ -0,0 +1,1666 @@ + {"follows": + [{"from":189087228, "to":8910992, "reciprocated":false}, + {"from":189087228, "to":10900412, "reciprocated":false}, + {"from":189087228, "to":13773232, "reciprocated":true}, + {"from":189087228, "to":16345873, "reciprocated":false}, + {"from":189087228, "to":16469978, "reciprocated":true}, + {"from":189087228, "to":17023762, "reciprocated":false}, + {"from":189087228, "to":17784346, "reciprocated":false}, + {"from":189087228, "to":18684157, "reciprocated":true}, + {"from":189087228, "to":19185849, "reciprocated":true}, + {"from":189087228, "to":19337079, "reciprocated":false}, + {"from":189087228, "to":19368326, "reciprocated":false}, + {"from":189087228, "to":19397172, "reciprocated":false}, + {"from":189087228, "to":19532509, "reciprocated":false}, + {"from":189087228, "to":19600064, "reciprocated":true}, + {"from":189087228, "to":19603042, "reciprocated":true}, + {"from":189087228, "to":19645267, "reciprocated":false}, + {"from":189087228, "to":19909207, "reciprocated":false}, + {"from":189087228, "to":20160673, "reciprocated":true}, + {"from":189087228, "to":20224126, "reciprocated":false}, + {"from":189087228, "to":21305960, "reciprocated":false}, + {"from":189087228, "to":21389079, "reciprocated":false}, + {"from":189087228, "to":21487384, "reciprocated":false}, + {"from":189087228, "to":21996235, "reciprocated":false}, + {"from":189087228, "to":22644877, "reciprocated":false}, + {"from":189087228, "to":22845401, "reciprocated":false}, + {"from":189087228, "to":23095072, "reciprocated":true}, + {"from":189087228, "to":24894570, "reciprocated":true}, + {"from":189087228, "to":25051012, "reciprocated":false}, + {"from":189087228, "to":25498891, "reciprocated":false}, + {"from":189087228, "to":26463542, "reciprocated":false}, + {"from":189087228, "to":27881243, "reciprocated":true}, + {"from":189087228, "to":34647948, "reciprocated":false}, + {"from":189087228, "to":34670493, "reciprocated":false}, + {"from":189087228, "to":39548147, "reciprocated":false}, + {"from":189087228, "to":41121344, "reciprocated":false}, + {"from":189087228, "to":41600546, "reciprocated":false}, + {"from":189087228, "to":44141829, "reciprocated":false}, + {"from":189087228, "to":45876960, "reciprocated":false}, + {"from":189087228, "to":52437557, "reciprocated":false}, + {"from":189087228, "to":53355611, "reciprocated":true}, + {"from":189087228, "to":55299403, "reciprocated":true}, + {"from":189087228, "to":58441079, "reciprocated":false}, + {"from":189087228, "to":65604105, "reciprocated":false}, + {"from":189087228, "to":72532264, "reciprocated":false}, + {"from":189087228, "to":76030185, "reciprocated":true}, + {"from":189087228, "to":80595484, "reciprocated":false}, + {"from":189087228, "to":81805825, "reciprocated":false}, + {"from":189087228, "to":87732913, "reciprocated":true}, + {"from":189087228, "to":89923671, "reciprocated":false}, + {"from":189087228, "to":90668561, "reciprocated":true}, + {"from":189087228, "to":91096410, "reciprocated":true}, + {"from":189087228, "to":92590714, "reciprocated":false}, + {"from":189087228, "to":95668712, "reciprocated":true}, + {"from":189087228, "to":102117784, "reciprocated":false}, + {"from":189087228, "to":114811890, "reciprocated":true}, + {"from":189087228, "to":117463781, "reciprocated":false}, + {"from":189087228, "to":118738344, "reciprocated":false}, + {"from":189087228, "to":119377322, "reciprocated":false}, + {"from":189087228, "to":121154835, "reciprocated":true}, + {"from":189087228, "to":124136910, "reciprocated":false}, + {"from":189087228, "to":125988502, "reciprocated":false}, + {"from":189087228, "to":137593665, "reciprocated":true}, + {"from":189087228, "to":145717740, "reciprocated":true}, + {"from":189087228, "to":147899791, "reciprocated":true}, + {"from":189087228, "to":168709838, "reciprocated":false}, + {"from":189087228, "to":171841885, "reciprocated":false}, + {"from":189087228, "to":179024836, "reciprocated":false}, + {"from":189087228, "to":187589516, "reciprocated":false}, + {"from":189087228, "to":194090195, "reciprocated":true}, + {"from":189087228, "to":213777599, "reciprocated":false}, + {"from":189087228, "to":214128115, "reciprocated":false}, + {"from":189087228, "to":265924188, "reciprocated":true}], + "is_followed_by": + [{"from":13773232, "to":189087228, "reciprocated":true}, + {"from":15074749, "to":189087228, "reciprocated":false}, + {"from":16469978, "to":189087228, "reciprocated":true}, + {"from":16870211, "to":189087228, "reciprocated":false}, + {"from":18510305, "to":189087228, "reciprocated":false}, + {"from":18684157, "to":189087228, "reciprocated":true}, + {"from":19185849, "to":189087228, "reciprocated":true}, + {"from":19600064, "to":189087228, "reciprocated":true}, + {"from":19603042, "to":189087228, "reciprocated":true}, + {"from":19761627, "to":189087228, "reciprocated":false}, + {"from":20160673, "to":189087228, "reciprocated":true}, + {"from":20821862, "to":189087228, "reciprocated":false}, + {"from":23095072, "to":189087228, "reciprocated":true}, + {"from":24894570, "to":189087228, "reciprocated":true}, + {"from":27881243, "to":189087228, "reciprocated":true}, + {"from":28316188, "to":189087228, "reciprocated":false}, + {"from":38422315, "to":189087228, "reciprocated":false}, + {"from":46690889, "to":189087228, "reciprocated":false}, + {"from":53355611, "to":189087228, "reciprocated":true}, + {"from":55299403, "to":189087228, "reciprocated":true}, + {"from":76030185, "to":189087228, "reciprocated":true}, + {"from":87732913, "to":189087228, "reciprocated":true}, + {"from":90668561, "to":189087228, "reciprocated":true}, + {"from":91096410, "to":189087228, "reciprocated":true}, + {"from":95668712, "to":189087228, "reciprocated":true}, + {"from":104474762, "to":189087228, "reciprocated":false}, + {"from":114811890, "to":189087228, "reciprocated":true}, + {"from":121154835, "to":189087228, "reciprocated":true}, + {"from":137593665, "to":189087228, "reciprocated":true}, + {"from":140093607, "to":189087228, "reciprocated":false}, + {"from":145717740, "to":189087228, "reciprocated":true}, + {"from":147899791, "to":189087228, "reciprocated":true}, + {"from":188058388, "to":189087228, "reciprocated":false}, + {"from":194090195, "to":189087228, "reciprocated":true}, + {"from":202101504, "to":189087228, "reciprocated":false}, + {"from":265924188, "to":189087228, "reciprocated":true}, + {"from":284446250, "to":189087228, "reciprocated":false}, + {"from":293471631, "to":189087228, "reciprocated":false}], + "mentions": + [{"from":189087228, "to":284446250, "count":3}, + {"from":189087228, "to":16469978, "count":21}, + {"from":189087228, "to":16870211, "count":2}, + {"from":189087228, "to":17779808, "count":1}, + {"from":189087228, "to":18684157, "count":6}, + {"from":189087228, "to":19397172, "count":1}, + {"from":189087228, "to":19603042, "count":1}, + {"from":189087228, "to":20821862, "count":1}, + {"from":189087228, "to":23095072, "count":13}, + {"from":189087228, "to":95668712, "count":5}, + {"from":189087228, "to":109563679, "count":2}, + {"from":189087228, "to":145717740, "count":9}, + {"from":189087228, "to":147899791, "count":3}, + {"from":189087228, "to":24894570, "count":5}, + {"from":189087228, "to":27881243, "count":5}, + {"from":189087228, "to":38422315, "count":2}, + {"from":189087228, "to":55299403, "count":1}, + {"from":189087228, "to":72532264, "count":2}], + "is_mentioned_by": + [{"from":16469978, "to":189087228, "count":16}, + {"from":16870211, "to":189087228, "count":4}, + {"from":17779808, "to":189087228, "count":1}, + {"from":18684157, "to":189087228, "count":1}, + {"from":19397172, "to":189087228, "count":1}, + {"from":19603042, "to":189087228, "count":1}, + {"from":20821862, "to":189087228, "count":4}, + {"from":23095072, "to":189087228, "count":5}, + {"from":95668712, "to":189087228, "count":3}, + {"from":109563679, "to":189087228, "count":1}, + {"from":145717740, "to":189087228, "count":1}, + {"from":147899791, "to":189087228, "count":1}, + {"from":24894570, "to":189087228, "count":1}, + {"from":27881243, "to":189087228, "count":5}, + {"from":38422315, "to":189087228, "count":1}, + {"from":55299403, "to":189087228, "count":1}, + {"from":72532264, "to":189087228, "count":6}, + {"from":284446250, "to":189087228, "count":5}], + "node_metadata": + [{"rank":8, + "follower_count":23, + "longitude":-0.0762234, + "name":"Albion London", + "postcode":"E1 6JJ", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"19909207", + "employee_count":null, + "latitude":51.524127, + "_id":"19909207", + "web_url":"http:\/\/www.albionlondon.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1260314698\/Albion_Twitter_logo_normal.jpg", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/1260314698\/Albion_Twitter_logo_normal.jpg", + "screen_name":"albionlondon"}, + {"rank":80, + "follower_count":2, + "longitude":-0.081349, + "name":"Radley Yeldar", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"39548147", + "employee_count":null, + "latitude":51.525373, + "_id":"39548147", + "web_url":"http:\/\/www.ry.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1022617685\/ry_symbol_K_master_normal.jpg", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1022617685\/ry_symbol_K_master_normal.jpg", + "screen_name":"RadleyYeldar"}, + {"rank":1, + "follower_count":38, + "longitude":-0.0762234, + "name":"Glue Isobar", + "postcode":"E1 6JJ", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"21996235", + "employee_count":null, + "latitude":51.524127, + "_id":"21996235", + "web_url":"http:\/\/www.glueisobar.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1111529009\/glue-avatar_normal.gif", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/1111529009\/glue-avatar_normal.gif", + "screen_name":"glueisobar"}, + {"rank":80, + "follower_count":2, + "longitude":-0.081117, + "name":"Inition", + "postcode":"EC2A 3LT", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"27881243", + "employee_count":null, + "latitude":51.5225975, + "_id":"27881243", + "web_url":"http:\/\/www.inition.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1338466579\/LOGO-ForUsageInSquareSpace_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/1338466579\/LOGO-ForUsageInSquareSpace_normal.jpg", + "screen_name":"Inition"}, + {"rank":39, + "follower_count":4, + "longitude":-0.0858669, + "name":"Thin Martian", + "postcode":"EC2A 4AW", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"19185849", + "employee_count":null, + "latitude":51.5255167, + "_id":"19185849", + "web_url":"http:\/\/www.thinmartian.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1369659488\/tm_logo_normal.jpg", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1369659488\/tm_logo_normal.jpg", + "screen_name":"thinmartian"}, + {"rank":119, + "follower_count":1, + "longitude":-0.11383, + "name":"Interactive Web Solutions Ltd", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"214128115", + "employee_count":null, + "latitude":51.531952, + "_id":"214128115", + "web_url":"http:\/\/www.iwebsolutions.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1399828151\/Untitled-3_normal.png", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1399828151\/Untitled-3_normal.png", + "screen_name":"iwebtweets"}, + {"rank":50, + "follower_count":3, + "longitude":-0.0811414, + "name":"Sitelynx", + "postcode":"EC2A 3PE", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"72532264", + "employee_count":null, + "latitude":51.5264737, + "_id":"72532264", + "web_url":"http:\/\/www.sitelynx.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1031953955\/fa9c1ef3-2404-4da2-b5c2-255556dfb1a7_normal.gif", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1031953955\/fa9c1ef3-2404-4da2-b5c2-255556dfb1a7_normal.gif", + "screen_name":"sitelynx"}, + {"rank":119, + "follower_count":1, + "longitude":-0.07851, + "name":"Fresh 01", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"22644877", + "employee_count":null, + "latitude":51.52637, + "_id":"22644877", + "web_url":"http:\/\/www.fresh01.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1180034164\/f_normal.gif", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/1180034164\/f_normal.gif", + "screen_name":"Fresh_01"}, + {"rank":50, + "follower_count":3, + "longitude":-0.088483, + "name":"Neue Media Limited", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"52437557", + "employee_count":null, + "latitude":51.528169, + "_id":"52437557", + "web_url":"http:\/\/neue-media.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/416477239\/default_profile_normal_copy_normal_normal.png", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/416477239\/default_profile_normal_copy_normal_normal.png", + "screen_name":"Neue_Media"}, + {"rank":119, + "follower_count":1, + "longitude":-0.09836, + "name":"The Pomegranate Group Ltd", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"17784346", + "employee_count":null, + "latitude":51.522962, + "_id":"17784346", + "web_url":"http:\/\/www.pomegranate.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1301967134\/Pome-Twitter-1_normal.jpg", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/1301967134\/Pome-Twitter-1_normal.jpg", + "screen_name":"Pomegranate_exp"}, + {"rank":119, + "follower_count":1, + "longitude":-0.079528, + "name":"2Cs Communications Ltd", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"119377322", + "employee_count":null, + "latitude":51.51761, + "_id":"119377322", + "web_url":"http:\/\/www.2cs.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/729718232\/2Cs_Logo_normal.jpg", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/729718232\/2Cs_Logo_normal.jpg", + "screen_name":"2CsGroup"}, + {"rank":80, + "follower_count":2, + "longitude":-0.103497, + "name":"Zard Creative Ltd", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"21305960", + "employee_count":null, + "latitude":51.523872, + "_id":"21305960", + "web_url":"http:\/\/www.zardcreative.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1277842361\/image_normal.jpg", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/1277842361\/image_normal.jpg", + "screen_name":"themightyzard"}, + {"rank":80, + "follower_count":2, + "longitude":-0.106868, + "name":"Catalysis", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"19600064", + "employee_count":null, + "latitude":51.524268, + "_id":"19600064", + "web_url":"http:\/\/www.catalysis.co.uk", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1272273199\/icon_normal.jpg", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1272273199\/icon_normal.jpg", + "screen_name":"Catalysis_Comms"}, + {"rank":119, + "follower_count":1, + "longitude":-0.080079, + "name":"Impero Design", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"121154835", + "employee_count":null, + "latitude":51.526764, + "_id":"121154835", + "web_url":"http:\/\/www.imperodesign.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1140103878\/Profile_Picture_of_WeAreImpero_normal.jpg", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/1140103878\/Profile_Picture_of_WeAreImpero_normal.jpg", + "screen_name":"WeAreImpero"}, + {"rank":27, + "follower_count":6, + "longitude":-0.098969, + "name":"Skills Matter", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"16345873", + "employee_count":null, + "latitude":51.52459, + "_id":"16345873", + "web_url":"http:\/\/www.skillsmatter.com", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/91904867\/skills-matter-twitter_normal.jpg", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/91904867\/skills-matter-twitter_normal.jpg", + "screen_name":"skillsmatter"}, + {"rank":119, + "follower_count":1, + "longitude":-0.094248, + "name":"Sherry Design", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"124136910", + "employee_count":null, + "latitude":51.526843, + "_id":"124136910", + "web_url":"http:\/\/www.sherrydesign.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1213767000\/sherry-icon-animated_normal.gif", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/1213767000\/sherry-icon-animated_normal.gif", + "screen_name":"sherry_design"}, + {"rank":119, + "follower_count":1, + "longitude":-0.108137, + "name":"Momentum London", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"87732913", + "employee_count":null, + "latitude":51.527382, + "_id":"87732913", + "web_url":"http:\/\/www.momentumww.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/749013137\/Twitter_normal.jpg", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/749013137\/Twitter_normal.jpg", + "screen_name":"MomentumWWide"}, + {"rank":80, + "follower_count":2, + "longitude":-0.101011, + "name":"Kitcatt Nohr Alexander Shaw Ltd", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"117463781", + "employee_count":null, + "latitude":51.521251, + "_id":"117463781", + "web_url":"http:\/\/www.kitcattnohr.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1304557196\/knd-logo-symbol_for_social_media_normal.jpg", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1304557196\/knd-logo-symbol_for_social_media_normal.jpg", + "screen_name":"kitcattnohr"}, + {"rank":27, + "follower_count":6, + "longitude":-0.072685, + "name":"Guided Ltd", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"89923671", + "employee_count":null, + "latitude":51.51854, + "_id":"89923671", + "web_url":"http:\/\/www.guidedcollective.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/755793638\/Guided_Creds_PPT_v2_normal.jpg", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/755793638\/Guided_Creds_PPT_v2_normal.jpg", + "screen_name":"_Guided_"}, + {"rank":119, + "follower_count":1, + "longitude":-0.108073, + "name":"Miniclip", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"19397172", + "employee_count":null, + "latitude":51.520241, + "_id":"19397172", + "web_url":"http:\/\/miniclip.com", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/446967006\/mc_twitterlogo_trans32_normal.png", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/446967006\/mc_twitterlogo_trans32_normal.png", + "screen_name":"MiniclipGames"}, + {"rank":27, + "follower_count":6, + "longitude":-0.0722893, + "name":"Unruly Media", + "postcode":"E1 6QL", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"16469978", + "employee_count":null, + "latitude":51.5217063, + "_id":"16469978", + "web_url":"http:\/\/www.unrulymedia.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1360900637\/UnrulyLogoProfilePic_normal.jpg", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1360900637\/UnrulyLogoProfilePic_normal.jpg", + "screen_name":"unrulymedia"}, + {"rank":119, + "follower_count":1, + "longitude":-0.09112, + "name":"Headshot London Photography", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"44141829", + "employee_count":null, + "latitude":51.517169, + "_id":"44141829", + "web_url":"http:\/\/www.headshotlondon.co.uk", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1363570301\/Square_Logo_-_NEW_gradientVS-png_normal.png", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/1363570301\/Square_Logo_-_NEW_gradientVS-png_normal.png", + "screen_name":"headshotlondon"}, + {"rank":50, + "follower_count":3, + "longitude":-0.081994, + "name":"VET", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"53355611", + "employee_count":null, + "latitude":51.527515, + "_id":"53355611", + "web_url":"http:\/\/www.vet.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/295297749\/VetLogo_blue_on_white_normal.jpg", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/295297749\/VetLogo_blue_on_white_normal.jpg", + "screen_name":"VEThoxton"}, + {"rank":119, + "follower_count":1, + "longitude":-0.106868, + "name":"Social (Uk)", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"171841885", + "employee_count":null, + "latitude":51.524268, + "_id":"171841885", + "web_url":"http:\/\/www.welcometosocial.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1118321543\/Social_Twitter_Logo_normal.jpg", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1118321543\/Social_Twitter_Logo_normal.jpg", + "screen_name":"welcometosocial"}, + {"rank":11, + "follower_count":17, + "longitude":-0.0762234, + "name":"Mother", + "postcode":"E2 7DD", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"145717740", + "employee_count":null, + "latitude":51.524127, + "_id":"145717740", + "web_url":"http:\/\/www.motherlondon.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1415556673\/Mum_for_Jane_003_-_web_normal.JPG", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1415556673\/Mum_for_Jane_003_-_web_normal.JPG", + "screen_name":"motherlondon"}, + {"rank":80, + "follower_count":2, + "longitude":-0.108065, + "name":"Purple Creative", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"92590714", + "employee_count":null, + "latitude":51.522867, + "_id":"92590714", + "web_url":"http:\/\/www.purplecreative.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/543755256\/purplelogo_twit_normal.jpg", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/543755256\/purplelogo_twit_normal.jpg", + "screen_name":"purple_creative"}, + {"rank":27, + "follower_count":6, + "longitude":-0.076197, + "name":"BD Network", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"20224126", + "employee_count":null, + "latitude":51.524129, + "_id":"20224126", + "web_url":"http:\/\/thisisbd.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/75966079\/BD-Badge_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/75966079\/BD-Badge_normal.jpg", + "screen_name":"thisisbd"}, + {"rank":119, + "follower_count":1, + "longitude":-0.009725, + "name":"Minx Creative", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"20160673", + "employee_count":null, + "latitude":51.518838, + "_id":"20160673", + "web_url":"http:\/\/www.minxcreative.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1110431168\/Minx_Creative_Logo_bigger_normal.jpg", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1110431168\/Minx_Creative_Logo_bigger_normal.jpg", + "screen_name":"MinxCreative"}, + {"rank":27, + "follower_count":6, + "longitude":-0.0806713, + "name":"Hijack Media", + "postcode":"EC2A 3QL", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"125988502", + "employee_count":null, + "latitude":51.52668180000001, + "_id":"125988502", + "web_url":"http:\/\/www.hijackmedia.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/772379104\/hijacksticker_normal.png", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/772379104\/hijacksticker_normal.png", + "screen_name":"HijackMedia"}, + {"rank":80, + "follower_count":2, + "longitude":-0.096872, + "name":"Underwired UK Ltd", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"19645267", + "employee_count":null, + "latitude":51.53755, + "_id":"19645267", + "web_url":"http:\/\/www.underwired.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/835079806\/icon1_normal.png", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/835079806\/icon1_normal.png", + "screen_name":"underwired"}, + {"rank":3, + "follower_count":30, + "longitude":-0.103262, + "name":"R\/Ga", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"17023762", + "employee_count":null, + "latitude":51.523275, + "_id":"17023762", + "web_url":"http:\/\/www.rga.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/129044572\/RedSquare_normal.gif", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/129044572\/RedSquare_normal.gif", + "screen_name":"RGA"}, + {"rank":80, + "follower_count":2, + "longitude":-0.101413, + "name":"Shift Media", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"26463542", + "employee_count":null, + "latitude":51.52025, + "_id":"26463542", + "web_url":"http:\/\/www.shift-media.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1105763376\/jade_arrow_normal.png", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/1105763376\/jade_arrow_normal.png", + "screen_name":"ShiftLearning"}, + {"rank":80, + "follower_count":2, + "longitude":-0.09272509999999999, + "name":"Media With Impact", + "postcode":"EC1V 3QT", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"102117784", + "employee_count":null, + "latitude":51.5259522, + "_id":"102117784", + "web_url":"http:\/\/www.mediawithimpact.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/611957795\/blacklogo_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/611957795\/blacklogo_normal.jpg", + "screen_name":"mwinews"}, + {"rank":119, + "follower_count":1, + "longitude":-0.079783, + "name":"Digital Health Service", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"19368326", + "employee_count":null, + "latitude":51.53175, + "_id":"19368326", + "web_url":"www.digitalhealthservice.com", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1010472555\/dhs_logo_normal.jpg", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/1010472555\/dhs_logo_normal.jpg", + "screen_name":"digitalhealth"}, + {"rank":119, + "follower_count":1, + "longitude":-0.073824, + "name":"Romabravo", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"41121344", + "employee_count":null, + "latitude":51.534908, + "_id":"41121344", + "web_url":"http:\/\/www.romabravo.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/218908632\/avatar_normal.jpg", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/218908632\/avatar_normal.jpg", + "screen_name":"romabravo"}, + {"rank":50, + "follower_count":3, + "longitude":-0.109852, + "name":"The Think Tank", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"91096410", + "employee_count":null, + "latitude":51.521834, + "_id":"91096410", + "web_url":"http:\/\/www.thinktank.org.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/671330546\/TwitterPic_normal.jpg", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/671330546\/TwitterPic_normal.jpg", + "screen_name":"thinktanklondon"}, + {"rank":119, + "follower_count":1, + "longitude":-0.103878, + "name":"The Brand Bucket Company", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"19337079", + "employee_count":null, + "latitude":51.521279, + "_id":"19337079", + "web_url":"http:\/\/www.thebrandbucketcompany.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/724007617\/brandbucketfranchise185_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/724007617\/brandbucketfranchise185_normal.jpg", + "screen_name":"thebrandbucket"}, + {"rank":80, + "follower_count":2, + "longitude":-0.0782042, + "name":"DN Digital", + "postcode":"E2 8AA", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"25498891", + "employee_count":null, + "latitude":51.5284399, + "_id":"25498891", + "web_url":"http:\/\/www.dndigital.net\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/980449715\/transparent_justlogo_normal.png", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/980449715\/transparent_justlogo_normal.png", + "screen_name":"dndigital"}, + {"rank":119, + "follower_count":1, + "longitude":-0.080663, + "name":"Visual Eyes Media Ltd", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"179024836", + "employee_count":null, + "latitude":51.525919, + "_id":"179024836", + "web_url":"http:\/\/www.visual-eyes-media.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1104100532\/Twitter_normal.jpg", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/1104100532\/Twitter_normal.jpg", + "screen_name":"VisualEyesMedia"}, + {"rank":5, + "follower_count":28, + "longitude":-0.0715103, + "name":"Lost Boys international", + "postcode":"E1 6RU", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"24894570", + "employee_count":null, + "latitude":51.5217205, + "_id":"24894570", + "web_url":"http:\/\/www.lbi.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1078914095\/big_london_normal.jpg", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/1078914095\/big_london_normal.jpg", + "screen_name":"LBiLondon"}, + {"rank":119, + "follower_count":1, + "longitude":-0.100533, + "name":"YARG Limited", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"90668561", + "employee_count":null, + "latitude":51.524076, + "_id":"90668561", + "web_url":"http:\/\/www.yarg.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/979742771\/YARG_Twitter_Banner72x72_normal.png", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/979742771\/YARG_Twitter_Banner72x72_normal.png", + "screen_name":"YARGLTD"}, + {"rank":119, + "follower_count":1, + "longitude":-0.0762234, + "name":"Balloon Dog", + "postcode":"E1 6JJ", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"104474762", + "employee_count":null, + "latitude":51.524127, + "_id":"104474762", + "web_url":"http:\/\/www.balloondog.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1220838294\/bd_poses_twitter_normal.jpg", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1220838294\/bd_poses_twitter_normal.jpg", + "screen_name":"balloon_dog"}, + {"rank":7, + "follower_count":24, + "longitude":-0.081422, + "name":"Moving Brands Limited", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"10900412", + "employee_count":null, + "latitude":51.526363, + "_id":"10900412", + "web_url":"http:\/\/www.movingbrands.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1208456909\/MB-Symbol-100px_normal.jpg", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/1208456909\/MB-Symbol-100px_normal.jpg", + "screen_name":"movingbrands"}, + {"rank":23, + "follower_count":7, + "longitude":-0.080847, + "name":"Caffeinehit", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"8910992", + "employee_count":null, + "latitude":51.526003, + "_id":"8910992", + "web_url":"http:\/\/www.caffeinehit.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1312241553\/me_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/1312241553\/me_normal.jpg", + "screen_name":"caffeinehit"}, + {"rank":27, + "follower_count":6, + "longitude":-0.0764021, + "name":"Less Rain", + "postcode":"E2 7JP", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"147899791", + "employee_count":null, + "latitude":51.526387, + "_id":"147899791", + "web_url":"http:\/\/www.lessrain.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1366992228\/avatar_lessrain4_normal", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/1366992228\/avatar_lessrain4_normal", + "screen_name":"LessRainLondon"}, + {"rank":119, + "follower_count":1, + "longitude":-0.085773, + "name":"Giraffe", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"168709838", + "employee_count":null, + "latitude":51.517154, + "_id":"168709838", + "web_url":"http:\/\/www.giraffeads.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1096165810\/twitter_logo_normal.png", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/1096165810\/twitter_logo_normal.png", + "screen_name":"ngicreative"}, + {"rank":119, + "follower_count":1, + "longitude":-0.053282, + "name":"MINIBAR", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"114811890", + "employee_count":null, + "latitude":51.528714, + "_id":"114811890", + "web_url":"http:\/\/www.openbusiness.cc\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/790160600\/6a00d83451e50a69e200e54f27ddc88834-800wi_normal.gif", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/790160600\/6a00d83451e50a69e200e54f27ddc88834-800wi_normal.gif", + "screen_name":"MiniBarlondon"}, + {"rank":27, + "follower_count":6, + "longitude":-0.0782042, + "name":"PlayGen", + "postcode":"E2 8AA", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"23095072", + "employee_count":null, + "latitude":51.5284399, + "_id":"23095072", + "web_url":"http:\/\/www.playgen.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1135052200\/kam-star_normal.png", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/1135052200\/kam-star_normal.png", + "screen_name":"playgen"}, + {"rank":119, + "follower_count":1, + "longitude":-0.094451, + "name":"Open Destinations Ltd", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"194090195", + "employee_count":null, + "latitude":51.530955, + "_id":"194090195", + "web_url":"http:\/\/www.opendestinations.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1225306415\/OD_letters_normal.JPG", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1225306415\/OD_letters_normal.JPG", + "screen_name":"OpenDestination"}, + {"rank":119, + "follower_count":1, + "longitude":-0.067476, + "name":"Elixir Media Consultant Ltd", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"213777599", + "employee_count":null, + "latitude":51.518661, + "_id":"213777599", + "web_url":"http:\/\/www.elixirmedia.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/sticky\/default_profile_images\/default_profile_0_normal.png", + "profile_image_url": + "http:\/\/a3.twimg.com\/sticky\/default_profile_images\/default_profile_0_normal.png", + "screen_name":"elixirmediacons"}, + {"rank":80, + "follower_count":2, + "longitude":-0.070651, + "name":"I Want Design", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"34647948", + "employee_count":null, + "latitude":51.519262, + "_id":"34647948", + "web_url":"http:\/\/www.iwantdesign.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1299576190\/bird_normal.png", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1299576190\/bird_normal.png", + "screen_name":"IWANTdesign"}, + {"rank":80, + "follower_count":2, + "longitude":-0.081812, + "name":"Stuff Multichannel Ltd.", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"45876960", + "employee_count":null, + "latitude":51.526361, + "_id":"45876960", + "web_url":"http:\/\/www.stuffmultichannel.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1285234665\/Stuff50_normal.gif", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/1285234665\/Stuff50_normal.gif", + "screen_name":"StuffMulti"}, + {"rank":15, + "follower_count":10, + "longitude":-0.09111459999999999, + "name":"Preloaded", + "postcode":"N1 7JQ", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"13773232", + "employee_count":null, + "latitude":51.5299906, + "_id":"13773232", + "web_url":"http:\/\/www.preloaded.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/613949415\/icon_p_normal.gif", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/613949415\/icon_p_normal.gif", + "screen_name":"Preloaded"}, + {"rank":23, + "follower_count":7, + "longitude":-0.06925, + "name":"(Untitled) Digital Agency", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"21487384", + "employee_count":null, + "latitude":51.515588, + "_id":"21487384", + "web_url":"http:\/\/www.untitledlondon.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/907278551\/f38e0fb4-7f95-418a-8969-aec4c7edb49a_normal.png", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/907278551\/f38e0fb4-7f95-418a-8969-aec4c7edb49a_normal.png", + "screen_name":"untitledlondon"}, + {"rank":119, + "follower_count":1, + "longitude":-0.097619, + "name":"Vibrant Media Ltd", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"22845401", + "employee_count":null, + "latitude":51.519622, + "_id":"22845401", + "web_url":"http:\/\/www.vibrantmedia.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/351384617\/vibrant_icon_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/351384617\/vibrant_icon_normal.jpg", + "screen_name":"VibrantMedia"}, + {"rank":119, + "follower_count":1, + "longitude":-0.103796, + "name":"EHS 4D Group", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"34670493", + "employee_count":null, + "latitude":51.52153, + "_id":"34670493", + "web_url":"http:\/\/www.ehsbrann.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/891021684\/EHS_Star_normal.JPG", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/891021684\/EHS_Star_normal.JPG", + "screen_name":"4dgroup"}, + {"rank":20, + "follower_count":8, + "longitude":-0.076197, + "name":"specialmoves", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"41600546", + "employee_count":null, + "latitude":51.524129, + "_id":"41600546", + "web_url":"http:\/\/specialmoves.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/316308162\/sm-twitter_normal.png", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/316308162\/sm-twitter_normal.png", + "screen_name":"specialmoves"}, + {"rank":80, + "follower_count":2, + "longitude":-0.076125, + "name":"What a Sunday", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"118738344", + "employee_count":null, + "latitude":51.528911, + "_id":"118738344", + "web_url":"http:\/\/www.whatasunday.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/872922202\/Me_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/872922202\/Me_normal.jpg", + "screen_name":"WDADComms"}, + {"rank":50, + "follower_count":3, + "longitude":-0.067775, + "name":"N1 Creative Ltd", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"21389079", + "employee_count":null, + "latitude":51.510591, + "_id":"21389079", + "web_url":"http:\/\/www.n1creative.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1230855752\/n1_normal.png", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/1230855752\/n1_normal.png", + "screen_name":"n1creative"}, + {"rank":119, + "follower_count":1, + "longitude":-0.072984, + "name":"Hyponik", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"81805825", + "employee_count":null, + "latitude":51.526144, + "_id":"81805825", + "web_url":"http:\/\/www.hyponik.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1300880423\/hyp_white_2__normal.jpg", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1300880423\/hyp_white_2__normal.jpg", + "screen_name":"Hyponik"}, + {"rank":119, + "follower_count":1, + "longitude":-0.076677, + "name":"Orpheus Studio", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"80595484", + "employee_count":null, + "latitude":51.535647, + "_id":"80595484", + "web_url":"http:\/\/www.orpheusstudio.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1173007732\/Orpheus_Logo_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/1173007732\/Orpheus_Logo_normal.jpg", + "screen_name":"orpheusstudio"}, + {"rank":20, + "follower_count":8, + "longitude":-0.0744205, + "name":"Digit", + "postcode":"E1 6NN", + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"19532509", + "employee_count":null, + "latitude":51.5207342, + "_id":"19532509", + "web_url":"http:\/\/www.digitlondon.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/73246455\/D2_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/73246455\/D2_normal.jpg", + "screen_name":"digitlondon"}, + {"rank":39, + "follower_count":4, + "longitude":-0.076197, + "name":"The Domain Group", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"76030185", + "employee_count":null, + "latitude":51.524129, + "_id":"76030185", + "web_url":"http:\/\/www.domain-london.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/427391554\/Domain_logo_normal.jpg", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/427391554\/Domain_logo_normal.jpg", + "screen_name":"DomainLondon"}, + {"rank":191, + "follower_count":0, + "longitude":-0.08364869999999999, + "name":"33 Seconds", + "postcode":"EC2A 4NE", + "updated_at":"2011-08-02 19:48:24.696135", + "sector":null, + "twitter_id":"293471631", + "employee_count":null, + "latitude":51.52547149999999, + "_id":"293471631", + "web_url":"http:\/\/33seconds.co\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1339785974\/33Seconds-circle_only_normal.jpg", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1339785974\/33Seconds-circle_only_normal.jpg", + "screen_name":"33SecondsAgency"}, + {"rank":119, + "follower_count":1, + "longitude":-0.0879852, + "name":"Latitude Digital Marketing", + "postcode":"EC1Y 2BP", + "updated_at":"2011-08-02 19:51:16.81984", + "sector":null, + "twitter_id":"16870211", + "employee_count":null, + "latitude":51.5251916, + "_id":"16870211", + "web_url":"http:\/\/www.latitudegroup.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1246983504\/Copy_of_latitude_logo_din_copy_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/1246983504\/Copy_of_latitude_logo_din_copy_normal.jpg", + "screen_name":"Latitude_Group"}, + {"rank":80, + "follower_count":2, + "longitude":-0.08364869999999999, + "name":"Gramafilm", + "postcode":"EC2A 4NE", + "updated_at":"2011-08-02 19:51:16.81984", + "sector":null, + "twitter_id":"18510305", + "employee_count":null, + "latitude":51.52547149999999, + "_id":"18510305", + "web_url":"http:\/\/www.gramafilm.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/200171084\/GramalogoTransparent_normal.png", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/200171084\/GramalogoTransparent_normal.png", + "screen_name":"Gramafilm"}, + {"rank":8, + "follower_count":23, + "longitude":-0.0818134, + "name":"BERG", + "postcode":"EC2A 4RQ", + "updated_at":"2011-08-02 19:51:16.81984", + "sector":null, + "twitter_id":"58441079", + "employee_count":null, + "latitude":51.5228337, + "_id":"58441079", + "web_url":"http:\/\/berglondon.com", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/362357729\/BERG_57px_rough_normal.png", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/362357729\/BERG_57px_rough_normal.png", + "screen_name":"BERGLONDON"}, + {"rank":80, + "follower_count":2, + "longitude":-0.081117, + "name":"Holition", + "postcode":"EC2A 3LT", + "updated_at":"2011-08-02 19:51:16.81984", + "sector":null, + "twitter_id":"95668712", + "employee_count":null, + "latitude":51.5225975, + "_id":"95668712", + "web_url":"http:\/\/www.holition.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/788054545\/Holition_icon_normal.png", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/788054545\/Holition_icon_normal.png", + "screen_name":"Holition"}, + {"rank":18, + "follower_count":9, + "longitude":-0.0785365, + "name":"Brass", + "postcode":"EC2A 3AY", + "updated_at":"2011-08-02 19:51:16.81984", + "sector":null, + "twitter_id":"109563679", + "employee_count":null, + "latitude":51.5263681, + "_id":"109563679", + "web_url":"http:\/\/www.brassagency.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1072344365\/b_logo94x94_normal.jpg", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/1072344365\/b_logo94x94_normal.jpg", + "screen_name":"BrassAgency"}, + {"rank":80, + "follower_count":2, + "longitude":-0.0799966, + "name":"Inensu", + "postcode":"N1 6NG", + "updated_at":"2011-08-02 19:51:16.81984", + "sector":null, + "twitter_id":"137593665", + "employee_count":null, + "latitude":51.5276419, + "_id":"137593665", + "web_url":"http:\/\/www.inensu.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/950054402\/Home_images_0005_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/950054402\/Home_images_0005_normal.jpg", + "screen_name":"inensu"}, + {"rank":191, + "follower_count":0, + "longitude":-0.0836296, + "name":"Dub", + "postcode":"EC2A 4RU", + "updated_at":"2011-08-02 19:51:16.81984", + "sector":null, + "twitter_id":"140093607", + "employee_count":null, + "latitude":51.5231781, + "_id":"140093607", + "web_url":"http:\/\/www.dubstudios.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/872781372\/Dub_logo_twitter_normal.png", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/872781372\/Dub_logo_twitter_normal.png", + "screen_name":"dub_research"}, + {"rank":191, + "follower_count":0, + "longitude":-0.0846702, + "name":"Credcomms", + "postcode":"EC2A 4JU", + "updated_at":"2011-08-02 19:51:16.81984", + "sector":null, + "twitter_id":"202101504", + "employee_count":null, + "latitude":51.52311419999999, + "_id":"202101504", + "web_url":"http:\/\/www.credcomms.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1237501160\/Credcomms_circle_green_normal.png", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/1237501160\/Credcomms_circle_green_normal.png", + "screen_name":"Credcomms"}, + {"rank":119, + "follower_count":1, + "longitude":-0.08120279999999999, + "name":"BuonGiorno", + "postcode":"EC2A 4PF", + "updated_at":"2011-08-02 19:51:16.81984", + "sector":null, + "twitter_id":"265924188", + "employee_count":null, + "latitude":51.523642, + "_id":"265924188", + "web_url":"http:\/\/www.buongiorno.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1272449944\/Picture2_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/1272449944\/Picture2_normal.jpg", + "screen_name":"AnnPRBuongiorno"}, + {"rank":39, + "follower_count":4, + "longitude":-0.07999880000000001, + "name":"Made In Me", + "postcode":"EC2A 3BA", + "updated_at":"2011-08-02 19:51:16.81984", + "sector":null, + "twitter_id":"284446250", + "employee_count":null, + "latitude":51.52656289999999, + "_id":"284446250", + "web_url":"http:\/\/www.madeinme.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1316966165\/twitter_normal.jpg", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/1316966165\/twitter_normal.jpg", + "screen_name":"the_landofme"}, + {"rank":80, + "follower_count":2, + "longitude":-0.07799529999999999, + "name":"Monorex", + "postcode":"EC2A 3PQ", + "updated_at":"2011-08-02 19:51:16.833368", + "sector":null, + "twitter_id":"28316188", + "employee_count":null, + "latitude":51.5234726, + "_id":"28316188", + "web_url":"http:\/\/www.monorex.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1337122495\/M_Monorex_normal.jpg", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/1337122495\/M_Monorex_normal.jpg", + "screen_name":"monorex"}, + {"rank":191, + "follower_count":0, + "longitude":-0.0834128, + "name":"Red Leader", + "postcode":"EC2A 4RX", + "updated_at":"2011-08-03 09:04:08.614463", + "sector":null, + "twitter_id":"15074749", + "employee_count":null, + "latitude":51.52319250000001, + "_id":"15074749", + "web_url":"http:\/\/www.redleader.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1304536460\/logo-white-square_normal.jpg", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1304536460\/logo-white-square_normal.jpg", + "screen_name":"redleaderlondon"}, + {"rank":50, + "follower_count":3, + "longitude":-0.07799529999999999, + "name":"RjDj (Reality Jockey)", + "postcode":"EC2A 3PQ", + "updated_at":"2011-08-03 09:04:08.614463", + "sector":null, + "twitter_id":"17779808", + "employee_count":null, + "latitude":51.5234726, + "_id":"17779808", + "web_url":"http:\/\/www.rjdj.me\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/69994067\/rjdj_icon_512px_normal.jpg", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/69994067\/rjdj_icon_512px_normal.jpg", + "screen_name":"rjdj"}, + {"rank":50, + "follower_count":3, + "longitude":-0.0776515, + "name":"MusicMetric", + "postcode":"E1 6HP", + "updated_at":"2011-08-03 09:04:08.614463", + "sector":null, + "twitter_id":"20821862", + "employee_count":null, + "latitude":51.5244471, + "_id":"20821862", + "web_url":"http:\/\/www.musicmetric.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/332717868\/mu_icon_big_normal.png", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/332717868\/mu_icon_big_normal.png", + "screen_name":"musicmetric"}, + {"rank":50, + "follower_count":3, + "longitude":-0.0813752, + "name":"Red Ant", + "postcode":"EC2A 3PB", + "updated_at":"2011-08-03 09:04:08.614463", + "sector":null, + "twitter_id":"25051012", + "employee_count":null, + "latitude":51.5253714, + "_id":"25051012", + "web_url":"http:\/\/www.redant.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/783519348\/twitterProfilePhoto_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/783519348\/twitterProfilePhoto_normal.jpg", + "screen_name":"Red_Ant"}, + {"rank":80, + "follower_count":2, + "longitude":-0.07983319999999999, + "name":"Shiny Ideas", + "postcode":"EC1V 9AU", + "updated_at":"2011-08-03 09:04:08.614463", + "sector":null, + "twitter_id":"55299403", + "employee_count":null, + "latitude":51.5270727, + "_id":"55299403", + "web_url":"http:\/\/shinyideas.co.uk", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/313869711\/shinyicon_normal.png", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/313869711\/shinyicon_normal.png", + "screen_name":"shinyideas"}, + {"rank":18, + "follower_count":9, + "longitude":-0.1003762, + "name":"Skive", + "postcode":"EC1V 0AP", + "updated_at":"2011-08-03 09:04:08.614463", + "sector":null, + "twitter_id":"65604105", + "employee_count":null, + "latitude":51.5250062, + "_id":"65604105", + "web_url":"http:\/\/www.skive.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1167844601\/TwitterLogo_04_normal.jpg", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/1167844601\/TwitterLogo_04_normal.jpg", + "screen_name":"_skive_"}, + {"rank":80, + "follower_count":2, + "longitude":-0.0777388, + "name":"seeper", + "postcode":"N1 5AQ", + "updated_at":"2011-08-03 09:04:08.614463", + "sector":null, + "twitter_id":"187589516", + "employee_count":null, + "latitude":51.5367504, + "_id":"187589516", + "web_url":"http:\/\/www.seeper.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1134378767\/LOgo_200x200_normal.jpg", + "profile_image_url": + "http:\/\/a3.twimg.com\/profile_images\/1134378767\/LOgo_200x200_normal.jpg", + "screen_name":"seeperarts"}, + {"rank":12, + "follower_count":16, + "longitude":-0.1096771, + "name":"Stink Digital", + "postcode":"EC1R 3AD", + "updated_at":"2011-08-03 10:34:35.687744", + "sector":null, + "twitter_id":"18684157", + "employee_count":null, + "latitude":51.5238975, + "_id":"18684157", + "web_url":"http:\/\/www.stinkdigital.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1399907312\/SD_LOGO-white-square_normal.png", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/1399907312\/SD_LOGO-white-square_normal.png", + "screen_name":"stinkdigital"}, + {"rank":50, + "follower_count":3, + "longitude":-0.0764021, + "name":"The 7th Chamber", + "postcode":"E2 7JP", + "updated_at":"2011-08-03 10:34:35.687744", + "sector":null, + "twitter_id":"19761627", + "employee_count":null, + "latitude":51.526387, + "_id":"19761627", + "web_url":"http:\/\/www.the7thchamber.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1232774244\/The-7th-Chamber-Twitter-profile_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/1232774244\/The-7th-Chamber-Twitter-profile_normal.jpg", + "screen_name":"the7thchamber"}, + {"rank":50, + "follower_count":3, + "longitude":-0.08222720000000001, + "name":"Ultra Knowledge", + "postcode":"EC2A 3DQ", + "updated_at":"2011-08-03 11:00:08.151825", + "sector":null, + "twitter_id":"19603042", + "employee_count":null, + "latitude":51.5263655, + "_id":"19603042", + "web_url":"http:\/\/www.ultraknowledge.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1149457046\/128_reasonably_small_normal.png", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/1149457046\/128_reasonably_small_normal.png", + "screen_name":"ultraknowledge"}, + {"rank":191, + "follower_count":0, + "longitude":-0.0813381, + "name":"Ticket Tailor", + "postcode":"EC2A 4HH", + "updated_at":"2011-08-03 11:00:08.151825", + "sector":null, + "twitter_id":"188058388", + "employee_count":null, + "latitude":51.5231676, + "_id":"188058388", + "web_url":"http:\/\/www.tickettailor.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1119307711\/Zima_021_normal.png", + "profile_image_url": + "http:\/\/a2.twimg.com\/profile_images\/1119307711\/Zima_021_normal.png", + "screen_name":"tickettailor"}, + {"rank":27, + "follower_count":6, + "longitude":-0.0762234, + "name":"We Love Mobile", + "postcode":"E1 6JJ", + "updated_at":"2011-08-03 13:50:00.288248", + "sector":null, + "twitter_id":"38422315", + "employee_count":null, + "latitude":51.524127, + "_id":"38422315", + "web_url":"http:\/\/www.welovemobile.co.uk\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1265670673\/icon_Welovemobile_normal.jpg", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/1265670673\/icon_Welovemobile_normal.jpg", + "screen_name":"WeLoveMobile"}, + {"rank":119, + "follower_count":1, + "longitude":-0.0766862, + "name":"Unboxed Consulting", + "postcode":"E1 6BT", + "updated_at":"2011-08-03 13:50:00.288248", + "sector":null, + "twitter_id":"46690889", + "employee_count":null, + "latitude":51.5213559, + "_id":"46690889", + "web_url":"http:\/\/www.unboxedconsulting.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1319753202\/LinkedIn_Image_normal.gif", + "profile_image_url": + "http:\/\/a0.twimg.com\/profile_images\/1319753202\/LinkedIn_Image_normal.gif", + "screen_name":"Ubxd"}, + {"rank":1, + "fixed":true, + "follower_count":38, + "longitude":-0.077022, + "name":"DigitalShoreditch", + "postcode":null, + "updated_at":"2011-08-01 19:54:27.11922", + "sector":null, + "twitter_id":"189087228", + "employee_count":null, + "latitude":51.529105, + "_id":"189087228", + "web_url":"http:\/\/digitalshoreditch.com\/", + "profile_image_url_https": + "https:\/\/si0.twimg.com\/profile_images\/1144541691\/basic_normal.png", + "profile_image_url": + "http:\/\/a1.twimg.com\/profile_images\/1144541691\/basic_normal.png", + "screen_name":"DigiShoreditch"} +]} diff --git a/gstudio/static/gstudio/js/force.js b/gstudio/static/gstudio/js/force.js new file mode 100644 index 0000000..dce9739 --- /dev/null +++ b/gstudio/static/gstudio/js/force.js @@ -0,0 +1,161 @@ +var w = 960, + h = 700, + fill = d3.scale.category20(); + +var vis = d3.select("#chart") + .append("svg:svg") + .attr("width", w) + .attr("height", h); + + vis.append("svg:g").attr("class", "edges"); + vis.append("svg:g").attr("class", "nodes"); + + +$(function() { + $.ajax({ + url: '/gstudio/graphs/rgraph', + //crossDomain: true, + //dataType: 'jsonp', + success : function(json) { + + var force; + + var nodes_by_id = _.reduce(json.node_metadata, function(acc, n) { + acc[n._id] = n; + return acc; + }, {}); + + + var follows_edges = _(json.is_followed_by).chain().map(function(e) { + e.source = nodes_by_id[e.from]; + e.target = nodes_by_id[e.to]; + e.type = 'follows_edges'; + return e; + }).filter(function(e){ + return nodes_by_id[e.from] && nodes_by_id[e.to] + }).value(); + + var mentions_edges = _(json.is_mentioned_by).chain().map(function(e) { + e.source = nodes_by_id[e.from]; + e.target = nodes_by_id[e.to]; + e.type = 'mentions_edges'; + return e; + }).filter(function(e){ + return nodes_by_id[e.from] && nodes_by_id[e.to] + }).value(); + + + nodes_by_id['189087228'].x = w/2.0; + nodes_by_id['189087228'].y = h/2.0; + + var force = d3.layout.force() + .linkStrength(0.5) + .charge(-2000) + .friction(0.7) + .linkDistance(50) + .nodes([]) + .links([]) + .size([w, h]) + .start(); + + function update(edges){ + + _.each(nodes_by_id, function(n){n.added = false}); + + var nodes = _.reduce(edges, function(acc, e) { + if(nodes_by_id[e.from] && !nodes_by_id[e.from].added){ + nodes_by_id[e.from].added = true; + acc.push(nodes_by_id[e.from]); + } + if(nodes_by_id[e.to] && !nodes_by_id[e.to].added){ + nodes_by_id[e.to].added = true; + acc.push(nodes_by_id[e.to]); + } + return acc; + }, []); + + force.nodes(nodes); + force.links(edges); + force.start(); + + var link = d3.select("#chart g.edges").selectAll("line.link") + .data(edges, function(e){return e.from + "-" + e.to + "-" + e.type}); + + link.enter().append("svg:line") + .attr("class", "link") + .style("stroke-width", function(d) { + return Math.sqrt(d.value); + }) + .attr("x1", function(d) { + return d.source.x; + }) + .attr("y1", function(d) { + return d.source.y; + }) + .attr("x2", function(d) { + return d.target.x; + }) + .attr("y2", function(d) { + return d.target.y; + }); + + link.exit().remove(); + + var node = d3.select("#chart g.nodes").selectAll("g.node").data(nodes); + + var new_g = node.enter().append("svg:g") + .attr("class", "node") + .call(force.drag); + + new_g.append("svg:image").attr('xlink:href', + function(d) { + return d.profile_image_url; + }).attr('height', 32).attr('width', 32); + + new_g.append("svg:text") + .attr("dy", 46) + .attr("text-anchor", "middle") + .text(function(d) { + return d.screen_name; + }); + + node.exit().remove(); + + + force.on("tick", function() { + + var x_center = $("#chart").width() / 2; + var y_center = $("#chart").height() / 2; + + link.attr("x1", function(d) { return d.source.x; }) + .attr("y1", function(d) { return d.source.y; }) + .attr("x2", function(d) { return d.target.x; }) + .attr("y2", function(d) { return d.target.y; }); + + node.attr("transform", function(d) { return "translate(" + (d.x-16) + "," + (d.y-16) + ")"; }); + + }); + } + + update(follows_edges); + vis.style("opacity", 1e-6) + .transition() + .duration(1000) + .style("opacity", 1); + + $('input#follows').change(function(){ + update(follows_edges); + }); + + $('input#mentions').change(function(){ + update(mentions_edges); + }); + } + }); + + $("#relation_type").buttonset(); + + $('input#mentions').change(function(){console.log(this)}); + $('input#hashtags').change(function(){console.log(this)}); + +}); diff --git a/gstudio/static/gstudio/js/gstudio.js b/gstudio/static/gstudio/js/gstudio.js new file mode 100644 index 0000000..bb5c879 --- /dev/null +++ b/gstudio/static/gstudio/js/gstudio.js @@ -0,0 +1,88 @@ +$ = django.jQuery + + + $(document).ready(function() { + + $("#id_atrributetype").ajaxSend(function(e,xhr,opt){ + + + function getCookie(name) { + var cookieValue = null; + if (document.cookie && document.cookie != '') { + var cookies = document.cookie.split(';'); + for (var i = 0; i < cookies.length; i++) { + var cookie = $.trim(cookies[i]); + // Does this cookie string begin with the name we want? + if (cookie.substring(0, name.length + 1) == (name + '=')) { + cookieValue = decodeURIComponent(cookie.substring(name.length + 1)); + break; + } + } + } + return cookieValue; + } + function sameOrigin(url) { + // url could be relative or scheme relative or absolute + var host = document.location.host; // host + port + var protocol = document.location.protocol; + var sr_origin = '//' + host; + var origin = protocol + sr_origin; + // Allow absolute or scheme relative URLs to same origin + return (url == origin || url.slice(0, origin.length + 1) == origin + '/') || + (url == sr_origin || url.slice(0, sr_origin.length + 1) == sr_origin + '/') || + // or any other URL that isn't scheme relative or absolute i.e relative. + !(/^(\/\/|http:|https:).*/.test(url)); + } + function safeMethod(method) { + return (/^(GET|HEAD|OPTIONS|TRACE)$/.test(method)); + } + + if (!safeMethod(settings.type) && sameOrigin(settings.url)) { + xhr.setRequestHeader("X-CSRFToken", getCookie('csrftoken')); + } + + } + ); + + + $("#id_attributetype").change(function() { + test = $("#id_attributetype").val() + url = "/gstudio/ajax/?id=" + test + $.get(url, + function(data){ + + $("#id_subject").empty() + + for (var key in data) { + $('#id_subject').append( + $('<option></option>').val(key).html(data[key]) + ); + } + + + + + + }); + + + }); + $(function() { + $( "#id_creation_date_0" ).datepicker(); + }); + + $(function() { + $( "#id_creation_date_1" ).timepicker(); + }); + + $(function() { + $( "#id_last_update_0" ).datepicker(); + }); + + $(function() { + $( "#id_last_update_1" ).timepicker(); + }); + + + + }); diff --git a/gstudio/static/gstudio/js/gstudiojs.js b/gstudio/static/gstudio/js/gstudiojs.js new file mode 100644 index 0000000..205cd97 --- /dev/null +++ b/gstudio/static/gstudio/js/gstudiojs.js @@ -0,0 +1,55 @@ +$ = django.jQuery + + $(document).ready(function() { + + $("#id_atrributetype").ajaxSend(function(e,xhr,opt){ + + + function getCookie(name) { + var cookieValue = null; + if (document.cookie && document.cookie != '') { + var cookies = document.cookie.split(';'); + for (var i = 0; i < cookies.length; i++) { + var cookie = jQuery.trim(cookies[i]); + // Does this cookie string begin with the name we want? + if (cookie.substring(0, name.length + 1) == (name + '=')) { + cookieValue = decodeURIComponent(cookie.substring(name.length + 1)); + break; + } + } + } + return cookieValue; + } + function sameOrigin(url) { + // url could be relative or scheme relative or absolute + var host = document.location.host; // host + port + var protocol = document.location.protocol; + var sr_origin = '//' + host; + var origin = protocol + sr_origin; + // Allow absolute or scheme relative URLs to same origin + return (url == origin || url.slice(0, origin.length + 1) == origin + '/') || + (url == sr_origin || url.slice(0, sr_origin.length + 1) == sr_origin + '/') || + // or any other URL that isn't scheme relative or absolute i.e relative. + !(/^(\/\/|http:|https:).*/.test(url)); + } + function safeMethod(method) { + return (/^(GET|HEAD|OPTIONS|TRACE)$/.test(method)); + } + + if (!safeMethod(settings.type) && sameOrigin(settings.url)) { + xhr.setRequestHeader("X-CSRFToken", getCookie('csrftoken')); + } + + } + ); + + + $("#id_attributetype").change(function() { + $.get("/gstudio/ajaxurls/", { attributetype: "date_of_birth"}, + function(data){ + alert("Data Loaded: " + data); + }); + + + }); + }); diff --git a/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/GPL-LICENSE.txt b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/GPL-LICENSE.txt new file mode 100644 index 0000000..932f111 --- /dev/null +++ b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/GPL-LICENSE.txt @@ -0,0 +1,278 @@ +GNU GENERAL PUBLIC LICENSE +Version 2, June 1991 + +Copyright (C) 1989, 1991 Free Software Foundation, Inc. +51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +Everyone is permitted to copy and distribute verbatim copies +of this license document, but changing it is not allowed. + +Preamble + +The licenses for most software are designed to take away your +freedom to share and change it. By contrast, the GNU General Public +License is intended to guarantee your freedom to share and change free +software--to make sure the software is free for all its users. This +General Public License applies to most of the Free Software +Foundation's software and to any other program whose authors commit to +using it. (Some other Free Software Foundation software is covered by + the GNU Lesser General Public License instead.) You can apply it to +your programs, too. + +When we speak of free software, we are referring to freedom, not +price. Our General Public Licenses are designed to make sure that you +have the freedom to distribute copies of free software (and charge for + this service if you wish), that you receive source code or can get it +if you want it, that you can change the software or use pieces of it +in new free programs; and that you know you can do these things. + +To protect your rights, we need to make restrictions that forbid +anyone to deny you these rights or to ask you to surrender the rights. +These restrictions translate to certain responsibilities for you if you +distribute copies of the software, or if you modify it. + +For example, if you distribute copies of such a program, whether +gratis or for a fee, you must give the recipients all the rights that +you have. You must make sure that they, too, receive or can get the +source code. And you must show them these terms so they know their +rights. + +We protect your rights with two steps: (1) copyright the software, and +(2) offer you this license which gives you legal permission to copy, + distribute and/or modify the software. + + Also, for each author's protection and ours, we want to make certain + that everyone understands that there is no warranty for this free + software. If the software is modified by someone else and passed on, we + want its recipients to know that what they have is not the original, so + that any problems introduced by others will not reflect on the original + authors' reputations. + + Finally, any free program is threatened constantly by software + patents. We wish to avoid the danger that redistributors of a free + program will individually obtain patent licenses, in effect making the + program proprietary. To prevent this, we have made it clear that any + patent must be licensed for everyone's free use or not licensed at all. + + The precise terms and conditions for copying, distribution and + modification follow. + + GNU GENERAL PUBLIC LICENSE + TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION + + 0. This License applies to any program or other work which contains + a notice placed by the copyright holder saying it may be distributed + under the terms of this General Public License. The "Program", below, + refers to any such program or work, and a "work based on the Program" + means either the Program or any derivative work under copyright law: + that is to say, a work containing the Program or a portion of it, + either verbatim or with modifications and/or translated into another + language. (Hereinafter, translation is included without limitation in + the term "modification".) Each licensee is addressed as "you". + + Activities other than copying, distribution and modification are not + covered by this License; they are outside its scope. The act of + running the Program is not restricted, and the output from the Program + is covered only if its contents constitute a work based on the + Program (independent of having been made by running the Program). + Whether that is true depends on what the Program does. + + 1. You may copy and distribute verbatim copies of the Program's + source code as you receive it, in any medium, provided that you + conspicuously and appropriately publish on each copy an appropriate + copyright notice and disclaimer of warranty; keep intact all the + notices that refer to this License and to the absence of any warranty; + and give any other recipients of the Program a copy of this License + along with the Program. + + You may charge a fee for the physical act of transferring a copy, and + you may at your option offer warranty protection in exchange for a fee. + + 2. You may modify your copy or copies of the Program or any portion + of it, thus forming a work based on the Program, and copy and + distribute such modifications or work under the terms of Section 1 + above, provided that you also meet all of these conditions: + + a) You must cause the modified files to carry prominent notices + stating that you changed the files and the date of any change. + + b) You must cause any work that you distribute or publish, that in + whole or in part contains or is derived from the Program or any + part thereof, to be licensed as a whole at no charge to all third + parties under the terms of this License. + + c) If the modified program normally reads commands interactively + when run, you must cause it, when started running for such + interactive use in the most ordinary way, to print or display an + announcement including an appropriate copyright notice and a + notice that there is no warranty (or else, saying that you provide + a warranty) and that users may redistribute the program under + these conditions, and telling the user how to view a copy of this + License. (Exception: if the Program itself is interactive but + does not normally print such an announcement, your work based on + the Program is not required to print an announcement.) + + These requirements apply to the modified work as a whole. If + identifiable sections of that work are not derived from the Program, + and can be reasonably considered independent and separate works in + themselves, then this License, and its terms, do not apply to those + sections when you distribute them as separate works. But when you + distribute the same sections as part of a whole which is a work based + on the Program, the distribution of the whole must be on the terms of + this License, whose permissions for other licensees extend to the + entire whole, and thus to each and every part regardless of who wrote it. + + Thus, it is not the intent of this section to claim rights or contest + your rights to work written entirely by you; rather, the intent is to + exercise the right to control the distribution of derivative or + collective works based on the Program. + + In addition, mere aggregation of another work not based on the Program + with the Program (or with a work based on the Program) on a volume of + a storage or distribution medium does not bring the other work under + the scope of this License. + + 3. You may copy and distribute the Program (or a work based on it, + under Section 2) in object code or executable form under the terms of + Sections 1 and 2 above provided that you also do one of the following: + + a) Accompany it with the complete corresponding machine-readable + source code, which must be distributed under the terms of Sections + 1 and 2 above on a medium customarily used for software interchange; or, + + b) Accompany it with a written offer, valid for at least three + years, to give any third party, for a charge no more than your + cost of physically performing source distribution, a complete + machine-readable copy of the corresponding source code, to be + distributed under the terms of Sections 1 and 2 above on a medium + customarily used for software interchange; or, + + c) Accompany it with the information you received as to the offer + to distribute corresponding source code. (This alternative is + allowed only for noncommercial distribution and only if you + received the program in object code or executable form with such + an offer, in accord with Subsection b above.) + + The source code for a work means the preferred form of the work for + making modifications to it. For an executable work, complete source + code means all the source code for all modules it contains, plus any + associated interface definition files, plus the scripts used to + control compilation and installation of the executable. However, as a + special exception, the source code distributed need not include + anything that is normally distributed (in either source or binary + form) with the major components (compiler, kernel, and so on) of the + operating system on which the executable runs, unless that component + itself accompanies the executable. + + If distribution of executable or object code is made by offering + access to copy from a designated place, then offering equivalent + access to copy the source code from the same place counts as + distribution of the source code, even though third parties are not + compelled to copy the source along with the object code. + + 4. You may not copy, modify, sublicense, or distribute the Program + except as expressly provided under this License. Any attempt + otherwise to copy, modify, sublicense or distribute the Program is + void, and will automatically terminate your rights under this License. + However, parties who have received copies, or rights, from you under + this License will not have their licenses terminated so long as such + parties remain in full compliance. + + 5. You are not required to accept this License, since you have not + signed it. However, nothing else grants you permission to modify or + distribute the Program or its derivative works. These actions are + prohibited by law if you do not accept this License. Therefore, by + modifying or distributing the Program (or any work based on the + Program), you indicate your acceptance of this License to do so, and + all its terms and conditions for copying, distributing or modifying + the Program or works based on it. + + 6. Each time you redistribute the Program (or any work based on the + Program), the recipient automatically receives a license from the + original licensor to copy, distribute or modify the Program subject to + these terms and conditions. You may not impose any further + restrictions on the recipients' exercise of the rights granted herein. + You are not responsible for enforcing compliance by third parties to + this License. + + 7. If, as a consequence of a court judgment or allegation of patent + infringement or for any other reason (not limited to patent issues), + conditions are imposed on you (whether by court order, agreement or + otherwise) that contradict the conditions of this License, they do not + excuse you from the conditions of this License. If you cannot + distribute so as to satisfy simultaneously your obligations under this + License and any other pertinent obligations, then as a consequence you + may not distribute the Program at all. For example, if a patent + license would not permit royalty-free redistribution of the Program by + all those who receive copies directly or indirectly through you, then + the only way you could satisfy both it and this License would be to + refrain entirely from distribution of the Program. + + If any portion of this section is held invalid or unenforceable under + any particular circumstance, the balance of the section is intended to + apply and the section as a whole is intended to apply in other + circumstances. + + It is not the purpose of this section to induce you to infringe any + patents or other property right claims or to contest validity of any + such claims; this section has the sole purpose of protecting the + integrity of the free software distribution system, which is + implemented by public license practices. Many people have made + generous contributions to the wide range of software distributed + through that system in reliance on consistent application of that + system; it is up to the author/donor to decide if he or she is willing + to distribute software through any other system and a licensee cannot + impose that choice. + + This section is intended to make thoroughly clear what is believed to + be a consequence of the rest of this License. + + 8. If the distribution and/or use of the Program is restricted in + certain countries either by patents or by copyrighted interfaces, the + original copyright holder who places the Program under this License + may add an explicit geographical distribution limitation excluding + those countries, so that distribution is permitted only in or among + countries not thus excluded. In such case, this License incorporates + the limitation as if written in the body of this License. + + 9. The Free Software Foundation may publish revised and/or new versions + of the General Public License from time to time. Such new versions will + be similar in spirit to the present version, but may differ in detail to + address new problems or concerns. + + Each version is given a distinguishing version number. If the Program + specifies a version number of this License which applies to it and "any + later version", you have the option of following the terms and conditions + either of that version or of any later version published by the Free + Software Foundation. If the Program does not specify a version number of + this License, you may choose any version ever published by the Free Software + Foundation. + + 10. If you wish to incorporate parts of the Program into other free + programs whose distribution conditions are different, write to the author + to ask for permission. For software which is copyrighted by the Free + Software Foundation, write to the Free Software Foundation; we sometimes + make exceptions for this. Our decision will be guided by the two goals + of preserving the free status of all derivatives of our free software and + of promoting the sharing and reuse of software generally. + + NO WARRANTY + + 11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY + FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN + OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES + PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED + OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS + TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE + PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING, + REPAIR OR CORRECTION. + + 12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING + WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR + REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, + INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING + OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED + TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY + YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER + PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE + POSSIBILITY OF SUCH DAMAGES.""'''''' diff --git a/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/MIT-LICENSE.txt b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/MIT-LICENSE.txt new file mode 100644 index 0000000..5327046 --- /dev/null +++ b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/MIT-LICENSE.txt @@ -0,0 +1,20 @@ +Copyright (c) 2011 John Resig, http://jquery.com/ + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/i18n/i18n.html b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/i18n/i18n.html new file mode 100644 index 0000000..83cb5e3 --- /dev/null +++ b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/i18n/i18n.html @@ -0,0 +1,73 @@ +<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="utf-8">
+ <title>Internationalisation page for the jquery ui timepicker</title>
+
+ <script src="../include/jquery-1.5.1.min.js"></script>
+ <script src="../include/jquery.ui.core.min.js"></script>
+ <script src="../include/jquery.ui.widget.min.js"></script>
+ <script src="../jquery.ui.timepicker.js"></script>
+
+ <link rel="stylesheet" href="../include/jquery-ui-1.8.14.custom.css" />
+ <link rel="stylesheet" href="../jquery.ui.timepicker.css" />
+ <style>
+ #timepicker { font-size: 10px }
+ </style>
+
+ <script src='jquery.ui.timepicker-de.js'></script>
+ <script src='jquery.ui.timepicker-fr.js'></script>
+ <script src='jquery.ui.timepicker-ja.js'></script>
+</head>
+<body>
+
+ <script type="text/javascript">
+ $(document).ready(function() {
+
+ $.timepicker.setDefaults( $.timepicker.regional[ "" ] );
+
+ $('#timepicker').timepicker({
+ showCloseButton: true,
+ showNowButton: true,
+ showDeselectButton: true
+ });
+
+ $('#locale').change(function() {
+ $('#timepicker').timepicker( "option",
+ $.timepicker.regional[ $( this ).val() ] );
+ });
+ });
+ </script>
+
+ Select a localisation :
+ <select id='locale'>
+ <option value='fr'>Français</option>
+ <option value='de'>Deutsch</option>
+ <option value='ja'>Japanese</option>
+ </select>
+
+ <br>
+
+ <div id="timepicker">
+
+ </div>
+
+ <br>
+
+ List of localisations :
+<ul>
+ <li>
+ <a href="jquery.ui.timepicker-de.js">Deutsch (jquery.ui.timepicker-de.js</a>
+ </li>
+
+ <li>
+ <a href="jquery.ui.timepicker-fr.js">Français (jquery.ui.timepicker-fr.js</a>
+ </li>
+
+ <li>
+ <a href="jquery.ui.timepicker-ja.js">Japanese (jquery.ui.timepicker-ja.js</a>
+ </li>
+
+</ul>
+
+</body>
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/i18n/jquery.ui.timepicker-de.js b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/i18n/jquery.ui.timepicker-de.js new file mode 100644 index 0000000..c010a49 --- /dev/null +++ b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/i18n/jquery.ui.timepicker-de.js @@ -0,0 +1,9 @@ +/* Deutsch initialisation for the timepicker plugin */
+/* Written by Bernd Plagge (bplagge@choicenet.ne.jp). */
+jQuery(function($){
+ $.timepicker.regional['de'] = {
+ hourText: 'Stunde',
+ minuteText: 'Minuten',
+ amPmText: ['AM', 'PM'] }
+ $.timepicker.setDefaults($.timepicker.regional['de']);
+});
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/i18n/jquery.ui.timepicker-fr.js b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/i18n/jquery.ui.timepicker-fr.js new file mode 100644 index 0000000..bd37d73 --- /dev/null +++ b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/i18n/jquery.ui.timepicker-fr.js @@ -0,0 +1,13 @@ +/* French initialisation for the jQuery time picker plugin. */
+/* Written by Bernd Plagge (bplagge@choicenet.ne.jp),
+ Francois Gelinas (frank@fgelinas.com) */
+jQuery(function($){
+ $.timepicker.regional['fr'] = {
+ hourText: 'Heures',
+ minuteText: 'Minutes',
+ amPmText: ['AM', 'PM'],
+ closeButtonText: 'Fermer',
+ nowButtonText: 'Maintenant',
+ deselectButtonText: 'Désélectionner' }
+ $.timepicker.setDefaults($.timepicker.regional['fr']);
+});
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/i18n/jquery.ui.timepicker-ja.js b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/i18n/jquery.ui.timepicker-ja.js new file mode 100644 index 0000000..01b2c8a --- /dev/null +++ b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/i18n/jquery.ui.timepicker-ja.js @@ -0,0 +1,9 @@ +/* Japanese initialisation for the jQuery time picker plugin. */
+/* Written by Bernd Plagge (bplagge@choicenet.ne.jp). */
+jQuery(function($){
+ $.timepicker.regional['ja'] = {
+ hourText: '時間',
+ minuteText: '分',
+ amPmText: ['午前', '午後'] }
+ $.timepicker.setDefaults($.timepicker.regional['ja']);
+});
diff --git a/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/index.html b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/index.html new file mode 100644 index 0000000..a29d78c --- /dev/null +++ b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/index.html @@ -0,0 +1,1007 @@ +<!DOCTYPE html>
+<html>
+<head>
+ <meta http-equiv="Content-Type" content="text/html;charset=utf-8" >
+ <title>jQuery UI Time Picker by Francois Gelinas</title>
+ <link rel="stylesheet" href="include/jquery-ui-1.8.14.custom.css" type="text/css" />
+ <link rel="stylesheet" href="jquery.ui.timepicker.css?v=0.2.9" type="text/css" />
+
+<!-- uncomment to test with legacy jquery -->
+<!--
+ <script type="text/javascript" src="jquery-1.2.6.js"></script>
+ <script type="text/javascript" src="jquery.fix.for.1.2.6.js"></script>
+ <script type="text/javascript" src="jquery.ui.1.6.all.js"></script>
+-->
+
+ <script type="text/javascript" src="include/jquery-1.5.1.min.js"></script>
+ <script type="text/javascript" src="include/jquery.ui.core.min.js"></script>
+ <script type="text/javascript" src="include/jquery.ui.widget.min.js"></script>
+ <script type="text/javascript" src="include/jquery.ui.tabs.min.js"></script>
+ <script type="text/javascript" src="include/jquery.ui.position.min.js"></script>
+
+ <script type="text/javascript" src="jquery.ui.timepicker.js?v=0.2.9"></script>
+
+ <script type="text/javascript" src="https://apis.google.com/js/plusone.js"></script>
+ <style type="text/css">
+ /* some styling for the page */
+ body { font-size: 10px; /* for the widget natural size */ }
+ #content { font-size: 1.2em; /* for the rest of the page to show at a normal size */
+ font-family: "Lucida Sans Unicode", "Lucida Grande", Verdana, Arial, Helvetica, sans-serif;
+ width: 950px; margin: auto;
+ }
+ .box { border: 1px solid #888; padding: 15px; margin:12px; }
+ .code { margin: 6px; padding: 9px; background-color: #fdf5ce; border: 1px solid #c77405; }
+ fieldset { padding: 0.5em 2em }
+ hr { margin: 0.5em 0; clear: both }
+ a { cursor: pointer; }
+ #requirements li { line-height: 1.6em; }
+ </style>
+
+ <script type="text/javascript">
+
+ var _gaq = _gaq || [];
+ _gaq.push(['_setAccount', 'UA-24327002-1']);
+ _gaq.push(['_trackPageview']);
+
+ (function() {
+ var ga = document.createElement('script'); ga.type = 'text/javascript'; ga.async = true;
+ ga.src = ('https:' == document.location.protocol ? 'https://ssl' : 'http://www') + '.google-analytics.com/ga.js';
+ var s = document.getElementsByTagName('script')[0]; s.parentNode.insertBefore(ga, s);
+ })();
+
+ function plusone_clicked() {
+ $('#thankyou').fadeIn(300);
+ }
+
+ $(document).ready(function() {
+ $('#floating_timepicker').timepicker({
+ onSelect: function(time, inst) {
+ $('#floating_selected_time').html('You selected ' + time);
+ }
+ });
+
+ $('#tabs').tabs();
+
+ });
+
+
+ </script>
+</head>
+<body>
+
+<div id="content">
+
+<div style="float: right; padding: 20px 0 20px 20px; font-size: 10px;">
+ <div id="floating_timepicker">
+ </div>
+ <span id="floating_selected_time">
+ </span>
+</div>
+
+<h1>jQuery UI Timepicker
+ <span style="color: #999; font-size:10px;">(By <a href="http://fgelinas.com">François Gélinas</a>)</span>
+ <g:plusone callback='plusone_clicked'></g:plusone>
+ <span id="thankyou" style="display: none; font-size: 0.6em;" class="code">
+ Thanks !! (:
+ </span>
+</h1>
+
+<h2>What is this?</h2>
+<p style="font-size: 1.1em;">
+
+ This is a jQuery UI time picker plugin build to match with other official jQuery UI widgets.
+ Based on the existing date picker, it will blend nicely with your form and use your selected jQuery UI theme.
+ The plugin is very easy to integrate in your form for you time (hours / minutes) inputs.
+</p>
+<p>
+ Licensed under the same license as jQuery : <a href="http://docs.jquery.com/Licensing">MIT and GPL licenses</a>
+</p>
+
+<div style="clear: both"></div>
+
+<div id="tabs">
+
+ <ul>
+ <li><a href="#examples">Examples</a></li>
+ <li><a href="#usage">Usage</a></li>
+ <li><a href="#requirements">Requirements</a></li>
+ <li><a href="#release_notes">Release notes</a></li>
+ <li><a href="#get_timepicker">Get Timepicker version 0.2.9</a></li>
+ </ul>
+
+ <div id="examples">
+ <div>
+ Default time picker :
+ <input type="text" style="width: 70px;" id="timepicker.[1]" value="" />
+ <script type="text/javascript">
+ $(document).ready(function() {
+ $('#timepicker\\.\\[1\\]').timepicker();
+ });
+ </script>
+
+ <a onclick="$('#script_1').toggle(200); return false;">[Show code]</a>
+ <pre id="script_1" style="display: none" class="code">$('#timepicker').timepicker();</pre>
+ </div>
+
+
+ <hr />
+
+ <div>
+ Time picker with period (AM/PM) in input and with hours leading 0s :
+ <input type="text" style="width: 70px;" id="timepicker_6" value="01:30 PM" />
+ <script type="text/javascript">
+ $(document).ready(function() {
+ $('#timepicker_6').timepicker({
+ showPeriod: true,
+ showLeadingZero: true
+ });
+ });
+ </script>
+
+ <a onclick="$('#script_6').toggle(200)">[Show code]</a>
+<pre id="script_6" style="display: none" class="code">$('#timepicker').timepicker({
+ showPeriod: true,
+ showLeadingZero: true
+});</pre>
+ </div>
+
+ <hr />
+
+ <div>
+ Time picker with buttons and labels in another language (Français) :
+ <input type="text" style="width: 70px;" id="timepicker_locale" value="13h30" />
+ <br>
+ See the <a href="i18n/i18n.html">internationalisation page</a> for more information and details.
+ <script type="text/javascript">
+ $(document).ready(function() {
+ $('#timepicker_locale').timepicker({
+ hourText: 'Heures',
+ minuteText: 'Minutes',
+ amPmText: ['AM', 'PM'],
+ timeSeparator: 'h',
+ showLeadingZero: false,
+ nowButtonText: 'Maintenant',
+ showNowButton: true,
+ closeButtonText: 'Fermer',
+ showCloseButton: true,
+ deselectButtonText: 'Désélectionner',
+ showDeselectButton: true
+ });
+ });
+
+ </script>
+ <a onclick="$('#script_locale').toggle(200)">[Show code]</a>
+<pre id="script_locale" style="display: none" class="code">$('#timepicker').timepicker({
+ hourText: 'Heures',
+ minuteText: 'Minutes',
+ amPmText: ['AM', 'PM'],
+ timeSeparator: 'h',
+ nowButtonText: 'Maintenant',
+ showNowButton: true,
+ closeButtonText: 'Fermer',
+ showCloseButton: true,
+ deselectButtonText: 'Désélectionner',
+ showDeselectButton: true
+});</pre>
+ </div>
+
+ <hr />
+
+ <div>
+ Time picker with restricted (disabled) hours / minutes. 8:30 PM to 6:30 AM disabled :
+ <input type="text" style="width: 70px" id="timepicker_7" value="01:30 PM" />
+
+ <script type="text/javascript">
+ $(document).ready(function() {
+ $('#timepicker_7').timepicker({
+ showPeriod: true,
+ onHourShow: timepicker7OnHourShowCallback,
+ onMinuteShow: timepicker7OnMinuteShowCallback
+ });
+ });
+ function timepicker7OnHourShowCallback(hour) {
+ if ((hour > 20) || (hour < 6)) {
+ return false;
+ }
+ return true;
+ }
+ function timepicker7OnMinuteShowCallback(hour, minute) {
+ if ((hour == 20) && (minute >= 30)) { return false; }
+ if ((hour == 6) && (minute < 30)) { return false; }
+ return true;
+ }
+
+ </script>
+ <a onclick="$('#script_7').toggle(200)">[Show code]</a>
+<pre id="script_7" style="display: none" class="code">$('#timepicker').timepicker({
+ showPeriod: true,
+ onHourShow: OnHourShowCallback,
+ onMinuteShow: OnMinuteShowCallback
+ });
+function OnHourShowCallback(hour) {
+ if ((hour > 20) || (hour < 6)) {
+ return false; // not valid
+ }
+ return true; // valid
+}
+function OnMinuteShowCallback(hour, minute) {
+ if ((hour == 20) && (minute >= 30)) { return false; } // not valid
+ if ((hour == 6) && (minute < 30)) { return false; } // not valid
+ return true; // valid
+}</pre>
+ </div>
+
+ <hr />
+
+ <div>
+ Define when the time picker is shown with the <kbd>showOn</kbd> option and set a trigger element with the <kbd>button</kbd> option
+ <input type="text" style="width: 70px;" id="timepicker_showon" value="13h30" />
+ <div class='timepicker_button_trigger'
+ style="width: 16px; height:16px; background: url(include/ui-lightness/images/ui-icons_222222_256x240.png) -80px, -96px;
+ display: inline-block; border-radius: 2px; border: 1px solid #222222; margin-top: 3px; cursor:pointer"></div>
+ <button class='timepicker_button_trigger' id="btn_trigger_timepicker">Show</button>
+
+
+ <script type="text/javascript">
+ $(document).ready(function() {
+ $('#timepicker_showon').timepicker({
+ showOn: 'button',
+ button: $('.timepicker_button_trigger'),
+ showLeadingZero: false,
+ timeSeparator: 'h'
+ });
+
+ });
+
+ </script>
+ <a onclick="$('#script_showhide').toggle(200)">[Show code]</a>
+<pre id="script_showhide" style="display: none" class="code">$('#timepicker').timepicker({
+ showOn: 'button',
+ button: '.timepicker_button_trigger'
+});
+</pre>
+
+ </div>
+
+
+ <hr />
+
+ <div>
+ Time picker without the AM/PM labels on the left (showPeriodLabels option set to false:
+ <input type="text" style="width: 70px;" id="timepicker_noPeriodLabels" value="13:30" />
+
+ <script type="text/javascript">
+ $(document).ready(function() {
+ $('#timepicker_noPeriodLabels').timepicker({
+ showPeriodLabels: false
+ });
+ });
+
+ </script>
+ <a onclick="$('#script_noPeriodLabels').toggle(200)">[Show code]</a>
+<pre id="script_noPeriodLabels" style="display: none" class="code">$('#timepicker').timepicker({
+ showPeriodLabels: false,
+});
+</pre>
+
+ </div>
+
+
+ <hr />
+
+ <div>
+
+ Custom defined hours range (Business hours 6am to 7pm) and minutes increment set to 15 instead of 5, on 3 rows
+ <input type="text" style="width: 70px" id="timepicker_customrange" value="13:30">
+ <script type="text/javascript">
+ $(document).ready(function() {
+ $('#timepicker_customrange').timepicker({
+ hours: { starts: 6, ends: 19 },
+ minutes: { interval: 15 },
+ rows: 3,
+ showPeriodLabels: true,
+ minuteText: 'Min'
+ })
+ });
+
+ </script>
+
+ <a onclick="$('#script_2').toggle(200)">[Show code]</a>
+<pre id="script_2" style="display: none" class="code"> $('#timepicke').timepicker({
+ hours: { starts: 6, ends: 19 },
+ minutes: { interval: 15 },
+ rows: 3
+ showPeriodLabels: true,
+ minuteText: 'Min'
+});
+</pre>
+ </div>
+
+ <hr />
+
+ <div>
+ Input for hours only :
+ <input type="text" style="width: 70px" id="timepicker_hours" value="5 PM">
+ , input for minutes only :
+ <input type="text" style="width: 70px" id="timepicker_minutes" value="45">
+
+ <script type="text/javascript">
+ $(document).ready(function() {
+ $('#timepicker_hours').timepicker({
+ showMinutes: false,
+ showPeriod: true,
+ showLeadingZero: false
+ });
+ $('#timepicker_minutes').timepicker({
+ showHours: false
+ });
+ })
+ </script>
+
+ <a onclick="$('#script_hoursminutesonly').toggle(200)">[Show code]</a>
+<pre id="script_hoursminutesonly" style="display: none" class="code">$('#timepicker_hours').timepicker({
+ showMinutes: false,
+ showPeriod: true,
+ showLeadingZero: false
+});
+$('#timepicker_minutes').timepicker({
+ showHours: false
+});</pre>
+
+ </div>
+
+
+ <hr />
+
+ <div>
+ Timepicker with the Now, Deselect and Close buttons
+ <input type="text" style="width: 70px" id="timepicker_buttons" value="12:35">
+
+
+ <script type="text/javascript">
+ $(document).ready(function() {
+ $('#timepicker_buttons').timepicker({
+ showNowButton: true,
+ showDeselectButton: true,
+ defaultTime: '', // removes the highlighted time for when the input is empty.
+ showCloseButton: true
+ });
+ })
+ </script>
+
+ <a onclick="$('#script_buttonpane').toggle(200)">[Show code]</a>
+<pre id="script_buttonpane" style="display: none" class="code">$('#timepicker_buttons').timepicker({
+ showNowButton: true,
+ showDeselectButton: true,
+ defaultTime: '', // removes the highlighted time for when the input is empty.
+ showCloseButton: true
+});</pre>
+
+ </div>
+
+
+ <hr />
+
+ <div>
+ onSelect (hours and minutes both trigger event), beforeShow and onClose events :
+ <input type="text" style="width: 70px" id="timepicker_3" value="13:30" />
+ <script type="text/javascript">
+ $(document).ready(function() {
+ $('#timepicker_3').timepicker({
+ beforeShow: function(input, inst) {
+ log_event('beforeShow triggered for instance id ' + inst.id);
+ },
+ onClose: function(time, inst) {
+ log_event('onClose triggered with time : ' + time + ' for instance id : ' + inst.id);
+ },
+ onSelect: function(time, inst) {
+ log_event('onSelect triggered with time : ' + time + ' for instance id : ' + inst.id);
+ }
+ });
+ });
+
+ function log_event(event) {
+ $('#events_log').val(
+ $('#events_log').val() + "\n" + event
+ )
+ }
+ </script>
+
+ <a onclick="$('#script_3').toggle(200)">[Show code]</a>
+<pre id="script_3" style="display: none" class="code">function log_event(event) {
+ $('#events_log').val(
+ $('#events_log').val() + "\n" + event
+ )
+}
+$('#timepicker').timepicker({
+ onClose: function(time, inst) {
+ log_event('onClose triggered with time : ' + time + ' for instance id : ' + inst.id);
+ },
+ onSelect: function(time, inst) {
+ log_event('onSelect triggered with time : ' + time + ' for instance id : ' + inst.id);
+ }
+});
+</pre>
+ <br />
+ <textarea id="events_log" rows="4" cols="120" >events log :</textarea>
+ </div>
+
+
+<hr />
+
+ <div>
+
+ <div style="float: left">
+ Inline time picker :
+ <span style="color: #888;">
+ Alternate field :
+ <input type="text" style="width: 70px" id="timepicker_alt" value="13:30" readonly="readonly" disabled="disabled"/>
+ </span>
+ <br />
+ <input type="button" value="Change time to 16:55" onclick="javascript:$('#timepicker_inline_7').timepicker('setTime','16:55');">
+ <br>
+ <input type="button" id='tp7_getTime_button' value="Get selected time" onclick="javascript:tp7_getTime();" >
+ <br>
+ <input type="button" id="tp7_getHourMinute_button" value="Get hour and minute" onclick="javascript:tp7_getHourMinute();" >
+ <br />
+ <a onclick="$('#script_inline').toggle(200); return false;">[Show code]</a>
+ </div>
+ <div id="timepicker_inline_7" style="font-size: 10px; float: left; margin-left: 24px;"></div>
+ <script type="text/javascript">
+ $(document).ready(function() {
+ $('#timepicker_inline_7').timepicker({
+ altField: '#timepicker_alt',
+ defaultTime: '13:30'
+ });
+ });
+ function tp7_getTime() {
+ $('#tp7_getTime_button').val('Selected time : ' + $('#timepicker_inline_7').timepicker('getTime'));
+ }
+ function tp7_getHourMinute() {
+ $('#tp7_getHourMinute_button').val(
+ 'Hour : ' + $('#timepicker_inline_7').timepicker('getHour')
+ + ', ' +
+ 'minute : ' + $('#timepicker_inline_7').timepicker('getMinute')
+ );
+ }
+ </script>
+ <div style="clear: both"></div>
+
+<pre class="code" id="script_inline" style="display: none">$('#timepicker_inline_div').timepicker({
+ altField: '#timepicker_alt_input',
+ defaultTime: '9:20'
+});
+function setNewTime() {
+ $('#timepicker_inline_div').timepicker('setTime','16:55');
+}
+function getTime() {
+ $('#getTime_button').val('Selected time : ' + $('#timepicker').timepicker('getTime'));
+}
+function getHourMinute() {
+ $('#getHourMinute_button').val(
+ 'Hour : ' + $('#timepicker').timepicker('getHour')
+ + ', ' +
+ 'minute : ' + $('#timepicker').timepicker('getMinute')
+ );
+}
+</pre>
+
+ </div>
+
+
+ <hr />
+
+ <div>
+
+ Two timepickers to select chronological time range, the first timepicker is restricted to before the time selected in the second timepicker, and vice versa.
+ <br>
+ Start time :
+ <input type="text" style="width: 70px" id="timepicker_start" value="9:15" />
+ end time :
+ <input type="text" style="width: 70px" id="timepicker_end" value="16:30" />
+
+ <a onclick="$('#script_time_range').toggle(200); return false;">[Show code]</a>
+
+ <script type="text/javascript">
+ $(document).ready(function() {
+ $('#timepicker_start').timepicker({
+ showLeadingZero: false,
+ onHourShow: tpStartOnHourShowCallback,
+ onMinuteShow: tpStartOnMinuteShowCallback
+ });
+ $('#timepicker_end').timepicker({
+ showLeadingZero: false,
+ onHourShow: tpEndOnHourShowCallback,
+ onMinuteShow: tpEndOnMinuteShowCallback
+ });
+ });
+
+ function tpStartOnHourShowCallback(hour) {
+ var tpEndHour = $('#timepicker_end').timepicker('getHour');
+ // Check if proposed hour is prior or equal to selected end time hour
+ if (hour <= tpEndHour) { return true; }
+ // if hour did not match, it can not be selected
+ return false;
+ }
+ function tpStartOnMinuteShowCallback(hour, minute) {
+ var tpEndHour = $('#timepicker_end').timepicker('getHour');
+ var tpEndMinute = $('#timepicker_end').timepicker('getMinute');
+ // Check if proposed hour is prior to selected end time hour
+ if (hour < tpEndHour) { return true; }
+ // Check if proposed hour is equal to selected end time hour and minutes is prior
+ if ( (hour == tpEndHour) && (minute < tpEndMinute) ) { return true; }
+ // if minute did not match, it can not be selected
+ return false;
+ }
+
+ function tpEndOnHourShowCallback(hour) {
+ var tpStartHour = $('#timepicker_start').timepicker('getHour');
+ // Check if proposed hour is after or equal to selected start time hour
+ if (hour >= tpStartHour) { return true; }
+ // if hour did not match, it can not be selected
+ return false;
+ }
+ function tpEndOnMinuteShowCallback(hour, minute) {
+ var tpStartHour = $('#timepicker_start').timepicker('getHour');
+ var tpStartMinute = $('#timepicker_start').timepicker('getMinute');
+ // Check if proposed hour is after selected start time hour
+ if (hour > tpStartHour) { return true; }
+ // Check if proposed hour is equal to selected start time hour and minutes is after
+ if ( (hour == tpStartHour) && (minute > tpStartMinute) ) { return true; }
+ // if minute did not match, it can not be selected
+ return false;
+ }
+
+ </script>
+
+<pre class="code" id="script_time_range" style="display: none">
+$(document).ready(function() {
+ $('#timepicker_start').timepicker({
+ showLeadingZero: false,
+ onHourShow: tpStartOnHourShowCallback,
+ onMinuteShow: tpStartOnMinuteShowCallback
+ });
+ $('#timepicker_end').timepicker({
+ showLeadingZero: false,
+ onHourShow: tpEndOnHourShowCallback,
+ onMinuteShow: tpEndOnMinuteShowCallback
+ });
+});
+
+function tpStartOnHourShowCallback(hour) {
+ var tpEndHour = $('#timepicker_end').timepicker('getHour');
+ // Check if proposed hour is prior or equal to selected end time hour
+ if (hour <= tpEndHour) { return true; }
+ // if hour did not match, it can not be selected
+ return false;
+}
+function tpStartOnMinuteShowCallback(hour, minute) {
+ var tpEndHour = $('#timepicker_end').timepicker('getHour');
+ var tpEndMinute = $('#timepicker_end').timepicker('getMinute');
+ // Check if proposed hour is prior to selected end time hour
+ if (hour < tpEndHour) { return true; }
+ // Check if proposed hour is equal to selected end time hour and minutes is prior
+ if ( (hour == tpEndHour) && (minute < tpEndMinute) ) { return true; }
+ // if minute did not match, it can not be selected
+ return false;
+}
+
+function tpEndOnHourShowCallback(hour) {
+ var tpStartHour = $('#timepicker_start').timepicker('getHour');
+ // Check if proposed hour is after or equal to selected start time hour
+ if (hour >= tpStartHour) { return true; }
+ // if hour did not match, it can not be selected
+ return false;
+}
+function tpEndOnMinuteShowCallback(hour, minute) {
+ var tpStartHour = $('#timepicker_start').timepicker('getHour');
+ var tpStartMinute = $('#timepicker_start').timepicker('getMinute');
+ // Check if proposed hour is after selected start time hour
+ if (hour > tpStartHour) { return true; }
+ // Check if proposed hour is equal to selected start time hour and minutes is after
+ if ( (hour == tpStartHour) && (minute > tpStartMinute) ) { return true; }
+ // if minute did not match, it can not be selected
+ return false;
+}
+</pre>
+
+ </div>
+
+
+
+ <hr />
+
+ <div>
+ Example to disable and re-enable a timepicker.
+ <br />
+ <div id="timepicker_disable_inline" style="font-size: 10px; float: left;"></div>
+ <input type="text" style="width: 70px" id="timepicker_disable" value="9:15" />
+ <br />
+ <button id="btn_disable_tp">Disable the time pickers</button>
+ <br />
+ <button id="btn_enable_tp">Re-enable the time pickers</button>
+ <br />
+ <a onclick="$('#script_tp_disable').toggle(200); return false;">[Show code]</a>
+ <div style="clear: both"></div>
+
+ <script type="text/javascript">
+ $(document).ready(function() {
+ $('#timepicker_disable_inline').timepicker();
+ $('#timepicker_disable').timepicker({showLeadingZero: false });
+ $('#btn_disable_tp').click(function() {
+ $('#timepicker_disable_inline').timepicker('disable');
+ $('#timepicker_disable').timepicker('disable');
+ });
+ $('#btn_enable_tp').click(function() {
+ $('#timepicker_disable_inline').timepicker('enable');
+ $('#timepicker_disable').timepicker('enable');
+ });
+ });
+ </script>
+<pre class="code" style="display: none" id="script_tp_disable">
+$('#timepicker_disable_inline').timepicker();
+$('#timepicker_disable').timepicker({showLeadingZero: false });
+$('#btn_disable_tp').click(function() {
+ $('#timepicker_disable_inline').timepicker('disable');
+ $('#timepicker_disable').timepicker('disable');
+});
+$('#btn_enable_tp').click(function() {
+ $('#timepicker_disable_inline').timepicker('enable');
+ $('#timepicker_disable').timepicker('enable');
+});
+</pre>
+ </div>
+
+
+ </div>
+
+ <!------------------------------------------------------------------------------------------------------------->
+ <!------------------------------------------------------------------------------------------------------------->
+ <!------------------------------------------------------------------------------------------------------------->
+
+ <div id="usage">
+
+ <h2><a name="documentation"></a>Usage:</h2>
+ <pre class="code">$('#timepicker').timepicker({
+ // Options
+ timeSeparator: ':', // The character to use to separate hours and minutes. (default: ':')
+ showLeadingZero: true, // Define whether or not to show a leading zero for hours < 10.
+ (default: true)
+ showMinutesLeadingZero: true, // Define whether or not to show a leading zero for minutes < 10.
+ (default: true)
+ showPeriod: false, // Define whether or not to show AM/PM with selected time. (default: false)
+ showPeriodLabels: true, // Define if the AM/PM labels on the left are displayed. (default: true)
+ periodSeparator: ' ', // The character to use to separate the time from the time period.
+ altField: '#alternate_input', // Define an alternate input to parse selected time to
+ defaultTime: '12:34', // Used as default time when input field is empty or for inline timePicker
+ // (set to 'now' for the current time, '' for no highlighted time,
+ default value: now)
+
+ // trigger options
+ showOn: 'focus', // Define when the timepicker is shown.
+ // 'focus': when the input gets focus, 'button' when the button trigger element is clicked,
+ // 'both': when the input gets focus and when the button is clicked.
+ button: null, // jQuery selector that acts as button trigger. ex: '#trigger_button'
+
+ // Localization
+ hourText: 'Hour', // Define the locale text for "Hours"
+ minuteText: 'Minute', // Define the locale text for "Minute"
+ amPmText: ['AM', 'PM'], // Define the locale text for periods
+
+ // Position
+ myPosition: 'left top', // Corner of the dialog to position, used with the jQuery UI Position utility if present.
+ atPosition: 'left bottom', // Corner of the input to position
+
+ // Events
+ beforeShow: beforeShowCallback, // Callback function executed before the timepicker is rendered and displayed.
+ onSelect: onSelectCallback, // Define a callback function when an hour / minutes is selected.
+ onClose: onCloseCallback, // Define a callback function when the timepicker is closed.
+ onHourShow: onHourShow, // Define a callback to enable / disable certain hours. ex: function onHourShow(hour)
+ onMinuteShow: onMinuteShow, // Define a callback to enable / disable certain minutes. ex: function onMinuteShow(hour, minute)
+
+ // custom hours and minutes
+ hours: {
+ starts: 0, // First displayed hour
+ ends: 23 // Last displayed hour
+ },
+ minutes: {
+ starts: 0, // First displayed minute
+ ends: 55, // Last displayed minute
+ interval: 5 // Interval of displayed minutes
+ },
+ rows: 4, // Number of rows for the input tables, minimum 2, makes more sense if you use multiple of 2
+ showHours: true, // Define if the hours section is displayed or not. Set to false to get a minute only dialog
+ showMinutes: true, // Define if the minutes section is displayed or not. Set to false to get an hour only dialog
+
+ // buttons
+ showCloseButton: false, // shows an OK button to confirm the edit
+ closeButtonText: 'Done', // Text for the confirmation button (ok button)
+ showNowButton: false, // Shows the 'now' button
+ nowButtonText: 'Now', // Text for the now button
+ showDeselectButton: false, // Shows the deselect time button
+ deselectButtonText: 'Deselect' // Text for the deselect button
+
+});</pre>
+
+ </div>
+
+ <!------------------------------------------------------------------------------------------------------------->
+ <!------------------------------------------------------------------------------------------------------------->
+ <!------------------------------------------------------------------------------------------------------------->
+
+ <div id="requirements">
+ <h2>Requirements : </h2>
+ <ul>
+ <li>
+ <a href="http://jquery.com">
+ jQuery 1.5.1 (probably works with previous versions)
+ </a>
+ </li>
+ <li>
+ <a href="http://jqueryui.com/">
+ jQuery UI Core (included in jquery-ui-x.x.x.custom.min.js)
+ </a>
+ </li>
+ <li>
+ <a href="http://jqueryui.com/demos/position/">
+ jQuery UI Position utility (optional for special position of the dialog)
+ </a>
+ </li>
+ <li>
+ <a href="http://jqueryui.com/">
+ jQuery UI Theme.css (included in jquery-ui-x.x.x.custom.css)
+ </a>
+ </li>
+
+ <li>
+ <a href="jquery.ui.timepicker.js?v=0.2.9">
+ jquery.ui.timepicker.js
+ </a>
+ </li>
+
+ <li>
+ <a href="jquery.ui.timepicker.css?v=0.2.9">
+ jquery.ui.timepicker.css
+ </a>
+ </li>
+
+
+ </ul>
+ </div>
+
+ <!------------------------------------------------------------------------------------------------------------->
+ <!------------------------------------------------------------------------------------------------------------->
+ <!------------------------------------------------------------------------------------------------------------->
+
+ <div id="release_notes">
+
+ <h2>Releases :</h2>
+ <dl>
+
+ <dt>Release 0.2.9 - November 13, 2011</dt>
+ <dd>Fixed the zIndex problem and removed the zIndex option (Thanks everyone who reported the problem)</dd>
+ <dd>Fix a bug where repeatedly clicking on hour cells made the timepicker very slow.</dd>
+ <dd>Added Italian translation, thanks to Serge Margarita.</dd>
+
+ <dt>Release 0.2.8 - October 28, 2011</dt>
+ <dd>Updated defaultTime to allow for Date object (github issue #26)</dd>
+ <dd>Fixed the now and deselect buttons in IE</dd>
+
+ <dt>Release 0.2.7 - October 19, 2011</dt>
+ <dd>Added option to omit minutes in parsed time when user select 0 for minutes. (Thanks tribalvibes, Github issue #23)</dd>
+ <dd>Added support for internationalisation (fr, de and ja, Thanks Bernd Plagge).</dd>
+ <dd>Added an <a href="i18n/i18n.html">internationalisation page</a></dd>
+
+ <dt>0.2.6 - October 12, 2011</dt>
+ <dd>Fixed a bug when input ID have more then one special char. (Thanks Jacqueline Krijnen)</dd>
+ <dd>Fixed a bug when parsing hours only or minutes only time. (Thanks protron, <a href="https://github.com/fgelinas/timepicker/issues/20">github issue #20</a>)</dd>
+ <dd>Added 'Now', 'Deselect' and 'Close' buttons. (Thanks Christian Grobmeier for the close button code, <a href="https://github.com/fgelinas/timepicker/issues/20">github issue #22</a>)</dd>
+
+ <dt>0.2.5 - September 13, 2011</dt>
+ <dd>Added support for disable and enable. (Suggested by danielrex, github issue #17)</dd>
+ <dd>Added an example for 2 timepicker to behave as a period selector (start time and end time). (Thanks Bill Pellowe)</dd>
+ <dd>Renamed the stylesheet to jquery.ui.timepicker.css to be more consistent with jQuery UI file name convention.</dd>
+
+ <dt>0.2.4 - August 5, 2011</dt>
+ <dd>Fixed the hand cursor in the css file. (Thanks Mike Neumegen)</dd>
+ <dd>Added position option to use with the jquery ui position utility.</dd>
+ <dd>Added option to display only hours or only minutes.</dd>
+
+ <dt>0.2.3 - July 11, 2011 </dt>
+ <dd>Fix github issue #3 : Bug when hours or minutes choices does not divide by number of rows (thanks wukimus).</dd>
+ <dd>Changed default behavior of the defaultTime option, if set to '' and input is empty, there will be no highlighted time in the popup (Thanks Rasmus Schultz)</dd>
+ <dd>Fix github issue #4 : Error when generating empty minute cell. (Thanks 123Haynes)</dd>
+ <dd>Fix github issue #5 : Add functionality for "getTime" option. (Thanks edanuff)</dd>
+ <dd>Added the periodSeparator option. (thanks jrchamp)</dd>
+ <dd>Fixed "getTime" for inline timepickers. (thanks Mike Neumegen)</dd>
+ <dd>Added "getHour" and "getMinute" to get individual values.</dd>
+ <dd>New page interface, about time :)</dd>
+
+ <dt>0.2.2 - June 16, 2011</dt>
+ <dd>Fixed a "console.log" line that I forgot to remove before release 0.2.1. (Thanks Derek Lavine)</dd>
+
+ <dt>0.2.1 - June 8, 2011</dt>
+ <dd>Timepicker does not give the focus back to the input any more after time selection. This is similar to the datepicker behaviour and is more natural to the user because it shows the dialog again when the user click on the input again, as expected.</dd>
+ <dd>Added options to customize the hours and minutes ranges and interval for more customization.</dd>
+
+ <dt>0.2 - May 28, 2011</dt>
+ <dd>In the last release, I messed up versions and lost some changes so I'm fixing all this up with release 0.2</dd>
+
+
+ <dt>0.1.2 - May 26, 2011</dt>
+ <dd>Fixed a bug with inline timepickers that would append a #timepickr hashtag when selecting hours and minutes.</dd>
+ <dd>Fixed z-index problem with IE6 (Thanks Graham Bentley)</dd>
+ <dd>Added selection of highlighted text when enter is pressed on the input field (Thanks Glen Chiacchieri)</dd>
+ <dd>Adjusted some focus problems, now the input gets the focus back when the used click on hours / minutes.</dd>
+
+ <dt>0.1.something aka the lost release - around April 11</dt>
+ <dd>Fixed a bug for when input Id had a dot in it, it was getting double escaped when it should not. (Thanks Zdenek Machac)</dd>
+ <dd>So in 0.1.1 I created a bug that made timepicker changes the location hash, well now it's fixed. (Thanks Lucas Falk)</dd>
+
+ <dt>0.1.1 - April 6, 2011</dt>
+ <dd>Changed the cells click and dblclick binding for faster rendering in IE6/7 (Thanks Blair Parsons)</dd>
+ <dd>Fixed a class naming bug created in 0.1.0 (Thanks Morlion Peter)</dd>
+
+ <dt>0.1.0 - March 23, 2011</dt>
+ <dd>Fixed some bugs with version 0.0.9</dd>
+
+ <dt>0.0.9 - March 22, 2011</dt>
+ <dd>Added zIndex option (Thanks Frank Enderle)</dd>
+ <dd>Added showPeriodLabels option (default: true) to show/hide AM/PM labels on the left (thanks Frank Enderle)</dd>
+ <dd>Added showOn ['focus'|'button'|'both'] and button options for alternate trigger method</dd>
+
+ <dt>0.0.8 - February 17, 2011</dt>
+ <dd>Fixed close event not triggered when switching to another input with time picker (thanks Stuart Gregg)</dd>
+
+ <dt>0.0.7 - February 10, 2011</dt>
+ <dd>Added function to set time after initialisation :$('#timepicker').timepicker('setTime',newTime);</dd>
+ <dd>Added support for disabled period of time : onHourShow and onMinuteShow (thanks Rene Felgenträger)</dd>
+
+ <dt>0.0.6 - January 19, 2011</dt>
+ <dd>Replaced some div with tables to : fix some display bugs in IE7, fix inline display and fix my headhake.</dd>
+ <dd>Added standard "change" event being triggered on the input when the content changes. (Thanks Rasmus Schultz)</dd>
+ <dd>Added support for inline timePicker, attached to div or span.</dd>
+ <dd>Added altField that receive the parsed time value when selected time changes.</dd>
+ <dd>Added defaultTime value to use when input field is missing (inline) or input value is empty. If defaultTime is missing then current time is used.</dd>
+
+ <dt>0.0.5 - January 18, 2011</dt>
+ <dd>Now updating time picker selected value when manually typing in the text field (thanks Rasmus Schultz)<br />
+ <small>Another step toward inline time picker ?</small></dd>
+ <dd>Fixed : with showPeriod: true and showLeadingZero: true, PM hours did not show leading zeros (thanks Chandler May)</dd>
+ <dd>Fixed : with showPeriod: true and showLeadingZero: true, Selecting 12 AM shows as 00 AM in the input field, also parsing 12AM did not work correctly (thanks Rasmus Schultz)</dd>
+
+ <dt>0.0.4 - January 10, 2011</dt>
+ <dd>Changed showLeadingZero to affect only hours, added showMinutesLeadingZero for minutes display.</dd>
+ <dd>Changed the default value of timeSeparator from 'h' to ':'.</dd>
+ <dd>Removed width:100% on tables in the css, caused a bug in some browsers.</dd>
+
+ <dt>0.0.3 - January 8, 2011</dt>
+ <dd>Fixed a bug with the widget not displaying with some jQuery UI 1.8.7 css. (Thanks Alexander Fietz)</dd>
+ <dd>Fixed a display bug on page load, a small empty div was visible at the bottom of pages. (Thanks Gertjan van Roekel)</dd>
+ <dd>Modified the jquery-ui-timepicker.css to make the widget more dynamic to style and sizes changes.</dd>
+
+ <dt>0.0.2 - January 4, 2011</dt>
+ <dd>Added showPeriod: period (AM/PM) in input and showLeadingZero: to control display of number < 10. (big thanks Steve Commisso)</dd>
+
+ <dt>0.0.1 - December 2010</dt>
+ <dd>First release</dd>
+ </dl>
+
+ <hr />
+
+ <h2>To Do : </h2>
+
+ <ul>
+ <li>
+ Possibility to use the timepicker for hours only, or minutes only.
+ </li>
+
+ <li>
+ Change the code style to use the jQuery widget framework.
+ </li>
+ <li>
+ Detect a second click on the same cell and close the picker (ie: the user selected hours and do not want to select different minutes or vice versa, and click twice on the same cell instead)
+ This is already simulated with the handling of the double click.
+ </li>
+ </ul>
+
+ </div>
+
+ <!------------------------------------------------------------------------------------------------------------->
+ <!------------------------------------------------------------------------------------------------------------->
+ <!------------------------------------------------------------------------------------------------------------->
+
+ <div id="get_timepicker">
+
+ <h2>Download Timepicker</h2>
+
+ <p>
+ Current version : 0.2.9 - released November 13, 2011
+ </p>
+
+ <p>
+ <a href="http://github.com/fgelinas/timepicker">Get it on github</a>
+ </p>
+
+ <p>
+ <a href="releases/jquery-ui-timepicker-0.2.9.zip">Download from here (.zip)</a>
+ </p>
+
+ <hr >
+
+ <p>
+ I put a lot of time and effort in this project. If you like it, please <span style="text-decoration: line-through">pay me a beer</span> donate
+ <form action="https://www.paypal.com/cgi-bin/webscr" method="post">
+ <input type="hidden" name="cmd" value="_s-xclick">
+ <input type="hidden" name="encrypted" value="-----BEGIN PKCS7-----MIIHXwYJKoZIhvcNAQcEoIIHUDCCB0wCAQExggEwMIIBLAIBADCBlDCBjjELMAkGA1UEBhMCVVMxCzAJBgNVBAgTAkNBMRYwFAYDVQQHEw1Nb3VudGFpbiBWaWV3MRQwEgYDVQQKEwtQYXlQYWwgSW5jLjETMBEGA1UECxQKbGl2ZV9jZXJ0czERMA8GA1UEAxQIbGl2ZV9hcGkxHDAaBgkqhkiG9w0BCQEWDXJlQHBheXBhbC5jb20CAQAwDQYJKoZIhvcNAQEBBQAEgYAWkzIsIl82czV2G3Q9ZXnb/DRAMXxqoRAbR2Ko9MxOohDZFiEVewPWrI/SK/7BiD0ja9juUtjuCVuy1o2biKJBi+iVii4Z3TFPiukwX+WfUymLym+6G0VdNdW6gjrL6UtYUy6c0y/edfwLuZCErAkSfUxa5TusNL8pwgPmtPBK7DELMAkGBSsOAwIaBQAwgdwGCSqGSIb3DQEHATAUBggqhkiG9w0DBwQIA9o7C8ZvFUqAgbjWPJxPrybGa8lccR3EvoJu44RfaBK43kMW+Z20hmldlWqLEx3M87vO5l6qKEBkpAGI9OMexe/qSfVCzbaDDA3pXOjJAKtdMvW0rXKoAvu9BTFJH0eaSWfc+8wO80xRgjdIawgDPlVBmDvd7ZHjMA+otaW85fhGLXBD5OCcdKgx57I2X9UAVkKRSJaFBr5Uoi1jjjToxgmVjggX48rM5siegUMnhXwy4CXZoyZLGPPIVIamwdHQFrr8oIIDhzCCA4MwggLsoAMCAQICAQAwDQYJKoZIhvcNAQEFBQAwgY4xCzAJBgNVBAYTAlVTMQswCQYDVQQIEwJDQTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEUMBIGA1UEChMLUGF5UGFsIEluYy4xEzARBgNVBAsUCmxpdmVfY2VydHMxETAPBgNVBAMUCGxpdmVfYXBpMRwwGgYJKoZIhvcNAQkBFg1yZUBwYXlwYWwuY29tMB4XDTA0MDIxMzEwMTMxNVoXDTM1MDIxMzEwMTMxNVowgY4xCzAJBgNVBAYTAlVTMQswCQYDVQQIEwJDQTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEUMBIGA1UEChMLUGF5UGFsIEluYy4xEzARBgNVBAsUCmxpdmVfY2VydHMxETAPBgNVBAMUCGxpdmVfYXBpMRwwGgYJKoZIhvcNAQkBFg1yZUBwYXlwYWwuY29tMIGfMA0GCSqGSIb3DQEBAQUAA4GNADCBiQKBgQDBR07d/ETMS1ycjtkpkvjXZe9k+6CieLuLsPumsJ7QC1odNz3sJiCbs2wC0nLE0uLGaEtXynIgRqIddYCHx88pb5HTXv4SZeuv0Rqq4+axW9PLAAATU8w04qqjaSXgbGLP3NmohqM6bV9kZZwZLR/klDaQGo1u9uDb9lr4Yn+rBQIDAQABo4HuMIHrMB0GA1UdDgQWBBSWn3y7xm8XvVk/UtcKG+wQ1mSUazCBuwYDVR0jBIGzMIGwgBSWn3y7xm8XvVk/UtcKG+wQ1mSUa6GBlKSBkTCBjjELMAkGA1UEBhMCVVMxCzAJBgNVBAgTAkNBMRYwFAYDVQQHEw1Nb3VudGFpbiBWaWV3MRQwEgYDVQQKEwtQYXlQYWwgSW5jLjETMBEGA1UECxQKbGl2ZV9jZXJ0czERMA8GA1UEAxQIbGl2ZV9hcGkxHDAaBgkqhkiG9w0BCQEWDXJlQHBheXBhbC5jb22CAQAwDAYDVR0TBAUwAwEB/zANBgkqhkiG9w0BAQUFAAOBgQCBXzpWmoBa5e9fo6ujionW1hUhPkOBakTr3YCDjbYfvJEiv/2P+IobhOGJr85+XHhN0v4gUkEDI8r2/rNk1m0GA8HKddvTjyGw/XqXa+LSTlDYkqI8OwR8GEYj4efEtcRpRYBxV8KxAW93YDWzFGvruKnnLbDAF6VR5w/cCMn5hzGCAZowggGWAgEBMIGUMIGOMQswCQYDVQQGEwJVUzELMAkGA1UECBMCQ0ExFjAUBgNVBAcTDU1vdW50YWluIFZpZXcxFDASBgNVBAoTC1BheVBhbCBJbmMuMRMwEQYDVQQLFApsaXZlX2NlcnRzMREwDwYDVQQDFAhsaXZlX2FwaTEcMBoGCSqGSIb3DQEJARYNcmVAcGF5cGFsLmNvbQIBADAJBgUrDgMCGgUAoF0wGAYJKoZIhvcNAQkDMQsGCSqGSIb3DQEHATAcBgkqhkiG9w0BCQUxDxcNMTEwODAzMDExMDA1WjAjBgkqhkiG9w0BCQQxFgQUgo9bH78dF5LRoNM548QKDGlFK6swDQYJKoZIhvcNAQEBBQAEgYBTMfZGH1bq7va+xzcOogdHkk+icmN3+f1FS+1sH5lxbanekELUV/ATDUdnoRMxEuOkGCsl0pLERGqhE0NDN6CwvrLf7mvY/dk/Q5sF1kARmp+4TAXdPkS/GoyVB/hDmBcfMvfVDUD1LFbzfSDnS+GY66Bn+bw3zqKB7Rb9RTWLxg==-----END PKCS7-----
+ ">
+ <input type="image" src="https://www.paypalobjects.com/en_US/i/btn/btn_donate_LG.gif" border="0" name="submit" alt="PayPal - The safer, easier way to pay online!">
+ <img alt="" border="0" src="https://www.paypalobjects.com/en_US/i/scr/pixel.gif" width="1" height="1">
+ </form>
+ </p>
+
+ <hr />
+
+ <p>
+ Instruction for legacy jQuery integration (jQuery 1.2.6 and jQuery UI 1.6)
+ <br>
+
+ <ul>
+ <li>
+ <a href="releases/jquery-ui-timepicker-legacy_support.zip">Get the legacy package here</a>
+ , built with jQuery Timepicker 0.2.4 but should work with newer versions
+ </li>
+ <li>
+ Make sure to include jquery-1.2.6.js, jquery.fix.for.1.2.6.js and jquery.ui.1.6.all.js
+ </li>
+ <li>
+ See the working example in index.html in the "legacy_1.2.6" folder.
+ </li>
+ <li>
+ Support for previous versions of jquery is limited.
+ </li>
+ </ul>
+
+ </p>
+
+ </div>
+</div>
+
+
+<hr />
+<!-- =============================================================================================================== -->
+
+<div id="footer">
+
+
+
+ <p>
+ <strong>New! New!</strong> TimePicker is now 100% more social, on GitHub @ <a href="http://github.com/fgelinas/timepicker">http://github.com/fgelinas/timepicker</a>.
+ </p>
+ <p>
+ Get the release package here : <a href="releases/jquery-ui-timepicker-0.2.9.zip">jquery-ui-timepicker-0.2.9.zip</a>
+ </p>
+
+ <hr />
+
+ <p>
+ <form action="https://www.paypal.com/cgi-bin/webscr" method="post">
+ I put a lot of time and effort in this project. If you like it, please <span style="text-decoration: line-through">pay me a beer</span> donate
+ <input type="hidden" name="cmd" value="_s-xclick">
+ <input type="hidden" name="encrypted" value="-----BEGIN PKCS7-----MIIHXwYJKoZIhvcNAQcEoIIHUDCCB0wCAQExggEwMIIBLAIBADCBlDCBjjELMAkGA1UEBhMCVVMxCzAJBgNVBAgTAkNBMRYwFAYDVQQHEw1Nb3VudGFpbiBWaWV3MRQwEgYDVQQKEwtQYXlQYWwgSW5jLjETMBEGA1UECxQKbGl2ZV9jZXJ0czERMA8GA1UEAxQIbGl2ZV9hcGkxHDAaBgkqhkiG9w0BCQEWDXJlQHBheXBhbC5jb20CAQAwDQYJKoZIhvcNAQEBBQAEgYAOOlt0j59m8piNj+eoHdZuDbEkv/TCvP1r0KRrnnprtQLlNhfnFOEmY1MQbrCs/QJb80MxUS1/O2pNK7z+GzdC3CFn41SIAHiaTVQlQ8HO6C7EqWqkwsVXhgkob/WdDw7BzN5UcI/lPfuhtwTZ2pVrS/FhKt14ce1OJlvwdo4kKTELMAkGBSsOAwIaBQAwgdwGCSqGSIb3DQEHATAUBggqhkiG9w0DBwQIsV1Pn/r0+ReAgbih+9Jwqy8FHU2Ba2iAkKRKBmwv7ZzNqVJ9f23bBu8eBG0EDbQuikn7lXozKnq23Qbjf9BtoX5B/92Ma2Ue/hB6WttZm4ka/nAnnK2lyS+mU8YVagQlieWblUiFzCvcltTDgukcI4L88rLtjmgG4x1Zf/ZBqiYrZzKt/J8wQWAvO69X75qULw6FRr+aFPmO668KtSi0Ggp2IDKpGiTMzaTaf3KChQTvgovPim2+4x6XH5888poSsuHAoIIDhzCCA4MwggLsoAMCAQICAQAwDQYJKoZIhvcNAQEFBQAwgY4xCzAJBgNVBAYTAlVTMQswCQYDVQQIEwJDQTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEUMBIGA1UEChMLUGF5UGFsIEluYy4xEzARBgNVBAsUCmxpdmVfY2VydHMxETAPBgNVBAMUCGxpdmVfYXBpMRwwGgYJKoZIhvcNAQkBFg1yZUBwYXlwYWwuY29tMB4XDTA0MDIxMzEwMTMxNVoXDTM1MDIxMzEwMTMxNVowgY4xCzAJBgNVBAYTAlVTMQswCQYDVQQIEwJDQTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEUMBIGA1UEChMLUGF5UGFsIEluYy4xEzARBgNVBAsUCmxpdmVfY2VydHMxETAPBgNVBAMUCGxpdmVfYXBpMRwwGgYJKoZIhvcNAQkBFg1yZUBwYXlwYWwuY29tMIGfMA0GCSqGSIb3DQEBAQUAA4GNADCBiQKBgQDBR07d/ETMS1ycjtkpkvjXZe9k+6CieLuLsPumsJ7QC1odNz3sJiCbs2wC0nLE0uLGaEtXynIgRqIddYCHx88pb5HTXv4SZeuv0Rqq4+axW9PLAAATU8w04qqjaSXgbGLP3NmohqM6bV9kZZwZLR/klDaQGo1u9uDb9lr4Yn+rBQIDAQABo4HuMIHrMB0GA1UdDgQWBBSWn3y7xm8XvVk/UtcKG+wQ1mSUazCBuwYDVR0jBIGzMIGwgBSWn3y7xm8XvVk/UtcKG+wQ1mSUa6GBlKSBkTCBjjELMAkGA1UEBhMCVVMxCzAJBgNVBAgTAkNBMRYwFAYDVQQHEw1Nb3VudGFpbiBWaWV3MRQwEgYDVQQKEwtQYXlQYWwgSW5jLjETMBEGA1UECxQKbGl2ZV9jZXJ0czERMA8GA1UEAxQIbGl2ZV9hcGkxHDAaBgkqhkiG9w0BCQEWDXJlQHBheXBhbC5jb22CAQAwDAYDVR0TBAUwAwEB/zANBgkqhkiG9w0BAQUFAAOBgQCBXzpWmoBa5e9fo6ujionW1hUhPkOBakTr3YCDjbYfvJEiv/2P+IobhOGJr85+XHhN0v4gUkEDI8r2/rNk1m0GA8HKddvTjyGw/XqXa+LSTlDYkqI8OwR8GEYj4efEtcRpRYBxV8KxAW93YDWzFGvruKnnLbDAF6VR5w/cCMn5hzGCAZowggGWAgEBMIGUMIGOMQswCQYDVQQGEwJVUzELMAkGA1UECBMCQ0ExFjAUBgNVBAcTDU1vdW50YWluIFZpZXcxFDASBgNVBAoTC1BheVBhbCBJbmMuMRMwEQYDVQQLFApsaXZlX2NlcnRzMREwDwYDVQQDFAhsaXZlX2FwaTEcMBoGCSqGSIb3DQEJARYNcmVAcGF5cGFsLmNvbQIBADAJBgUrDgMCGgUAoF0wGAYJKoZIhvcNAQkDMQsGCSqGSIb3DQEHATAcBgkqhkiG9w0BCQUxDxcNMTEwODAzMDExOTA1WjAjBgkqhkiG9w0BCQQxFgQUF1zJZYGVyFN/5C0fJiA3xL4Mgr8wDQYJKoZIhvcNAQEBBQAEgYCgdTdP9XXWmEtk2C7m8A1d4zR1UBxLplBAdiIF3lNrEr3zZFXoptVZ5TMbydvkQKhHrXEsBfjFs7lkB1vU0heqpN4fUmVB5nXUsiv8e/W92yOnJb59DQ4hXG6ASibeynTyGXbQxphj/128LC2lmi2waQdRzSdf5gY+bMZ4OgabQg==-----END PKCS7-----
+ ">
+ <input type="image" src="https://www.paypalobjects.com/en_US/i/btn/btn_donate_SM.gif" border="0" name="submit" alt="PayPal - The safer, easier way to pay online!">
+ <img alt="" border="0" src="https://www.paypalobjects.com/en_US/i/scr/pixel.gif" width="1" height="1">
+ </form>
+ </p>
+
+
+ <hr />
+ Bug, ideas or comments : <a href="mailto:frank@fgelinas.com">frank@fgelinas.com</a>
+
+</div>
+
+</div>
+
+</body>
+</html>
diff --git a/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/jquery.ui.timepicker.css b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/jquery.ui.timepicker.css new file mode 100644 index 0000000..08b442a --- /dev/null +++ b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/jquery.ui.timepicker.css @@ -0,0 +1,69 @@ +/*
+ * Timepicker stylesheet
+ * Highly inspired from datepicker
+ * FG - Nov 2010 - Web3R
+ *
+ * version 0.0.3 : Fixed some settings, more dynamic
+ * version 0.0.4 : Removed width:100% on tables
+ * version 0.1.1 : set width 0 on tables to fix an ie6 bug
+ */
+
+.ui-timepicker-inline { display: inline; }
+
+#ui-timepicker-div { padding: 0.2em }
+.ui-timepicker-table { display: inline-table; width: 0; }
+.ui-timepicker-table table { margin:0.15em 0 0 0; border-collapse: collapse; }
+
+.ui-timepicker-hours, .ui-timepicker-minutes { padding: 0.2em; }
+
+.ui-timepicker-table .ui-timepicker-title { line-height: 1.8em; text-align: center; }
+.ui-timepicker-table td { padding: 0.1em; width: 2.2em; }
+.ui-timepicker-table th.periods { padding: 0.1em; width: 2.2em; }
+
+/* span for disabled cells */
+.ui-timepicker-table td span {
+ display:block;
+ padding:0.2em 0.3em 0.2em 0.5em;
+ width: 1.2em;
+
+ text-align:right;
+ text-decoration:none;
+}
+/* anchors for clickable cells */
+.ui-timepicker-table td a {
+ display:block;
+ padding:0.2em 0.3em 0.2em 0.5em;
+ width: 1.2em;
+ cursor: pointer;
+ text-align:right;
+ text-decoration:none;
+}
+
+
+/* buttons and button pane styling */
+.ui-timepicker .ui-timepicker-buttonpane {
+ background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0;
+}
+.ui-timepicker .ui-timepicker-buttonpane button { margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+/* The close button */
+.ui-timepicker .ui-timepicker-close { float: right }
+
+/* the now button */
+.ui-timepicker .ui-timepicker-now { float: left; }
+
+/* the deselect button */
+.ui-timepicker .ui-timepicker-deselect { float: left; }
+
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-timepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/jquery.ui.timepicker.js b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/jquery.ui.timepicker.js new file mode 100644 index 0000000..d086b67 --- /dev/null +++ b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/jquery.ui.timepicker.js @@ -0,0 +1,1345 @@ +/*
+ * jQuery UI Timepicker 0.2.9
+ *
+ * Copyright 2010-2011, Francois Gelinas
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://fgelinas.com/code/timepicker
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.position.js (only if position settngs are used)
+ *
+ * Change version 0.1.0 - moved the t-rex up here
+ *
+ ____
+ ___ .-~. /_"-._
+ `-._~-. / /_ "~o\ :Y
+ \ \ / : \~x. ` ')
+ ] Y / | Y< ~-.__j
+ / ! _.--~T : l l< /.-~
+ / / ____.--~ . ` l /~\ \<|Y
+ / / .-~~" /| . ',-~\ \L|
+ / / / .^ \ Y~Y \.^>/l_ "--'
+ / Y .-"( . l__ j_j l_/ /~_.-~ .
+ Y l / \ ) ~~~." / `/"~ / \.__/l_
+ | \ _.-" ~-{__ l : l._Z~-.___.--~
+ | ~---~ / ~~"---\_ ' __[>
+ l . _.^ ___ _>-y~
+ \ \ . .-~ .-~ ~>--" /
+ \ ~---" / ./ _.-'
+ "-.,_____.,_ _.--~\ _.-~
+ ~~ ( _} -Row
+ `. ~(
+ ) \
+ /,`--'~\--'~\
+ ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+ ->T-Rex<-
+*/
+
+(function ($, undefined) {
+
+ $.extend($.ui, { timepicker: { version: "0.2.9"} });
+
+ var PROP_NAME = 'timepicker';
+ var tpuuid = new Date().getTime();
+
+ /* Time picker manager.
+ Use the singleton instance of this class, $.timepicker, to interact with the time picker.
+ Settings for (groups of) time pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+ function Timepicker() {
+ this.debug = true; // Change this to true to start debugging
+ this._curInst = null; // The current instance in use
+ this._isInline = false; // true if the instance is displayed inline
+ this._disabledInputs = []; // List of time picker inputs that have been disabled
+ this._timepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._dialogClass = 'ui-timepicker-dialog'; // The name of the dialog marker class
+ this._mainDivId = 'ui-timepicker-div'; // The ID of the main timepicker division
+ this._inlineClass = 'ui-timepicker-inline'; // The name of the inline marker class
+ this._currentClass = 'ui-timepicker-current'; // The name of the current hour / minutes marker class
+ this._dayOverClass = 'ui-timepicker-days-cell-over'; // The name of the day hover marker class
+
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[''] = { // Default regional settings
+ hourText: 'Hour', // Display text for hours section
+ minuteText: 'Minute', // Display text for minutes link
+ amPmText: ['AM', 'PM'], // Display text for AM PM
+ closeButtonText: 'Done', // Text for the confirmation button (ok button)
+ nowButtonText: 'Now', // Text for the now button
+ deselectButtonText: 'Deselect' // Text for the deselect button
+ };
+ this._defaults = { // Global defaults for all the time picker instances
+ showOn: 'focus', // 'focus' for popup on focus,
+ // 'button' for trigger button, or 'both' for either (not yet implemented)
+ button: null, // 'button' element that will trigger the timepicker
+ showAnim: 'fadeIn', // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ appendText: '', // Display text following the input box, e.g. showing the format
+
+ beforeShow: null, // Define a callback function executed before the timepicker is shown
+ onSelect: null, // Define a callback function when a hour / minutes is selected
+ onClose: null, // Define a callback function when the timepicker is closed
+
+ timeSeparator: ':', // The character to use to separate hours and minutes.
+ periodSeparator: ' ', // The character to use to separate the time from the time period.
+ showPeriod: false, // Define whether or not to show AM/PM with selected time
+ showPeriodLabels: true, // Show the AM/PM labels on the left of the time picker
+ showLeadingZero: true, // Define whether or not to show a leading zero for hours < 10. [true/false]
+ showMinutesLeadingZero: true, // Define whether or not to show a leading zero for minutes < 10.
+ altField: '', // Selector for an alternate field to store selected time into
+ defaultTime: 'now', // Used as default time when input field is empty or for inline timePicker
+ // (set to 'now' for the current time, '' for no highlighted time)
+ myPosition: 'left top', // Position of the dialog relative to the input.
+ // see the position utility for more info : http://jqueryui.com/demos/position/
+ atPosition: 'left bottom', // Position of the input element to match
+ // Note : if the position utility is not loaded, the timepicker will attach left top to left bottom
+ //NEW: 2011-02-03
+ onHourShow: null, // callback for enabling / disabling on selectable hours ex : function(hour) { return true; }
+ onMinuteShow: null, // callback for enabling / disabling on time selection ex : function(hour,minute) { return true; }
+
+ hours: {
+ starts: 0, // first displayed hour
+ ends: 23 // last displayed hour
+ },
+ minutes: {
+ starts: 0, // first displayed minute
+ ends: 55, // last displayed minute
+ interval: 5 // interval of displayed minutes
+ },
+ rows: 4, // number of rows for the input tables, minimum 2, makes more sense if you use multiple of 2
+ // 2011-08-05 0.2.4
+ showHours: true, // display the hours section of the dialog
+ showMinutes: true, // display the minute section of the dialog
+ optionalMinutes: false, // optionally parse inputs of whole hours with minutes omitted
+
+ // buttons
+ showCloseButton: false, // shows an OK button to confirm the edit
+ showNowButton: false, // Shows the 'now' button
+ showDeselectButton: false // Shows the deselect time button
+
+ };
+ $.extend(this._defaults, this.regional['']);
+
+ this.tpDiv = $('<div id="' + this._mainDivId + '" class="ui-timepicker ui-widget ui-helper-clearfix ui-corner-all " style="display: none"></div>');
+ }
+
+ $.extend(Timepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a time picker. */
+ markerClassName: 'hasTimepicker',
+
+ /* Debug logging (if enabled). */
+ log: function () {
+ if (this.debug)
+ console.log.apply('', arguments);
+ },
+
+ _widgetTimepicker: function () {
+ return this.tpDiv;
+ },
+
+ /* Override the default settings for all instances of the time picker.
+ @param settings object - the new settings to use as defaults (anonymous object)
+ @return the manager object */
+ setDefaults: function (settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the time picker to a jQuery selection.
+ @param target element - the target input field or division or span
+ @param settings object - the new settings to use for this time picker instance (anonymous) */
+ _attachTimepicker: function (target, settings) {
+ // check for settings on the control itself - in namespace 'time:'
+ var inlineSettings = null;
+ for (var attrName in this._defaults) {
+ var attrValue = target.getAttribute('time:' + attrName);
+ if (attrValue) {
+ inlineSettings = inlineSettings || {};
+ try {
+ inlineSettings[attrName] = eval(attrValue);
+ } catch (err) {
+ inlineSettings[attrName] = attrValue;
+ }
+ }
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ var inline = (nodeName == 'div' || nodeName == 'span');
+
+ if (!target.id) {
+ this.uuid += 1;
+ target.id = 'tp' + this.uuid;
+ }
+ var inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+ if (nodeName == 'input') {
+ this._connectTimepicker(target, inst);
+ // init inst.hours and inst.minutes from the input value
+ this._setTimeFromField(inst);
+ } else if (inline) {
+ this._inlineTimepicker(target, inst);
+ }
+
+
+ },
+
+ /* Create a new instance object. */
+ _newInst: function (target, inline) {
+ var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars
+ return {
+ id: id, input: target, // associated target
+ inline: inline, // is timepicker inline or not :
+ tpDiv: (!inline ? this.tpDiv : // presentation div
+ $('<div class="' + this._inlineClass + ' ui-timepicker ui-widget ui-helper-clearfix"></div>'))
+ };
+ },
+
+ /* Attach the time picker to an input field. */
+ _connectTimepicker: function (target, inst) {
+ var input = $(target);
+ inst.append = $([]);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName)) { return; }
+ this._attachments(input, inst);
+ input.addClass(this.markerClassName).
+ keydown(this._doKeyDown).
+ keyup(this._doKeyUp).
+ bind("setData.timepicker", function (event, key, value) {
+ inst.settings[key] = value;
+ }).
+ bind("getData.timepicker", function (event, key) {
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function (event) {
+ var inst = $.timepicker._getInst(event.target);
+ var handled = true;
+ inst._keyEvent = true;
+ if ($.timepicker._timepickerShowing) {
+ switch (event.keyCode) {
+ case 9: $.timepicker._hideTimepicker();
+ handled = false;
+ break; // hide on tab out
+ case 13:
+ $.timepicker._updateSelectedValue(inst);
+ $.timepicker._hideTimepicker();
+
+ return false; // don't submit the form
+ break; // select the value on enter
+ case 27: $.timepicker._hideTimepicker();
+ break; // hide on escape
+ default: handled = false;
+ }
+ }
+ else if (event.keyCode == 36 && event.ctrlKey) { // display the time picker on ctrl+home
+ $.timepicker._showTimepicker(this);
+ }
+ else {
+ handled = false;
+ }
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Update selected time on keyUp */
+ /* Added verion 0.0.5 */
+ _doKeyUp: function (event) {
+ var inst = $.timepicker._getInst(event.target);
+ $.timepicker._setTimeFromField(inst);
+ $.timepicker._updateTimepicker(inst);
+ },
+
+ /* Make attachments based on settings. */
+ _attachments: function (input, inst) {
+ var appendText = this._get(inst, 'appendText');
+ var isRTL = this._get(inst, 'isRTL');
+ if (inst.append) { inst.append.remove(); }
+ if (appendText) {
+ inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
+ input[isRTL ? 'before' : 'after'](inst.append);
+ }
+ input.unbind('focus.timepicker', this._showTimepicker);
+ if (inst.trigger) { inst.trigger.remove(); }
+
+ var showOn = this._get(inst, 'showOn');
+ if (showOn == 'focus' || showOn == 'both') { // pop-up time picker when in the marked field
+ input.bind("focus.timepicker", this._showTimepicker);
+ }
+ if (showOn == 'button' || showOn == 'both') { // pop-up time picker when 'button' element is clicked
+ var button = this._get(inst, 'button');
+ $(button).bind("click.timepicker", function () {
+ if ($.timepicker._timepickerShowing && $.timepicker._lastInput == input[0]) { $.timepicker._hideTimepicker(); }
+ else { $.timepicker._showTimepicker(input[0]); }
+ return false;
+ });
+
+ }
+ },
+
+
+ /* Attach an inline time picker to a div. */
+ _inlineTimepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName))
+ return;
+ divSpan.addClass(this.markerClassName).append(inst.tpDiv).
+ bind("setData.timepicker", function(event, key, value){
+ inst.settings[key] = value;
+ }).bind("getData.timepicker", function(event, key){
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+
+ this._setTimeFromField(inst);
+ this._updateTimepicker(inst);
+ inst.tpDiv.show();
+ },
+
+ /* Pop-up the time picker for a given input field.
+ @param input element - the input field attached to the time picker or
+ event - if triggered by focus */
+ _showTimepicker: function (input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() != 'input') { input = $('input', input.parentNode)[0]; } // find from button/image trigger
+ if ($.timepicker._isDisabledTimepicker(input) || $.timepicker._lastInput == input) { return; } // already here
+
+ // fix v 0.0.8 - close current timepicker before showing another one
+ $.timepicker._hideTimepicker();
+
+ var inst = $.timepicker._getInst(input);
+ if ($.timepicker._curInst && $.timepicker._curInst != inst) {
+ $.timepicker._curInst.tpDiv.stop(true, true);
+ }
+ var beforeShow = $.timepicker._get(inst, 'beforeShow');
+ extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
+ inst.lastVal = null;
+ $.timepicker._lastInput = input;
+
+ $.timepicker._setTimeFromField(inst);
+
+ // calculate default position
+ if ($.timepicker._inDialog) { input.value = ''; } // hide cursor
+ if (!$.timepicker._pos) { // position below input
+ $.timepicker._pos = $.timepicker._findPos(input);
+ $.timepicker._pos[1] += input.offsetHeight; // add the height
+ }
+ var isFixed = false;
+ $(input).parents().each(function () {
+ isFixed |= $(this).css('position') == 'fixed';
+ return !isFixed;
+ });
+ if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+ $.timepicker._pos[0] -= document.documentElement.scrollLeft;
+ $.timepicker._pos[1] -= document.documentElement.scrollTop;
+ }
+
+ var offset = { left: $.timepicker._pos[0], top: $.timepicker._pos[1] };
+
+ $.timepicker._pos = null;
+ // determine sizing offscreen
+ inst.tpDiv.css({ position: 'absolute', display: 'block', top: '-1000px' });
+ $.timepicker._updateTimepicker(inst);
+
+
+ // position with the ui position utility, if loaded
+ if ( ( ! inst.inline ) && ( typeof $.ui.position == 'object' ) ) {
+ inst.tpDiv.position({
+ of: inst.input,
+ my: $.timepicker._get( inst, 'myPosition' ),
+ at: $.timepicker._get( inst, 'atPosition' ),
+ // offset: $( "#offset" ).val(),
+ // using: using,
+ collision: 'flip'
+ });
+ var offset = inst.tpDiv.offset();
+ $.timepicker._pos = [offset.top, offset.left];
+ }
+
+
+ // reset clicked state
+ inst._hoursClicked = false;
+ inst._minutesClicked = false;
+
+ // fix width for dynamic number of time pickers
+ // and adjust position before showing
+ offset = $.timepicker._checkOffset(inst, offset, isFixed);
+ inst.tpDiv.css({ position: ($.timepicker._inDialog && $.blockUI ?
+ 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+ left: offset.left + 'px', top: offset.top + 'px'
+ });
+ if ( ! inst.inline ) {
+ var showAnim = $.timepicker._get(inst, 'showAnim');
+ var duration = $.timepicker._get(inst, 'duration');
+
+ var postProcess = function () {
+ $.timepicker._timepickerShowing = true;
+ var borders = $.timepicker._getBorders(inst.tpDiv);
+ inst.tpDiv.find('iframe.ui-timepicker-cover'). // IE6- only
+ css({ left: -borders[0], top: -borders[1],
+ width: inst.tpDiv.outerWidth(), height: inst.tpDiv.outerHeight()
+ });
+ };
+
+ // Fixed the zIndex problem for real (I hope) - FG - v 0.2.9
+ inst.tpDiv.css('zIndex', $.timepicker._getZIndex(input) +1);
+
+ if ($.effects && $.effects[showAnim]) {
+ inst.tpDiv.show(showAnim, $.timepicker._get(inst, 'showOptions'), duration, postProcess);
+ }
+ else {
+ inst.tpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess);
+ }
+ if (!showAnim || !duration) { postProcess(); }
+ if (inst.input.is(':visible') && !inst.input.is(':disabled')) { inst.input.focus(); }
+ $.timepicker._curInst = inst;
+ }
+ },
+
+ // This is a copy of the zIndex function of UI core 1.8.??
+ // Copied in the timepicker to stay backward compatible.
+ _getZIndex: function (target) {
+ var elem = $( target ), position, value;
+ while ( elem.length && elem[ 0 ] !== document ) {
+ position = elem.css( "position" );
+ if ( position === "absolute" || position === "relative" || position === "fixed" ) {
+ value = parseInt( elem.css( "zIndex" ), 10 );
+ if ( !isNaN( value ) && value !== 0 ) {
+ return value;
+ }
+ }
+ elem = elem.parent();
+ }
+ },
+
+ /* Generate the time picker content. */
+ _updateTimepicker: function (inst) {
+ inst.tpDiv.empty().append(this._generateHTML(inst));
+ this._rebindDialogEvents(inst);
+
+ },
+
+ _rebindDialogEvents: function (inst) {
+ var borders = $.timepicker._getBorders(inst.tpDiv),
+ self = this;
+ inst.tpDiv
+ .find('iframe.ui-timepicker-cover') // IE6- only
+ .css({ left: -borders[0], top: -borders[1],
+ width: inst.tpDiv.outerWidth(), height: inst.tpDiv.outerHeight()
+ })
+ .end()
+ // after the picker html is appended bind the click & double click events (faster in IE this way
+ // then letting the browser interpret the inline events)
+ // the binding for the minute cells also exists in _updateMinuteDisplay
+ .find('.ui-timepicker-minute-cell')
+ .unbind()
+ .bind("click", { fromDoubleClick:false }, $.proxy($.timepicker.selectMinutes, this))
+ .bind("dblclick", { fromDoubleClick:true }, $.proxy($.timepicker.selectMinutes, this))
+ .end()
+ .find('.ui-timepicker-hour-cell')
+ .unbind()
+ .bind("click", { fromDoubleClick:false }, $.proxy($.timepicker.selectHours, this))
+ .bind("dblclick", { fromDoubleClick:true }, $.proxy($.timepicker.selectHours, this))
+ .end()
+ .find('.ui-timepicker td a')
+ .unbind()
+ .bind('mouseout', function () {
+ $(this).removeClass('ui-state-hover');
+ if (this.className.indexOf('ui-timepicker-prev') != -1) $(this).removeClass('ui-timepicker-prev-hover');
+ if (this.className.indexOf('ui-timepicker-next') != -1) $(this).removeClass('ui-timepicker-next-hover');
+ })
+ .bind('mouseover', function () {
+ if ( ! self._isDisabledTimepicker(inst.inline ? inst.tpDiv.parent()[0] : inst.input[0])) {
+ $(this).parents('.ui-timepicker-calendar').find('a').removeClass('ui-state-hover');
+ $(this).addClass('ui-state-hover');
+ if (this.className.indexOf('ui-timepicker-prev') != -1) $(this).addClass('ui-timepicker-prev-hover');
+ if (this.className.indexOf('ui-timepicker-next') != -1) $(this).addClass('ui-timepicker-next-hover');
+ }
+ })
+ .end()
+ .find('.' + this._dayOverClass + ' a')
+ .trigger('mouseover')
+ .end()
+ .find('.ui-timepicker-now').bind("click",function(e) {
+ $.timepicker.selectNow(e);
+ }).end()
+ .find('.ui-timepicker-deselect').bind("click",function(e) {
+ $.timepicker.deselectTime(e);
+ }).end()
+ .find('.ui-timepicker-close').bind("click",function(e) {
+ $.timepicker._hideTimepicker();
+ }).end();
+ },
+
+ /* Generate the HTML for the current state of the time picker. */
+ _generateHTML: function (inst) {
+
+ var h, m, row, col, html, hoursHtml, minutesHtml = '',
+ showPeriod = (this._get(inst, 'showPeriod') == true),
+ showPeriodLabels = (this._get(inst, 'showPeriodLabels') == true),
+ showLeadingZero = (this._get(inst, 'showLeadingZero') == true),
+ showHours = (this._get(inst, 'showHours') == true),
+ showMinutes = (this._get(inst, 'showMinutes') == true),
+ amPmText = this._get(inst, 'amPmText'),
+ rows = this._get(inst, 'rows'),
+ amRows = 0,
+ pmRows = 0,
+ amItems = 0,
+ pmItems = 0,
+ amFirstRow = 0,
+ pmFirstRow = 0,
+ hours = Array(),
+ hours_options = this._get(inst, 'hours'),
+ hoursPerRow = null,
+ hourCounter = 0,
+ hourLabel = this._get(inst, 'hourText'),
+ showCloseButton = this._get(inst, 'showCloseButton'),
+ closeButtonText = this._get(inst, 'closeButtonText'),
+ showNowButton = this._get(inst, 'showNowButton'),
+ nowButtonText = this._get(inst, 'nowButtonText'),
+ showDeselectButton = this._get(inst, 'showDeselectButton'),
+ deselectButtonText = this._get(inst, 'deselectButtonText'),
+ showButtonPanel = showCloseButton || showNowButton || showDeselectButton;
+
+
+
+ // prepare all hours and minutes, makes it easier to distribute by rows
+ for (h = hours_options.starts; h <= hours_options.ends; h++) {
+ hours.push (h);
+ }
+ hoursPerRow = Math.ceil(hours.length / rows); // always round up
+
+ if (showPeriodLabels) {
+ for (hourCounter = 0; hourCounter < hours.length; hourCounter++) {
+ if (hours[hourCounter] < 12) {
+ amItems++;
+ }
+ else {
+ pmItems++;
+ }
+ }
+ hourCounter = 0;
+
+ amRows = Math.floor(amItems / hours.length * rows);
+ pmRows = Math.floor(pmItems / hours.length * rows);
+
+ // assign the extra row to the period that is more densly populated
+ if (rows != amRows + pmRows) {
+ // Make sure: AM Has Items and either PM Does Not, AM has no rows yet, or AM is more dense
+ if (amItems && (!pmItems || !amRows || (pmRows && amItems / amRows >= pmItems / pmRows))) {
+ amRows++;
+ } else {
+ pmRows++;
+ }
+ }
+ amFirstRow = Math.min(amRows, 1);
+ pmFirstRow = amRows + 1;
+ hoursPerRow = Math.ceil(Math.max(amItems / amRows, pmItems / pmRows));
+ }
+
+
+ html = '<table class="ui-timepicker-table ui-widget-content ui-corner-all"><tr>';
+
+ if (showHours) {
+
+ html += '<td class="ui-timepicker-hours">' +
+ '<div class="ui-timepicker-title ui-widget-header ui-helper-clearfix ui-corner-all">' +
+ hourLabel +
+ '</div>' +
+ '<table class="ui-timepicker">';
+
+ for (row = 1; row <= rows; row++) {
+ html += '<tr>';
+ // AM
+ if (row == amFirstRow && showPeriodLabels) {
+ html += '<th rowspan="' + amRows.toString() + '" class="periods" scope="row">' + amPmText[0] + '</th>';
+ }
+ // PM
+ if (row == pmFirstRow && showPeriodLabels) {
+ html += '<th rowspan="' + pmRows.toString() + '" class="periods" scope="row">' + amPmText[1] + '</th>';
+ }
+ for (col = 1; col <= hoursPerRow; col++) {
+ if (showPeriodLabels && row < pmFirstRow && hours[hourCounter] >= 12) {
+ html += this._generateHTMLHourCell(inst, undefined, showPeriod, showLeadingZero);
+ } else {
+ html += this._generateHTMLHourCell(inst, hours[hourCounter], showPeriod, showLeadingZero);
+ hourCounter++;
+ }
+ }
+ html += '</tr>';
+ }
+ html += '</tr></table>' + // Close the hours cells table
+ '</td>'; // Close the Hour td
+ }
+
+ if (showMinutes) {
+ html += '<td class="ui-timepicker-minutes">';
+ html += this._generateHTMLMinutes(inst);
+ html += '</td>';
+ }
+
+ html += '</tr>';
+
+
+ if (showButtonPanel) {
+ var buttonPanel = '<tr><td colspan="3"><div class="ui-timepicker-buttonpane ui-widget-content">';
+ if (showNowButton) {
+ buttonPanel += '<button type="button" class="ui-timepicker-now ui-state-default ui-corner-all" '
+ + ' data-timepicker-instance-id="#' + inst.id.replace(/\\\\/g,"\\") + '" >'
+ + nowButtonText + '</button>';
+ }
+ if (showDeselectButton) {
+ buttonPanel += '<button type="button" class="ui-timepicker-deselect ui-state-default ui-corner-all" '
+ + ' data-timepicker-instance-id="#' + inst.id.replace(/\\\\/g,"\\") + '" >'
+ + deselectButtonText + '</button>';
+ }
+ if (showCloseButton) {
+ buttonPanel += '<button type="button" class="ui-timepicker-close ui-state-default ui-corner-all" '
+ + ' data-timepicker-instance-id="#' + inst.id.replace(/\\\\/g,"\\") + '" >'
+ + closeButtonText + '</button>';
+ }
+
+ html += buttonPanel + '</div></td></tr>';
+ }
+ html += '</table>';
+
+ /* IE6 IFRAME FIX (taken from datepicker 1.5.3, fixed in 0.1.2 */
+ html += ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ '<iframe src="javascript:false;" class="ui-timepicker-cover" frameborder="0"></iframe>' : '');
+
+ return html;
+ },
+
+ /* Special function that update the minutes selection in currently visible timepicker
+ * called on hour selection when onMinuteShow is defined */
+ _updateMinuteDisplay: function (inst) {
+ var newHtml = this._generateHTMLMinutes(inst);
+ inst.tpDiv.find('td.ui-timepicker-minutes').html(newHtml);
+ this._rebindDialogEvents(inst);
+ // after the picker html is appended bind the click & double click events (faster in IE this way
+ // then letting the browser interpret the inline events)
+ // yes I know, duplicate code, sorry
+/* .find('.ui-timepicker-minute-cell')
+ .bind("click", { fromDoubleClick:false }, $.proxy($.timepicker.selectMinutes, this))
+ .bind("dblclick", { fromDoubleClick:true }, $.proxy($.timepicker.selectMinutes, this));
+*/
+
+ },
+
+ /*
+ * Generate the minutes table
+ * This is separated from the _generateHTML function because is can be called separately (when hours changes)
+ */
+ _generateHTMLMinutes: function (inst) {
+
+ var m, row, html = '',
+ rows = this._get(inst, 'rows'),
+ minutes = Array(),
+ minutes_options = this._get(inst, 'minutes'),
+ minutesPerRow = null,
+ minuteCounter = 0,
+ showMinutesLeadingZero = (this._get(inst, 'showMinutesLeadingZero') == true),
+ onMinuteShow = this._get(inst, 'onMinuteShow'),
+ minuteLabel = this._get(inst, 'minuteText');
+
+ if ( ! minutes_options.starts) {
+ minutes_options.starts = 0;
+ }
+ if ( ! minutes_options.ends) {
+ minutes_options.ends = 59;
+ }
+ for (m = minutes_options.starts; m <= minutes_options.ends; m += minutes_options.interval) {
+ minutes.push(m);
+ }
+ minutesPerRow = Math.round(minutes.length / rows + 0.49); // always round up
+
+ /*
+ * The minutes table
+ */
+ // if currently selected minute is not enabled, we have a problem and need to select a new minute.
+ if (onMinuteShow &&
+ (onMinuteShow.apply((inst.input ? inst.input[0] : null), [inst.hours , inst.minutes]) == false) ) {
+ // loop minutes and select first available
+ for (minuteCounter = 0; minuteCounter < minutes.length; minuteCounter += 1) {
+ m = minutes[minuteCounter];
+ if (onMinuteShow.apply((inst.input ? inst.input[0] : null), [inst.hours, m])) {
+ inst.minutes = m;
+ break;
+ }
+ }
+ }
+
+
+
+ html += '<div class="ui-timepicker-title ui-widget-header ui-helper-clearfix ui-corner-all">' +
+ minuteLabel +
+ '</div>' +
+ '<table class="ui-timepicker">';
+
+ minuteCounter = 0;
+ for (row = 1; row <= rows; row++) {
+ html += '<tr>';
+ while (minuteCounter < row * minutesPerRow) {
+ var m = minutes[minuteCounter];
+ var displayText = '';
+ if (m !== undefined ) {
+ displayText = (m < 10) && showMinutesLeadingZero ? "0" + m.toString() : m.toString();
+ }
+ html += this._generateHTMLMinuteCell(inst, m, displayText);
+ minuteCounter++;
+ }
+ html += '</tr>';
+ }
+
+ html += '</table>';
+
+ return html;
+ },
+
+ /* Generate the content of a "Hour" cell */
+ _generateHTMLHourCell: function (inst, hour, showPeriod, showLeadingZero) {
+
+ var displayHour = hour;
+ if ((hour > 12) && showPeriod) {
+ displayHour = hour - 12;
+ }
+ if ((displayHour == 0) && showPeriod) {
+ displayHour = 12;
+ }
+ if ((displayHour < 10) && showLeadingZero) {
+ displayHour = '0' + displayHour;
+ }
+
+ var html = "";
+ var enabled = true;
+ var onHourShow = this._get(inst, 'onHourShow'); //custom callback
+
+ if (hour == undefined) {
+ html = '<td><span class="ui-state-default ui-state-disabled"> </span></td>';
+ return html;
+ }
+
+ if (onHourShow) {
+ enabled = onHourShow.apply((inst.input ? inst.input[0] : null), [hour]);
+ }
+
+ if (enabled) {
+ html = '<td class="ui-timepicker-hour-cell" data-timepicker-instance-id="#' + inst.id.replace(/\\\\/g,"\\") + '" data-hour="' + hour.toString() + '">' +
+ '<a class="ui-state-default ' +
+ (hour == inst.hours ? 'ui-state-active' : '') +
+ '">' +
+ displayHour.toString() +
+ '</a></td>';
+ }
+ else {
+ html =
+ '<td>' +
+ '<span class="ui-state-default ui-state-disabled ' +
+ (hour == inst.hours ? ' ui-state-active ' : ' ') +
+ '">' +
+ displayHour.toString() +
+ '</span>' +
+ '</td>';
+ }
+ return html;
+ },
+
+ /* Generate the content of a "Hour" cell */
+ _generateHTMLMinuteCell: function (inst, minute, displayText) {
+ var html = "";
+ var enabled = true;
+ var onMinuteShow = this._get(inst, 'onMinuteShow'); //custom callback
+ if (onMinuteShow) {
+ //NEW: 2011-02-03 we should give the hour as a parameter as well!
+ enabled = onMinuteShow.apply((inst.input ? inst.input[0] : null), [inst.hours,minute]); //trigger callback
+ }
+
+ if (minute == undefined) {
+ html = '<td><span class="ui-state-default ui-state-disabled"> </span></td>';
+ return html;
+ }
+
+ if (enabled) {
+ html = '<td class="ui-timepicker-minute-cell" data-timepicker-instance-id="#' + inst.id.replace(/\\\\/g,"\\") + '" data-minute="' + minute.toString() + '" >' +
+ '<a class="ui-state-default ' +
+ (minute == inst.minutes ? 'ui-state-active' : '') +
+ '" >' +
+ displayText +
+ '</a></td>';
+ }
+ else {
+
+ html = '<td>' +
+ '<span class="ui-state-default ui-state-disabled" >' +
+ displayText +
+ '</span>' +
+ '</td>';
+ }
+ return html;
+ },
+
+
+ /* Enable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _enableTimepicker: function(target) {
+ var $target = $(target),
+ target_id = $target.attr('id'),
+ inst = $.data(target, PROP_NAME);
+
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = false;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = false; }).end();
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().removeClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target_id ? null : value); }); // delete entry
+ },
+
+ /* Disable the time picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _disableTimepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = true;
+
+ inst.trigger.filter('button').
+ each(function() { this.disabled = true; }).end();
+
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().addClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = $target.attr('id');
+ },
+
+ /* Is the first field in a jQuery collection disabled as a timepicker?
+ @param target_id element - the target input field or division or span
+ @return boolean - true if disabled, false if enabled */
+ _isDisabledTimepicker: function (target_id) {
+ if ( ! target_id) { return false; }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] == target_id) { return true; }
+ }
+ return false;
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function (inst, offset, isFixed) {
+ var tpWidth = inst.tpDiv.outerWidth();
+ var tpHeight = inst.tpDiv.outerHeight();
+ var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+ var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+ var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft();
+ var viewHeight = document.documentElement.clientHeight + $(document).scrollTop();
+
+ offset.left -= (this._get(inst, 'isRTL') ? (tpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= Math.min(offset.left, (offset.left + tpWidth > viewWidth && viewWidth > tpWidth) ?
+ Math.abs(offset.left + tpWidth - viewWidth) : 0);
+ offset.top -= Math.min(offset.top, (offset.top + tpHeight > viewHeight && viewHeight > tpHeight) ?
+ Math.abs(tpHeight + inputHeight) : 0);
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function (obj) {
+ var inst = this._getInst(obj);
+ var isRTL = this._get(inst, 'isRTL');
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
+ obj = obj[isRTL ? 'previousSibling' : 'nextSibling'];
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Retrieve the size of left and top borders for an element.
+ @param elem (jQuery object) the element of interest
+ @return (number[2]) the left and top borders */
+ _getBorders: function (elem) {
+ var convert = function (value) {
+ return { thin: 1, medium: 2, thick: 3}[value] || value;
+ };
+ return [parseFloat(convert(elem.css('border-left-width'))),
+ parseFloat(convert(elem.css('border-top-width')))];
+ },
+
+
+ /* Close time picker if clicked elsewhere. */
+ _checkExternalClick: function (event) {
+ if (!$.timepicker._curInst) { return; }
+ var $target = $(event.target);
+ if ($target[0].id != $.timepicker._mainDivId &&
+ $target.parents('#' + $.timepicker._mainDivId).length == 0 &&
+ !$target.hasClass($.timepicker.markerClassName) &&
+ !$target.hasClass($.timepicker._triggerClass) &&
+ $.timepicker._timepickerShowing && !($.timepicker._inDialog && $.blockUI))
+ $.timepicker._hideTimepicker();
+ },
+
+ /* Hide the time picker from view.
+ @param input element - the input field attached to the time picker */
+ _hideTimepicker: function (input) {
+ var inst = this._curInst;
+ if (!inst || (input && inst != $.data(input, PROP_NAME))) { return; }
+ if (this._timepickerShowing) {
+ var showAnim = this._get(inst, 'showAnim');
+ var duration = this._get(inst, 'duration');
+ var postProcess = function () {
+ $.timepicker._tidyDialog(inst);
+ this._curInst = null;
+ };
+ if ($.effects && $.effects[showAnim]) {
+ inst.tpDiv.hide(showAnim, $.timepicker._get(inst, 'showOptions'), duration, postProcess);
+ }
+ else {
+ inst.tpDiv[(showAnim == 'slideDown' ? 'slideUp' :
+ (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess);
+ }
+ if (!showAnim) { postProcess(); }
+ var onClose = this._get(inst, 'onClose');
+ if (onClose) {
+ onClose.apply(
+ (inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
+ }
+ this._timepickerShowing = false;
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+ if ($.blockUI) {
+ $.unblockUI();
+ $('body').append(this.tpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ },
+
+
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function (inst) {
+ inst.tpDiv.removeClass(this._dialogClass).unbind('.ui-timepicker');
+ },
+
+ /* Retrieve the instance data for the target control.
+ @param target element - the target input field or division or span
+ @return object - the associated instance data
+ @throws error if a jQuery problem getting data */
+ _getInst: function (target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw 'Missing instance data for this timepicker';
+ }
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function (inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing time and initialise time picker. */
+ _setTimeFromField: function (inst) {
+ if (inst.input.val() == inst.lastVal) { return; }
+ var defaultTime = this._get(inst, 'defaultTime');
+
+ var timeToParse = defaultTime == 'now' ? this._getCurrentTimeRounded(inst) : defaultTime;
+ if ((inst.inline == false) && (inst.input.val() != '')) { timeToParse = inst.input.val() }
+
+ if (timeToParse instanceof Date) {
+ inst.hours = timeToParse.getHours();
+ inst.minutes = timeToParse.getMinutes();
+ } else {
+ var timeVal = inst.lastVal = timeToParse;
+ if (timeToParse == '') {
+ inst.hours = -1;
+ inst.minutes = -1;
+ } else {
+ var time = this.parseTime(inst, timeVal);
+ inst.hours = time.hours;
+ inst.minutes = time.minutes;
+ }
+ }
+
+
+ $.timepicker._updateTimepicker(inst);
+ },
+
+ /* Update or retrieve the settings for an existing time picker.
+ @param target element - the target input field or division or span
+ @param name object - the new settings to update or
+ string - the name of the setting to change or retrieve,
+ when retrieving also 'all' for all instance settings or
+ 'defaults' for all global defaults
+ @param value any - the new value for the setting
+ (omit if above is an object or to retrieve a value) */
+ _optionTimepicker: function(target, name, value) {
+ var inst = this._getInst(target);
+ if (arguments.length == 2 && typeof name == 'string') {
+ return (name == 'defaults' ? $.extend({}, $.timepicker._defaults) :
+ (inst ? (name == 'all' ? $.extend({}, inst.settings) :
+ this._get(inst, name)) : null));
+ }
+ var settings = name || {};
+ if (typeof name == 'string') {
+ settings = {};
+ settings[name] = value;
+ }
+ if (inst) {
+ if (this._curInst == inst) {
+ this._hideTimepicker();
+ }
+ extendRemove(inst.settings, settings);
+ this._updateTimepicker(inst);
+ }
+ },
+
+
+ /* Set the time for a jQuery selection.
+ @param target element - the target input field or division or span
+ @param time String - the new time */
+ _setTimeTimepicker: function(target, time) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setTime(inst, time);
+ this._updateTimepicker(inst);
+ this._updateAlternate(inst, time);
+ }
+ },
+
+ /* Set the time directly. */
+ _setTime: function(inst, time, noChange) {
+ var origHours = inst.hours;
+ var origMinutes = inst.minutes;
+ var time = this.parseTime(inst, time);
+ inst.hours = time.hours;
+ inst.minutes = time.minutes;
+
+ if ((origHours != inst.hours || origMinutes != inst.minuts) && !noChange) {
+ inst.input.trigger('change');
+ }
+ this._updateTimepicker(inst);
+ this._updateSelectedValue(inst);
+ },
+
+ /* Return the current time, ready to be parsed, rounded to the closest 5 minute */
+ _getCurrentTimeRounded: function (inst) {
+ var currentTime = new Date(),
+ currentMinutes = currentTime.getMinutes(),
+ // round to closest 5
+ adjustedMinutes = Math.round( currentMinutes / 5 ) * 5;
+ currentTime.setMinutes(adjustedMinutes);
+ return currentTime;
+ },
+
+ /*
+ * Parse a time string into hours and minutes
+ */
+ parseTime: function (inst, timeVal) {
+ var retVal = new Object();
+ retVal.hours = -1;
+ retVal.minutes = -1;
+
+ var timeSeparator = this._get(inst, 'timeSeparator'),
+ amPmText = this._get(inst, 'amPmText'),
+ showHours = this._get(inst, 'showHours'),
+ showMinutes = this._get(inst, 'showMinutes'),
+ optionalMinutes = this._get(inst, 'optionalMinutes'),
+ showPeriod = (this._get(inst, 'showPeriod') == true),
+ p = timeVal.indexOf(timeSeparator);
+
+ // check if time separator found
+ if (p != -1) {
+ retVal.hours = parseInt(timeVal.substr(0, p), 10);
+ retVal.minutes = parseInt(timeVal.substr(p + 1), 10);
+ }
+ // check for hours only
+ else if ( (showHours) && ( !showMinutes || optionalMinutes ) ) {
+ retVal.hours = parseInt(timeVal, 10);
+ }
+ // check for minutes only
+ else if ( ( ! showHours) && (showMinutes) ) {
+ retVal.minutes = parseInt(timeVal, 10);
+ }
+
+ if (showHours) {
+ var timeValUpper = timeVal.toUpperCase();
+ if ((retVal.hours < 12) && (showPeriod) && (timeValUpper.indexOf(amPmText[1].toUpperCase()) != -1)) {
+ retVal.hours += 12;
+ }
+ // fix for 12 AM
+ if ((retVal.hours == 12) && (showPeriod) && (timeValUpper.indexOf(amPmText[0].toUpperCase()) != -1)) {
+ retVal.hours = 0;
+ }
+ }
+
+ return retVal;
+ },
+
+ selectNow: function(e) {
+
+ var id = $(e.target).attr("data-timepicker-instance-id"),
+ $target = $(id),
+ inst = this._getInst($target[0]);
+
+ //if (!inst || (input && inst != $.data(input, PROP_NAME))) { return; }
+ var currentTime = new Date();
+ inst.hours = currentTime.getHours();
+ inst.minutes = currentTime.getMinutes();
+ this._updateSelectedValue(inst);
+ this._updateTimepicker(inst);
+ this._hideTimepicker();
+ },
+
+ deselectTime: function(e) {
+ var id = $(e.target).attr("data-timepicker-instance-id"),
+ $target = $(id),
+ inst = this._getInst($target[0]);
+ inst.hours = -1;
+ inst.minutes = -1;
+ this._updateSelectedValue(inst);
+ this._hideTimepicker();
+ },
+
+
+ selectHours: function (event) {
+ var $td = $(event.currentTarget),
+ id = $td.attr("data-timepicker-instance-id"),
+ newHours = $td.attr("data-hour"),
+ fromDoubleClick = event.data.fromDoubleClick,
+ $target = $(id),
+ inst = this._getInst($target[0]),
+ showMinutes = (this._get(inst, 'showMinutes') == true);
+
+ // don't select if disabled
+ if ( $.timepicker._isDisabledTimepicker($target.attr('id')) ) { return false }
+
+ $td.parents('.ui-timepicker-hours:first').find('a').removeClass('ui-state-active');
+ $td.children('a').addClass('ui-state-active');
+ inst.hours = newHours;
+
+ // added for onMinuteShow callback
+ var onMinuteShow = this._get(inst, 'onMinuteShow');
+ if (onMinuteShow) {
+ // this will trigger a callback on selected hour to make sure selected minute is allowed.
+ this._updateMinuteDisplay(inst);
+ }
+
+ this._updateSelectedValue(inst);
+
+ inst._hoursClicked = true;
+ if ((inst._minutesClicked) || (fromDoubleClick) || (showMinutes == false)) {
+ $.timepicker._hideTimepicker();
+ }
+ // return false because if used inline, prevent the url to change to a hashtag
+ return false;
+ },
+
+ selectMinutes: function (event) {
+ var $td = $(event.currentTarget),
+ id = $td.attr("data-timepicker-instance-id"),
+ newMinutes = $td.attr("data-minute"),
+ fromDoubleClick = event.data.fromDoubleClick,
+ $target = $(id),
+ inst = this._getInst($target[0]),
+ showHours = (this._get(inst, 'showHours') == true);
+
+ // don't select if disabled
+ if ( $.timepicker._isDisabledTimepicker($target.attr('id')) ) { return false }
+
+ $td.parents('.ui-timepicker-minutes:first').find('a').removeClass('ui-state-active');
+ $td.children('a').addClass('ui-state-active');
+
+ inst.minutes = newMinutes;
+ this._updateSelectedValue(inst);
+
+ inst._minutesClicked = true;
+ if ((inst._hoursClicked) || (fromDoubleClick) || (showHours == false)) {
+ $.timepicker._hideTimepicker();
+ // return false because if used inline, prevent the url to change to a hashtag
+ return false;
+ }
+
+ // return false because if used inline, prevent the url to change to a hashtag
+ return false;
+ },
+
+ _updateSelectedValue: function (inst) {
+ var newTime = this._getParsedTime(inst);
+ if (inst.input) {
+ inst.input.val(newTime);
+ inst.input.trigger('change');
+ }
+ var onSelect = this._get(inst, 'onSelect');
+ if (onSelect) { onSelect.apply((inst.input ? inst.input[0] : null), [newTime, inst]); } // trigger custom callback
+ this._updateAlternate(inst, newTime);
+ return newTime;
+ },
+
+ /* this function process selected time and return it parsed according to instance options */
+ _getParsedTime: function(inst) {
+
+ if (inst.hours == -1 && inst.minutes == -1) {
+ return '';
+ }
+
+ if ((inst.hours < 0) || (inst.hours > 23)) { inst.hours = 12; }
+ if ((inst.minutes < 0) || (inst.minutes > 59)) { inst.minutes = 0; }
+
+ var period = "",
+ showPeriod = (this._get(inst, 'showPeriod') == true),
+ showLeadingZero = (this._get(inst, 'showLeadingZero') == true),
+ showHours = (this._get(inst, 'showHours') == true),
+ showMinutes = (this._get(inst, 'showMinutes') == true),
+ optionalMinutes = (this._get(inst, 'optionalMinutes') == true),
+ amPmText = this._get(inst, 'amPmText'),
+ selectedHours = inst.hours ? inst.hours : 0,
+ selectedMinutes = inst.minutes ? inst.minutes : 0,
+ displayHours = selectedHours ? selectedHours : 0,
+ parsedTime = '';
+
+ if (showPeriod) {
+ if (inst.hours == 0) {
+ displayHours = 12;
+ }
+ if (inst.hours < 12) {
+ period = amPmText[0];
+ }
+ else {
+ period = amPmText[1];
+ if (displayHours > 12) {
+ displayHours -= 12;
+ }
+ }
+ }
+
+ var h = displayHours.toString();
+ if (showLeadingZero && (displayHours < 10)) { h = '0' + h; }
+
+ var m = selectedMinutes.toString();
+ if (selectedMinutes < 10) { m = '0' + m; }
+
+ if (showHours) {
+ parsedTime += h;
+ }
+ if (showHours && showMinutes && (!optionalMinutes || m != 0)) {
+ parsedTime += this._get(inst, 'timeSeparator');
+ }
+ if (showMinutes && (!optionalMinutes || m != 0)) {
+ parsedTime += m;
+ }
+ if (showHours) {
+ if (period.length > 0) { parsedTime += this._get(inst, 'periodSeparator') + period; }
+ }
+
+ return parsedTime;
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst, newTime) {
+ var altField = this._get(inst, 'altField');
+ if (altField) { // update alternate field too
+ $(altField).each(function(i,e) {
+ $(e).val(newTime);
+ });
+ }
+ },
+
+ /* This might look unused but it's called by the $.fn.timepicker function with param getTime */
+ /* added v 0.2.3 - gitHub issue #5 - Thanks edanuff */
+ _getTimeTimepicker : function(input) {
+ var inst = this._getInst(input);
+ return this._getParsedTime(inst);
+ },
+ _getHourTimepicker: function(input) {
+ var inst = this._getInst(input);
+ if ( inst == undefined) { return -1; }
+ return inst.hours;
+ },
+ _getMinuteTimepicker: function(input) {
+ var inst= this._getInst(input);
+ if ( inst == undefined) { return -1; }
+ return inst.minutes;
+ }
+
+ });
+
+
+
+ /* Invoke the timepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new timepicker functionality
+ @return jQuery object */
+ $.fn.timepicker = function (options) {
+
+ /* Initialise the time picker. */
+ if (!$.timepicker.initialized) {
+ $(document).mousedown($.timepicker._checkExternalClick).
+ find('body').append($.timepicker.tpDiv);
+ $.timepicker.initialized = true;
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && (options == 'getTime' || options == 'getHour' || options == 'getMinute' ))
+ return $.timepicker['_' + options + 'Timepicker'].
+ apply($.timepicker, [this[0]].concat(otherArgs));
+ if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
+ return $.timepicker['_' + options + 'Timepicker'].
+ apply($.timepicker, [this[0]].concat(otherArgs));
+ return this.each(function () {
+ typeof options == 'string' ?
+ $.timepicker['_' + options + 'Timepicker'].
+ apply($.timepicker, [this].concat(otherArgs)) :
+ $.timepicker._attachTimepicker(this, options);
+ });
+ };
+
+ /* jQuery extend now ignores nulls! */
+ function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props)
+ if (props[name] == null || props[name] == undefined)
+ target[name] = props[name];
+ return target;
+ };
+
+ $.timepicker = new Timepicker(); // singleton instance
+ $.timepicker.initialized = false;
+ $.timepicker.uuid = new Date().getTime();
+ $.timepicker.version = "0.2.9";
+
+ // Workaround for #4055
+ // Add another global to avoid noConflict issues with inline event handlers
+ window['TP_jQuery_' + tpuuid] = $;
+
+})(jQuery);
diff --git a/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/releases.txt b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/releases.txt new file mode 100644 index 0000000..64622d4 --- /dev/null +++ b/gstudio/static/gstudio/js/jquery-ui-timepicker-0.2.9/releases.txt @@ -0,0 +1,105 @@ +Release 0.2.9 - November 13, 2011
+Fixed the zIndex problem and removed the zIndex option (Thanks everyone who reported the problem)
+Fix a bug where repeatedly clicking on hour cells made the timepicker very slow.
+Added Italian translation, thanks to Serge Margarita.
+
+Release 0.2.8 - November 5, 2011
+Updated "defaultTime" to allow for Date object (github issue #26)
+Fixed the now and deselect buttons in IE
+
+Release 0.2.7 - October 19, 2011
+Added option to omit minutes in parsed time when user select 0 for minutes. (Thanks tribalvibes, Github issue #23)
+Added support for internationalisation (fr, de and ja, Thanks Bernd Plagge).
+
+Release 0.2.6 - October 12, 2011
+Fixed a bug when input ID have more then one special char. (Thamks Jacqueline Krijnen)
+Fixed a bug when parsing hours only or minutes only time. (Thanks protron, <a href="https://github.com/fgelinas/timepicker/issues/20">github issue #20</a>)
+Added 'Now', 'Deselect' and 'Close' buttons. (Thanks Christian Grobmeier for the close button code, <a href="https://github.com/fgelinas/timepicker/issues/20">github issue #22</a>)
+
+Release 0.2.5 - September 13, 2011
+Added support for disable and enable. (Suggested by danielrex, github issue #17)
+Added an example for 2 timepicker to behave as a period selector (start time and end time). (Thanks Bill Pellowe)
+Renamed the stylesheet to jquery.ui.timepicker.css to be more consistent with jQuery UI file name convention.
+
+Release 0.2.4 - August 5, 2011
+Fixed the hand cursor in the css file. (Thanks Mike Neumegen)
+Added position option to use with the jquery ui position utility.
+Added option to display only hours or only minutes.
+
+Release 0.2.3 - July 11, 2011
+Fix github issue #3 : Bug when hours or minutes choices does not divide by number of rows (thanks wukimus)
+Changed default behavior of the defaultTime option, if set to '' and input is empty, there will be no highlighted time in the popup (Thanks Rasmus Schultz)
+Fix github issue #4 : Error when generating empty minute cell. (Thanks 123Haynes)
+Fix github issue #5 : Add functionality for "getTime" option. (Thanks edanuff)
+Added the periodSeparator option. (thanks jrchamp)
+Fixed "getTime" for inline timepickers. (thanks Mike Neumegen)
+Added "getHour" and "getMinute" to get individual values.
+
+Release 0.2.2 - June 16, 2011
+Fixed a "console.log" line that I forgot to remove before release 0.2.1
+
+Release 0.2.1 - June 12, 2011
+Timepicker does not give the focus back to the input any more after time selection. This is similar to the datepicker behaviour and is more natural to the user because it shows the dialog again when the user click on the input again, as expected.
+Added options to customize the hours and minutes ranges and interval for more customization.
+
+Release 0.2 - May 28, 2011
+So in the previous release I mixed up versions and lost some changes, I guess that's what happen when you drink and code.
+
+Release 0.1.2 - May 26, 2011
+Fixed a bug with inline timepickers that would append a #timepickr hashtag when selecting hours and minutes.
+Fixed z-index problem with IE6 (Thanks Graham Bentley)
+Added selection of highlighted text when enter is pressed on the input field (Thanks Glen Chiacchieri)
+Adjusted some focus problems, now the input gets the focus back when the used click on hours / minutes.
+
+Release 0.1.something aka the lost release - around April 11
+Fixed a bug for when input Id had a dot in it, it was getting double escaped when it should not. (Thanks Zdenek Machac)
+So in 0.1.1 I created a bug that made timepicker changes the location hash, well now it's fixed. (Thanks Lucas Falk)
+
+Release 0.1.1 - April 6, 2011
+Changed the cells click and dblclick binding for faster rendering in IE6/7 (Thanks Blair Parsons)
+Fixed a class naming bug created in 0.1.0 (Thanks Morlion Peter)
+
+Release 0.1.0 - March 23, 2011
+Fixed some bugs with release 0.0.9
+
+Release 0.0.9 - March 22, 2011
+Added zIndex option (Thanks Frank Enderle)
+Added option showPeriodLabels that defines if the AM/PM labels are displayed on the left (Thanks Frank Enderle)
+Added showOn ['focus'|'button'|'both'] and button options for alternate trigger method
+
+Release 0.0.8 - Fev 17, 2011
+Fixed close event not triggered when switching to another input with time picker (thanks Stuart Gregg)
+
+Release 0.0.7 - Fev 10, 2011
+Added function to set time after initialisation :$('#timepicker').timepicker('setTime',newTime);
+Added support for disabled period of time : onHourShow and onMinuteShow (thanks Rene Felgentr�ger)
+
+Release 0.0.6 - Jan 19, 2011
+Added standard "change" event being triggered on the input when the content changes. (Thanks Rasmus Schultz)
+Added support for inline timePicker, attached to div or span
+Added altField that receive the parsed time value when selected time changes
+Added defaultTime value to use when input field is missing (inline) or input value is empty
+ if defaultTime is missing, current time is used
+
+Release 0.0.5 - Jan 18, 2011
+Now updating time picker selected value when manually typing in the text field (thanks Rasmus Schultz)
+Fixed : with showPeriod: true and showLeadingZero: true, PM hours did not show leading zeros (thanks Chandler May)
+Fixed : with showPeriod: true and showLeadingZero: true, Selecting 12 AM shows as 00 AM in the input field, also parsing 12AM did not work correctly (thanks Rasmus Schultz)
+
+Release 0.0.4 - jan 10, 2011
+changed showLeadingZero to affect only hours, added showMinutesLeadingZero for minutes display
+Removed width:100% for tables in css
+
+Release 0.0.3 - Jan 8, 2011
+Re-added a display:none on the main div (fix a small empty div visible at the bottom of the page before timepicker is called) (Thanks Gertjan van Roekel)
+Fixed a problem where the timepicker was never displayed with jquery ui 1.8.7 css,
+ the problem was the class ui-helper-hidden-accessible, witch I removed.
+ Thanks Alexander Fietz and StackOverflow : http://stackoverflow.com/questions/4522274/jquery-timepicker-and-jqueryui-1-8-7-conflict
+
+Release 0.0.2 - Jan 6, 2011
+Updated to include common display options for USA users
+Stephen Commisso - Jan 2011
+
+As it is a timepicker, I inspired most of the code from the datepicker
+Francois Gelinas - Nov 2010
+
diff --git a/gstudio/static/gstudio/js/jquery-ui.js b/gstudio/static/gstudio/js/jquery-ui.js new file mode 100644 index 0000000..cd515f3 --- /dev/null +++ b/gstudio/static/gstudio/js/jquery-ui.js @@ -0,0 +1,11767 @@ +/*! + * jQuery UI 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.16", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + propAttr: $.fn.prop || $.fn.attr, + + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; +}); + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || isTabIndexNotNaN + : isTabIndexNotNaN) + // the element and all of its ancestors must be visible + && visible( element ); +} + +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); +/*! + * jQuery UI Widget 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + try { + $( this ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var callback = this.options[ type ]; + + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + data = data || {}; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( event.originalEvent ) { + for ( var i = $.event.props.length, prop; i; ) { + prop = $.event.props[ --i ]; + event[ prop ] = event.originalEvent[ prop ]; + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); +/*! + * jQuery UI Mouse 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function( e ) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return }; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); +/* + * jQuery UI Draggable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + if ( o.iframeFix ) { + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + } + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + + //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) + if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event); + + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is removed, don't bother to continue if helper is set to "original" + if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original") + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function(event) { + if (this.options.iframeFix === true) { + $("div.ui-draggable-iframeFix").each(function() { + this.parentNode.removeChild(this); + }); //Remove frame helpers + } + + //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) + if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event); + + return $.ui.mouse.prototype._mouseUp.call(this, event); + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var c = $(o.containment); + var ce = c[0]; if(!ce) return; + var co = c.offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + this.relative_container = c; + + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + var containment; + if(this.containment) { + if (this.relative_container){ + var co = this.relative_container.offset(); + containment = [ this.containment[0] + co.left, + this.containment[1] + co.top, + this.containment[2] + co.left, + this.containment[3] + co.top ]; + } + else { + containment = this.containment; + } + + if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top; + } + + if(o.grid) { + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) + var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; + pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; + pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.16" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); +/* + * jQuery UI Droppable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.16" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = dropped || this._drop.call(this, event); + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + dragStart: function( draggable, event ) { + //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) + draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() { + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + }); + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + }, + dragStop: function( draggable, event ) { + draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" ); + //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + } +}; + +})(jQuery); +/* + * jQuery UI Resizable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + if (o.disabled) return; + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (o.disabled) return; + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + // Put this in the mouseDrag handler since the user can start pressing shift while resizing + this._updateVirtualBoundaries(event.shiftKey); + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateVirtualBoundaries: function(forceAspectRatio) { + var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b; + + b = { + minWidth: isNumber(o.minWidth) ? o.minWidth : 0, + maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, + minHeight: isNumber(o.minHeight) ? o.minHeight : 0, + maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity + }; + + if(this._aspectRatio || forceAspectRatio) { + // We want to create an enclosing box whose aspect ration is the requested one + // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if(pMinWidth > b.minWidth) b.minWidth = pMinWidth; + if(pMinHeight > b.minHeight) b.minHeight = pMinHeight; + if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth; + if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight; + } + this._vBoundaries = b; + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (isNumber(data.height)) data.width = (data.height * this.aspectRatio); + else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.16" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10), + position: el.css('position') // to reset Opera on stop() + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + // Opera fixing relative position + if ($.browser.opera && /relative/.test(el.css('position'))) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _reset = function (exp) { + $(exp).each(function() { + var el = $(this); + // reset position for Opera - no need to verify it was changed + el.css({ position: el.data("resizable-alsoresize").position }); + }); + }; + + if (self._revertToRelativePosition) { + self._revertToRelativePosition = false; + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp) { _reset(exp); }); + }else{ + _reset(o.alsoResize); + } + } + + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); +/* + * jQuery UI Selectable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("<div class='ui-selectable-helper'></div>"); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = !event.metaKey || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if (event.metaKey && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.16" +}); + +})(jQuery); +/* + * jQuery UI Sortable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + }, + + destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled") + .removeData("sortable") + .unbind(".sortable"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData("sortable-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, 'sortable-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(sortable-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data('sortable-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.16" +}); + +})(jQuery); +/* + * jQuery UI Effects 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($, undefined) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.queue(function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('class'); + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('class', className); + + that.animate(styleDifference(originalStyle, newStyle), { + queue: false, + duration: duration, + easing: easing, + complete: function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + $.dequeue( this ); + } + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.16", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('<div></div>') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }), + active = document.activeElement; + + element.wrap(wrapper); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + var parent, + active = document.activeElement; + + if (element.parent().is('.ui-effects-wrapper')) { + parent = element.parent().replaceWith(element); + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + return parent; + } + + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); + } + } + + return effectMethod.call(this, args2); + }, + + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +})(jQuery); +/* + * jQuery UI Effects Blind 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Bounce 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Clip 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Drop 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Explode 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i<rows;i++) { // = + for(var j=0;j<cells;j++) { // || + el + .clone() + .appendTo('body') + .wrap('<div></div>') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Fade 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); + + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/* + * jQuery UI Effects Fold 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Highlight 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/* + * jQuery UI Effects Pulsate 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'); + times = ((o.options.times || 5) * 2) - 1; + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); +/* + * jQuery UI Effects Scale 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; + var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Shake 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Slide 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Transfer 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('<div class="ui-effects-transfer"></div>') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); +/* + * jQuery UI Accordion 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + + _create: function() { + var self = this, + options = self.options; + + self.running = 0; + + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); + + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } + } + + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); + + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); + + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); + + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .hide(); + + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }); + } + + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } + + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, + + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "<span></span>" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, + + destroy: function() { + var options = this.options; + + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-selected" ) + .removeAttr( "tabIndex" ); + + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } + + return $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, + + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } + + return true; + }, + + resize: function() { + var options = this.options, + maxHeight; + + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); + } + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); + } + + return this; + }, + + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); + + return this; + }, + + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); + }, + + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; + } + + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); + + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } + + // find elements to show and hide + var active = this.active, + toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); + + // switch classes + active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + + return; + }, + + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; + + self.toShow = toShow; + self.toHide = toHide; + self.data = data; + + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; + + // trigger changestart event + self._trigger( "changestart", null, self.data ); + + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if ( options.animated ) { + var animOptions = {}; + + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + + if ( !options.proxied ) { + options.proxied = options.animated; + } + + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } + + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; + + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; + + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete( true ); + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }) + .focus(); + }, + + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; + } + + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + // Work around for rendering bug in IE (#5421) + if ( this.toHide.length ) { + this.toHide.parent()[0].className = this.toHide.parent()[0].className; + } + + this._trigger( "change", null, this.data ); + } +}); + +$.extend( $.ui.accordion, { + version: "1.8.16", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( parseInt( s.parent().width(), 10 ) + - parseInt( s.css( "paddingLeft" ), 10 ) + - parseInt( s.css( "paddingRight" ), 10 ) + - ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 ) + - ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } + + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})( jQuery ); +/* + * jQuery UI Autocomplete 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function( $, undefined ) { + +// used to prevent race conditions with remote data sources +var requestIndex = 0; + +$.widget( "ui.autocomplete", { + options: { + appendTo: "body", + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null + }, + + pending: 0, + + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument, + suppressKeyPress; + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) { + return; + } + + suppressKeyPress = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._move( "previous", event ); + // prevent moving cursor to beginning of text field in some browsers + event.preventDefault(); + break; + case keyCode.DOWN: + self._move( "next", event ); + // prevent moving cursor to end of text field in some browsers + event.preventDefault(); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( self.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + // only search if the value has changed + if ( self.term != self.element.val() ) { + self.selectedItem = null; + self.search( null, event ); + } + }, self.options.delay ); + break; + } + }) + .bind( "keypress.autocomplete", function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + } + }) + .bind( "focus.autocomplete", function() { + if ( self.options.disabled ) { + return; + } + + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + if ( self.options.disabled ) { + return; + } + + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.response = function() { + return self._response.apply( self, arguments ); + }; + this.menu = $( "<ul></ul>" ) + .addClass( "ui-autocomplete" ) + .appendTo( $( this.options.appendTo || "body", doc )[0] ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function( event ) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = self.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + setTimeout(function() { + $( document ).one( 'mousedown', function( event ) { + if ( event.target !== self.element[ 0 ] && + event.target !== menuElement && + !$.ui.contains( menuElement, event.target ) ) { + self.close(); + } + }); + }, 1 ); + } + + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ), + previous = self.previous; + + // only trigger when focus was lost (click on menu) + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + setTimeout(function() { + self.previous = previous; + self.selectedItem = item; + }, 1); + } + + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + self.term = self.element.val(); + + self.close( event ); + self.selectedItem = item; + }, + blur: function( event, ui ) { + // don't set the value of the text field if it's already correct + // this prevents moving the cursor unnecessarily + if ( self.menu.element.is(":visible") && + ( self.element.val() !== self.term ) ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _initSource: function() { + var self = this, + array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( self.xhr ) { + self.xhr.abort(); + } + self.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + autocompleteRequest: ++requestIndex, + success: function( data, status ) { + if ( this.autocompleteRequest === requestIndex ) { + response( data ); + } + }, + error: function() { + if ( this.autocompleteRequest === requestIndex ) { + response( [] ); + } + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + + // always save the actual value, not the one passed as an argument + this.term = this.element.val(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + + this.source( { term: value }, this.response ); + }, + + _response: function( content ) { + if ( !this.options.disabled && content && content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + this.pending--; + if ( !this.pending ) { + this.element.removeClass( "ui-autocomplete-loading" ); + } + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this.menu.element.hide(); + this.menu.deactivate(); + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + + if ( this.options.autoFocus ) { + this.menu.next( new $.Event("mouseover") ); + } + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + ul.width( "" ).outerWidth(), + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "<li></li>" ) + .data( "item.autocomplete", item ) + .append( $( "<a></a>" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.scrollTop(), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.scrollTop( scroll + offset); + } else if (offset >= elementHeight) { + this.element.scrollTop( scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(); + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); +/* + * jQuery UI Button 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var lastActive, startXPos, startYPos, clickDragged, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var buttons = $( this ).find( ":ui-button" ); + setTimeout(function() { + buttons.button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = this.element.propAttr( "disabled" ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + if ( this.element.is( ":disabled" ) ) { + options.disabled = true; + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "click.button", function( event ) { + if ( options.disabled ) { + event.preventDefault(); + event.stopImmediatePropagation(); + } + }); + + this.element + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + self.buttonElement.addClass( focusClass ); + }) + .bind( "blur.button", function() { + self.buttonElement.removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + if ( clickDragged ) { + return; + } + self.refresh(); + }); + // if mouse moves between mousedown and mouseup (drag) set clickDragged flag + // prevents issue where button state changes but checkbox/radio checked state + // does not in Firefox (see ticket #6970) + this.buttonElement + .bind( "mousedown.button", function( event ) { + if ( options.disabled ) { + return; + } + clickDragged = false; + startXPos = event.pageX; + startYPos = event.pageY; + }) + .bind( "mouseup.button", function( event ) { + if ( options.disabled ) { + return; + } + if ( startXPos !== event.pageX || startYPos !== event.pageY ) { + clickDragged = true; + } + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", "true" ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + this._resetButton(); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else if ( this.element.is(":radio") ) { + this.type = "radio"; + } else if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + var ancestor = this.element.parents().filter(":last"), + labelSelector = "label[for='" + this.element.attr("id") + "']"; + this.buttonElement = ancestor.find( labelSelector ); + if ( !this.buttonElement.length ) { + ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); + this.buttonElement = ancestor.filter( labelSelector ); + if ( !this.buttonElement.length ) { + this.buttonElement = ancestor.find( labelSelector ); + } + } + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.propAttr( "disabled", true ); + } else { + this.element.propAttr( "disabled", false ); + } + return; + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "<span></span>" ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary, + buttonClasses = []; + + if ( icons.primary || icons.secondary ) { + if ( this.options.text ) { + buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + } + + if ( icons.primary ) { + buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" ); + } + + if ( icons.secondary ) { + buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" ); + } + + if ( !this.options.text ) { + buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonClasses.push( "ui-button-text-only" ); + } + buttonElement.addClass( buttonClasses.join( " " ) ); + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + var ltr = this.element.css( "direction" ) === "ltr"; + + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( ltr ? "ui-corner-left" : "ui-corner-right" ) + .end() + .filter( ":last" ) + .addClass( ltr ? "ui-corner-right" : "ui-corner-left" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); +/* + * jQuery UI Datepicker 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.16" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); +var instActive; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false, // True to size the input for the date format, false to leave as is + disabled: false // The initial disabled state + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = bindHover($('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + //Keep track of the maximum number of rows displayed (see #7043) + maxRows: 4, + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + bindHover($('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>'); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('<img/>').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('<button type="button"></button>').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('<img/>').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $('<input type="text" id="' + id + + '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>'); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + removeAttr("disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + attr("disabled", "disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + var onSelect = $.datepicker._get(inst, 'onSelect'); + if (onSelect) { + var dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (event) { + $.datepicker.log(event); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + If false returned from beforeShow event handler do not show. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + if ( $.datepicker._datepickerShowing ) { + $.datepicker._triggerOnClose($.datepicker._curInst); + } + $.datepicker._curInst.dpDiv.stop(true, true); + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + //false + return; + } + extendRemove(inst.settings, beforeShowSettings); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + var borders = $.datepicker._getBorders(inst.dpDiv); + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); + var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Trigger custom callback of onClose. */ + _triggerOnClose: function(inst) { + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + this._curInst = null; + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + $.datepicker._triggerOnClose(inst); + this._datepickerShowing = false; + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + var $target = $(event.target); + if ($target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.hasClass($.datepicker._triggerClass) && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + var index = -1; + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index != -1) + return index + 1; + else + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (iValue < value.length){ + throw "Extra/unparsed characters found in date: " + value.substring(iValue); + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' + + ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' + + ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : ''); + var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._gotoToday(\'#' + inst.id + '\');"' + + '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + this.maxRows = 4; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '<div class="ui-datepicker-group'; + if (numMonths[1] > 1) + switch (col) { + case 0: calender += ' ui-datepicker-group-first'; + cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break; + case numMonths[1]-1: calender += ' ui-datepicker-group-last'; + cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break; + default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break; + } + calender += '">'; + } + calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '</div><table class="ui-datepicker-calendar"><thead>' + + '<tr>'; + var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>'; + } + calender += thead + '</tr></thead><tbody>'; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += '<tr>'; + var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' + + this._get(inst, 'calculateWeek')(printDate) + '</td>'); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += '<td class="' + + ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends + (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months + ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key + (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ? + // or defaultDate is current printedDate and defaultDate is selectedDate + ' ' + this._dayOverClass : '') + // highlight selected day + (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days + (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates + (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day + (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different) + ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title + (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' + + inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' + + (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') + + (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day + (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months + '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + '</tr>'; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '</tbody></table>' + (isMultiMonth ? '</div>' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '<div class="ui-datepicker-title">'; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>'; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += '<select class="ui-datepicker-month" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' + + '>'; + for (var month = 0; month < 12; month++) { + if ((!inMinYear || month >= minDate.getMonth()) && + (!inMaxYear || month <= maxDate.getMonth())) + monthHtml += '<option value="' + month + '"' + + (month == drawMonth ? ' selected="selected"' : '') + + '>' + monthNamesShort[month] + '</option>'; + } + monthHtml += '</select>'; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '<span class="ui-datepicker-year">' + drawYear + '</span>'; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += '<select class="ui-datepicker-year" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' + + '>'; + for (; year <= endYear; year++) { + inst.yearshtml += '<option value="' + year + '"' + + (year == drawYear ? ' selected="selected"' : '') + + '>' + year + '</option>'; + } + inst.yearshtml += '</select>'; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '</div>'; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.bind('mouseout', function(event) { + var elem = $( event.target ).closest( selector ); + if ( !elem.length ) { + return; + } + elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); + }) + .bind('mouseover', function(event) { + var elem = $( event.target ).closest( selector ); + if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || + !elem.length ) { + return; + } + elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + elem.addClass('ui-state-hover'); + if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); + if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.16"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); +/* + * jQuery UI Dialog 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }, + // support for jQuery 1.3.2 - handle common attrFn methods for dialog + attrFn = $.attrFn || { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true, + click: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('<div></div>')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"></a>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span></span>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if (options.modal) { + uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode !== $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "<div></div>" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('<button type="button"></button>') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in attrFn ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.16", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); +/* + * jQuery UI Position 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions (see #5280) + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +}( jQuery )); +/* + * jQuery UI Progressbar 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.16" +}); + +})( jQuery ); +/* + * jQuery UI Slider 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>", + handleCount = ( o.values && o.values.length ) || 1, + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } + + this.range = $( "<div></div>" ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + for ( var i = existingHandles.length; i < handleCount; i += 1 ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var ret = true, + index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + ret = false; + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + + return ret; + + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.propAttr( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.propAttr( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.16" +}); + +}(jQuery)); +/* + * jQuery UI Tabs 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "<div></div>", + remove: null, + select: null, + show: null, + spinner: "<em>Loading…</em>", + tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>" + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on <li> + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.16" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + t = o.selected; + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); diff --git a/gstudio/static/gstudio/js/jquery.autocomplete.js b/gstudio/static/gstudio/js/jquery.autocomplete.js new file mode 100644 index 0000000..4b021c1 --- /dev/null +++ b/gstudio/static/gstudio/js/jquery.autocomplete.js @@ -0,0 +1,13 @@ +/* + * jQuery Autocomplete plugin 1.1 + * + * Copyright (c) 2009 Jörn Zaefferer + * + * Dual licensed under the MIT and GPL licenses: + * http://www.opensource.org/licenses/mit-license.php + * http://www.gnu.org/licenses/gpl.html + * + * Revision: $Id: jquery.autocomplete.js 15 2009-08-22 10:30:27Z joern.zaefferer $ + */;(function($){$.fn.extend({autocomplete:function(urlOrData,options){var isUrl=typeof urlOrData=="string";options=$.extend({},$.Autocompleter.defaults,{url:isUrl?urlOrData:null,data:isUrl?null:urlOrData,delay:isUrl?$.Autocompleter.defaults.delay:10,max:options&&!options.scroll?10:150},options);options.highlight=options.highlight||function(value){return value;};options.formatMatch=options.formatMatch||options.formatItem;return this.each(function(){new $.Autocompleter(this,options);});},result:function(handler){return this.bind("result",handler);},search:function(handler){return this.trigger("search",[handler]);},flushCache:function(){return this.trigger("flushCache");},setOptions:function(options){return this.trigger("setOptions",[options]);},unautocomplete:function(){return this.trigger("unautocomplete");}});$.Autocompleter=function(input,options){var KEY={UP:38,DOWN:40,DEL:46,TAB:9,RETURN:13,ESC:27,COMMA:188,PAGEUP:33,PAGEDOWN:34,BACKSPACE:8};var $input=$(input).attr("autocomplete","off").addClass(options.inputClass);var timeout;var previousValue="";var cache=$.Autocompleter.Cache(options);var hasFocus=0;var lastKeyPressCode;var config={mouseDownOnSelect:false};var select=$.Autocompleter.Select(options,input,selectCurrent,config);var blockSubmit;$.browser.opera&&$(input.form).bind("submit.autocomplete",function(){if(blockSubmit){blockSubmit=false;return false;}});$input.bind(($.browser.opera?"keypress":"keydown")+".autocomplete",function(event){hasFocus=1;lastKeyPressCode=event.keyCode;switch(event.keyCode){case KEY.UP:event.preventDefault();if(select.visible()){select.prev();}else{onChange(0,true);}break;case KEY.DOWN:event.preventDefault();if(select.visible()){select.next();}else{onChange(0,true);}break;case KEY.PAGEUP:event.preventDefault();if(select.visible()){select.pageUp();}else{onChange(0,true);}break;case KEY.PAGEDOWN:event.preventDefault();if(select.visible()){select.pageDown();}else{onChange(0,true);}break;case options.multiple&&$.trim(options.multipleSeparator)==","&&KEY.COMMA:case KEY.TAB:case KEY.RETURN:if(selectCurrent()){event.preventDefault();blockSubmit=true;return false;}break;case KEY.ESC:select.hide();break;default:clearTimeout(timeout);timeout=setTimeout(onChange,options.delay);break;}}).focus(function(){hasFocus++;}).blur(function(){hasFocus=0;if(!config.mouseDownOnSelect){hideResults();}}).click(function(){if(hasFocus++>1&&!select.visible()){onChange(0,true);}}).bind("search",function(){var fn=(arguments.length>1)?arguments[1]:null;function findValueCallback(q,data){var result;if(data&&data.length){for(var i=0;i<data.length;i++){if(data[i].result.toLowerCase()==q.toLowerCase()){result=data[i];break;}}}if(typeof fn=="function")fn(result);else $input.trigger("result",result&&[result.data,result.value]);}$.each(trimWords($input.val()),function(i,value){request(value,findValueCallback,findValueCallback);});}).bind("flushCache",function(){cache.flush();}).bind("setOptions",function(){$.extend(options,arguments[1]);if("data"in arguments[1])cache.populate();}).bind("unautocomplete",function(){select.unbind();$input.unbind();$(input.form).unbind(".autocomplete");});function selectCurrent(){var selected=select.selected();if(!selected)return false;var v=selected.result;previousValue=v;if(options.multiple){var words=trimWords($input.val());if(words.length>1){var seperator=options.multipleSeparator.length;var cursorAt=$(input).selection().start;var wordAt,progress=0;$.each(words,function(i,word){progress+=word.length;if(cursorAt<=progress){wordAt=i;return false;}progress+=seperator;});words[wordAt]=v;v=words.join(options.multipleSeparator);}v+=options.multipleSeparator;}$input.val(v);hideResultsNow();$input.trigger("result",[selected.data,selected.value]);return true;}function onChange(crap,skipPrevCheck){if(lastKeyPressCode==KEY.DEL){select.hide();return;}var currentValue=$input.val();if(!skipPrevCheck&¤tValue==previousValue)return;previousValue=currentValue;currentValue=lastWord(currentValue);if(currentValue.length>=options.minChars){$input.addClass(options.loadingClass);if(!options.matchCase)currentValue=currentValue.toLowerCase();request(currentValue,receiveData,hideResultsNow);}else{stopLoading();select.hide();}};function trimWords(value){if(!value)return[""];if(!options.multiple)return[$.trim(value)];return $.map(value.split(options.multipleSeparator),function(word){return $.trim(value).length?$.trim(word):null;});}function lastWord(value){if(!options.multiple)return value;var words=trimWords(value);if(words.length==1)return words[0];var cursorAt=$(input).selection().start;if(cursorAt==value.length){words=trimWords(value)}else{words=trimWords(value.replace(value.substring(cursorAt),""));}return words[words.length-1];}function autoFill(q,sValue){if(options.autoFill&&(lastWord($input.val()).toLowerCase()==q.toLowerCase())&&lastKeyPressCode!=KEY.BACKSPACE){$input.val($input.val()+sValue.substring(lastWord(previousValue).length));$(input).selection(previousValue.length,previousValue.length+sValue.length);}};function hideResults(){clearTimeout(timeout);timeout=setTimeout(hideResultsNow,200);};function hideResultsNow(){var wasVisible=select.visible();select.hide();clearTimeout(timeout);stopLoading();if(options.mustMatch){$input.search(function(result){if(!result){if(options.multiple){var words=trimWords($input.val()).slice(0,-1);$input.val(words.join(options.multipleSeparator)+(words.length?options.multipleSeparator:""));}else{$input.val("");$input.trigger("result",null);}}});}};function receiveData(q,data){if(data&&data.length&&hasFocus){stopLoading();select.display(data,q);autoFill(q,data[0].value);select.show();}else{hideResultsNow();}};function request(term,success,failure){if(!options.matchCase)term=term.toLowerCase();var data=cache.load(term);if(data&&data.length){success(term,data);}else if((typeof options.url=="string")&&(options.url.length>0)){var extraParams={timestamp:+new Date()};$.each(options.extraParams,function(key,param){extraParams[key]=typeof param=="function"?param():param;});$.ajax({mode:"abort",port:"autocomplete"+input.name,dataType:options.dataType,url:options.url,data:$.extend({q:lastWord(term),limit:options.max},extraParams),success:function(data){var parsed=options.parse&&options.parse(data)||parse(data);cache.add(term,parsed);success(term,parsed);}});}else{select.emptyList();failure(term);}};function parse(data){var parsed=[];var rows=data.split("\n");for(var i=0;i<rows.length;i++){var row=$.trim(rows[i]);if(row){row=row.split("|");parsed[parsed.length]={data:row,value:row[0],result:options.formatResult&&options.formatResult(row,row[0])||row[0]};}}return parsed;};function stopLoading(){$input.removeClass(options.loadingClass);};};$.Autocompleter.defaults={inputClass:"ac_input",resultsClass:"ac_results",loadingClass:"ac_loading",minChars:1,delay:400,matchCase:false,matchSubset:true,matchContains:false,cacheLength:10,max:100,mustMatch:false,extraParams:{},selectFirst:true,formatItem:function(row){return row[0];},formatMatch:null,autoFill:false,width:0,multiple:false,multipleSeparator:", ",highlight:function(value,term){return value.replace(new RegExp("(?![^&;]+;)(?!<[^<>]*)("+term.replace(/([\^\$\(\)\[\]\{\}\*\.\+\?\|\\])/gi,"\\$1")+")(?![^<>]*>)(?![^&;]+;)","gi"),"<strong>$1</strong>");},scroll:true,scrollHeight:180};$.Autocompleter.Cache=function(options){var data={};var length=0;function matchSubset(s,sub){if(!options.matchCase)s=s.toLowerCase();var i=s.indexOf(sub);if(options.matchContains=="word"){i=s.toLowerCase().search("\\b"+sub.toLowerCase());}if(i==-1)return false;return i==0||options.matchContains;};function add(q,value){if(length>options.cacheLength){flush();}if(!data[q]){length++;}data[q]=value;}function populate(){if(!options.data)return false;var stMatchSets={},nullData=0;if(!options.url)options.cacheLength=1;stMatchSets[""]=[];for(var i=0,ol=options.data.length;i<ol;i++){var rawValue=options.data[i];rawValue=(typeof rawValue=="string")?[rawValue]:rawValue;var value=options.formatMatch(rawValue,i+1,options.data.length);if(value===false)continue;var firstChar=value.charAt(0).toLowerCase();if(!stMatchSets[firstChar])stMatchSets[firstChar]=[];var row={value:value,data:rawValue,result:options.formatResult&&options.formatResult(rawValue)||value};stMatchSets[firstChar].push(row);if(nullData++<options.max){stMatchSets[""].push(row);}};$.each(stMatchSets,function(i,value){options.cacheLength++;add(i,value);});}setTimeout(populate,25);function flush(){data={};length=0;}return{flush:flush,add:add,populate:populate,load:function(q){if(!options.cacheLength||!length)return null;if(!options.url&&options.matchContains){var csub=[];for(var k in data){if(k.length>0){var c=data[k];$.each(c,function(i,x){if(matchSubset(x.value,q)){csub.push(x);}});}}return csub;}else +if(data[q]){return data[q];}else +if(options.matchSubset){for(var i=q.length-1;i>=options.minChars;i--){var c=data[q.substr(0,i)];if(c){var csub=[];$.each(c,function(i,x){if(matchSubset(x.value,q)){csub[csub.length]=x;}});return csub;}}}return null;}};};$.Autocompleter.Select=function(options,input,select,config){var CLASSES={ACTIVE:"ac_over"};var listItems,active=-1,data,term="",needsInit=true,element,list;function init(){if(!needsInit)return;element=$("<div/>").hide().addClass(options.resultsClass).css("position","absolute").appendTo(document.body);list=$("<ul/>").appendTo(element).mouseover(function(event){if(target(event).nodeName&&target(event).nodeName.toUpperCase()=='LI'){active=$("li",list).removeClass(CLASSES.ACTIVE).index(target(event));$(target(event)).addClass(CLASSES.ACTIVE);}}).click(function(event){$(target(event)).addClass(CLASSES.ACTIVE);select();input.focus();return false;}).mousedown(function(){config.mouseDownOnSelect=true;}).mouseup(function(){config.mouseDownOnSelect=false;});if(options.width>0)element.css("width",options.width);needsInit=false;}function target(event){var element=event.target;while(element&&element.tagName!="LI")element=element.parentNode;if(!element)return[];return element;}function moveSelect(step){listItems.slice(active,active+1).removeClass(CLASSES.ACTIVE);movePosition(step);var activeItem=listItems.slice(active,active+1).addClass(CLASSES.ACTIVE);if(options.scroll){var offset=0;listItems.slice(0,active).each(function(){offset+=this.offsetHeight;});if((offset+activeItem[0].offsetHeight-list.scrollTop())>list[0].clientHeight){list.scrollTop(offset+activeItem[0].offsetHeight-list.innerHeight());}else if(offset<list.scrollTop()){list.scrollTop(offset);}}};function movePosition(step){active+=step;if(active<0){active=listItems.size()-1;}else if(active>=listItems.size()){active=0;}}function limitNumberOfItems(available){return options.max&&options.max<available?options.max:available;}function fillList(){list.empty();var max=limitNumberOfItems(data.length);for(var i=0;i<max;i++){if(!data[i])continue;var formatted=options.formatItem(data[i].data,i+1,max,data[i].value,term);if(formatted===false)continue;var li=$("<li/>").html(options.highlight(formatted,term)).addClass(i%2==0?"ac_even":"ac_odd").appendTo(list)[0];$.data(li,"ac_data",data[i]);}listItems=list.find("li");if(options.selectFirst){listItems.slice(0,1).addClass(CLASSES.ACTIVE);active=0;}if($.fn.bgiframe)list.bgiframe();}return{display:function(d,q){init();data=d;term=q;fillList();},next:function(){moveSelect(1);},prev:function(){moveSelect(-1);},pageUp:function(){if(active!=0&&active-8<0){moveSelect(-active);}else{moveSelect(-8);}},pageDown:function(){if(active!=listItems.size()-1&&active+8>listItems.size()){moveSelect(listItems.size()-1-active);}else{moveSelect(8);}},hide:function(){element&&element.hide();listItems&&listItems.removeClass(CLASSES.ACTIVE);active=-1;},visible:function(){return element&&element.is(":visible");},current:function(){return this.visible()&&(listItems.filter("."+CLASSES.ACTIVE)[0]||options.selectFirst&&listItems[0]);},show:function(){var offset=$(input).offset();element.css({width:typeof options.width=="string"||options.width>0?options.width:$(input).width(),top:offset.top+input.offsetHeight,left:offset.left}).show();if(options.scroll){list.scrollTop(0);list.css({maxHeight:options.scrollHeight,overflow:'auto'});if($.browser.msie&&typeof document.body.style.maxHeight==="undefined"){var listHeight=0;listItems.each(function(){listHeight+=this.offsetHeight;});var scrollbarsVisible=listHeight>options.scrollHeight;list.css('height',scrollbarsVisible?options.scrollHeight:listHeight);if(!scrollbarsVisible){listItems.width(list.width()-parseInt(listItems.css("padding-left"))-parseInt(listItems.css("padding-right")));}}}},selected:function(){var selected=listItems&&listItems.filter("."+CLASSES.ACTIVE).removeClass(CLASSES.ACTIVE);return selected&&selected.length&&$.data(selected[0],"ac_data");},emptyList:function(){list&&list.empty();},unbind:function(){element&&element.remove();}};};$.fn.selection=function(start,end){if(start!==undefined){return this.each(function(){if(this.createTextRange){var selRange=this.createTextRange();if(end===undefined||start==end){selRange.move("character",start);selRange.select();}else{selRange.collapse(true);selRange.moveStart("character",start);selRange.moveEnd("character",end);selRange.select();}}else if(this.setSelectionRange){this.setSelectionRange(start,end);}else if(this.selectionStart){this.selectionStart=start;this.selectionEnd=end;}});}var field=this[0];if(field.createTextRange){var range=document.selection.createRange(),orig=field.value,teststring="<->",textLength=range.text.length;range.text=teststring;var caretAt=field.value.indexOf(teststring);field.value=orig;this.selection(caretAt,caretAt+textLength);return{start:caretAt,end:caretAt+textLength}}else if(field.selectionStart!==undefined){return{start:field.selectionStart,end:field.selectionEnd}}};})(jQuery);
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/jquery.bgiframe.js b/gstudio/static/gstudio/js/jquery.bgiframe.js new file mode 100644 index 0000000..7faef4b --- /dev/null +++ b/gstudio/static/gstudio/js/jquery.bgiframe.js @@ -0,0 +1,10 @@ +/* Copyright (c) 2006 Brandon Aaron (http://brandonaaron.net) + * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php) + * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses. + * + * $LastChangedDate: 2007-07-22 01:45:56 +0200 (Son, 22 Jul 2007) $ + * $Rev: 2447 $ + * + * Version 2.1.1 + */ +(function($){$.fn.bgIframe=$.fn.bgiframe=function(s){if($.browser.msie&&/6.0/.test(navigator.userAgent)){s=$.extend({top:'auto',left:'auto',width:'auto',height:'auto',opacity:true,src:'javascript:false;'},s||{});var prop=function(n){return n&&n.constructor==Number?n+'px':n;},html='<iframe class="bgiframe"frameborder="0"tabindex="-1"src="'+s.src+'"'+'style="display:block;position:absolute;z-index:-1;'+(s.opacity!==false?'filter:Alpha(Opacity=\'0\');':'')+'top:'+(s.top=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderTopWidth)||0)*-1)+\'px\')':prop(s.top))+';'+'left:'+(s.left=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderLeftWidth)||0)*-1)+\'px\')':prop(s.left))+';'+'width:'+(s.width=='auto'?'expression(this.parentNode.offsetWidth+\'px\')':prop(s.width))+';'+'height:'+(s.height=='auto'?'expression(this.parentNode.offsetHeight+\'px\')':prop(s.height))+';'+'"/>';return this.each(function(){if($('> iframe.bgiframe',this).length==0)this.insertBefore(document.createElement(html),this.firstChild);});}return this;};})(jQuery);
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/jquery.js b/gstudio/static/gstudio/js/jquery.js new file mode 100644 index 0000000..8f3ca2e --- /dev/null +++ b/gstudio/static/gstudio/js/jquery.js @@ -0,0 +1,167 @@ +/*! + * jQuery JavaScript Library v1.4.4 + * http://jquery.com/ + * + * Copyright 2010, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2010, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Thu Nov 11 19:04:53 2010 -0500 + */ +(function(E,B){function ka(a,b,d){if(d===B&&a.nodeType===1){d=a.getAttribute("data-"+b);if(typeof d==="string"){try{d=d==="true"?true:d==="false"?false:d==="null"?null:!c.isNaN(d)?parseFloat(d):Ja.test(d)?c.parseJSON(d):d}catch(e){}c.data(a,b,d)}else d=B}return d}function U(){return false}function ca(){return true}function la(a,b,d){d[0].type=a;return c.event.handle.apply(b,d)}function Ka(a){var b,d,e,f,h,l,k,o,x,r,A,C=[];f=[];h=c.data(this,this.nodeType?"events":"__events__");if(typeof h==="function")h= +h.events;if(!(a.liveFired===this||!h||!h.live||a.button&&a.type==="click")){if(a.namespace)A=RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)");a.liveFired=this;var J=h.live.slice(0);for(k=0;k<J.length;k++){h=J[k];h.origType.replace(X,"")===a.type?f.push(h.selector):J.splice(k--,1)}f=c(a.target).closest(f,a.currentTarget);o=0;for(x=f.length;o<x;o++){r=f[o];for(k=0;k<J.length;k++){h=J[k];if(r.selector===h.selector&&(!A||A.test(h.namespace))){l=r.elem;e=null;if(h.preType==="mouseenter"|| +h.preType==="mouseleave"){a.type=h.preType;e=c(a.relatedTarget).closest(h.selector)[0]}if(!e||e!==l)C.push({elem:l,handleObj:h,level:r.level})}}}o=0;for(x=C.length;o<x;o++){f=C[o];if(d&&f.level>d)break;a.currentTarget=f.elem;a.data=f.handleObj.data;a.handleObj=f.handleObj;A=f.handleObj.origHandler.apply(f.elem,arguments);if(A===false||a.isPropagationStopped()){d=f.level;if(A===false)b=false;if(a.isImmediatePropagationStopped())break}}return b}}function Y(a,b){return(a&&a!=="*"?a+".":"")+b.replace(La, +"`").replace(Ma,"&")}function ma(a,b,d){if(c.isFunction(b))return c.grep(a,function(f,h){return!!b.call(f,h,f)===d});else if(b.nodeType)return c.grep(a,function(f){return f===b===d});else if(typeof b==="string"){var e=c.grep(a,function(f){return f.nodeType===1});if(Na.test(b))return c.filter(b,e,!d);else b=c.filter(b,e)}return c.grep(a,function(f){return c.inArray(f,b)>=0===d})}function na(a,b){var d=0;b.each(function(){if(this.nodeName===(a[d]&&a[d].nodeName)){var e=c.data(a[d++]),f=c.data(this, +e);if(e=e&&e.events){delete f.handle;f.events={};for(var h in e)for(var l in e[h])c.event.add(this,h,e[h][l],e[h][l].data)}}})}function Oa(a,b){b.src?c.ajax({url:b.src,async:false,dataType:"script"}):c.globalEval(b.text||b.textContent||b.innerHTML||"");b.parentNode&&b.parentNode.removeChild(b)}function oa(a,b,d){var e=b==="width"?a.offsetWidth:a.offsetHeight;if(d==="border")return e;c.each(b==="width"?Pa:Qa,function(){d||(e-=parseFloat(c.css(a,"padding"+this))||0);if(d==="margin")e+=parseFloat(c.css(a, +"margin"+this))||0;else e-=parseFloat(c.css(a,"border"+this+"Width"))||0});return e}function da(a,b,d,e){if(c.isArray(b)&&b.length)c.each(b,function(f,h){d||Ra.test(a)?e(a,h):da(a+"["+(typeof h==="object"||c.isArray(h)?f:"")+"]",h,d,e)});else if(!d&&b!=null&&typeof b==="object")c.isEmptyObject(b)?e(a,""):c.each(b,function(f,h){da(a+"["+f+"]",h,d,e)});else e(a,b)}function S(a,b){var d={};c.each(pa.concat.apply([],pa.slice(0,b)),function(){d[this]=a});return d}function qa(a){if(!ea[a]){var b=c("<"+ +a+">").appendTo("body"),d=b.css("display");b.remove();if(d==="none"||d==="")d="block";ea[a]=d}return ea[a]}function fa(a){return c.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:false}var t=E.document,c=function(){function a(){if(!b.isReady){try{t.documentElement.doScroll("left")}catch(j){setTimeout(a,1);return}b.ready()}}var b=function(j,s){return new b.fn.init(j,s)},d=E.jQuery,e=E.$,f,h=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]+)$)/,l=/\S/,k=/^\s+/,o=/\s+$/,x=/\W/,r=/\d/,A=/^<(\w+)\s*\/?>(?:<\/\1>)?$/, +C=/^[\],:{}\s]*$/,J=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,w=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,I=/(?:^|:|,)(?:\s*\[)+/g,L=/(webkit)[ \/]([\w.]+)/,g=/(opera)(?:.*version)?[ \/]([\w.]+)/,i=/(msie) ([\w.]+)/,n=/(mozilla)(?:.*? rv:([\w.]+))?/,m=navigator.userAgent,p=false,q=[],u,y=Object.prototype.toString,F=Object.prototype.hasOwnProperty,M=Array.prototype.push,N=Array.prototype.slice,O=String.prototype.trim,D=Array.prototype.indexOf,R={};b.fn=b.prototype={init:function(j, +s){var v,z,H;if(!j)return this;if(j.nodeType){this.context=this[0]=j;this.length=1;return this}if(j==="body"&&!s&&t.body){this.context=t;this[0]=t.body;this.selector="body";this.length=1;return this}if(typeof j==="string")if((v=h.exec(j))&&(v[1]||!s))if(v[1]){H=s?s.ownerDocument||s:t;if(z=A.exec(j))if(b.isPlainObject(s)){j=[t.createElement(z[1])];b.fn.attr.call(j,s,true)}else j=[H.createElement(z[1])];else{z=b.buildFragment([v[1]],[H]);j=(z.cacheable?z.fragment.cloneNode(true):z.fragment).childNodes}return b.merge(this, +j)}else{if((z=t.getElementById(v[2]))&&z.parentNode){if(z.id!==v[2])return f.find(j);this.length=1;this[0]=z}this.context=t;this.selector=j;return this}else if(!s&&!x.test(j)){this.selector=j;this.context=t;j=t.getElementsByTagName(j);return b.merge(this,j)}else return!s||s.jquery?(s||f).find(j):b(s).find(j);else if(b.isFunction(j))return f.ready(j);if(j.selector!==B){this.selector=j.selector;this.context=j.context}return b.makeArray(j,this)},selector:"",jquery:"1.4.4",length:0,size:function(){return this.length}, +toArray:function(){return N.call(this,0)},get:function(j){return j==null?this.toArray():j<0?this.slice(j)[0]:this[j]},pushStack:function(j,s,v){var z=b();b.isArray(j)?M.apply(z,j):b.merge(z,j);z.prevObject=this;z.context=this.context;if(s==="find")z.selector=this.selector+(this.selector?" ":"")+v;else if(s)z.selector=this.selector+"."+s+"("+v+")";return z},each:function(j,s){return b.each(this,j,s)},ready:function(j){b.bindReady();if(b.isReady)j.call(t,b);else q&&q.push(j);return this},eq:function(j){return j=== +-1?this.slice(j):this.slice(j,+j+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(N.apply(this,arguments),"slice",N.call(arguments).join(","))},map:function(j){return this.pushStack(b.map(this,function(s,v){return j.call(s,v,s)}))},end:function(){return this.prevObject||b(null)},push:M,sort:[].sort,splice:[].splice};b.fn.init.prototype=b.fn;b.extend=b.fn.extend=function(){var j,s,v,z,H,G=arguments[0]||{},K=1,Q=arguments.length,ga=false; +if(typeof G==="boolean"){ga=G;G=arguments[1]||{};K=2}if(typeof G!=="object"&&!b.isFunction(G))G={};if(Q===K){G=this;--K}for(;K<Q;K++)if((j=arguments[K])!=null)for(s in j){v=G[s];z=j[s];if(G!==z)if(ga&&z&&(b.isPlainObject(z)||(H=b.isArray(z)))){if(H){H=false;v=v&&b.isArray(v)?v:[]}else v=v&&b.isPlainObject(v)?v:{};G[s]=b.extend(ga,v,z)}else if(z!==B)G[s]=z}return G};b.extend({noConflict:function(j){E.$=e;if(j)E.jQuery=d;return b},isReady:false,readyWait:1,ready:function(j){j===true&&b.readyWait--; +if(!b.readyWait||j!==true&&!b.isReady){if(!t.body)return setTimeout(b.ready,1);b.isReady=true;if(!(j!==true&&--b.readyWait>0))if(q){var s=0,v=q;for(q=null;j=v[s++];)j.call(t,b);b.fn.trigger&&b(t).trigger("ready").unbind("ready")}}},bindReady:function(){if(!p){p=true;if(t.readyState==="complete")return setTimeout(b.ready,1);if(t.addEventListener){t.addEventListener("DOMContentLoaded",u,false);E.addEventListener("load",b.ready,false)}else if(t.attachEvent){t.attachEvent("onreadystatechange",u);E.attachEvent("onload", +b.ready);var j=false;try{j=E.frameElement==null}catch(s){}t.documentElement.doScroll&&j&&a()}}},isFunction:function(j){return b.type(j)==="function"},isArray:Array.isArray||function(j){return b.type(j)==="array"},isWindow:function(j){return j&&typeof j==="object"&&"setInterval"in j},isNaN:function(j){return j==null||!r.test(j)||isNaN(j)},type:function(j){return j==null?String(j):R[y.call(j)]||"object"},isPlainObject:function(j){if(!j||b.type(j)!=="object"||j.nodeType||b.isWindow(j))return false;if(j.constructor&& +!F.call(j,"constructor")&&!F.call(j.constructor.prototype,"isPrototypeOf"))return false;for(var s in j);return s===B||F.call(j,s)},isEmptyObject:function(j){for(var s in j)return false;return true},error:function(j){throw j;},parseJSON:function(j){if(typeof j!=="string"||!j)return null;j=b.trim(j);if(C.test(j.replace(J,"@").replace(w,"]").replace(I,"")))return E.JSON&&E.JSON.parse?E.JSON.parse(j):(new Function("return "+j))();else b.error("Invalid JSON: "+j)},noop:function(){},globalEval:function(j){if(j&& +l.test(j)){var s=t.getElementsByTagName("head")[0]||t.documentElement,v=t.createElement("script");v.type="text/javascript";if(b.support.scriptEval)v.appendChild(t.createTextNode(j));else v.text=j;s.insertBefore(v,s.firstChild);s.removeChild(v)}},nodeName:function(j,s){return j.nodeName&&j.nodeName.toUpperCase()===s.toUpperCase()},each:function(j,s,v){var z,H=0,G=j.length,K=G===B||b.isFunction(j);if(v)if(K)for(z in j){if(s.apply(j[z],v)===false)break}else for(;H<G;){if(s.apply(j[H++],v)===false)break}else if(K)for(z in j){if(s.call(j[z], +z,j[z])===false)break}else for(v=j[0];H<G&&s.call(v,H,v)!==false;v=j[++H]);return j},trim:O?function(j){return j==null?"":O.call(j)}:function(j){return j==null?"":j.toString().replace(k,"").replace(o,"")},makeArray:function(j,s){var v=s||[];if(j!=null){var z=b.type(j);j.length==null||z==="string"||z==="function"||z==="regexp"||b.isWindow(j)?M.call(v,j):b.merge(v,j)}return v},inArray:function(j,s){if(s.indexOf)return s.indexOf(j);for(var v=0,z=s.length;v<z;v++)if(s[v]===j)return v;return-1},merge:function(j, +s){var v=j.length,z=0;if(typeof s.length==="number")for(var H=s.length;z<H;z++)j[v++]=s[z];else for(;s[z]!==B;)j[v++]=s[z++];j.length=v;return j},grep:function(j,s,v){var z=[],H;v=!!v;for(var G=0,K=j.length;G<K;G++){H=!!s(j[G],G);v!==H&&z.push(j[G])}return z},map:function(j,s,v){for(var z=[],H,G=0,K=j.length;G<K;G++){H=s(j[G],G,v);if(H!=null)z[z.length]=H}return z.concat.apply([],z)},guid:1,proxy:function(j,s,v){if(arguments.length===2)if(typeof s==="string"){v=j;j=v[s];s=B}else if(s&&!b.isFunction(s)){v= +s;s=B}if(!s&&j)s=function(){return j.apply(v||this,arguments)};if(j)s.guid=j.guid=j.guid||s.guid||b.guid++;return s},access:function(j,s,v,z,H,G){var K=j.length;if(typeof s==="object"){for(var Q in s)b.access(j,Q,s[Q],z,H,v);return j}if(v!==B){z=!G&&z&&b.isFunction(v);for(Q=0;Q<K;Q++)H(j[Q],s,z?v.call(j[Q],Q,H(j[Q],s)):v,G);return j}return K?H(j[0],s):B},now:function(){return(new Date).getTime()},uaMatch:function(j){j=j.toLowerCase();j=L.exec(j)||g.exec(j)||i.exec(j)||j.indexOf("compatible")<0&&n.exec(j)|| +[];return{browser:j[1]||"",version:j[2]||"0"}},browser:{}});b.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(j,s){R["[object "+s+"]"]=s.toLowerCase()});m=b.uaMatch(m);if(m.browser){b.browser[m.browser]=true;b.browser.version=m.version}if(b.browser.webkit)b.browser.safari=true;if(D)b.inArray=function(j,s){return D.call(s,j)};if(!/\s/.test("\u00a0")){k=/^[\s\xA0]+/;o=/[\s\xA0]+$/}f=b(t);if(t.addEventListener)u=function(){t.removeEventListener("DOMContentLoaded",u, +false);b.ready()};else if(t.attachEvent)u=function(){if(t.readyState==="complete"){t.detachEvent("onreadystatechange",u);b.ready()}};return E.jQuery=E.$=b}();(function(){c.support={};var a=t.documentElement,b=t.createElement("script"),d=t.createElement("div"),e="script"+c.now();d.style.display="none";d.innerHTML=" <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";var f=d.getElementsByTagName("*"),h=d.getElementsByTagName("a")[0],l=t.createElement("select"), +k=l.appendChild(t.createElement("option"));if(!(!f||!f.length||!h)){c.support={leadingWhitespace:d.firstChild.nodeType===3,tbody:!d.getElementsByTagName("tbody").length,htmlSerialize:!!d.getElementsByTagName("link").length,style:/red/.test(h.getAttribute("style")),hrefNormalized:h.getAttribute("href")==="/a",opacity:/^0.55$/.test(h.style.opacity),cssFloat:!!h.style.cssFloat,checkOn:d.getElementsByTagName("input")[0].value==="on",optSelected:k.selected,deleteExpando:true,optDisabled:false,checkClone:false, +scriptEval:false,noCloneEvent:true,boxModel:null,inlineBlockNeedsLayout:false,shrinkWrapBlocks:false,reliableHiddenOffsets:true};l.disabled=true;c.support.optDisabled=!k.disabled;b.type="text/javascript";try{b.appendChild(t.createTextNode("window."+e+"=1;"))}catch(o){}a.insertBefore(b,a.firstChild);if(E[e]){c.support.scriptEval=true;delete E[e]}try{delete b.test}catch(x){c.support.deleteExpando=false}a.removeChild(b);if(d.attachEvent&&d.fireEvent){d.attachEvent("onclick",function r(){c.support.noCloneEvent= +false;d.detachEvent("onclick",r)});d.cloneNode(true).fireEvent("onclick")}d=t.createElement("div");d.innerHTML="<input type='radio' name='radiotest' checked='checked'/>";a=t.createDocumentFragment();a.appendChild(d.firstChild);c.support.checkClone=a.cloneNode(true).cloneNode(true).lastChild.checked;c(function(){var r=t.createElement("div");r.style.width=r.style.paddingLeft="1px";t.body.appendChild(r);c.boxModel=c.support.boxModel=r.offsetWidth===2;if("zoom"in r.style){r.style.display="inline";r.style.zoom= +1;c.support.inlineBlockNeedsLayout=r.offsetWidth===2;r.style.display="";r.innerHTML="<div style='width:4px;'></div>";c.support.shrinkWrapBlocks=r.offsetWidth!==2}r.innerHTML="<table><tr><td style='padding:0;display:none'></td><td>t</td></tr></table>";var A=r.getElementsByTagName("td");c.support.reliableHiddenOffsets=A[0].offsetHeight===0;A[0].style.display="";A[1].style.display="none";c.support.reliableHiddenOffsets=c.support.reliableHiddenOffsets&&A[0].offsetHeight===0;r.innerHTML="";t.body.removeChild(r).style.display= +"none"});a=function(r){var A=t.createElement("div");r="on"+r;var C=r in A;if(!C){A.setAttribute(r,"return;");C=typeof A[r]==="function"}return C};c.support.submitBubbles=a("submit");c.support.changeBubbles=a("change");a=b=d=f=h=null}})();var ra={},Ja=/^(?:\{.*\}|\[.*\])$/;c.extend({cache:{},uuid:0,expando:"jQuery"+c.now(),noData:{embed:true,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:true},data:function(a,b,d){if(c.acceptData(a)){a=a==E?ra:a;var e=a.nodeType,f=e?a[c.expando]:null,h= +c.cache;if(!(e&&!f&&typeof b==="string"&&d===B)){if(e)f||(a[c.expando]=f=++c.uuid);else h=a;if(typeof b==="object")if(e)h[f]=c.extend(h[f],b);else c.extend(h,b);else if(e&&!h[f])h[f]={};a=e?h[f]:h;if(d!==B)a[b]=d;return typeof b==="string"?a[b]:a}}},removeData:function(a,b){if(c.acceptData(a)){a=a==E?ra:a;var d=a.nodeType,e=d?a[c.expando]:a,f=c.cache,h=d?f[e]:e;if(b){if(h){delete h[b];d&&c.isEmptyObject(h)&&c.removeData(a)}}else if(d&&c.support.deleteExpando)delete a[c.expando];else if(a.removeAttribute)a.removeAttribute(c.expando); +else if(d)delete f[e];else for(var l in a)delete a[l]}},acceptData:function(a){if(a.nodeName){var b=c.noData[a.nodeName.toLowerCase()];if(b)return!(b===true||a.getAttribute("classid")!==b)}return true}});c.fn.extend({data:function(a,b){var d=null;if(typeof a==="undefined"){if(this.length){var e=this[0].attributes,f;d=c.data(this[0]);for(var h=0,l=e.length;h<l;h++){f=e[h].name;if(f.indexOf("data-")===0){f=f.substr(5);ka(this[0],f,d[f])}}}return d}else if(typeof a==="object")return this.each(function(){c.data(this, +a)});var k=a.split(".");k[1]=k[1]?"."+k[1]:"";if(b===B){d=this.triggerHandler("getData"+k[1]+"!",[k[0]]);if(d===B&&this.length){d=c.data(this[0],a);d=ka(this[0],a,d)}return d===B&&k[1]?this.data(k[0]):d}else return this.each(function(){var o=c(this),x=[k[0],b];o.triggerHandler("setData"+k[1]+"!",x);c.data(this,a,b);o.triggerHandler("changeData"+k[1]+"!",x)})},removeData:function(a){return this.each(function(){c.removeData(this,a)})}});c.extend({queue:function(a,b,d){if(a){b=(b||"fx")+"queue";var e= +c.data(a,b);if(!d)return e||[];if(!e||c.isArray(d))e=c.data(a,b,c.makeArray(d));else e.push(d);return e}},dequeue:function(a,b){b=b||"fx";var d=c.queue(a,b),e=d.shift();if(e==="inprogress")e=d.shift();if(e){b==="fx"&&d.unshift("inprogress");e.call(a,function(){c.dequeue(a,b)})}}});c.fn.extend({queue:function(a,b){if(typeof a!=="string"){b=a;a="fx"}if(b===B)return c.queue(this[0],a);return this.each(function(){var d=c.queue(this,a,b);a==="fx"&&d[0]!=="inprogress"&&c.dequeue(this,a)})},dequeue:function(a){return this.each(function(){c.dequeue(this, +a)})},delay:function(a,b){a=c.fx?c.fx.speeds[a]||a:a;b=b||"fx";return this.queue(b,function(){var d=this;setTimeout(function(){c.dequeue(d,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])}});var sa=/[\n\t]/g,ha=/\s+/,Sa=/\r/g,Ta=/^(?:href|src|style)$/,Ua=/^(?:button|input)$/i,Va=/^(?:button|input|object|select|textarea)$/i,Wa=/^a(?:rea)?$/i,ta=/^(?:radio|checkbox)$/i;c.props={"for":"htmlFor","class":"className",readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan", +colspan:"colSpan",tabindex:"tabIndex",usemap:"useMap",frameborder:"frameBorder"};c.fn.extend({attr:function(a,b){return c.access(this,a,b,true,c.attr)},removeAttr:function(a){return this.each(function(){c.attr(this,a,"");this.nodeType===1&&this.removeAttribute(a)})},addClass:function(a){if(c.isFunction(a))return this.each(function(x){var r=c(this);r.addClass(a.call(this,x,r.attr("class")))});if(a&&typeof a==="string")for(var b=(a||"").split(ha),d=0,e=this.length;d<e;d++){var f=this[d];if(f.nodeType=== +1)if(f.className){for(var h=" "+f.className+" ",l=f.className,k=0,o=b.length;k<o;k++)if(h.indexOf(" "+b[k]+" ")<0)l+=" "+b[k];f.className=c.trim(l)}else f.className=a}return this},removeClass:function(a){if(c.isFunction(a))return this.each(function(o){var x=c(this);x.removeClass(a.call(this,o,x.attr("class")))});if(a&&typeof a==="string"||a===B)for(var b=(a||"").split(ha),d=0,e=this.length;d<e;d++){var f=this[d];if(f.nodeType===1&&f.className)if(a){for(var h=(" "+f.className+" ").replace(sa," "), +l=0,k=b.length;l<k;l++)h=h.replace(" "+b[l]+" "," ");f.className=c.trim(h)}else f.className=""}return this},toggleClass:function(a,b){var d=typeof a,e=typeof b==="boolean";if(c.isFunction(a))return this.each(function(f){var h=c(this);h.toggleClass(a.call(this,f,h.attr("class"),b),b)});return this.each(function(){if(d==="string")for(var f,h=0,l=c(this),k=b,o=a.split(ha);f=o[h++];){k=e?k:!l.hasClass(f);l[k?"addClass":"removeClass"](f)}else if(d==="undefined"||d==="boolean"){this.className&&c.data(this, +"__className__",this.className);this.className=this.className||a===false?"":c.data(this,"__className__")||""}})},hasClass:function(a){a=" "+a+" ";for(var b=0,d=this.length;b<d;b++)if((" "+this[b].className+" ").replace(sa," ").indexOf(a)>-1)return true;return false},val:function(a){if(!arguments.length){var b=this[0];if(b){if(c.nodeName(b,"option")){var d=b.attributes.value;return!d||d.specified?b.value:b.text}if(c.nodeName(b,"select")){var e=b.selectedIndex;d=[];var f=b.options;b=b.type==="select-one"; +if(e<0)return null;var h=b?e:0;for(e=b?e+1:f.length;h<e;h++){var l=f[h];if(l.selected&&(c.support.optDisabled?!l.disabled:l.getAttribute("disabled")===null)&&(!l.parentNode.disabled||!c.nodeName(l.parentNode,"optgroup"))){a=c(l).val();if(b)return a;d.push(a)}}return d}if(ta.test(b.type)&&!c.support.checkOn)return b.getAttribute("value")===null?"on":b.value;return(b.value||"").replace(Sa,"")}return B}var k=c.isFunction(a);return this.each(function(o){var x=c(this),r=a;if(this.nodeType===1){if(k)r= +a.call(this,o,x.val());if(r==null)r="";else if(typeof r==="number")r+="";else if(c.isArray(r))r=c.map(r,function(C){return C==null?"":C+""});if(c.isArray(r)&&ta.test(this.type))this.checked=c.inArray(x.val(),r)>=0;else if(c.nodeName(this,"select")){var A=c.makeArray(r);c("option",this).each(function(){this.selected=c.inArray(c(this).val(),A)>=0});if(!A.length)this.selectedIndex=-1}else this.value=r}})}});c.extend({attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true}, +attr:function(a,b,d,e){if(!a||a.nodeType===3||a.nodeType===8)return B;if(e&&b in c.attrFn)return c(a)[b](d);e=a.nodeType!==1||!c.isXMLDoc(a);var f=d!==B;b=e&&c.props[b]||b;var h=Ta.test(b);if((b in a||a[b]!==B)&&e&&!h){if(f){b==="type"&&Ua.test(a.nodeName)&&a.parentNode&&c.error("type property can't be changed");if(d===null)a.nodeType===1&&a.removeAttribute(b);else a[b]=d}if(c.nodeName(a,"form")&&a.getAttributeNode(b))return a.getAttributeNode(b).nodeValue;if(b==="tabIndex")return(b=a.getAttributeNode("tabIndex"))&& +b.specified?b.value:Va.test(a.nodeName)||Wa.test(a.nodeName)&&a.href?0:B;return a[b]}if(!c.support.style&&e&&b==="style"){if(f)a.style.cssText=""+d;return a.style.cssText}f&&a.setAttribute(b,""+d);if(!a.attributes[b]&&a.hasAttribute&&!a.hasAttribute(b))return B;a=!c.support.hrefNormalized&&e&&h?a.getAttribute(b,2):a.getAttribute(b);return a===null?B:a}});var X=/\.(.*)$/,ia=/^(?:textarea|input|select)$/i,La=/\./g,Ma=/ /g,Xa=/[^\w\s.|`]/g,Ya=function(a){return a.replace(Xa,"\\$&")},ua={focusin:0,focusout:0}; +c.event={add:function(a,b,d,e){if(!(a.nodeType===3||a.nodeType===8)){if(c.isWindow(a)&&a!==E&&!a.frameElement)a=E;if(d===false)d=U;else if(!d)return;var f,h;if(d.handler){f=d;d=f.handler}if(!d.guid)d.guid=c.guid++;if(h=c.data(a)){var l=a.nodeType?"events":"__events__",k=h[l],o=h.handle;if(typeof k==="function"){o=k.handle;k=k.events}else if(!k){a.nodeType||(h[l]=h=function(){});h.events=k={}}if(!o)h.handle=o=function(){return typeof c!=="undefined"&&!c.event.triggered?c.event.handle.apply(o.elem, +arguments):B};o.elem=a;b=b.split(" ");for(var x=0,r;l=b[x++];){h=f?c.extend({},f):{handler:d,data:e};if(l.indexOf(".")>-1){r=l.split(".");l=r.shift();h.namespace=r.slice(0).sort().join(".")}else{r=[];h.namespace=""}h.type=l;if(!h.guid)h.guid=d.guid;var A=k[l],C=c.event.special[l]||{};if(!A){A=k[l]=[];if(!C.setup||C.setup.call(a,e,r,o)===false)if(a.addEventListener)a.addEventListener(l,o,false);else a.attachEvent&&a.attachEvent("on"+l,o)}if(C.add){C.add.call(a,h);if(!h.handler.guid)h.handler.guid= +d.guid}A.push(h);c.event.global[l]=true}a=null}}},global:{},remove:function(a,b,d,e){if(!(a.nodeType===3||a.nodeType===8)){if(d===false)d=U;var f,h,l=0,k,o,x,r,A,C,J=a.nodeType?"events":"__events__",w=c.data(a),I=w&&w[J];if(w&&I){if(typeof I==="function"){w=I;I=I.events}if(b&&b.type){d=b.handler;b=b.type}if(!b||typeof b==="string"&&b.charAt(0)==="."){b=b||"";for(f in I)c.event.remove(a,f+b)}else{for(b=b.split(" ");f=b[l++];){r=f;k=f.indexOf(".")<0;o=[];if(!k){o=f.split(".");f=o.shift();x=RegExp("(^|\\.)"+ +c.map(o.slice(0).sort(),Ya).join("\\.(?:.*\\.)?")+"(\\.|$)")}if(A=I[f])if(d){r=c.event.special[f]||{};for(h=e||0;h<A.length;h++){C=A[h];if(d.guid===C.guid){if(k||x.test(C.namespace)){e==null&&A.splice(h--,1);r.remove&&r.remove.call(a,C)}if(e!=null)break}}if(A.length===0||e!=null&&A.length===1){if(!r.teardown||r.teardown.call(a,o)===false)c.removeEvent(a,f,w.handle);delete I[f]}}else for(h=0;h<A.length;h++){C=A[h];if(k||x.test(C.namespace)){c.event.remove(a,r,C.handler,h);A.splice(h--,1)}}}if(c.isEmptyObject(I)){if(b= +w.handle)b.elem=null;delete w.events;delete w.handle;if(typeof w==="function")c.removeData(a,J);else c.isEmptyObject(w)&&c.removeData(a)}}}}},trigger:function(a,b,d,e){var f=a.type||a;if(!e){a=typeof a==="object"?a[c.expando]?a:c.extend(c.Event(f),a):c.Event(f);if(f.indexOf("!")>=0){a.type=f=f.slice(0,-1);a.exclusive=true}if(!d){a.stopPropagation();c.event.global[f]&&c.each(c.cache,function(){this.events&&this.events[f]&&c.event.trigger(a,b,this.handle.elem)})}if(!d||d.nodeType===3||d.nodeType=== +8)return B;a.result=B;a.target=d;b=c.makeArray(b);b.unshift(a)}a.currentTarget=d;(e=d.nodeType?c.data(d,"handle"):(c.data(d,"__events__")||{}).handle)&&e.apply(d,b);e=d.parentNode||d.ownerDocument;try{if(!(d&&d.nodeName&&c.noData[d.nodeName.toLowerCase()]))if(d["on"+f]&&d["on"+f].apply(d,b)===false){a.result=false;a.preventDefault()}}catch(h){}if(!a.isPropagationStopped()&&e)c.event.trigger(a,b,e,true);else if(!a.isDefaultPrevented()){var l;e=a.target;var k=f.replace(X,""),o=c.nodeName(e,"a")&&k=== +"click",x=c.event.special[k]||{};if((!x._default||x._default.call(d,a)===false)&&!o&&!(e&&e.nodeName&&c.noData[e.nodeName.toLowerCase()])){try{if(e[k]){if(l=e["on"+k])e["on"+k]=null;c.event.triggered=true;e[k]()}}catch(r){}if(l)e["on"+k]=l;c.event.triggered=false}}},handle:function(a){var b,d,e,f;d=[];var h=c.makeArray(arguments);a=h[0]=c.event.fix(a||E.event);a.currentTarget=this;b=a.type.indexOf(".")<0&&!a.exclusive;if(!b){e=a.type.split(".");a.type=e.shift();d=e.slice(0).sort();e=RegExp("(^|\\.)"+ +d.join("\\.(?:.*\\.)?")+"(\\.|$)")}a.namespace=a.namespace||d.join(".");f=c.data(this,this.nodeType?"events":"__events__");if(typeof f==="function")f=f.events;d=(f||{})[a.type];if(f&&d){d=d.slice(0);f=0;for(var l=d.length;f<l;f++){var k=d[f];if(b||e.test(k.namespace)){a.handler=k.handler;a.data=k.data;a.handleObj=k;k=k.handler.apply(this,h);if(k!==B){a.result=k;if(k===false){a.preventDefault();a.stopPropagation()}}if(a.isImmediatePropagationStopped())break}}}return a.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), +fix:function(a){if(a[c.expando])return a;var b=a;a=c.Event(b);for(var d=this.props.length,e;d;){e=this.props[--d];a[e]=b[e]}if(!a.target)a.target=a.srcElement||t;if(a.target.nodeType===3)a.target=a.target.parentNode;if(!a.relatedTarget&&a.fromElement)a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement;if(a.pageX==null&&a.clientX!=null){b=t.documentElement;d=t.body;a.pageX=a.clientX+(b&&b.scrollLeft||d&&d.scrollLeft||0)-(b&&b.clientLeft||d&&d.clientLeft||0);a.pageY=a.clientY+(b&&b.scrollTop|| +d&&d.scrollTop||0)-(b&&b.clientTop||d&&d.clientTop||0)}if(a.which==null&&(a.charCode!=null||a.keyCode!=null))a.which=a.charCode!=null?a.charCode:a.keyCode;if(!a.metaKey&&a.ctrlKey)a.metaKey=a.ctrlKey;if(!a.which&&a.button!==B)a.which=a.button&1?1:a.button&2?3:a.button&4?2:0;return a},guid:1E8,proxy:c.proxy,special:{ready:{setup:c.bindReady,teardown:c.noop},live:{add:function(a){c.event.add(this,Y(a.origType,a.selector),c.extend({},a,{handler:Ka,guid:a.handler.guid}))},remove:function(a){c.event.remove(this, +Y(a.origType,a.selector),a)}},beforeunload:{setup:function(a,b,d){if(c.isWindow(this))this.onbeforeunload=d},teardown:function(a,b){if(this.onbeforeunload===b)this.onbeforeunload=null}}}};c.removeEvent=t.removeEventListener?function(a,b,d){a.removeEventListener&&a.removeEventListener(b,d,false)}:function(a,b,d){a.detachEvent&&a.detachEvent("on"+b,d)};c.Event=function(a){if(!this.preventDefault)return new c.Event(a);if(a&&a.type){this.originalEvent=a;this.type=a.type}else this.type=a;this.timeStamp= +c.now();this[c.expando]=true};c.Event.prototype={preventDefault:function(){this.isDefaultPrevented=ca;var a=this.originalEvent;if(a)if(a.preventDefault)a.preventDefault();else a.returnValue=false},stopPropagation:function(){this.isPropagationStopped=ca;var a=this.originalEvent;if(a){a.stopPropagation&&a.stopPropagation();a.cancelBubble=true}},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=ca;this.stopPropagation()},isDefaultPrevented:U,isPropagationStopped:U,isImmediatePropagationStopped:U}; +var va=function(a){var b=a.relatedTarget;try{for(;b&&b!==this;)b=b.parentNode;if(b!==this){a.type=a.data;c.event.handle.apply(this,arguments)}}catch(d){}},wa=function(a){a.type=a.data;c.event.handle.apply(this,arguments)};c.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){c.event.special[a]={setup:function(d){c.event.add(this,b,d&&d.selector?wa:va,a)},teardown:function(d){c.event.remove(this,b,d&&d.selector?wa:va)}}});if(!c.support.submitBubbles)c.event.special.submit={setup:function(){if(this.nodeName.toLowerCase()!== +"form"){c.event.add(this,"click.specialSubmit",function(a){var b=a.target,d=b.type;if((d==="submit"||d==="image")&&c(b).closest("form").length){a.liveFired=B;return la("submit",this,arguments)}});c.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,d=b.type;if((d==="text"||d==="password")&&c(b).closest("form").length&&a.keyCode===13){a.liveFired=B;return la("submit",this,arguments)}})}else return false},teardown:function(){c.event.remove(this,".specialSubmit")}};if(!c.support.changeBubbles){var V, +xa=function(a){var b=a.type,d=a.value;if(b==="radio"||b==="checkbox")d=a.checked;else if(b==="select-multiple")d=a.selectedIndex>-1?c.map(a.options,function(e){return e.selected}).join("-"):"";else if(a.nodeName.toLowerCase()==="select")d=a.selectedIndex;return d},Z=function(a,b){var d=a.target,e,f;if(!(!ia.test(d.nodeName)||d.readOnly)){e=c.data(d,"_change_data");f=xa(d);if(a.type!=="focusout"||d.type!=="radio")c.data(d,"_change_data",f);if(!(e===B||f===e))if(e!=null||f){a.type="change";a.liveFired= +B;return c.event.trigger(a,b,d)}}};c.event.special.change={filters:{focusout:Z,beforedeactivate:Z,click:function(a){var b=a.target,d=b.type;if(d==="radio"||d==="checkbox"||b.nodeName.toLowerCase()==="select")return Z.call(this,a)},keydown:function(a){var b=a.target,d=b.type;if(a.keyCode===13&&b.nodeName.toLowerCase()!=="textarea"||a.keyCode===32&&(d==="checkbox"||d==="radio")||d==="select-multiple")return Z.call(this,a)},beforeactivate:function(a){a=a.target;c.data(a,"_change_data",xa(a))}},setup:function(){if(this.type=== +"file")return false;for(var a in V)c.event.add(this,a+".specialChange",V[a]);return ia.test(this.nodeName)},teardown:function(){c.event.remove(this,".specialChange");return ia.test(this.nodeName)}};V=c.event.special.change.filters;V.focus=V.beforeactivate}t.addEventListener&&c.each({focus:"focusin",blur:"focusout"},function(a,b){function d(e){e=c.event.fix(e);e.type=b;return c.event.trigger(e,null,e.target)}c.event.special[b]={setup:function(){ua[b]++===0&&t.addEventListener(a,d,true)},teardown:function(){--ua[b]=== +0&&t.removeEventListener(a,d,true)}}});c.each(["bind","one"],function(a,b){c.fn[b]=function(d,e,f){if(typeof d==="object"){for(var h in d)this[b](h,e,d[h],f);return this}if(c.isFunction(e)||e===false){f=e;e=B}var l=b==="one"?c.proxy(f,function(o){c(this).unbind(o,l);return f.apply(this,arguments)}):f;if(d==="unload"&&b!=="one")this.one(d,e,f);else{h=0;for(var k=this.length;h<k;h++)c.event.add(this[h],d,l,e)}return this}});c.fn.extend({unbind:function(a,b){if(typeof a==="object"&&!a.preventDefault)for(var d in a)this.unbind(d, +a[d]);else{d=0;for(var e=this.length;d<e;d++)c.event.remove(this[d],a,b)}return this},delegate:function(a,b,d,e){return this.live(b,d,e,a)},undelegate:function(a,b,d){return arguments.length===0?this.unbind("live"):this.die(b,null,d,a)},trigger:function(a,b){return this.each(function(){c.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0]){var d=c.Event(a);d.preventDefault();d.stopPropagation();c.event.trigger(d,b,this[0]);return d.result}},toggle:function(a){for(var b=arguments,d= +1;d<b.length;)c.proxy(a,b[d++]);return this.click(c.proxy(a,function(e){var f=(c.data(this,"lastToggle"+a.guid)||0)%d;c.data(this,"lastToggle"+a.guid,f+1);e.preventDefault();return b[f].apply(this,arguments)||false}))},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var ya={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};c.each(["live","die"],function(a,b){c.fn[b]=function(d,e,f,h){var l,k=0,o,x,r=h||this.selector;h=h?this:c(this.context);if(typeof d=== +"object"&&!d.preventDefault){for(l in d)h[b](l,e,d[l],r);return this}if(c.isFunction(e)){f=e;e=B}for(d=(d||"").split(" ");(l=d[k++])!=null;){o=X.exec(l);x="";if(o){x=o[0];l=l.replace(X,"")}if(l==="hover")d.push("mouseenter"+x,"mouseleave"+x);else{o=l;if(l==="focus"||l==="blur"){d.push(ya[l]+x);l+=x}else l=(ya[l]||l)+x;if(b==="live"){x=0;for(var A=h.length;x<A;x++)c.event.add(h[x],"live."+Y(l,r),{data:e,selector:r,handler:f,origType:l,origHandler:f,preType:o})}else h.unbind("live."+Y(l,r),f)}}return this}}); +c.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){c.fn[b]=function(d,e){if(e==null){e=d;d=null}return arguments.length>0?this.bind(b,d,e):this.trigger(b)};if(c.attrFn)c.attrFn[b]=true});E.attachEvent&&!E.addEventListener&&c(E).bind("unload",function(){for(var a in c.cache)if(c.cache[a].handle)try{c.event.remove(c.cache[a].handle.elem)}catch(b){}}); +(function(){function a(g,i,n,m,p,q){p=0;for(var u=m.length;p<u;p++){var y=m[p];if(y){var F=false;for(y=y[g];y;){if(y.sizcache===n){F=m[y.sizset];break}if(y.nodeType===1&&!q){y.sizcache=n;y.sizset=p}if(y.nodeName.toLowerCase()===i){F=y;break}y=y[g]}m[p]=F}}}function b(g,i,n,m,p,q){p=0;for(var u=m.length;p<u;p++){var y=m[p];if(y){var F=false;for(y=y[g];y;){if(y.sizcache===n){F=m[y.sizset];break}if(y.nodeType===1){if(!q){y.sizcache=n;y.sizset=p}if(typeof i!=="string"){if(y===i){F=true;break}}else if(k.filter(i, +[y]).length>0){F=y;break}}y=y[g]}m[p]=F}}}var d=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,e=0,f=Object.prototype.toString,h=false,l=true;[0,0].sort(function(){l=false;return 0});var k=function(g,i,n,m){n=n||[];var p=i=i||t;if(i.nodeType!==1&&i.nodeType!==9)return[];if(!g||typeof g!=="string")return n;var q,u,y,F,M,N=true,O=k.isXML(i),D=[],R=g;do{d.exec("");if(q=d.exec(R)){R=q[3];D.push(q[1]);if(q[2]){F=q[3]; +break}}}while(q);if(D.length>1&&x.exec(g))if(D.length===2&&o.relative[D[0]])u=L(D[0]+D[1],i);else for(u=o.relative[D[0]]?[i]:k(D.shift(),i);D.length;){g=D.shift();if(o.relative[g])g+=D.shift();u=L(g,u)}else{if(!m&&D.length>1&&i.nodeType===9&&!O&&o.match.ID.test(D[0])&&!o.match.ID.test(D[D.length-1])){q=k.find(D.shift(),i,O);i=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]}if(i){q=m?{expr:D.pop(),set:C(m)}:k.find(D.pop(),D.length===1&&(D[0]==="~"||D[0]==="+")&&i.parentNode?i.parentNode:i,O);u=q.expr?k.filter(q.expr, +q.set):q.set;if(D.length>0)y=C(u);else N=false;for(;D.length;){q=M=D.pop();if(o.relative[M])q=D.pop();else M="";if(q==null)q=i;o.relative[M](y,q,O)}}else y=[]}y||(y=u);y||k.error(M||g);if(f.call(y)==="[object Array]")if(N)if(i&&i.nodeType===1)for(g=0;y[g]!=null;g++){if(y[g]&&(y[g]===true||y[g].nodeType===1&&k.contains(i,y[g])))n.push(u[g])}else for(g=0;y[g]!=null;g++)y[g]&&y[g].nodeType===1&&n.push(u[g]);else n.push.apply(n,y);else C(y,n);if(F){k(F,p,n,m);k.uniqueSort(n)}return n};k.uniqueSort=function(g){if(w){h= +l;g.sort(w);if(h)for(var i=1;i<g.length;i++)g[i]===g[i-1]&&g.splice(i--,1)}return g};k.matches=function(g,i){return k(g,null,null,i)};k.matchesSelector=function(g,i){return k(i,null,null,[g]).length>0};k.find=function(g,i,n){var m;if(!g)return[];for(var p=0,q=o.order.length;p<q;p++){var u,y=o.order[p];if(u=o.leftMatch[y].exec(g)){var F=u[1];u.splice(1,1);if(F.substr(F.length-1)!=="\\"){u[1]=(u[1]||"").replace(/\\/g,"");m=o.find[y](u,i,n);if(m!=null){g=g.replace(o.match[y],"");break}}}}m||(m=i.getElementsByTagName("*")); +return{set:m,expr:g}};k.filter=function(g,i,n,m){for(var p,q,u=g,y=[],F=i,M=i&&i[0]&&k.isXML(i[0]);g&&i.length;){for(var N in o.filter)if((p=o.leftMatch[N].exec(g))!=null&&p[2]){var O,D,R=o.filter[N];D=p[1];q=false;p.splice(1,1);if(D.substr(D.length-1)!=="\\"){if(F===y)y=[];if(o.preFilter[N])if(p=o.preFilter[N](p,F,n,y,m,M)){if(p===true)continue}else q=O=true;if(p)for(var j=0;(D=F[j])!=null;j++)if(D){O=R(D,p,j,F);var s=m^!!O;if(n&&O!=null)if(s)q=true;else F[j]=false;else if(s){y.push(D);q=true}}if(O!== +B){n||(F=y);g=g.replace(o.match[N],"");if(!q)return[];break}}}if(g===u)if(q==null)k.error(g);else break;u=g}return F};k.error=function(g){throw"Syntax error, unrecognized expression: "+g;};var o=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\((even|odd|[\dn+\-]*)\))?/, +POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(g){return g.getAttribute("href")}},relative:{"+":function(g,i){var n=typeof i==="string",m=n&&!/\W/.test(i);n=n&&!m;if(m)i=i.toLowerCase();m=0;for(var p=g.length,q;m<p;m++)if(q=g[m]){for(;(q=q.previousSibling)&&q.nodeType!==1;);g[m]=n||q&&q.nodeName.toLowerCase()=== +i?q||false:q===i}n&&k.filter(i,g,true)},">":function(g,i){var n,m=typeof i==="string",p=0,q=g.length;if(m&&!/\W/.test(i))for(i=i.toLowerCase();p<q;p++){if(n=g[p]){n=n.parentNode;g[p]=n.nodeName.toLowerCase()===i?n:false}}else{for(;p<q;p++)if(n=g[p])g[p]=m?n.parentNode:n.parentNode===i;m&&k.filter(i,g,true)}},"":function(g,i,n){var m,p=e++,q=b;if(typeof i==="string"&&!/\W/.test(i)){m=i=i.toLowerCase();q=a}q("parentNode",i,p,g,m,n)},"~":function(g,i,n){var m,p=e++,q=b;if(typeof i==="string"&&!/\W/.test(i)){m= +i=i.toLowerCase();q=a}q("previousSibling",i,p,g,m,n)}},find:{ID:function(g,i,n){if(typeof i.getElementById!=="undefined"&&!n)return(g=i.getElementById(g[1]))&&g.parentNode?[g]:[]},NAME:function(g,i){if(typeof i.getElementsByName!=="undefined"){for(var n=[],m=i.getElementsByName(g[1]),p=0,q=m.length;p<q;p++)m[p].getAttribute("name")===g[1]&&n.push(m[p]);return n.length===0?null:n}},TAG:function(g,i){return i.getElementsByTagName(g[1])}},preFilter:{CLASS:function(g,i,n,m,p,q){g=" "+g[1].replace(/\\/g, +"")+" ";if(q)return g;q=0;for(var u;(u=i[q])!=null;q++)if(u)if(p^(u.className&&(" "+u.className+" ").replace(/[\t\n]/g," ").indexOf(g)>=0))n||m.push(u);else if(n)i[q]=false;return false},ID:function(g){return g[1].replace(/\\/g,"")},TAG:function(g){return g[1].toLowerCase()},CHILD:function(g){if(g[1]==="nth"){var i=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(g[2]==="even"&&"2n"||g[2]==="odd"&&"2n+1"||!/\D/.test(g[2])&&"0n+"+g[2]||g[2]);g[2]=i[1]+(i[2]||1)-0;g[3]=i[3]-0}g[0]=e++;return g},ATTR:function(g,i,n, +m,p,q){i=g[1].replace(/\\/g,"");if(!q&&o.attrMap[i])g[1]=o.attrMap[i];if(g[2]==="~=")g[4]=" "+g[4]+" ";return g},PSEUDO:function(g,i,n,m,p){if(g[1]==="not")if((d.exec(g[3])||"").length>1||/^\w/.test(g[3]))g[3]=k(g[3],null,null,i);else{g=k.filter(g[3],i,n,true^p);n||m.push.apply(m,g);return false}else if(o.match.POS.test(g[0])||o.match.CHILD.test(g[0]))return true;return g},POS:function(g){g.unshift(true);return g}},filters:{enabled:function(g){return g.disabled===false&&g.type!=="hidden"},disabled:function(g){return g.disabled=== +true},checked:function(g){return g.checked===true},selected:function(g){return g.selected===true},parent:function(g){return!!g.firstChild},empty:function(g){return!g.firstChild},has:function(g,i,n){return!!k(n[3],g).length},header:function(g){return/h\d/i.test(g.nodeName)},text:function(g){return"text"===g.type},radio:function(g){return"radio"===g.type},checkbox:function(g){return"checkbox"===g.type},file:function(g){return"file"===g.type},password:function(g){return"password"===g.type},submit:function(g){return"submit"=== +g.type},image:function(g){return"image"===g.type},reset:function(g){return"reset"===g.type},button:function(g){return"button"===g.type||g.nodeName.toLowerCase()==="button"},input:function(g){return/input|select|textarea|button/i.test(g.nodeName)}},setFilters:{first:function(g,i){return i===0},last:function(g,i,n,m){return i===m.length-1},even:function(g,i){return i%2===0},odd:function(g,i){return i%2===1},lt:function(g,i,n){return i<n[3]-0},gt:function(g,i,n){return i>n[3]-0},nth:function(g,i,n){return n[3]- +0===i},eq:function(g,i,n){return n[3]-0===i}},filter:{PSEUDO:function(g,i,n,m){var p=i[1],q=o.filters[p];if(q)return q(g,n,i,m);else if(p==="contains")return(g.textContent||g.innerText||k.getText([g])||"").indexOf(i[3])>=0;else if(p==="not"){i=i[3];n=0;for(m=i.length;n<m;n++)if(i[n]===g)return false;return true}else k.error("Syntax error, unrecognized expression: "+p)},CHILD:function(g,i){var n=i[1],m=g;switch(n){case "only":case "first":for(;m=m.previousSibling;)if(m.nodeType===1)return false;if(n=== +"first")return true;m=g;case "last":for(;m=m.nextSibling;)if(m.nodeType===1)return false;return true;case "nth":n=i[2];var p=i[3];if(n===1&&p===0)return true;var q=i[0],u=g.parentNode;if(u&&(u.sizcache!==q||!g.nodeIndex)){var y=0;for(m=u.firstChild;m;m=m.nextSibling)if(m.nodeType===1)m.nodeIndex=++y;u.sizcache=q}m=g.nodeIndex-p;return n===0?m===0:m%n===0&&m/n>=0}},ID:function(g,i){return g.nodeType===1&&g.getAttribute("id")===i},TAG:function(g,i){return i==="*"&&g.nodeType===1||g.nodeName.toLowerCase()=== +i},CLASS:function(g,i){return(" "+(g.className||g.getAttribute("class"))+" ").indexOf(i)>-1},ATTR:function(g,i){var n=i[1];n=o.attrHandle[n]?o.attrHandle[n](g):g[n]!=null?g[n]:g.getAttribute(n);var m=n+"",p=i[2],q=i[4];return n==null?p==="!=":p==="="?m===q:p==="*="?m.indexOf(q)>=0:p==="~="?(" "+m+" ").indexOf(q)>=0:!q?m&&n!==false:p==="!="?m!==q:p==="^="?m.indexOf(q)===0:p==="$="?m.substr(m.length-q.length)===q:p==="|="?m===q||m.substr(0,q.length+1)===q+"-":false},POS:function(g,i,n,m){var p=o.setFilters[i[2]]; +if(p)return p(g,n,i,m)}}},x=o.match.POS,r=function(g,i){return"\\"+(i-0+1)},A;for(A in o.match){o.match[A]=RegExp(o.match[A].source+/(?![^\[]*\])(?![^\(]*\))/.source);o.leftMatch[A]=RegExp(/(^(?:.|\r|\n)*?)/.source+o.match[A].source.replace(/\\(\d+)/g,r))}var C=function(g,i){g=Array.prototype.slice.call(g,0);if(i){i.push.apply(i,g);return i}return g};try{Array.prototype.slice.call(t.documentElement.childNodes,0)}catch(J){C=function(g,i){var n=0,m=i||[];if(f.call(g)==="[object Array]")Array.prototype.push.apply(m, +g);else if(typeof g.length==="number")for(var p=g.length;n<p;n++)m.push(g[n]);else for(;g[n];n++)m.push(g[n]);return m}}var w,I;if(t.documentElement.compareDocumentPosition)w=function(g,i){if(g===i){h=true;return 0}if(!g.compareDocumentPosition||!i.compareDocumentPosition)return g.compareDocumentPosition?-1:1;return g.compareDocumentPosition(i)&4?-1:1};else{w=function(g,i){var n,m,p=[],q=[];n=g.parentNode;m=i.parentNode;var u=n;if(g===i){h=true;return 0}else if(n===m)return I(g,i);else if(n){if(!m)return 1}else return-1; +for(;u;){p.unshift(u);u=u.parentNode}for(u=m;u;){q.unshift(u);u=u.parentNode}n=p.length;m=q.length;for(u=0;u<n&&u<m;u++)if(p[u]!==q[u])return I(p[u],q[u]);return u===n?I(g,q[u],-1):I(p[u],i,1)};I=function(g,i,n){if(g===i)return n;for(g=g.nextSibling;g;){if(g===i)return-1;g=g.nextSibling}return 1}}k.getText=function(g){for(var i="",n,m=0;g[m];m++){n=g[m];if(n.nodeType===3||n.nodeType===4)i+=n.nodeValue;else if(n.nodeType!==8)i+=k.getText(n.childNodes)}return i};(function(){var g=t.createElement("div"), +i="script"+(new Date).getTime(),n=t.documentElement;g.innerHTML="<a name='"+i+"'/>";n.insertBefore(g,n.firstChild);if(t.getElementById(i)){o.find.ID=function(m,p,q){if(typeof p.getElementById!=="undefined"&&!q)return(p=p.getElementById(m[1]))?p.id===m[1]||typeof p.getAttributeNode!=="undefined"&&p.getAttributeNode("id").nodeValue===m[1]?[p]:B:[]};o.filter.ID=function(m,p){var q=typeof m.getAttributeNode!=="undefined"&&m.getAttributeNode("id");return m.nodeType===1&&q&&q.nodeValue===p}}n.removeChild(g); +n=g=null})();(function(){var g=t.createElement("div");g.appendChild(t.createComment(""));if(g.getElementsByTagName("*").length>0)o.find.TAG=function(i,n){var m=n.getElementsByTagName(i[1]);if(i[1]==="*"){for(var p=[],q=0;m[q];q++)m[q].nodeType===1&&p.push(m[q]);m=p}return m};g.innerHTML="<a href='#'></a>";if(g.firstChild&&typeof g.firstChild.getAttribute!=="undefined"&&g.firstChild.getAttribute("href")!=="#")o.attrHandle.href=function(i){return i.getAttribute("href",2)};g=null})();t.querySelectorAll&& +function(){var g=k,i=t.createElement("div");i.innerHTML="<p class='TEST'></p>";if(!(i.querySelectorAll&&i.querySelectorAll(".TEST").length===0)){k=function(m,p,q,u){p=p||t;m=m.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!u&&!k.isXML(p))if(p.nodeType===9)try{return C(p.querySelectorAll(m),q)}catch(y){}else if(p.nodeType===1&&p.nodeName.toLowerCase()!=="object"){var F=p.getAttribute("id"),M=F||"__sizzle__";F||p.setAttribute("id",M);try{return C(p.querySelectorAll("#"+M+" "+m),q)}catch(N){}finally{F|| +p.removeAttribute("id")}}return g(m,p,q,u)};for(var n in g)k[n]=g[n];i=null}}();(function(){var g=t.documentElement,i=g.matchesSelector||g.mozMatchesSelector||g.webkitMatchesSelector||g.msMatchesSelector,n=false;try{i.call(t.documentElement,"[test!='']:sizzle")}catch(m){n=true}if(i)k.matchesSelector=function(p,q){q=q.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(p))try{if(n||!o.match.PSEUDO.test(q)&&!/!=/.test(q))return i.call(p,q)}catch(u){}return k(q,null,null,[p]).length>0}})();(function(){var g= +t.createElement("div");g.innerHTML="<div class='test e'></div><div class='test'></div>";if(!(!g.getElementsByClassName||g.getElementsByClassName("e").length===0)){g.lastChild.className="e";if(g.getElementsByClassName("e").length!==1){o.order.splice(1,0,"CLASS");o.find.CLASS=function(i,n,m){if(typeof n.getElementsByClassName!=="undefined"&&!m)return n.getElementsByClassName(i[1])};g=null}}})();k.contains=t.documentElement.contains?function(g,i){return g!==i&&(g.contains?g.contains(i):true)}:t.documentElement.compareDocumentPosition? +function(g,i){return!!(g.compareDocumentPosition(i)&16)}:function(){return false};k.isXML=function(g){return(g=(g?g.ownerDocument||g:0).documentElement)?g.nodeName!=="HTML":false};var L=function(g,i){for(var n,m=[],p="",q=i.nodeType?[i]:i;n=o.match.PSEUDO.exec(g);){p+=n[0];g=g.replace(o.match.PSEUDO,"")}g=o.relative[g]?g+"*":g;n=0;for(var u=q.length;n<u;n++)k(g,q[n],m);return k.filter(p,m)};c.find=k;c.expr=k.selectors;c.expr[":"]=c.expr.filters;c.unique=k.uniqueSort;c.text=k.getText;c.isXMLDoc=k.isXML; +c.contains=k.contains})();var Za=/Until$/,$a=/^(?:parents|prevUntil|prevAll)/,ab=/,/,Na=/^.[^:#\[\.,]*$/,bb=Array.prototype.slice,cb=c.expr.match.POS;c.fn.extend({find:function(a){for(var b=this.pushStack("","find",a),d=0,e=0,f=this.length;e<f;e++){d=b.length;c.find(a,this[e],b);if(e>0)for(var h=d;h<b.length;h++)for(var l=0;l<d;l++)if(b[l]===b[h]){b.splice(h--,1);break}}return b},has:function(a){var b=c(a);return this.filter(function(){for(var d=0,e=b.length;d<e;d++)if(c.contains(this,b[d]))return true})}, +not:function(a){return this.pushStack(ma(this,a,false),"not",a)},filter:function(a){return this.pushStack(ma(this,a,true),"filter",a)},is:function(a){return!!a&&c.filter(a,this).length>0},closest:function(a,b){var d=[],e,f,h=this[0];if(c.isArray(a)){var l,k={},o=1;if(h&&a.length){e=0;for(f=a.length;e<f;e++){l=a[e];k[l]||(k[l]=c.expr.match.POS.test(l)?c(l,b||this.context):l)}for(;h&&h.ownerDocument&&h!==b;){for(l in k){e=k[l];if(e.jquery?e.index(h)>-1:c(h).is(e))d.push({selector:l,elem:h,level:o})}h= +h.parentNode;o++}}return d}l=cb.test(a)?c(a,b||this.context):null;e=0;for(f=this.length;e<f;e++)for(h=this[e];h;)if(l?l.index(h)>-1:c.find.matchesSelector(h,a)){d.push(h);break}else{h=h.parentNode;if(!h||!h.ownerDocument||h===b)break}d=d.length>1?c.unique(d):d;return this.pushStack(d,"closest",a)},index:function(a){if(!a||typeof a==="string")return c.inArray(this[0],a?c(a):this.parent().children());return c.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var d=typeof a==="string"?c(a,b||this.context): +c.makeArray(a),e=c.merge(this.get(),d);return this.pushStack(!d[0]||!d[0].parentNode||d[0].parentNode.nodeType===11||!e[0]||!e[0].parentNode||e[0].parentNode.nodeType===11?e:c.unique(e))},andSelf:function(){return this.add(this.prevObject)}});c.each({parent:function(a){return(a=a.parentNode)&&a.nodeType!==11?a:null},parents:function(a){return c.dir(a,"parentNode")},parentsUntil:function(a,b,d){return c.dir(a,"parentNode",d)},next:function(a){return c.nth(a,2,"nextSibling")},prev:function(a){return c.nth(a, +2,"previousSibling")},nextAll:function(a){return c.dir(a,"nextSibling")},prevAll:function(a){return c.dir(a,"previousSibling")},nextUntil:function(a,b,d){return c.dir(a,"nextSibling",d)},prevUntil:function(a,b,d){return c.dir(a,"previousSibling",d)},siblings:function(a){return c.sibling(a.parentNode.firstChild,a)},children:function(a){return c.sibling(a.firstChild)},contents:function(a){return c.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:c.makeArray(a.childNodes)}},function(a, +b){c.fn[a]=function(d,e){var f=c.map(this,b,d);Za.test(a)||(e=d);if(e&&typeof e==="string")f=c.filter(e,f);f=this.length>1?c.unique(f):f;if((this.length>1||ab.test(e))&&$a.test(a))f=f.reverse();return this.pushStack(f,a,bb.call(arguments).join(","))}});c.extend({filter:function(a,b,d){if(d)a=":not("+a+")";return b.length===1?c.find.matchesSelector(b[0],a)?[b[0]]:[]:c.find.matches(a,b)},dir:function(a,b,d){var e=[];for(a=a[b];a&&a.nodeType!==9&&(d===B||a.nodeType!==1||!c(a).is(d));){a.nodeType===1&& +e.push(a);a=a[b]}return e},nth:function(a,b,d){b=b||1;for(var e=0;a;a=a[d])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){for(var d=[];a;a=a.nextSibling)a.nodeType===1&&a!==b&&d.push(a);return d}});var za=/ jQuery\d+="(?:\d+|null)"/g,$=/^\s+/,Aa=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,Ba=/<([\w:]+)/,db=/<tbody/i,eb=/<|&#?\w+;/,Ca=/<(?:script|object|embed|option|style)/i,Da=/checked\s*(?:[^=]|=\s*.checked.)/i,fb=/\=([^="'>\s]+\/)>/g,P={option:[1, +"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};P.optgroup=P.option;P.tbody=P.tfoot=P.colgroup=P.caption=P.thead;P.th=P.td;if(!c.support.htmlSerialize)P._default=[1,"div<div>","</div>"];c.fn.extend({text:function(a){if(c.isFunction(a))return this.each(function(b){var d= +c(this);d.text(a.call(this,b,d.text()))});if(typeof a!=="object"&&a!==B)return this.empty().append((this[0]&&this[0].ownerDocument||t).createTextNode(a));return c.text(this)},wrapAll:function(a){if(c.isFunction(a))return this.each(function(d){c(this).wrapAll(a.call(this,d))});if(this[0]){var b=c(a,this[0].ownerDocument).eq(0).clone(true);this[0].parentNode&&b.insertBefore(this[0]);b.map(function(){for(var d=this;d.firstChild&&d.firstChild.nodeType===1;)d=d.firstChild;return d}).append(this)}return this}, +wrapInner:function(a){if(c.isFunction(a))return this.each(function(b){c(this).wrapInner(a.call(this,b))});return this.each(function(){var b=c(this),d=b.contents();d.length?d.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){c(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){c.nodeName(this,"body")||c(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.appendChild(a)})}, +prepend:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,this)});else if(arguments.length){var a=c(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b, +this.nextSibling)});else if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,c(arguments[0]).toArray());return a}},remove:function(a,b){for(var d=0,e;(e=this[d])!=null;d++)if(!a||c.filter(a,[e]).length){if(!b&&e.nodeType===1){c.cleanData(e.getElementsByTagName("*"));c.cleanData([e])}e.parentNode&&e.parentNode.removeChild(e)}return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++)for(b.nodeType===1&&c.cleanData(b.getElementsByTagName("*"));b.firstChild;)b.removeChild(b.firstChild); +return this},clone:function(a){var b=this.map(function(){if(!c.support.noCloneEvent&&!c.isXMLDoc(this)){var d=this.outerHTML,e=this.ownerDocument;if(!d){d=e.createElement("div");d.appendChild(this.cloneNode(true));d=d.innerHTML}return c.clean([d.replace(za,"").replace(fb,'="$1">').replace($,"")],e)[0]}else return this.cloneNode(true)});if(a===true){na(this,b);na(this.find("*"),b.find("*"))}return b},html:function(a){if(a===B)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(za,""):null; +else if(typeof a==="string"&&!Ca.test(a)&&(c.support.leadingWhitespace||!$.test(a))&&!P[(Ba.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Aa,"<$1></$2>");try{for(var b=0,d=this.length;b<d;b++)if(this[b].nodeType===1){c.cleanData(this[b].getElementsByTagName("*"));this[b].innerHTML=a}}catch(e){this.empty().append(a)}}else c.isFunction(a)?this.each(function(f){var h=c(this);h.html(a.call(this,f,h.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(c.isFunction(a))return this.each(function(b){var d= +c(this),e=d.html();d.replaceWith(a.call(this,b,e))});if(typeof a!=="string")a=c(a).detach();return this.each(function(){var b=this.nextSibling,d=this.parentNode;c(this).remove();b?c(b).before(a):c(d).append(a)})}else return this.pushStack(c(c.isFunction(a)?a():a),"replaceWith",a)},detach:function(a){return this.remove(a,true)},domManip:function(a,b,d){var e,f,h,l=a[0],k=[];if(!c.support.checkClone&&arguments.length===3&&typeof l==="string"&&Da.test(l))return this.each(function(){c(this).domManip(a, +b,d,true)});if(c.isFunction(l))return this.each(function(x){var r=c(this);a[0]=l.call(this,x,b?r.html():B);r.domManip(a,b,d)});if(this[0]){e=l&&l.parentNode;e=c.support.parentNode&&e&&e.nodeType===11&&e.childNodes.length===this.length?{fragment:e}:c.buildFragment(a,this,k);h=e.fragment;if(f=h.childNodes.length===1?h=h.firstChild:h.firstChild){b=b&&c.nodeName(f,"tr");f=0;for(var o=this.length;f<o;f++)d.call(b?c.nodeName(this[f],"table")?this[f].getElementsByTagName("tbody")[0]||this[f].appendChild(this[f].ownerDocument.createElement("tbody")): +this[f]:this[f],f>0||e.cacheable||this.length>1?h.cloneNode(true):h)}k.length&&c.each(k,Oa)}return this}});c.buildFragment=function(a,b,d){var e,f,h;b=b&&b[0]?b[0].ownerDocument||b[0]:t;if(a.length===1&&typeof a[0]==="string"&&a[0].length<512&&b===t&&!Ca.test(a[0])&&(c.support.checkClone||!Da.test(a[0]))){f=true;if(h=c.fragments[a[0]])if(h!==1)e=h}if(!e){e=b.createDocumentFragment();c.clean(a,b,e,d)}if(f)c.fragments[a[0]]=h?e:1;return{fragment:e,cacheable:f}};c.fragments={};c.each({appendTo:"append", +prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){c.fn[a]=function(d){var e=[];d=c(d);var f=this.length===1&&this[0].parentNode;if(f&&f.nodeType===11&&f.childNodes.length===1&&d.length===1){d[b](this[0]);return this}else{f=0;for(var h=d.length;f<h;f++){var l=(f>0?this.clone(true):this).get();c(d[f])[b](l);e=e.concat(l)}return this.pushStack(e,a,d.selector)}}});c.extend({clean:function(a,b,d,e){b=b||t;if(typeof b.createElement==="undefined")b=b.ownerDocument|| +b[0]&&b[0].ownerDocument||t;for(var f=[],h=0,l;(l=a[h])!=null;h++){if(typeof l==="number")l+="";if(l){if(typeof l==="string"&&!eb.test(l))l=b.createTextNode(l);else if(typeof l==="string"){l=l.replace(Aa,"<$1></$2>");var k=(Ba.exec(l)||["",""])[1].toLowerCase(),o=P[k]||P._default,x=o[0],r=b.createElement("div");for(r.innerHTML=o[1]+l+o[2];x--;)r=r.lastChild;if(!c.support.tbody){x=db.test(l);k=k==="table"&&!x?r.firstChild&&r.firstChild.childNodes:o[1]==="<table>"&&!x?r.childNodes:[];for(o=k.length- +1;o>=0;--o)c.nodeName(k[o],"tbody")&&!k[o].childNodes.length&&k[o].parentNode.removeChild(k[o])}!c.support.leadingWhitespace&&$.test(l)&&r.insertBefore(b.createTextNode($.exec(l)[0]),r.firstChild);l=r.childNodes}if(l.nodeType)f.push(l);else f=c.merge(f,l)}}if(d)for(h=0;f[h];h++)if(e&&c.nodeName(f[h],"script")&&(!f[h].type||f[h].type.toLowerCase()==="text/javascript"))e.push(f[h].parentNode?f[h].parentNode.removeChild(f[h]):f[h]);else{f[h].nodeType===1&&f.splice.apply(f,[h+1,0].concat(c.makeArray(f[h].getElementsByTagName("script")))); +d.appendChild(f[h])}return f},cleanData:function(a){for(var b,d,e=c.cache,f=c.event.special,h=c.support.deleteExpando,l=0,k;(k=a[l])!=null;l++)if(!(k.nodeName&&c.noData[k.nodeName.toLowerCase()]))if(d=k[c.expando]){if((b=e[d])&&b.events)for(var o in b.events)f[o]?c.event.remove(k,o):c.removeEvent(k,o,b.handle);if(h)delete k[c.expando];else k.removeAttribute&&k.removeAttribute(c.expando);delete e[d]}}});var Ea=/alpha\([^)]*\)/i,gb=/opacity=([^)]*)/,hb=/-([a-z])/ig,ib=/([A-Z])/g,Fa=/^-?\d+(?:px)?$/i, +jb=/^-?\d/,kb={position:"absolute",visibility:"hidden",display:"block"},Pa=["Left","Right"],Qa=["Top","Bottom"],W,Ga,aa,lb=function(a,b){return b.toUpperCase()};c.fn.css=function(a,b){if(arguments.length===2&&b===B)return this;return c.access(this,a,b,true,function(d,e,f){return f!==B?c.style(d,e,f):c.css(d,e)})};c.extend({cssHooks:{opacity:{get:function(a,b){if(b){var d=W(a,"opacity","opacity");return d===""?"1":d}else return a.style.opacity}}},cssNumber:{zIndex:true,fontWeight:true,opacity:true, +zoom:true,lineHeight:true},cssProps:{"float":c.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,b,d,e){if(!(!a||a.nodeType===3||a.nodeType===8||!a.style)){var f,h=c.camelCase(b),l=a.style,k=c.cssHooks[h];b=c.cssProps[h]||h;if(d!==B){if(!(typeof d==="number"&&isNaN(d)||d==null)){if(typeof d==="number"&&!c.cssNumber[h])d+="px";if(!k||!("set"in k)||(d=k.set(a,d))!==B)try{l[b]=d}catch(o){}}}else{if(k&&"get"in k&&(f=k.get(a,false,e))!==B)return f;return l[b]}}},css:function(a,b,d){var e,f=c.camelCase(b), +h=c.cssHooks[f];b=c.cssProps[f]||f;if(h&&"get"in h&&(e=h.get(a,true,d))!==B)return e;else if(W)return W(a,b,f)},swap:function(a,b,d){var e={},f;for(f in b){e[f]=a.style[f];a.style[f]=b[f]}d.call(a);for(f in b)a.style[f]=e[f]},camelCase:function(a){return a.replace(hb,lb)}});c.curCSS=c.css;c.each(["height","width"],function(a,b){c.cssHooks[b]={get:function(d,e,f){var h;if(e){if(d.offsetWidth!==0)h=oa(d,b,f);else c.swap(d,kb,function(){h=oa(d,b,f)});if(h<=0){h=W(d,b,b);if(h==="0px"&&aa)h=aa(d,b,b); +if(h!=null)return h===""||h==="auto"?"0px":h}if(h<0||h==null){h=d.style[b];return h===""||h==="auto"?"0px":h}return typeof h==="string"?h:h+"px"}},set:function(d,e){if(Fa.test(e)){e=parseFloat(e);if(e>=0)return e+"px"}else return e}}});if(!c.support.opacity)c.cssHooks.opacity={get:function(a,b){return gb.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var d=a.style;d.zoom=1;var e=c.isNaN(b)?"":"alpha(opacity="+b*100+")",f= +d.filter||"";d.filter=Ea.test(f)?f.replace(Ea,e):d.filter+" "+e}};if(t.defaultView&&t.defaultView.getComputedStyle)Ga=function(a,b,d){var e;d=d.replace(ib,"-$1").toLowerCase();if(!(b=a.ownerDocument.defaultView))return B;if(b=b.getComputedStyle(a,null)){e=b.getPropertyValue(d);if(e===""&&!c.contains(a.ownerDocument.documentElement,a))e=c.style(a,d)}return e};if(t.documentElement.currentStyle)aa=function(a,b){var d,e,f=a.currentStyle&&a.currentStyle[b],h=a.style;if(!Fa.test(f)&&jb.test(f)){d=h.left; +e=a.runtimeStyle.left;a.runtimeStyle.left=a.currentStyle.left;h.left=b==="fontSize"?"1em":f||0;f=h.pixelLeft+"px";h.left=d;a.runtimeStyle.left=e}return f===""?"auto":f};W=Ga||aa;if(c.expr&&c.expr.filters){c.expr.filters.hidden=function(a){var b=a.offsetHeight;return a.offsetWidth===0&&b===0||!c.support.reliableHiddenOffsets&&(a.style.display||c.css(a,"display"))==="none"};c.expr.filters.visible=function(a){return!c.expr.filters.hidden(a)}}var mb=c.now(),nb=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, +ob=/^(?:select|textarea)/i,pb=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,qb=/^(?:GET|HEAD)$/,Ra=/\[\]$/,T=/\=\?(&|$)/,ja=/\?/,rb=/([?&])_=[^&]*/,sb=/^(\w+:)?\/\/([^\/?#]+)/,tb=/%20/g,ub=/#.*$/,Ha=c.fn.load;c.fn.extend({load:function(a,b,d){if(typeof a!=="string"&&Ha)return Ha.apply(this,arguments);else if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var f=a.slice(e,a.length);a=a.slice(0,e)}e="GET";if(b)if(c.isFunction(b)){d=b;b=null}else if(typeof b=== +"object"){b=c.param(b,c.ajaxSettings.traditional);e="POST"}var h=this;c.ajax({url:a,type:e,dataType:"html",data:b,complete:function(l,k){if(k==="success"||k==="notmodified")h.html(f?c("<div>").append(l.responseText.replace(nb,"")).find(f):l.responseText);d&&h.each(d,[l.responseText,k,l])}});return this},serialize:function(){return c.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?c.makeArray(this.elements):this}).filter(function(){return this.name&& +!this.disabled&&(this.checked||ob.test(this.nodeName)||pb.test(this.type))}).map(function(a,b){var d=c(this).val();return d==null?null:c.isArray(d)?c.map(d,function(e){return{name:b.name,value:e}}):{name:b.name,value:d}}).get()}});c.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){c.fn[b]=function(d){return this.bind(b,d)}});c.extend({get:function(a,b,d,e){if(c.isFunction(b)){e=e||d;d=b;b=null}return c.ajax({type:"GET",url:a,data:b,success:d,dataType:e})}, +getScript:function(a,b){return c.get(a,null,b,"script")},getJSON:function(a,b,d){return c.get(a,b,d,"json")},post:function(a,b,d,e){if(c.isFunction(b)){e=e||d;d=b;b={}}return c.ajax({type:"POST",url:a,data:b,success:d,dataType:e})},ajaxSetup:function(a){c.extend(c.ajaxSettings,a)},ajaxSettings:{url:location.href,global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:function(){return new E.XMLHttpRequest},accepts:{xml:"application/xml, text/xml",html:"text/html", +script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},ajax:function(a){var b=c.extend(true,{},c.ajaxSettings,a),d,e,f,h=b.type.toUpperCase(),l=qb.test(h);b.url=b.url.replace(ub,"");b.context=a&&a.context!=null?a.context:b;if(b.data&&b.processData&&typeof b.data!=="string")b.data=c.param(b.data,b.traditional);if(b.dataType==="jsonp"){if(h==="GET")T.test(b.url)||(b.url+=(ja.test(b.url)?"&":"?")+(b.jsonp||"callback")+"=?");else if(!b.data|| +!T.test(b.data))b.data=(b.data?b.data+"&":"")+(b.jsonp||"callback")+"=?";b.dataType="json"}if(b.dataType==="json"&&(b.data&&T.test(b.data)||T.test(b.url))){d=b.jsonpCallback||"jsonp"+mb++;if(b.data)b.data=(b.data+"").replace(T,"="+d+"$1");b.url=b.url.replace(T,"="+d+"$1");b.dataType="script";var k=E[d];E[d]=function(m){if(c.isFunction(k))k(m);else{E[d]=B;try{delete E[d]}catch(p){}}f=m;c.handleSuccess(b,w,e,f);c.handleComplete(b,w,e,f);r&&r.removeChild(A)}}if(b.dataType==="script"&&b.cache===null)b.cache= +false;if(b.cache===false&&l){var o=c.now(),x=b.url.replace(rb,"$1_="+o);b.url=x+(x===b.url?(ja.test(b.url)?"&":"?")+"_="+o:"")}if(b.data&&l)b.url+=(ja.test(b.url)?"&":"?")+b.data;b.global&&c.active++===0&&c.event.trigger("ajaxStart");o=(o=sb.exec(b.url))&&(o[1]&&o[1].toLowerCase()!==location.protocol||o[2].toLowerCase()!==location.host);if(b.dataType==="script"&&h==="GET"&&o){var r=t.getElementsByTagName("head")[0]||t.documentElement,A=t.createElement("script");if(b.scriptCharset)A.charset=b.scriptCharset; +A.src=b.url;if(!d){var C=false;A.onload=A.onreadystatechange=function(){if(!C&&(!this.readyState||this.readyState==="loaded"||this.readyState==="complete")){C=true;c.handleSuccess(b,w,e,f);c.handleComplete(b,w,e,f);A.onload=A.onreadystatechange=null;r&&A.parentNode&&r.removeChild(A)}}}r.insertBefore(A,r.firstChild);return B}var J=false,w=b.xhr();if(w){b.username?w.open(h,b.url,b.async,b.username,b.password):w.open(h,b.url,b.async);try{if(b.data!=null&&!l||a&&a.contentType)w.setRequestHeader("Content-Type", +b.contentType);if(b.ifModified){c.lastModified[b.url]&&w.setRequestHeader("If-Modified-Since",c.lastModified[b.url]);c.etag[b.url]&&w.setRequestHeader("If-None-Match",c.etag[b.url])}o||w.setRequestHeader("X-Requested-With","XMLHttpRequest");w.setRequestHeader("Accept",b.dataType&&b.accepts[b.dataType]?b.accepts[b.dataType]+", */*; q=0.01":b.accepts._default)}catch(I){}if(b.beforeSend&&b.beforeSend.call(b.context,w,b)===false){b.global&&c.active--===1&&c.event.trigger("ajaxStop");w.abort();return false}b.global&& +c.triggerGlobal(b,"ajaxSend",[w,b]);var L=w.onreadystatechange=function(m){if(!w||w.readyState===0||m==="abort"){J||c.handleComplete(b,w,e,f);J=true;if(w)w.onreadystatechange=c.noop}else if(!J&&w&&(w.readyState===4||m==="timeout")){J=true;w.onreadystatechange=c.noop;e=m==="timeout"?"timeout":!c.httpSuccess(w)?"error":b.ifModified&&c.httpNotModified(w,b.url)?"notmodified":"success";var p;if(e==="success")try{f=c.httpData(w,b.dataType,b)}catch(q){e="parsererror";p=q}if(e==="success"||e==="notmodified")d|| +c.handleSuccess(b,w,e,f);else c.handleError(b,w,e,p);d||c.handleComplete(b,w,e,f);m==="timeout"&&w.abort();if(b.async)w=null}};try{var g=w.abort;w.abort=function(){w&&Function.prototype.call.call(g,w);L("abort")}}catch(i){}b.async&&b.timeout>0&&setTimeout(function(){w&&!J&&L("timeout")},b.timeout);try{w.send(l||b.data==null?null:b.data)}catch(n){c.handleError(b,w,null,n);c.handleComplete(b,w,e,f)}b.async||L();return w}},param:function(a,b){var d=[],e=function(h,l){l=c.isFunction(l)?l():l;d[d.length]= +encodeURIComponent(h)+"="+encodeURIComponent(l)};if(b===B)b=c.ajaxSettings.traditional;if(c.isArray(a)||a.jquery)c.each(a,function(){e(this.name,this.value)});else for(var f in a)da(f,a[f],b,e);return d.join("&").replace(tb,"+")}});c.extend({active:0,lastModified:{},etag:{},handleError:function(a,b,d,e){a.error&&a.error.call(a.context,b,d,e);a.global&&c.triggerGlobal(a,"ajaxError",[b,a,e])},handleSuccess:function(a,b,d,e){a.success&&a.success.call(a.context,e,d,b);a.global&&c.triggerGlobal(a,"ajaxSuccess", +[b,a])},handleComplete:function(a,b,d){a.complete&&a.complete.call(a.context,b,d);a.global&&c.triggerGlobal(a,"ajaxComplete",[b,a]);a.global&&c.active--===1&&c.event.trigger("ajaxStop")},triggerGlobal:function(a,b,d){(a.context&&a.context.url==null?c(a.context):c.event).trigger(b,d)},httpSuccess:function(a){try{return!a.status&&location.protocol==="file:"||a.status>=200&&a.status<300||a.status===304||a.status===1223}catch(b){}return false},httpNotModified:function(a,b){var d=a.getResponseHeader("Last-Modified"), +e=a.getResponseHeader("Etag");if(d)c.lastModified[b]=d;if(e)c.etag[b]=e;return a.status===304},httpData:function(a,b,d){var e=a.getResponseHeader("content-type")||"",f=b==="xml"||!b&&e.indexOf("xml")>=0;a=f?a.responseXML:a.responseText;f&&a.documentElement.nodeName==="parsererror"&&c.error("parsererror");if(d&&d.dataFilter)a=d.dataFilter(a,b);if(typeof a==="string")if(b==="json"||!b&&e.indexOf("json")>=0)a=c.parseJSON(a);else if(b==="script"||!b&&e.indexOf("javascript")>=0)c.globalEval(a);return a}}); +if(E.ActiveXObject)c.ajaxSettings.xhr=function(){if(E.location.protocol!=="file:")try{return new E.XMLHttpRequest}catch(a){}try{return new E.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}};c.support.ajax=!!c.ajaxSettings.xhr();var ea={},vb=/^(?:toggle|show|hide)$/,wb=/^([+\-]=)?([\d+.\-]+)(.*)$/,ba,pa=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];c.fn.extend({show:function(a,b,d){if(a||a===0)return this.animate(S("show", +3),a,b,d);else{d=0;for(var e=this.length;d<e;d++){a=this[d];b=a.style.display;if(!c.data(a,"olddisplay")&&b==="none")b=a.style.display="";b===""&&c.css(a,"display")==="none"&&c.data(a,"olddisplay",qa(a.nodeName))}for(d=0;d<e;d++){a=this[d];b=a.style.display;if(b===""||b==="none")a.style.display=c.data(a,"olddisplay")||""}return this}},hide:function(a,b,d){if(a||a===0)return this.animate(S("hide",3),a,b,d);else{a=0;for(b=this.length;a<b;a++){d=c.css(this[a],"display");d!=="none"&&c.data(this[a],"olddisplay", +d)}for(a=0;a<b;a++)this[a].style.display="none";return this}},_toggle:c.fn.toggle,toggle:function(a,b,d){var e=typeof a==="boolean";if(c.isFunction(a)&&c.isFunction(b))this._toggle.apply(this,arguments);else a==null||e?this.each(function(){var f=e?a:c(this).is(":hidden");c(this)[f?"show":"hide"]()}):this.animate(S("toggle",3),a,b,d);return this},fadeTo:function(a,b,d,e){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,d,e)},animate:function(a,b,d,e){var f=c.speed(b, +d,e);if(c.isEmptyObject(a))return this.each(f.complete);return this[f.queue===false?"each":"queue"](function(){var h=c.extend({},f),l,k=this.nodeType===1,o=k&&c(this).is(":hidden"),x=this;for(l in a){var r=c.camelCase(l);if(l!==r){a[r]=a[l];delete a[l];l=r}if(a[l]==="hide"&&o||a[l]==="show"&&!o)return h.complete.call(this);if(k&&(l==="height"||l==="width")){h.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY];if(c.css(this,"display")==="inline"&&c.css(this,"float")==="none")if(c.support.inlineBlockNeedsLayout)if(qa(this.nodeName)=== +"inline")this.style.display="inline-block";else{this.style.display="inline";this.style.zoom=1}else this.style.display="inline-block"}if(c.isArray(a[l])){(h.specialEasing=h.specialEasing||{})[l]=a[l][1];a[l]=a[l][0]}}if(h.overflow!=null)this.style.overflow="hidden";h.curAnim=c.extend({},a);c.each(a,function(A,C){var J=new c.fx(x,h,A);if(vb.test(C))J[C==="toggle"?o?"show":"hide":C](a);else{var w=wb.exec(C),I=J.cur()||0;if(w){var L=parseFloat(w[2]),g=w[3]||"px";if(g!=="px"){c.style(x,A,(L||1)+g);I=(L|| +1)/J.cur()*I;c.style(x,A,I+g)}if(w[1])L=(w[1]==="-="?-1:1)*L+I;J.custom(I,L,g)}else J.custom(I,C,"")}});return true})},stop:function(a,b){var d=c.timers;a&&this.queue([]);this.each(function(){for(var e=d.length-1;e>=0;e--)if(d[e].elem===this){b&&d[e](true);d.splice(e,1)}});b||this.dequeue();return this}});c.each({slideDown:S("show",1),slideUp:S("hide",1),slideToggle:S("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){c.fn[a]=function(d,e,f){return this.animate(b, +d,e,f)}});c.extend({speed:function(a,b,d){var e=a&&typeof a==="object"?c.extend({},a):{complete:d||!d&&b||c.isFunction(a)&&a,duration:a,easing:d&&b||b&&!c.isFunction(b)&&b};e.duration=c.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in c.fx.speeds?c.fx.speeds[e.duration]:c.fx.speeds._default;e.old=e.complete;e.complete=function(){e.queue!==false&&c(this).dequeue();c.isFunction(e.old)&&e.old.call(this)};return e},easing:{linear:function(a,b,d,e){return d+e*a},swing:function(a,b,d,e){return(-Math.cos(a* +Math.PI)/2+0.5)*e+d}},timers:[],fx:function(a,b,d){this.options=b;this.elem=a;this.prop=d;if(!b.orig)b.orig={}}});c.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this);(c.fx.step[this.prop]||c.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a=parseFloat(c.css(this.elem,this.prop));return a&&a>-1E4?a:0},custom:function(a,b,d){function e(l){return f.step(l)} +var f=this,h=c.fx;this.startTime=c.now();this.start=a;this.end=b;this.unit=d||this.unit||"px";this.now=this.start;this.pos=this.state=0;e.elem=this.elem;if(e()&&c.timers.push(e)&&!ba)ba=setInterval(h.tick,h.interval)},show:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.show=true;this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur());c(this.elem).show()},hide:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.hide=true; +this.custom(this.cur(),0)},step:function(a){var b=c.now(),d=true;if(a||b>=this.options.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;for(var e in this.options.curAnim)if(this.options.curAnim[e]!==true)d=false;if(d){if(this.options.overflow!=null&&!c.support.shrinkWrapBlocks){var f=this.elem,h=this.options;c.each(["","X","Y"],function(k,o){f.style["overflow"+o]=h.overflow[k]})}this.options.hide&&c(this.elem).hide();if(this.options.hide|| +this.options.show)for(var l in this.options.curAnim)c.style(this.elem,l,this.options.orig[l]);this.options.complete.call(this.elem)}return false}else{a=b-this.startTime;this.state=a/this.options.duration;b=this.options.easing||(c.easing.swing?"swing":"linear");this.pos=c.easing[this.options.specialEasing&&this.options.specialEasing[this.prop]||b](this.state,a,0,1,this.options.duration);this.now=this.start+(this.end-this.start)*this.pos;this.update()}return true}};c.extend(c.fx,{tick:function(){for(var a= +c.timers,b=0;b<a.length;b++)a[b]()||a.splice(b--,1);a.length||c.fx.stop()},interval:13,stop:function(){clearInterval(ba);ba=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){c.style(a.elem,"opacity",a.now)},_default:function(a){if(a.elem.style&&a.elem.style[a.prop]!=null)a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit;else a.elem[a.prop]=a.now}}});if(c.expr&&c.expr.filters)c.expr.filters.animated=function(a){return c.grep(c.timers,function(b){return a=== +b.elem}).length};var xb=/^t(?:able|d|h)$/i,Ia=/^(?:body|html)$/i;c.fn.offset="getBoundingClientRect"in t.documentElement?function(a){var b=this[0],d;if(a)return this.each(function(l){c.offset.setOffset(this,a,l)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);try{d=b.getBoundingClientRect()}catch(e){}var f=b.ownerDocument,h=f.documentElement;if(!d||!c.contains(h,b))return d||{top:0,left:0};b=f.body;f=fa(f);return{top:d.top+(f.pageYOffset||c.support.boxModel&& +h.scrollTop||b.scrollTop)-(h.clientTop||b.clientTop||0),left:d.left+(f.pageXOffset||c.support.boxModel&&h.scrollLeft||b.scrollLeft)-(h.clientLeft||b.clientLeft||0)}}:function(a){var b=this[0];if(a)return this.each(function(x){c.offset.setOffset(this,a,x)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);c.offset.initialize();var d,e=b.offsetParent,f=b.ownerDocument,h=f.documentElement,l=f.body;d=(f=f.defaultView)?f.getComputedStyle(b,null):b.currentStyle; +for(var k=b.offsetTop,o=b.offsetLeft;(b=b.parentNode)&&b!==l&&b!==h;){if(c.offset.supportsFixedPosition&&d.position==="fixed")break;d=f?f.getComputedStyle(b,null):b.currentStyle;k-=b.scrollTop;o-=b.scrollLeft;if(b===e){k+=b.offsetTop;o+=b.offsetLeft;if(c.offset.doesNotAddBorder&&!(c.offset.doesAddBorderForTableAndCells&&xb.test(b.nodeName))){k+=parseFloat(d.borderTopWidth)||0;o+=parseFloat(d.borderLeftWidth)||0}e=b.offsetParent}if(c.offset.subtractsBorderForOverflowNotVisible&&d.overflow!=="visible"){k+= +parseFloat(d.borderTopWidth)||0;o+=parseFloat(d.borderLeftWidth)||0}d=d}if(d.position==="relative"||d.position==="static"){k+=l.offsetTop;o+=l.offsetLeft}if(c.offset.supportsFixedPosition&&d.position==="fixed"){k+=Math.max(h.scrollTop,l.scrollTop);o+=Math.max(h.scrollLeft,l.scrollLeft)}return{top:k,left:o}};c.offset={initialize:function(){var a=t.body,b=t.createElement("div"),d,e,f,h=parseFloat(c.css(a,"marginTop"))||0;c.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px", +height:"1px",visibility:"hidden"});b.innerHTML="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";a.insertBefore(b,a.firstChild);d=b.firstChild;e=d.firstChild;f=d.nextSibling.firstChild.firstChild;this.doesNotAddBorder=e.offsetTop!==5;this.doesAddBorderForTableAndCells= +f.offsetTop===5;e.style.position="fixed";e.style.top="20px";this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15;e.style.position=e.style.top="";d.style.overflow="hidden";d.style.position="relative";this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5;this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==h;a.removeChild(b);c.offset.initialize=c.noop},bodyOffset:function(a){var b=a.offsetTop,d=a.offsetLeft;c.offset.initialize();if(c.offset.doesNotIncludeMarginInBodyOffset){b+=parseFloat(c.css(a, +"marginTop"))||0;d+=parseFloat(c.css(a,"marginLeft"))||0}return{top:b,left:d}},setOffset:function(a,b,d){var e=c.css(a,"position");if(e==="static")a.style.position="relative";var f=c(a),h=f.offset(),l=c.css(a,"top"),k=c.css(a,"left"),o=e==="absolute"&&c.inArray("auto",[l,k])>-1;e={};var x={};if(o)x=f.position();l=o?x.top:parseInt(l,10)||0;k=o?x.left:parseInt(k,10)||0;if(c.isFunction(b))b=b.call(a,d,h);if(b.top!=null)e.top=b.top-h.top+l;if(b.left!=null)e.left=b.left-h.left+k;"using"in b?b.using.call(a, +e):f.css(e)}};c.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),d=this.offset(),e=Ia.test(b[0].nodeName)?{top:0,left:0}:b.offset();d.top-=parseFloat(c.css(a,"marginTop"))||0;d.left-=parseFloat(c.css(a,"marginLeft"))||0;e.top+=parseFloat(c.css(b[0],"borderTopWidth"))||0;e.left+=parseFloat(c.css(b[0],"borderLeftWidth"))||0;return{top:d.top-e.top,left:d.left-e.left}},offsetParent:function(){return this.map(function(){for(var a=this.offsetParent||t.body;a&&!Ia.test(a.nodeName)&& +c.css(a,"position")==="static";)a=a.offsetParent;return a})}});c.each(["Left","Top"],function(a,b){var d="scroll"+b;c.fn[d]=function(e){var f=this[0],h;if(!f)return null;if(e!==B)return this.each(function(){if(h=fa(this))h.scrollTo(!a?e:c(h).scrollLeft(),a?e:c(h).scrollTop());else this[d]=e});else return(h=fa(f))?"pageXOffset"in h?h[a?"pageYOffset":"pageXOffset"]:c.support.boxModel&&h.document.documentElement[d]||h.document.body[d]:f[d]}});c.each(["Height","Width"],function(a,b){var d=b.toLowerCase(); +c.fn["inner"+b]=function(){return this[0]?parseFloat(c.css(this[0],d,"padding")):null};c.fn["outer"+b]=function(e){return this[0]?parseFloat(c.css(this[0],d,e?"margin":"border")):null};c.fn[d]=function(e){var f=this[0];if(!f)return e==null?null:this;if(c.isFunction(e))return this.each(function(l){var k=c(this);k[d](e.call(this,l,k[d]()))});if(c.isWindow(f))return f.document.compatMode==="CSS1Compat"&&f.document.documentElement["client"+b]||f.document.body["client"+b];else if(f.nodeType===9)return Math.max(f.documentElement["client"+ +b],f.body["scroll"+b],f.documentElement["scroll"+b],f.body["offset"+b],f.documentElement["offset"+b]);else if(e===B){f=c.css(f,d);var h=parseFloat(f);return c.isNaN(h)?f:h}else return this.css(d,typeof e==="string"?e:e+"px")}})})(window); diff --git a/gstudio/static/gstudio/js/jquery.masonry.js b/gstudio/static/gstudio/js/jquery.masonry.js new file mode 100644 index 0000000..f6e8a82 --- /dev/null +++ b/gstudio/static/gstudio/js/jquery.masonry.js @@ -0,0 +1,12 @@ +/************************************************* +** jQuery Masonry version 1.3.2 +** Copyright David DeSandro, licensed MIT +** http://desandro.com/resources/jquery-masonry +**************************************************/ +(function(e){var n=e.event,o;n.special.smartresize={setup:function(){e(this).bind("resize",n.special.smartresize.handler)},teardown:function(){e(this).unbind("resize",n.special.smartresize.handler)},handler:function(j,l){var g=this,d=arguments;j.type="smartresize";o&&clearTimeout(o);o=setTimeout(function(){jQuery.event.handle.apply(g,d)},l==="execAsap"?0:100)}};e.fn.smartresize=function(j){return j?this.bind("smartresize",j):this.trigger("smartresize",["execAsap"])};e.fn.masonry=function(j,l){var g= +{getBricks:function(d,b,a){var c=a.itemSelector===undefined;b.$bricks=a.appendedContent===undefined?c?d.children():d.find(a.itemSelector):c?a.appendedContent:a.appendedContent.filter(a.itemSelector)},placeBrick:function(d,b,a,c,h){b=Math.min.apply(Math,a);for(var i=b+d.outerHeight(true),f=a.length,k=f,m=c.colCount+1-f;f--;)if(a[f]==b)k=f;d.applyStyle({left:c.colW*k+c.posLeft,top:b},e.extend(true,{},h.animationOptions));for(f=0;f<m;f++)c.colY[k+f]=i},setup:function(d,b,a){g.getBricks(d,a,b);if(a.masoned)a.previousData= +d.data("masonry");a.colW=b.columnWidth===undefined?a.masoned?a.previousData.colW:a.$bricks.outerWidth(true):b.columnWidth;a.colCount=Math.floor(d.width()/a.colW);a.colCount=Math.max(a.colCount,1)},arrange:function(d,b,a){var c;if(!a.masoned||b.appendedContent!==undefined)a.$bricks.css("position","absolute");if(a.masoned){a.posTop=a.previousData.posTop;a.posLeft=a.previousData.posLeft}else{d.css("position","relative");var h=e(document.createElement("div"));d.prepend(h);a.posTop=Math.round(h.position().top); +a.posLeft=Math.round(h.position().left);h.remove()}if(a.masoned&&b.appendedContent!==undefined){a.colY=a.previousData.colY;for(c=a.previousData.colCount;c<a.colCount;c++)a.colY[c]=a.posTop}else{a.colY=[];for(c=a.colCount;c--;)a.colY.push(a.posTop)}e.fn.applyStyle=a.masoned&&b.animate?e.fn.animate:e.fn.css;b.singleMode?a.$bricks.each(function(){var i=e(this);g.placeBrick(i,a.colCount,a.colY,a,b)}):a.$bricks.each(function(){var i=e(this),f=Math.ceil(i.outerWidth(true)/a.colW);f=Math.min(f,a.colCount); +if(f===1)g.placeBrick(i,a.colCount,a.colY,a,b);else{var k=a.colCount+1-f,m=[];for(c=0;c<k;c++){var p=a.colY.slice(c,c+f);m[c]=Math.max.apply(Math,p)}g.placeBrick(i,k,m,a,b)}});a.wallH=Math.max.apply(Math,a.colY);d.applyStyle({height:a.wallH-a.posTop},e.extend(true,[],b.animationOptions));a.masoned||setTimeout(function(){d.addClass("masoned")},1);l.call(a.$bricks);d.data("masonry",a)},resize:function(d,b,a){a.masoned=!!d.data("masonry");var c=d.data("masonry").colCount;g.setup(d,b,a);a.colCount!=c&& +g.arrange(d,b,a)}};return this.each(function(){var d=e(this),b={};b.masoned=!!d.data("masonry");var a=b.masoned?d.data("masonry").options:{},c=e.extend({},e.fn.masonry.defaults,a,j),h=a.resizeable;b.options=c.saveOptions?c:a;l=l||function(){};g.getBricks(d,b,c);if(!b.$bricks.length)return this;g.setup(d,c,b);g.arrange(d,c,b);!h&&c.resizeable&&e(window).bind("smartresize.masonry",function(){g.resize(d,c,b)});h&&!c.resizeable&&e(window).unbind("smartresize.masonry")})};e.fn.masonry.defaults={singleMode:false, +columnWidth:undefined,itemSelector:undefined,appendedContent:undefined,saveOptions:true,resizeable:true,animate:false,animationOptions:{}}})(jQuery);
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/jquery.min.js b/gstudio/static/gstudio/js/jquery.min.js new file mode 100644 index 0000000..48590ec --- /dev/null +++ b/gstudio/static/gstudio/js/jquery.min.js @@ -0,0 +1,18 @@ +/*! + * jQuery JavaScript Library v1.6.2 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Thu Jun 30 14:16:56 2011 -0400 + */ +(function(a,b){function cv(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cs(a){if(!cg[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){ch||(ch=c.createElement("iframe"),ch.frameBorder=ch.width=ch.height=0),b.appendChild(ch);if(!ci||!ch.createElement)ci=(ch.contentWindow||ch.contentDocument).document,ci.write((c.compatMode==="CSS1Compat"?"<!doctype html>":"")+"<html><body>"),ci.close();d=ci.createElement(a),ci.body.appendChild(d),e=f.css(d,"display"),b.removeChild(ch)}cg[a]=e}return cg[a]}function cr(a,b){var c={};f.each(cm.concat.apply([],cm.slice(0,b)),function(){c[this]=a});return c}function cq(){cn=b}function cp(){setTimeout(cq,0);return cn=f.now()}function cf(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ce(){try{return new a.XMLHttpRequest}catch(b){}}function b$(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function bZ(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function bY(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bC.test(a)?d(a,e):bY(a+"["+(typeof e=="object"||f.isArray(e)?b:"")+"]",e,c,d)});else if(!c&&b!=null&&typeof b=="object")for(var e in b)bY(a+"["+e+"]",b[e],c,d);else d(a,b)}function bX(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bR,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=bX(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=bX(a,c,d,e,"*",g));return l}function bW(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bN),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bA(a,b,c){var d=b==="width"?a.offsetWidth:a.offsetHeight,e=b==="width"?bv:bw;if(d>0){c!=="border"&&f.each(e,function(){c||(d-=parseFloat(f.css(a,"padding"+this))||0),c==="margin"?d+=parseFloat(f.css(a,c+this))||0:d-=parseFloat(f.css(a,"border"+this+"Width"))||0});return d+"px"}d=bx(a,b,b);if(d<0||d==null)d=a.style[b]||0;d=parseFloat(d)||0,c&&f.each(e,function(){d+=parseFloat(f.css(a,"padding"+this))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+this+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+this))||0)});return d+"px"}function bm(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(be,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bl(a){f.nodeName(a,"input")?bk(a):"getElementsByTagName"in a&&f.grep(a.getElementsByTagName("input"),bk)}function bk(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bj(a){return"getElementsByTagName"in a?a.getElementsByTagName("*"):"querySelectorAll"in a?a.querySelectorAll("*"):[]}function bi(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bh(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c=f.expando,d=f.data(a),e=f.data(b,d);if(d=d[c]){var g=d.events;e=e[c]=f.extend({},d);if(g){delete e.handle,e.events={};for(var h in g)for(var i=0,j=g[h].length;i<j;i++)f.event.add(b,h+(g[h][i].namespace?".":"")+g[h][i].namespace,g[h][i],g[h][i].data)}}}}function bg(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function W(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(R.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function V(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function N(a,b){return(a&&a!=="*"?a+".":"")+b.replace(z,"`").replace(A,"&")}function M(a){var b,c,d,e,g,h,i,j,k,l,m,n,o,p=[],q=[],r=f._data(this,"events");if(!(a.liveFired===this||!r||!r.live||a.target.disabled||a.button&&a.type==="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var s=r.live.slice(0);for(i=0;i<s.length;i++)g=s[i],g.origType.replace(x,"")===a.type?q.push(g.selector):s.splice(i--,1);e=f(a.target).closest(q,a.currentTarget);for(j=0,k=e.length;j<k;j++){m=e[j];for(i=0;i<s.length;i++){g=s[i];if(m.selector===g.selector&&(!n||n.test(g.namespace))&&!m.elem.disabled){h=m.elem,d=null;if(g.preType==="mouseenter"||g.preType==="mouseleave")a.type=g.preType,d=f(a.relatedTarget).closest(g.selector)[0],d&&f.contains(h,d)&&(d=h);(!d||d!==h)&&p.push({elem:h,handleObj:g,level:m.level})}}}for(j=0,k=p.length;j<k;j++){e=p[j];if(c&&e.level>c)break;a.currentTarget=e.elem,a.data=e.handleObj.data,a.handleObj=e.handleObj,o=e.handleObj.origHandler.apply(e.elem,arguments);if(o===!1||a.isPropagationStopped()){c=e.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function K(a,c,d){var e=f.extend({},d[0]);e.type=a,e.originalEvent={},e.liveFired=b,f.event.handle.call(c,e),e.isDefaultPrevented()&&d[0].preventDefault()}function E(){return!0}function D(){return!1}function m(a,c,d){var e=c+"defer",g=c+"queue",h=c+"mark",i=f.data(a,e,b,!0);i&&(d==="queue"||!f.data(a,g,b,!0))&&(d==="mark"||!f.data(a,h,b,!0))&&setTimeout(function(){!f.data(a,g,b,!0)&&!f.data(a,h,b,!0)&&(f.removeData(a,e,!0),i.resolve())},0)}function l(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function k(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(j,"$1-$2").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNaN(d)?i.test(d)?f.parseJSON(d):d:parseFloat(d)}catch(g){}f.data(a,c,d)}else d=b}return d}var c=a.document,d=a.navigator,e=a.location,f=function(){function J(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(J,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/\d/,n=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,o=/^[\],:{}\s]*$/,p=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,q=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,r=/(?:^|:|,)(?:\s*\[)+/g,s=/(webkit)[ \/]([\w.]+)/,t=/(opera)(?:.*version)?[ \/]([\w.]+)/,u=/(msie) ([\w.]+)/,v=/(mozilla)(?:.*? rv:([\w.]+))?/,w=/-([a-z])/ig,x=function(a,b){return b.toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=n.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.6.2",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;A.resolveWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!A){A=e._Deferred();if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNaN:function(a){return a==null||!m.test(a)||isNaN(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a);return c===b||D.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(o.test(b.replace(p,"@").replace(q,"]").replace(r,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(b,c,d){a.DOMParser?(d=new DOMParser,c=d.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),d=c.documentElement,(!d||!d.nodeName||d.nodeName==="parsererror")&&e.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:G?function(a){return a==null?"":G.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?E.call(c,a):e.merge(c,a)}return c},inArray:function(a,b){if(H)return H.call(b,a);for(var c=0,d=b.length;c<d;c++)if(b[c]===a)return c;return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=F.call(arguments,2),g=function(){return a.apply(c,f.concat(F.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h){var i=a.length;if(typeof c=="object"){for(var j in c)e.access(a,j,c[j],f,g,d);return a}if(d!==b){f=!h&&f&&e.isFunction(d);for(var k=0;k<i;k++)g(a[k],c,f?d.call(a[k],k,g(a[k],c)):d,h);return a}return i?g(a[0],c):b},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=s.exec(a)||t.exec(a)||u.exec(a)||a.indexOf("compatible")<0&&v.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){I["[object "+b+"]"]=b.toLowerCase()}),z=e.uaMatch(y),z.browser&&(e.browser[z.browser]=!0,e.browser.version=z.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?B=function(){c.removeEventListener("DOMContentLoaded",B,!1),e.ready()}:c.attachEvent&&(B=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",B),e.ready())});return e}(),g="done fail isResolved isRejected promise then always pipe".split(" "),h=[].slice;f.extend({_Deferred:function(){var a=[],b,c,d,e={done:function(){if(!d){var c=arguments,g,h,i,j,k;b&&(k=b,b=0);for(g=0,h=c.length;g<h;g++)i=c[g],j=f.type(i),j==="array"?e.done.apply(e,i):j==="function"&&a.push(i);k&&e.resolveWith(k[0],k[1])}return this},resolveWith:function(e,f){if(!d&&!b&&!c){f=f||[],c=1;try{while(a[0])a.shift().apply(e,f)}finally{b=[e,f],c=0}}return this},resolve:function(){e.resolveWith(this,arguments);return this},isResolved:function(){return!!c||!!b},cancel:function(){d=1,a=[];return this}};return e},Deferred:function(a){var b=f._Deferred(),c=f._Deferred(),d;f.extend(b,{then:function(a,c){b.done(a).fail(c);return this},always:function(){return b.done.apply(b,arguments).fail.apply(this,arguments)},fail:c.done,rejectWith:c.resolveWith,reject:c.resolve,isRejected:c.isResolved,pipe:function(a,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[c,"reject"]},function(a,c){var e=c[0],g=c[1],h;f.isFunction(e)?b[a](function(){h=e.apply(this,arguments),h&&f.isFunction(h.promise)?h.promise().then(d.resolve,d.reject):d[g](h)}):b[a](d[g])})}).promise()},promise:function(a){if(a==null){if(d)return d;d=a={}}var c=g.length;while(c--)a[g[c]]=b[g[c]];return a}}),b.done(c.cancel).fail(b.cancel),delete b.cancel,a&&a.call(b,b);return b},when:function(a){function i(a){return function(c){b[a]=arguments.length>1?h.call(arguments,0):c,--e||g.resolveWith(g,h.call(b,0))}}var b=arguments,c=0,d=b.length,e=d,g=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred();if(d>1){for(;c<d;c++)b[c]&&f.isFunction(b[c].promise)?b[c].promise().then(i(c),g.reject):--e;e||g.resolveWith(g,b)}else g!==a&&g.resolveWith(g,d?[a]:[]);return g.promise()}}),f.support=function(){var a=c.createElement("div"),b=c.documentElement,d,e,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u;a.setAttribute("className","t"),a.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=a.getElementsByTagName("*"),e=a.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=a.getElementsByTagName("input")[0],k={leadingWhitespace:a.firstChild.nodeType===3,tbody:!a.getElementsByTagName("tbody").length,htmlSerialize:!!a.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55$/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:a.className!=="t",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},i.checked=!0,k.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,k.optDisabled=!h.disabled;try{delete a.test}catch(v){k.deleteExpando=!1}!a.addEventListener&&a.attachEvent&&a.fireEvent&&(a.attachEvent("onclick",function(){k.noCloneEvent=!1}),a.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),k.radioValue=i.value==="t",i.setAttribute("checked","checked"),a.appendChild(i),l=c.createDocumentFragment(),l.appendChild(a.firstChild),k.checkClone=l.cloneNode(!0).cloneNode(!0).lastChild.checked,a.innerHTML="",a.style.width=a.style.paddingLeft="1px",m=c.getElementsByTagName("body")[0],o=c.createElement(m?"div":"body"),p={visibility:"hidden",width:0,height:0,border:0,margin:0},m&&f.extend(p,{position:"absolute",left:-1e3,top:-1e3});for(t in p)o.style[t]=p[t];o.appendChild(a),n=m||b,n.insertBefore(o,n.firstChild),k.appendChecked=i.checked,k.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,k.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="<div style='width:4px;'></div>",k.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>",q=a.getElementsByTagName("td"),u=q[0].offsetHeight===0,q[0].style.display="",q[1].style.display="none",k.reliableHiddenOffsets=u&&q[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(j=c.createElement("div"),j.style.width="0",j.style.marginRight="0",a.appendChild(j),k.reliableMarginRight=(parseInt((c.defaultView.getComputedStyle(j,null)||{marginRight:0}).marginRight,10)||0)===0),o.innerHTML="",n.removeChild(o);if(a.attachEvent)for(t in{submit:1,change:1,focusin:1})s="on"+t,u=s in a,u||(a.setAttribute(s,"return;"),u=typeof a[s]=="function"),k[t+"Bubbles"]=u;o=l=g=h=m=j=a=i=null;return k}(),f.boxModel=f.support.boxModel;var i=/^(?:\{.*\}|\[.*\])$/,j=/([a-z])([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!l(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g=f.expando,h=typeof c=="string",i,j=a.nodeType,k=j?f.cache:a,l=j?a[f.expando]:a[f.expando]&&f.expando;if((!l||e&&l&&!k[l][g])&&h&&d===b)return;l||(j?a[f.expando]=l=++f.uuid:l=f.expando),k[l]||(k[l]={},j||(k[l].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?k[l][g]=f.extend(k[l][g],c):k[l]=f.extend(k[l],c);i=k[l],e&&(i[g]||(i[g]={}),i=i[g]),d!==b&&(i[f.camelCase(c)]=d);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[f.camelCase(c)]||i[c]:i}},removeData:function(b,c,d){if(!!f.acceptData(b)){var e=f.expando,g=b.nodeType,h=g?f.cache:b,i=g?b[f.expando]:f.expando;if(!h[i])return;if(c){var j=d?h[i][e]:h[i];if(j){delete j[c];if(!l(j))return}}if(d){delete h[i][e];if(!l(h[i]))return}var k=h[i][e];f.support.deleteExpando||h!=a?delete h[i]:h[i]=null,k?(h[i]={},g||(h[i].toJSON=f.noop),h[i][e]=k):g&&(f.support.deleteExpando?delete b[f.expando]:b.removeAttribute?b.removeAttribute(f.expando):b[f.expando]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d=null;if(typeof a=="undefined"){if(this.length){d=f.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,g;for(var h=0,i=e.length;h<i;h++)g=e[h].name,g.indexOf("data-")===0&&(g=f.camelCase(g.substring(5)),k(this[0],g,d[g]))}}return d}if(typeof a=="object")return this.each(function(){f.data(this,a)});var j=a.split(".");j[1]=j[1]?"."+j[1]:"";if(c===b){d=this.triggerHandler("getData"+j[1]+"!",[j[0]]),d===b&&this.length&&(d=f.data(this[0],a),d=k(this[0],a,d));return d===b&&j[1]?this.data(j[0]):d}return this.each(function(){var b=f(this),d=[j[0],c];b.triggerHandler("setData"+j[1]+"!",d),f.data(this,a,c),b.triggerHandler("changeData"+j[1]+"!",d)})},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,c){a&&(c=(c||"fx")+"mark",f.data(a,c,(f.data(a,c,b,!0)||0)+1,!0))},_unmark:function(a,c,d){a!==!0&&(d=c,c=a,a=!1);if(c){d=d||"fx";var e=d+"mark",g=a?0:(f.data(c,e,b,!0)||1)-1;g?f.data(c,e,g,!0):(f.removeData(c,e,!0),m(c,d,"mark"))}},queue:function(a,c,d){if(a){c=(c||"fx")+"queue";var e=f.data(a,c,b,!0);d&&(!e||f.isArray(d)?e=f.data(a,c,f.makeArray(d),!0):e.push(d));return e||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e;d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),d.call(a,function(){f.dequeue(a,b)})),c.length||(f.removeData(a,b+"queue",!0),m(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){typeof a!="string"&&(c=a,a="fx");if(c===b)return f.queue(this[0],a);return this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(){var c=this;setTimeout(function(){f.dequeue(c,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f._Deferred(),!0))h++,l.done(m);m();return d.promise()}});var n=/[\n\t\r]/g,o=/\s+/,p=/\r/g,q=/^(?:button|input)$/i,r=/^(?:button|input|object|select|textarea)$/i,s=/^a(?:rea)?$/i,t=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,u=/\:|^on/,v,w;f.fn.extend({attr:function(a,b){return f.access(this,a,b,!0,f.attr)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,a,b,!0,f.prop)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,g,h,i;if(f.isFunction(a))return this.each(function(b){f(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(o);for(c=0,d=this.length;c<d;c++){e=this[c];if(e.nodeType===1)if(!e.className&&b.length===1)e.className=a;else{g=" "+e.className+" ";for(h=0,i=b.length;h<i;h++)~g.indexOf(" "+b[h]+" ")||(g+=b[h]+" ");e.className=f.trim(g)}}}return this},removeClass:function(a){var c,d,e,g,h,i,j;if(f.isFunction(a))return this.each(function(b){f(this).removeClass(a.call(this,b,this.className))});if(a&&typeof a=="string"||a===b){c=(a||"").split(o);for(d=0,e=this.length;d<e;d++){g=this[d];if(g.nodeType===1&&g.className)if(a){h=(" "+g.className+" ").replace(n," ");for(i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){f(this).toggleClass(a.call(this,c,this.className,b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(o);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ";for(var c=0,d=this.length;c<d;c++)if((" "+this[c].className+" ").replace(n," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e=this[0];if(!arguments.length){if(e){c=f.valHooks[e.nodeName.toLowerCase()]||f.valHooks[e.type];if(c&&"get"in c&&(d=c.get(e,"value"))!==b)return d;d=e.value;return typeof d=="string"?d.replace(p,""):d==null?"":d}return b}var g=f.isFunction(a);return this.each(function(d){var e=f(this),h;if(this.nodeType===1){g?h=a.call(this,d,e.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c=a.selectedIndex,d=[],e=a.options,g=a.type==="select-one";if(c<0)return null;for(var h=g?c:0,i=g?c+1:e.length;h<i;h++){var j=e[h];if(j.selected&&(f.support.optDisabled?!j.disabled:j.getAttribute("disabled")===null)&&(!j.parentNode.disabled||!f.nodeName(j.parentNode,"optgroup"))){b=f(j).val();if(g)return b;d.push(b)}}if(g&&!d.length&&e.length)return f(e[c]).val();return d},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attrFix:{tabindex:"tabIndex"},attr:function(a,c,d,e){var g=a.nodeType;if(!a||g===3||g===8||g===2)return b;if(e&&c in f.attrFn)return f(a)[c](d);if(!("getAttribute"in a))return f.prop(a,c,d);var h,i,j=g!==1||!f.isXMLDoc(a);j&&(c=f.attrFix[c]||c,i=f.attrHooks[c],i||(t.test(c)?i=w:v&&c!=="className"&&(f.nodeName(a,"form")||u.test(c))&&(i=v)));if(d!==b){if(d===null){f.removeAttr(a,c);return b}if(i&&"set"in i&&j&&(h=i.set(a,d,c))!==b)return h;a.setAttribute(c,""+d);return d}if(i&&"get"in i&&j&&(h=i.get(a,c))!==null)return h;h=a.getAttribute(c);return h===null?b:h},removeAttr:function(a,b){var c;a.nodeType===1&&(b=f.attrFix[b]||b,f.support.getSetAttribute?a.removeAttribute(b):(f.attr(a,b,""),a.removeAttributeNode(a.getAttributeNode(b))),t.test(b)&&(c=f.propFix[b]||b)in a&&(a[c]=!1))},attrHooks:{type:{set:function(a,b){if(q.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},tabIndex:{get:function(a){var c=a.getAttributeNode("tabIndex");return c&&c.specified?parseInt(c.value,10):r.test(a.nodeName)||s.test(a.nodeName)&&a.href?0:b}},value:{get:function(a,b){if(v&&f.nodeName(a,"button"))return v.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(v&&f.nodeName(a,"button"))return v.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e=a.nodeType;if(!a||e===3||e===8||e===2)return b;var g,h,i=e!==1||!f.isXMLDoc(a);i&&(c=f.propFix[c]||c,h=f.propHooks[c]);return d!==b?h&&"set"in h&&(g=h.set(a,d,c))!==b?g:a[c]=d:h&&"get"in h&&(g=h.get(a,c))!==b?g:a[c]},propHooks:{}}),w={get:function(a,c){return f.prop(a,c)?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},f.support.getSetAttribute||(f.attrFix=f.propFix,v=f.attrHooks.name=f.attrHooks.title=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&d.nodeValue!==""?d.nodeValue:b},set:function(a,b,c){var d=a.getAttributeNode(c);if(d){d.nodeValue=b;return b}}},f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})})),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}})),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var x=/\.(.*)$/,y=/^(?:textarea|input|select)$/i,z=/\./g,A=/ /g,B=/[^\w\s.|`]/g,C=function(a){return a.replace(B,"\\$&")};f.event={add:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){if(d===!1)d=D;else if(!d)return;var g,h;d.handler&&(g=d,d=g.handler),d.guid||(d.guid=f.guid++);var i=f._data(a);if(!i)return;var j=i.events,k=i.handle;j||(i.events=j={}),k||(i.handle=k=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.handle.apply(k.elem,arguments):b}),k.elem=a,c=c.split(" ");var l,m=0,n;while(l=c[m++]){h=g?f.extend({},g):{handler:d,data:e},l.indexOf(".")>-1?(n=l.split("."),l=n.shift(),h.namespace=n.slice(0).sort().join(".")):(n=[],h.namespace=""),h.type=l,h.guid||(h.guid=d.guid);var o=j[l],p=f.event.special[l]||{};if(!o){o=j[l]=[];if(!p.setup||p.setup.call(a,e,n,k)===!1)a.addEventListener?a.addEventListener(l,k,!1):a.attachEvent&&a.attachEvent("on"+l,k)}p.add&&(p.add.call(a,h),h.handler.guid||(h.handler.guid=d.guid)),o.push(h),f.event.global[l]=!0}a=null}},global:{},remove:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){d===!1&&(d=D);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=f.hasData(a)&&f._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(d=c.handler,c=c.type);if(!c||typeof c=="string"&&c.charAt(0)==="."){c=c||"";for(h in t)f.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+f.map(m.slice(0).sort(),C).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!d){for(j=0;j<p.length;j++){q=p[j];if(l||n.test(q.namespace))f.event.remove(a,r,q.handler,j),p.splice(j--,1)}continue}o=f.event.special[h]||{};for(j=e||0;j<p.length;j++){q=p[j];if(d.guid===q.guid){if(l||n.test(q.namespace))e==null&&p.splice(j--,1),o.remove&&o.remove.call(a,q);if(e!=null)break}}if(p.length===0||e!=null&&p.length===1)(!o.teardown||o.teardown.call(a,m)===!1)&&f.removeEvent(a,h,s.handle),g=null,delete t[h]}if(f.isEmptyObject(t)){var u=s.handle;u&&(u.elem=null),delete s.events,delete s.handle,f.isEmptyObject(s)&&f.removeData(a,b,!0)}}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){var h=c.type||c,i=[],j;h.indexOf("!")>=0&&(h=h.slice(0,-1),j=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i. +shift(),i.sort());if(!!e&&!f.event.customEvent[h]||!!f.event.global[h]){c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.exclusive=j,c.namespace=i.join("."),c.namespace_re=new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)");if(g||!e)c.preventDefault(),c.stopPropagation();if(!e){f.each(f.cache,function(){var a=f.expando,b=this[a];b&&b.events&&b.events[h]&&f.event.trigger(c,d,b.handle.elem)});return}if(e.nodeType===3||e.nodeType===8)return;c.result=b,c.target=e,d=d!=null?f.makeArray(d):[],d.unshift(c);var k=e,l=h.indexOf(":")<0?"on"+h:"";do{var m=f._data(k,"handle");c.currentTarget=k,m&&m.apply(k,d),l&&f.acceptData(k)&&k[l]&&k[l].apply(k,d)===!1&&(c.result=!1,c.preventDefault()),k=k.parentNode||k.ownerDocument||k===c.target.ownerDocument&&a}while(k&&!c.isPropagationStopped());if(!c.isDefaultPrevented()){var n,o=f.event.special[h]||{};if((!o._default||o._default.call(e.ownerDocument,c)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)){try{l&&e[h]&&(n=e[l],n&&(e[l]=null),f.event.triggered=h,e[h]())}catch(p){}n&&(e[l]=n),f.event.triggered=b}}return c.result}},handle:function(c){c=f.event.fix(c||a.event);var d=((f._data(this,"events")||{})[c.type]||[]).slice(0),e=!c.exclusive&&!c.namespace,g=Array.prototype.slice.call(arguments,0);g[0]=c,c.currentTarget=this;for(var h=0,i=d.length;h<i;h++){var j=d[h];if(e||c.namespace_re.test(j.namespace)){c.handler=j.handler,c.data=j.data,c.handleObj=j;var k=j.handler.apply(this,g);k!==b&&(c.result=k,k===!1&&(c.preventDefault(),c.stopPropagation()));if(c.isImmediatePropagationStopped())break}}return c.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(a){if(a[f.expando])return a;var d=a;a=f.Event(d);for(var e=this.props.length,g;e;)g=this.props[--e],a[g]=d[g];a.target||(a.target=a.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),!a.relatedTarget&&a.fromElement&&(a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement);if(a.pageX==null&&a.clientX!=null){var h=a.target.ownerDocument||c,i=h.documentElement,j=h.body;a.pageX=a.clientX+(i&&i.scrollLeft||j&&j.scrollLeft||0)-(i&&i.clientLeft||j&&j.clientLeft||0),a.pageY=a.clientY+(i&&i.scrollTop||j&&j.scrollTop||0)-(i&&i.clientTop||j&&j.clientTop||0)}a.which==null&&(a.charCode!=null||a.keyCode!=null)&&(a.which=a.charCode!=null?a.charCode:a.keyCode),!a.metaKey&&a.ctrlKey&&(a.metaKey=a.ctrlKey),!a.which&&a.button!==b&&(a.which=a.button&1?1:a.button&2?3:a.button&4?2:0);return a},guid:1e8,proxy:f.proxy,special:{ready:{setup:f.bindReady,teardown:f.noop},live:{add:function(a){f.event.add(this,N(a.origType,a.selector),f.extend({},a,{handler:M,guid:a.handler.guid}))},remove:function(a){f.event.remove(this,N(a.origType,a.selector),a)}},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}}},f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!this.preventDefault)return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?E:D):this.type=a,b&&f.extend(this,b),this.timeStamp=f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=E;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=E;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=E,this.stopPropagation()},isDefaultPrevented:D,isPropagationStopped:D,isImmediatePropagationStopped:D};var F=function(a){var b=a.relatedTarget,c=!1,d=a.type;a.type=a.data,b!==this&&(b&&(c=f.contains(this,b)),c||(f.event.handle.apply(this,arguments),a.type=d))},G=function(a){a.type=a.data,f.event.handle.apply(this,arguments)};f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={setup:function(c){f.event.add(this,b,c&&c.selector?G:F,a)},teardown:function(a){f.event.remove(this,b,a&&a.selector?G:F)}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(a,b){if(!f.nodeName(this,"form"))f.event.add(this,"click.specialSubmit",function(a){var b=a.target,c=b.type;(c==="submit"||c==="image")&&f(b).closest("form").length&&K("submit",this,arguments)}),f.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,c=b.type;(c==="text"||c==="password")&&f(b).closest("form").length&&a.keyCode===13&&K("submit",this,arguments)});else return!1},teardown:function(a){f.event.remove(this,".specialSubmit")}});if(!f.support.changeBubbles){var H,I=function(a){var b=a.type,c=a.value;b==="radio"||b==="checkbox"?c=a.checked:b==="select-multiple"?c=a.selectedIndex>-1?f.map(a.options,function(a){return a.selected}).join("-"):"":f.nodeName(a,"select")&&(c=a.selectedIndex);return c},J=function(c){var d=c.target,e,g;if(!!y.test(d.nodeName)&&!d.readOnly){e=f._data(d,"_change_data"),g=I(d),(c.type!=="focusout"||d.type!=="radio")&&f._data(d,"_change_data",g);if(e===b||g===e)return;if(e!=null||g)c.type="change",c.liveFired=b,f.event.trigger(c,arguments[1],d)}};f.event.special.change={filters:{focusout:J,beforedeactivate:J,click:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(c==="radio"||c==="checkbox"||f.nodeName(b,"select"))&&J.call(this,a)},keydown:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(a.keyCode===13&&!f.nodeName(b,"textarea")||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&J.call(this,a)},beforeactivate:function(a){var b=a.target;f._data(b,"_change_data",I(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in H)f.event.add(this,c+".specialChange",H[c]);return y.test(this.nodeName)},teardown:function(a){f.event.remove(this,".specialChange");return y.test(this.nodeName)}},H=f.event.special.change.filters,H.focus=H.beforeactivate}f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){function e(a){var c=f.event.fix(a);c.type=b,c.originalEvent={},f.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var d=0;f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.each(["bind","one"],function(a,c){f.fn[c]=function(a,d,e){var g;if(typeof a=="object"){for(var h in a)this[c](h,d,a[h],e);return this}if(arguments.length===2||d===!1)e=d,d=b;c==="one"?(g=function(a){f(this).unbind(a,g);return e.apply(this,arguments)},g.guid=e.guid||f.guid++):g=e;if(a==="unload"&&c!=="one")this.one(a,d,e);else for(var i=0,j=this.length;i<j;i++)f.event.add(this[i],a,g,d);return this}}),f.fn.extend({unbind:function(a,b){if(typeof a=="object"&&!a.preventDefault)for(var c in a)this.unbind(c,a[c]);else for(var d=0,e=this.length;d<e;d++)f.event.remove(this[d],a,b);return this},delegate:function(a,b,c,d){return this.live(b,c,d,a)},undelegate:function(a,b,c){return arguments.length===0?this.unbind("live"):this.die(b,null,c,a)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f.data(this,"lastToggle"+a.guid)||0)%d;f.data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var L={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};f.each(["live","die"],function(a,c){f.fn[c]=function(a,d,e,g){var h,i=0,j,k,l,m=g||this.selector,n=g?this:f(this.context);if(typeof a=="object"&&!a.preventDefault){for(var o in a)n[c](o,d,a[o],m);return this}if(c==="die"&&!a&&g&&g.charAt(0)==="."){n.unbind(g);return this}if(d===!1||f.isFunction(d))e=d||D,d=b;a=(a||"").split(" ");while((h=a[i++])!=null){j=x.exec(h),k="",j&&(k=j[0],h=h.replace(x,""));if(h==="hover"){a.push("mouseenter"+k,"mouseleave"+k);continue}l=h,L[h]?(a.push(L[h]+k),h=h+k):h=(L[h]||h)+k;if(c==="live")for(var p=0,q=n.length;p<q;p++)f.event.add(n[p],"live."+N(h,m),{data:d,selector:m,handler:e,origType:h,origHandler:e,preType:l});else n.unbind("live."+N(h,m),e)}return this}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.bind(b,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}if(i.nodeType===1){f||(i.sizcache=c,i.sizset=g);if(typeof b!="string"){if(i===b){j=!0;break}}else if(k.filter(b,[i]).length>0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}i.nodeType===1&&!f&&(i.sizcache=c,i.sizset=g);if(i.nodeName.toLowerCase()===b){j=i;break}i=i[a]}d[g]=j}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d=0,e=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,f,g){f=f||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return f;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(e.call(n)==="[object Array]")if(!u)f.push.apply(f,n);else if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&f.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&f.push(j[t]);else p(n,f);o&&(k(o,h,f,g),k.uniqueSort(f));return f};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},k.matches=function(a,b){return k(a,null,null,b)},k.matchesSelector=function(a,b){return k(b,null,null,[a]).length>0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e<f;e++){var g,h=l.order[e];if(g=l.leftMatch[h].exec(a)){var j=g[1];g.splice(1,1);if(j.substr(j.length-1)!=="\\"){g[1]=(g[1]||"").replace(i,""),d=l.find[h](g,b,c);if(d!=null){a=a.replace(l.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},k.filter=function(a,c,d,e){var f,g,h=a,i=[],j=c,m=c&&c[0]&&k.isXML(c[0]);while(a&&c.length){for(var n in l.filter)if((f=l.leftMatch[n].exec(a))!=null&&f[2]){var o,p,q=l.filter[n],r=f[1];g=!1,f.splice(1,1);if(r.substr(r.length-1)==="\\")continue;j===i&&(i=[]);if(l.preFilter[n]){f=l.preFilter[n](f,j,d,i,e,m);if(!f)g=o=!0;else if(f===!0)continue}if(f)for(var s=0;(p=j[s])!=null;s++)if(p){o=q(p,f,s,j);var t=e^!!o;d&&o!=null?t?g=!0:j[s]=!1:t&&(i.push(p),g=!0)}if(o!==b){d||(j=i),a=a.replace(l.match[n],"");if(!g)return[];break}}if(a===h)if(g==null)k.error(a);else break;h=a}return j},k.error=function(a){throw"Syntax error, unrecognized expression: "+a};var l=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!j.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&k.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&k.filter(b,a,!0)}},"":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("parentNode",b,f,a,e,c)},"~":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("previousSibling",b,f,a,e,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(i,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=d++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}k.error(e)},CHILD:function(a,b){var c=b[1],d=a;switch(c){case"only":case"first":while(d=d.previousSibling)if(d.nodeType===1)return!1;if(c==="first")return!0;d=a;case"last":while(d=d.nextSibling)if(d.nodeType===1)return!1;return!0;case"nth":var e=b[2],f=b[3];if(e===1&&f===0)return!0;var g=b[0],h=a.parentNode;if(h&&(h.sizcache!==g||!a.nodeIndex)){var i=0;for(d=h.firstChild;d;d=d.nextSibling)d.nodeType===1&&(d.nodeIndex=++i);h.sizcache=g}var j=a.nodeIndex-f;return e===0?j===0:j%e===0&&j/e>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(e.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var f=a.length;c<f;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var r,s;c.documentElement.compareDocumentPosition?r=function(a,b){if(a===b){g=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(r=function(a,b){if(a===b){g=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],h=a.parentNode,i=b.parentNode,j=h;if(h===i)return s(a,b);if(!h)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return s(e[k],f[k]);return k===c?s(a,f[k],-1):s(e[k],b,1)},s=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),k.getText=function(a){var b="",c;for(var d=0;a[d];d++)c=a[d],c.nodeType===3||c.nodeType===4?b+=c.nodeValue:c.nodeType!==8&&(b+=k.getText(c.childNodes));return b},function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g<h;g++)k(a,f[g],d);return k.filter(e,d)};f.find=k,f.expr=k.selectors,f.expr[":"]=f.expr.filters,f.unique=k.uniqueSort,f.text=k.getText,f.isXMLDoc=k.isXML,f.contains=k.contains}();var O=/Until$/,P=/^(?:parents|prevUntil|prevAll)/,Q=/,/,R=/^.[^:#\[\.,]*$/,S=Array.prototype.slice,T=f.expr.match.POS,U={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(W(this,a,!1),"not",a)},filter:function(a){return this.pushStack(W(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(d=0,e=a.length;d<e;d++)i=a[d],j[i]||(j[i]=T.test(i)?f(i,b||this.context):i);while(g&&g.ownerDocument&&g!==b){for(i in j)h=j[i],(h.jquery?h.index(g)>-1:f(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=T.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(l?l.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a=="string")return f.inArray(this[0],a?f(a):this.parent().children());return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(V(c[0])||V(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c),g=S.call(arguments);O.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!U[a]?f.unique(e):e,(this.length>1||Q.test(d))&&P.test(a)&&(e=e.reverse());return this.pushStack(e,a,g.join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var X=/ jQuery\d+="(?:\d+|null)"/g,Y=/^\s+/,Z=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,$=/<([\w:]+)/,_=/<tbody/i,ba=/<|&#?\w+;/,bb=/<(?:script|object|embed|option|style)/i,bc=/checked\s*(?:[^=]|=\s*.checked.)/i,bd=/\/(java|ecma)script/i,be=/^\s*<!(?:\[CDATA\[|\-\-)/,bf={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};bf.optgroup=bf.option,bf.tbody=bf.tfoot=bf.colgroup=bf.caption=bf.thead,bf.th=bf.td,f.support.htmlSerialize||(bf._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){f(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(X,""):null;if(typeof a=="string"&&!bb.test(a)&&(f.support.leadingWhitespace||!Y.test(a))&&!bf[($.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Z,"<$1></$2>");try{for(var c=0,d=this.length;c<d;c++)this[c].nodeType===1&&(f.cleanData(this[c].getElementsByTagName("*")),this[c].innerHTML=a)}catch(e){this.empty().append(a)}}else f.isFunction(a)?this.each(function(b){var c=f(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bc.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bg(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,bm)}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i;b&&b[0]&&(i=b[0].ownerDocument||b[0]),i.createDocumentFragment||(i=c),a.length===1&&typeof a[0]=="string"&&a[0].length<512&&i===c&&a[0].charAt(0)==="<"&&!bb.test(a[0])&&(f.support.checkClone||!bc.test(a[0]))&&(g=!0,h=f.fragments[a[0]],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[a[0]]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j +)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d=a.cloneNode(!0),e,g,h;if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bi(a,d),e=bj(a),g=bj(d);for(h=0;e[h];++h)bi(e[h],g[h])}if(b){bh(a,d);if(c){e=bj(a),g=bj(d);for(h=0;e[h];++h)bh(e[h],g[h])}}e=g=null;return d},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!ba.test(k))k=b.createTextNode(k);else{k=k.replace(Z,"<$1></$2>");var l=($.exec(k)||["",""])[1].toLowerCase(),m=bf[l]||bf._default,n=m[0],o=b.createElement("div");o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=_.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]==="<table>"&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&Y.test(k)&&o.insertBefore(b.createTextNode(Y.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i<r;i++)bl(k[i]);else bl(k);k.nodeType?h.push(k):h=f.merge(h,k)}if(d){g=function(a){return!a.type||bd.test(a.type)};for(j=0;h[j];j++)if(e&&f.nodeName(h[j],"script")&&(!h[j].type||h[j].type.toLowerCase()==="text/javascript"))e.push(h[j].parentNode?h[j].parentNode.removeChild(h[j]):h[j]);else{if(h[j].nodeType===1){var s=f.grep(h[j].getElementsByTagName("script"),g);h.splice.apply(h,[j+1,0].concat(s))}d.appendChild(h[j])}}return h},cleanData:function(a){var b,c,d=f.cache,e=f.expando,g=f.event.special,h=f.support.deleteExpando;for(var i=0,j;(j=a[i])!=null;i++){if(j.nodeName&&f.noData[j.nodeName.toLowerCase()])continue;c=j[f.expando];if(c){b=d[c]&&d[c][e];if(b&&b.events){for(var k in b.events)g[k]?f.event.remove(j,k):f.removeEvent(j,k,b.handle);b.handle&&(b.handle.elem=null)}h?delete j[f.expando]:j.removeAttribute&&j.removeAttribute(f.expando),delete d[c]}}}});var bn=/alpha\([^)]*\)/i,bo=/opacity=([^)]*)/,bp=/([A-Z]|^ms)/g,bq=/^-?\d+(?:px)?$/i,br=/^-?\d/,bs=/^[+\-]=/,bt=/[^+\-\.\de]+/g,bu={position:"absolute",visibility:"hidden",display:"block"},bv=["Left","Right"],bw=["Top","Bottom"],bx,by,bz;f.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return f.access(this,a,c,!0,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)})},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bx(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d;if(h==="number"&&isNaN(d)||d==null)return;h==="string"&&bs.test(d)&&(d=+d.replace(bt,"")+parseFloat(f.css(a,c)),h="number"),h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(bx)return bx(a,c)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]}}),f.curCSS=f.css,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){var e;if(c){if(a.offsetWidth!==0)return bA(a,b,d);f.swap(a,bu,function(){e=bA(a,b,d)});return e}},set:function(a,b){if(!bq.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bo.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle;c.zoom=1;var e=f.isNaN(b)?"":"alpha(opacity="+b*100+")",g=d&&d.filter||c.filter||"";c.filter=bn.test(g)?g.replace(bn,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bx(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(by=function(a,c){var d,e,g;c=c.replace(bp,"-$1").toLowerCase();if(!(e=a.ownerDocument.defaultView))return b;if(g=e.getComputedStyle(a,null))d=g.getPropertyValue(c),d===""&&!f.contains(a.ownerDocument.documentElement,a)&&(d=f.style(a,c));return d}),c.documentElement.currentStyle&&(bz=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bq.test(d)&&br.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bx=by||bz,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bB=/%20/g,bC=/\[\]$/,bD=/\r?\n/g,bE=/#.*$/,bF=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bG=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bH=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,bI=/^(?:GET|HEAD)$/,bJ=/^\/\//,bK=/\?/,bL=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bM=/^(?:select|textarea)/i,bN=/\s+/,bO=/([?&])_=[^&]*/,bP=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bQ=f.fn.load,bR={},bS={},bT,bU;try{bT=e.href}catch(bV){bT=c.createElement("a"),bT.href="",bT=bT.href}bU=bP.exec(bT.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bQ)return bQ.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bL,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bM.test(this.nodeName)||bG.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bD,"\r\n")}}):{name:b.name,value:c.replace(bD,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.bind(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?f.extend(!0,a,f.ajaxSettings,b):(b=a,a=f.extend(!0,f.ajaxSettings,b));for(var c in{context:1,url:1})c in b?a[c]=b[c]:c in f.ajaxSettings&&(a[c]=f.ajaxSettings[c]);return a},ajaxSettings:{url:bT,isLocal:bH.test(bU[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML}},ajaxPrefilter:bW(bR),ajaxTransport:bW(bS),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a?4:0;var o,r,u,w=l?bZ(d,v,l):b,x,y;if(a>=200&&a<300||a===304){if(d.ifModified){if(x=v.getResponseHeader("Last-Modified"))f.lastModified[k]=x;if(y=v.getResponseHeader("Etag"))f.etag[k]=y}if(a===304)c="notmodified",o=!0;else try{r=b$(d,w),c="success",o=!0}catch(z){c="parsererror",u=z}}else{u=c;if(!c||a)c="error",a<0&&(a=0)}v.status=a,v.statusText=c,o?h.resolveWith(e,[r,c,v]):h.rejectWith(e,[v,c,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.resolveWith(e,[v,c]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f._Deferred(),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bF.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.done,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bE,"").replace(bJ,bU[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bN),d.crossDomain==null&&(r=bP.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bU[1]&&r[2]==bU[2]&&(r[3]||(r[1]==="http:"?80:443))==(bU[3]||(bU[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),bX(bR,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bI.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bK.test(d.url)?"&":"?")+d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bO,"$1_="+x);d.url=y+(y===d.url?(bK.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", */*; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=bX(bS,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){status<2?w(-1,z):f.error(z)}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)bY(g,a[g],c,e);return d.join("&").replace(bB,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var b_=f.now(),ca=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+b_++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(ca.test(b.url)||e&&ca.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(ca,l),b.url===j&&(e&&(k=k.replace(ca,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var cb=a.ActiveXObject?function(){for(var a in cd)cd[a](0,1)}:!1,cc=0,cd;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ce()||cf()}:ce,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,cb&&delete cd[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cc,cb&&(cd||(cd={},f(a).unload(cb)),cd[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cg={},ch,ci,cj=/^(?:toggle|show|hide)$/,ck=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cl,cm=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cn,co=a.webkitRequestAnimationFrame||a.mozRequestAnimationFrame||a.oRequestAnimationFrame;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cr("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),e===""&&f.css(d,"display")==="none"&&f._data(d,"olddisplay",cs(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(cr("hide",3),a,b,c);for(var d=0,e=this.length;d<e;d++)if(this[d].style){var g=f.css(this[d],"display");g!=="none"&&!f._data(this[d],"olddisplay")&&f._data(this[d],"olddisplay",g)}for(d=0;d<e;d++)this[d].style&&(this[d].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(cr("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return this[e.queue===!1?"each":"queue"](function(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]),h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(f.support.inlineBlockNeedsLayout?(j=cs(this.nodeName),j==="inline"?this.style.display="inline-block":(this.style.display="inline",this.style.zoom=1)):this.style.display="inline-block"))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)k=new f.fx(this,b,i),h=a[i],cj.test(h)?k[h==="toggle"?d?"show":"hide":h]():(l=ck.exec(h),m=k.cur(),l?(n=parseFloat(l[2]),o=l[3]||(f.cssNumber[i]?"":"px"),o!=="px"&&(f.style(this,i,(n||1)+o),m=(n||1)/k.cur()*m,f.style(this,i,m+o)),l[1]&&(n=(l[1]==="-="?-1:1)*n+m),k.custom(m,n,o)):k.custom(m,h,""));return!0})},stop:function(a,b){a&&this.queue([]),this.each(function(){var a=f.timers,c=a.length;b||f._unmark(!0,this);while(c--)a[c].elem===this&&(b&&a[c](!0),a.splice(c,1))}),b||this.dequeue();return this}}),f.each({slideDown:cr("show",1),slideUp:cr("hide",1),slideToggle:cr("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default,d.old=d.complete,d.complete=function(a){f.isFunction(d.old)&&d.old.call(this),d.queue!==!1?f.dequeue(this):a!==!1&&f._unmark(this)};return d},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,b,c){function h(a){return d.step(a)}var d=this,e=f.fx,g;this.startTime=cn||cp(),this.start=a,this.end=b,this.unit=c||this.unit||(f.cssNumber[this.prop]?"":"px"),this.now=this.start,this.pos=this.state=0,h.elem=this.elem,h()&&f.timers.push(h)&&!cl&&(co?(cl=!0,g=function(){cl&&(co(g),e.tick())},co(g)):cl=setInterval(e.tick,e.interval))},show:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.show=!0,this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b=cn||cp(),c=!0,d=this.elem,e=this.options,g,h;if(a||b>=e.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),e.animatedProperties[this.prop]=!0;for(g in e.animatedProperties)e.animatedProperties[g]!==!0&&(c=!1);if(c){e.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){d.style["overflow"+b]=e.overflow[a]}),e.hide&&f(d).hide();if(e.hide||e.show)for(var i in e.animatedProperties)f.style(d,i,e.orig[i]);e.complete.call(d)}return!1}e.duration==Infinity?this.now=b:(h=b-this.startTime,this.state=h/e.duration,this.pos=f.easing[e.animatedProperties[this.prop]](this.state,h,0,1,e.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){for(var a=f.timers,b=0;b<a.length;++b)a[b]()||a.splice(b--,1);a.length||f.fx.stop()},interval:13,stop:function(){clearInterval(cl),cl=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit:a.elem[a.prop]=a.now}}}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var ct=/^t(?:able|d|h)$/i,cu=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?f.fn.offset=function(a){var b=this[0],c;if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);try{c=b.getBoundingClientRect()}catch(d){}var e=b.ownerDocument,g=e.documentElement;if(!c||!f.contains(g,b))return c?{top:c.top,left:c.left}:{top:0,left:0};var h=e.body,i=cv(e),j=g.clientTop||h.clientTop||0,k=g.clientLeft||h.clientLeft||0,l=i.pageYOffset||f.support.boxModel&&g.scrollTop||h.scrollTop,m=i.pageXOffset||f.support.boxModel&&g.scrollLeft||h.scrollLeft,n=c.top+l-j,o=c.left+m-k;return{top:n,left:o}}:f.fn.offset=function(a){var b=this[0];if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);f.offset.initialize();var c,d=b.offsetParent,e=b,g=b.ownerDocument,h=g.documentElement,i=g.body,j=g.defaultView,k=j?j.getComputedStyle(b,null):b.currentStyle,l=b.offsetTop,m=b.offsetLeft;while((b=b.parentNode)&&b!==i&&b!==h){if(f.offset.supportsFixedPosition&&k.position==="fixed")break;c=j?j.getComputedStyle(b,null):b.currentStyle,l-=b.scrollTop,m-=b.scrollLeft,b===d&&(l+=b.offsetTop,m+=b.offsetLeft,f.offset.doesNotAddBorder&&(!f.offset.doesAddBorderForTableAndCells||!ct.test(b.nodeName))&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),e=d,d=b.offsetParent),f.offset.subtractsBorderForOverflowNotVisible&&c.overflow!=="visible"&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),k=c}if(k.position==="relative"||k.position==="static")l+=i.offsetTop,m+=i.offsetLeft;f.offset.supportsFixedPosition&&k.position==="fixed"&&(l+=Math.max(h.scrollTop,i.scrollTop),m+=Math.max(h.scrollLeft,i.scrollLeft));return{top:l,left:m}},f.offset={initialize:function(){var a=c.body,b=c.createElement("div"),d,e,g,h,i=parseFloat(f.css(a,"marginTop"))||0,j="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";f.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),d=b.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,this.doesNotAddBorder=e.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,e.style.position="fixed",e.style.top="20px",this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),f.offset.initialize=f.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.offset.initialize(),f.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cu.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cu.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cv(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cv(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){var a=this[0];return a&&a.style?parseFloat(f.css(a,d,"padding")):null},f.fn["outer"+c]=function(a){var b=this[0];return b&&b.style?parseFloat(f.css(b,d,a?"margin":"border")):null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c];return e.document.compatMode==="CSS1Compat"&&g||e.document.body["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var h=f.css(e,d),i=parseFloat(h);return f.isNaN(i)?h:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f})(window);
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/jquery.ui.js b/gstudio/static/gstudio/js/jquery.ui.js new file mode 100644 index 0000000..044d307 --- /dev/null +++ b/gstudio/static/gstudio/js/jquery.ui.js @@ -0,0 +1,68 @@ +/*! + * jQuery UI 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.9",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106, +NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this, +"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position"); +if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f, +"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h, +d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}}); +c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&& +b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery); +;/*! + * jQuery UI Widget 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h, +a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h; +e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options, +this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")}, +widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this}, +enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery); +;/* + * jQuery UI Tabs 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& +e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= +d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| +(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ +g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; +this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= +-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= +d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, +e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); +j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); +if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, +this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, +load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, +"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.9"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&& +a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery); +;
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/jquery.ui.timepicker.js b/gstudio/static/gstudio/js/jquery.ui.timepicker.js new file mode 100644 index 0000000..d086b67 --- /dev/null +++ b/gstudio/static/gstudio/js/jquery.ui.timepicker.js @@ -0,0 +1,1345 @@ +/*
+ * jQuery UI Timepicker 0.2.9
+ *
+ * Copyright 2010-2011, Francois Gelinas
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://fgelinas.com/code/timepicker
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.position.js (only if position settngs are used)
+ *
+ * Change version 0.1.0 - moved the t-rex up here
+ *
+ ____
+ ___ .-~. /_"-._
+ `-._~-. / /_ "~o\ :Y
+ \ \ / : \~x. ` ')
+ ] Y / | Y< ~-.__j
+ / ! _.--~T : l l< /.-~
+ / / ____.--~ . ` l /~\ \<|Y
+ / / .-~~" /| . ',-~\ \L|
+ / / / .^ \ Y~Y \.^>/l_ "--'
+ / Y .-"( . l__ j_j l_/ /~_.-~ .
+ Y l / \ ) ~~~." / `/"~ / \.__/l_
+ | \ _.-" ~-{__ l : l._Z~-.___.--~
+ | ~---~ / ~~"---\_ ' __[>
+ l . _.^ ___ _>-y~
+ \ \ . .-~ .-~ ~>--" /
+ \ ~---" / ./ _.-'
+ "-.,_____.,_ _.--~\ _.-~
+ ~~ ( _} -Row
+ `. ~(
+ ) \
+ /,`--'~\--'~\
+ ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+ ->T-Rex<-
+*/
+
+(function ($, undefined) {
+
+ $.extend($.ui, { timepicker: { version: "0.2.9"} });
+
+ var PROP_NAME = 'timepicker';
+ var tpuuid = new Date().getTime();
+
+ /* Time picker manager.
+ Use the singleton instance of this class, $.timepicker, to interact with the time picker.
+ Settings for (groups of) time pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+ function Timepicker() {
+ this.debug = true; // Change this to true to start debugging
+ this._curInst = null; // The current instance in use
+ this._isInline = false; // true if the instance is displayed inline
+ this._disabledInputs = []; // List of time picker inputs that have been disabled
+ this._timepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._dialogClass = 'ui-timepicker-dialog'; // The name of the dialog marker class
+ this._mainDivId = 'ui-timepicker-div'; // The ID of the main timepicker division
+ this._inlineClass = 'ui-timepicker-inline'; // The name of the inline marker class
+ this._currentClass = 'ui-timepicker-current'; // The name of the current hour / minutes marker class
+ this._dayOverClass = 'ui-timepicker-days-cell-over'; // The name of the day hover marker class
+
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[''] = { // Default regional settings
+ hourText: 'Hour', // Display text for hours section
+ minuteText: 'Minute', // Display text for minutes link
+ amPmText: ['AM', 'PM'], // Display text for AM PM
+ closeButtonText: 'Done', // Text for the confirmation button (ok button)
+ nowButtonText: 'Now', // Text for the now button
+ deselectButtonText: 'Deselect' // Text for the deselect button
+ };
+ this._defaults = { // Global defaults for all the time picker instances
+ showOn: 'focus', // 'focus' for popup on focus,
+ // 'button' for trigger button, or 'both' for either (not yet implemented)
+ button: null, // 'button' element that will trigger the timepicker
+ showAnim: 'fadeIn', // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ appendText: '', // Display text following the input box, e.g. showing the format
+
+ beforeShow: null, // Define a callback function executed before the timepicker is shown
+ onSelect: null, // Define a callback function when a hour / minutes is selected
+ onClose: null, // Define a callback function when the timepicker is closed
+
+ timeSeparator: ':', // The character to use to separate hours and minutes.
+ periodSeparator: ' ', // The character to use to separate the time from the time period.
+ showPeriod: false, // Define whether or not to show AM/PM with selected time
+ showPeriodLabels: true, // Show the AM/PM labels on the left of the time picker
+ showLeadingZero: true, // Define whether or not to show a leading zero for hours < 10. [true/false]
+ showMinutesLeadingZero: true, // Define whether or not to show a leading zero for minutes < 10.
+ altField: '', // Selector for an alternate field to store selected time into
+ defaultTime: 'now', // Used as default time when input field is empty or for inline timePicker
+ // (set to 'now' for the current time, '' for no highlighted time)
+ myPosition: 'left top', // Position of the dialog relative to the input.
+ // see the position utility for more info : http://jqueryui.com/demos/position/
+ atPosition: 'left bottom', // Position of the input element to match
+ // Note : if the position utility is not loaded, the timepicker will attach left top to left bottom
+ //NEW: 2011-02-03
+ onHourShow: null, // callback for enabling / disabling on selectable hours ex : function(hour) { return true; }
+ onMinuteShow: null, // callback for enabling / disabling on time selection ex : function(hour,minute) { return true; }
+
+ hours: {
+ starts: 0, // first displayed hour
+ ends: 23 // last displayed hour
+ },
+ minutes: {
+ starts: 0, // first displayed minute
+ ends: 55, // last displayed minute
+ interval: 5 // interval of displayed minutes
+ },
+ rows: 4, // number of rows for the input tables, minimum 2, makes more sense if you use multiple of 2
+ // 2011-08-05 0.2.4
+ showHours: true, // display the hours section of the dialog
+ showMinutes: true, // display the minute section of the dialog
+ optionalMinutes: false, // optionally parse inputs of whole hours with minutes omitted
+
+ // buttons
+ showCloseButton: false, // shows an OK button to confirm the edit
+ showNowButton: false, // Shows the 'now' button
+ showDeselectButton: false // Shows the deselect time button
+
+ };
+ $.extend(this._defaults, this.regional['']);
+
+ this.tpDiv = $('<div id="' + this._mainDivId + '" class="ui-timepicker ui-widget ui-helper-clearfix ui-corner-all " style="display: none"></div>');
+ }
+
+ $.extend(Timepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a time picker. */
+ markerClassName: 'hasTimepicker',
+
+ /* Debug logging (if enabled). */
+ log: function () {
+ if (this.debug)
+ console.log.apply('', arguments);
+ },
+
+ _widgetTimepicker: function () {
+ return this.tpDiv;
+ },
+
+ /* Override the default settings for all instances of the time picker.
+ @param settings object - the new settings to use as defaults (anonymous object)
+ @return the manager object */
+ setDefaults: function (settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the time picker to a jQuery selection.
+ @param target element - the target input field or division or span
+ @param settings object - the new settings to use for this time picker instance (anonymous) */
+ _attachTimepicker: function (target, settings) {
+ // check for settings on the control itself - in namespace 'time:'
+ var inlineSettings = null;
+ for (var attrName in this._defaults) {
+ var attrValue = target.getAttribute('time:' + attrName);
+ if (attrValue) {
+ inlineSettings = inlineSettings || {};
+ try {
+ inlineSettings[attrName] = eval(attrValue);
+ } catch (err) {
+ inlineSettings[attrName] = attrValue;
+ }
+ }
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ var inline = (nodeName == 'div' || nodeName == 'span');
+
+ if (!target.id) {
+ this.uuid += 1;
+ target.id = 'tp' + this.uuid;
+ }
+ var inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+ if (nodeName == 'input') {
+ this._connectTimepicker(target, inst);
+ // init inst.hours and inst.minutes from the input value
+ this._setTimeFromField(inst);
+ } else if (inline) {
+ this._inlineTimepicker(target, inst);
+ }
+
+
+ },
+
+ /* Create a new instance object. */
+ _newInst: function (target, inline) {
+ var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars
+ return {
+ id: id, input: target, // associated target
+ inline: inline, // is timepicker inline or not :
+ tpDiv: (!inline ? this.tpDiv : // presentation div
+ $('<div class="' + this._inlineClass + ' ui-timepicker ui-widget ui-helper-clearfix"></div>'))
+ };
+ },
+
+ /* Attach the time picker to an input field. */
+ _connectTimepicker: function (target, inst) {
+ var input = $(target);
+ inst.append = $([]);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName)) { return; }
+ this._attachments(input, inst);
+ input.addClass(this.markerClassName).
+ keydown(this._doKeyDown).
+ keyup(this._doKeyUp).
+ bind("setData.timepicker", function (event, key, value) {
+ inst.settings[key] = value;
+ }).
+ bind("getData.timepicker", function (event, key) {
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function (event) {
+ var inst = $.timepicker._getInst(event.target);
+ var handled = true;
+ inst._keyEvent = true;
+ if ($.timepicker._timepickerShowing) {
+ switch (event.keyCode) {
+ case 9: $.timepicker._hideTimepicker();
+ handled = false;
+ break; // hide on tab out
+ case 13:
+ $.timepicker._updateSelectedValue(inst);
+ $.timepicker._hideTimepicker();
+
+ return false; // don't submit the form
+ break; // select the value on enter
+ case 27: $.timepicker._hideTimepicker();
+ break; // hide on escape
+ default: handled = false;
+ }
+ }
+ else if (event.keyCode == 36 && event.ctrlKey) { // display the time picker on ctrl+home
+ $.timepicker._showTimepicker(this);
+ }
+ else {
+ handled = false;
+ }
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Update selected time on keyUp */
+ /* Added verion 0.0.5 */
+ _doKeyUp: function (event) {
+ var inst = $.timepicker._getInst(event.target);
+ $.timepicker._setTimeFromField(inst);
+ $.timepicker._updateTimepicker(inst);
+ },
+
+ /* Make attachments based on settings. */
+ _attachments: function (input, inst) {
+ var appendText = this._get(inst, 'appendText');
+ var isRTL = this._get(inst, 'isRTL');
+ if (inst.append) { inst.append.remove(); }
+ if (appendText) {
+ inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
+ input[isRTL ? 'before' : 'after'](inst.append);
+ }
+ input.unbind('focus.timepicker', this._showTimepicker);
+ if (inst.trigger) { inst.trigger.remove(); }
+
+ var showOn = this._get(inst, 'showOn');
+ if (showOn == 'focus' || showOn == 'both') { // pop-up time picker when in the marked field
+ input.bind("focus.timepicker", this._showTimepicker);
+ }
+ if (showOn == 'button' || showOn == 'both') { // pop-up time picker when 'button' element is clicked
+ var button = this._get(inst, 'button');
+ $(button).bind("click.timepicker", function () {
+ if ($.timepicker._timepickerShowing && $.timepicker._lastInput == input[0]) { $.timepicker._hideTimepicker(); }
+ else { $.timepicker._showTimepicker(input[0]); }
+ return false;
+ });
+
+ }
+ },
+
+
+ /* Attach an inline time picker to a div. */
+ _inlineTimepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName))
+ return;
+ divSpan.addClass(this.markerClassName).append(inst.tpDiv).
+ bind("setData.timepicker", function(event, key, value){
+ inst.settings[key] = value;
+ }).bind("getData.timepicker", function(event, key){
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+
+ this._setTimeFromField(inst);
+ this._updateTimepicker(inst);
+ inst.tpDiv.show();
+ },
+
+ /* Pop-up the time picker for a given input field.
+ @param input element - the input field attached to the time picker or
+ event - if triggered by focus */
+ _showTimepicker: function (input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() != 'input') { input = $('input', input.parentNode)[0]; } // find from button/image trigger
+ if ($.timepicker._isDisabledTimepicker(input) || $.timepicker._lastInput == input) { return; } // already here
+
+ // fix v 0.0.8 - close current timepicker before showing another one
+ $.timepicker._hideTimepicker();
+
+ var inst = $.timepicker._getInst(input);
+ if ($.timepicker._curInst && $.timepicker._curInst != inst) {
+ $.timepicker._curInst.tpDiv.stop(true, true);
+ }
+ var beforeShow = $.timepicker._get(inst, 'beforeShow');
+ extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
+ inst.lastVal = null;
+ $.timepicker._lastInput = input;
+
+ $.timepicker._setTimeFromField(inst);
+
+ // calculate default position
+ if ($.timepicker._inDialog) { input.value = ''; } // hide cursor
+ if (!$.timepicker._pos) { // position below input
+ $.timepicker._pos = $.timepicker._findPos(input);
+ $.timepicker._pos[1] += input.offsetHeight; // add the height
+ }
+ var isFixed = false;
+ $(input).parents().each(function () {
+ isFixed |= $(this).css('position') == 'fixed';
+ return !isFixed;
+ });
+ if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+ $.timepicker._pos[0] -= document.documentElement.scrollLeft;
+ $.timepicker._pos[1] -= document.documentElement.scrollTop;
+ }
+
+ var offset = { left: $.timepicker._pos[0], top: $.timepicker._pos[1] };
+
+ $.timepicker._pos = null;
+ // determine sizing offscreen
+ inst.tpDiv.css({ position: 'absolute', display: 'block', top: '-1000px' });
+ $.timepicker._updateTimepicker(inst);
+
+
+ // position with the ui position utility, if loaded
+ if ( ( ! inst.inline ) && ( typeof $.ui.position == 'object' ) ) {
+ inst.tpDiv.position({
+ of: inst.input,
+ my: $.timepicker._get( inst, 'myPosition' ),
+ at: $.timepicker._get( inst, 'atPosition' ),
+ // offset: $( "#offset" ).val(),
+ // using: using,
+ collision: 'flip'
+ });
+ var offset = inst.tpDiv.offset();
+ $.timepicker._pos = [offset.top, offset.left];
+ }
+
+
+ // reset clicked state
+ inst._hoursClicked = false;
+ inst._minutesClicked = false;
+
+ // fix width for dynamic number of time pickers
+ // and adjust position before showing
+ offset = $.timepicker._checkOffset(inst, offset, isFixed);
+ inst.tpDiv.css({ position: ($.timepicker._inDialog && $.blockUI ?
+ 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+ left: offset.left + 'px', top: offset.top + 'px'
+ });
+ if ( ! inst.inline ) {
+ var showAnim = $.timepicker._get(inst, 'showAnim');
+ var duration = $.timepicker._get(inst, 'duration');
+
+ var postProcess = function () {
+ $.timepicker._timepickerShowing = true;
+ var borders = $.timepicker._getBorders(inst.tpDiv);
+ inst.tpDiv.find('iframe.ui-timepicker-cover'). // IE6- only
+ css({ left: -borders[0], top: -borders[1],
+ width: inst.tpDiv.outerWidth(), height: inst.tpDiv.outerHeight()
+ });
+ };
+
+ // Fixed the zIndex problem for real (I hope) - FG - v 0.2.9
+ inst.tpDiv.css('zIndex', $.timepicker._getZIndex(input) +1);
+
+ if ($.effects && $.effects[showAnim]) {
+ inst.tpDiv.show(showAnim, $.timepicker._get(inst, 'showOptions'), duration, postProcess);
+ }
+ else {
+ inst.tpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess);
+ }
+ if (!showAnim || !duration) { postProcess(); }
+ if (inst.input.is(':visible') && !inst.input.is(':disabled')) { inst.input.focus(); }
+ $.timepicker._curInst = inst;
+ }
+ },
+
+ // This is a copy of the zIndex function of UI core 1.8.??
+ // Copied in the timepicker to stay backward compatible.
+ _getZIndex: function (target) {
+ var elem = $( target ), position, value;
+ while ( elem.length && elem[ 0 ] !== document ) {
+ position = elem.css( "position" );
+ if ( position === "absolute" || position === "relative" || position === "fixed" ) {
+ value = parseInt( elem.css( "zIndex" ), 10 );
+ if ( !isNaN( value ) && value !== 0 ) {
+ return value;
+ }
+ }
+ elem = elem.parent();
+ }
+ },
+
+ /* Generate the time picker content. */
+ _updateTimepicker: function (inst) {
+ inst.tpDiv.empty().append(this._generateHTML(inst));
+ this._rebindDialogEvents(inst);
+
+ },
+
+ _rebindDialogEvents: function (inst) {
+ var borders = $.timepicker._getBorders(inst.tpDiv),
+ self = this;
+ inst.tpDiv
+ .find('iframe.ui-timepicker-cover') // IE6- only
+ .css({ left: -borders[0], top: -borders[1],
+ width: inst.tpDiv.outerWidth(), height: inst.tpDiv.outerHeight()
+ })
+ .end()
+ // after the picker html is appended bind the click & double click events (faster in IE this way
+ // then letting the browser interpret the inline events)
+ // the binding for the minute cells also exists in _updateMinuteDisplay
+ .find('.ui-timepicker-minute-cell')
+ .unbind()
+ .bind("click", { fromDoubleClick:false }, $.proxy($.timepicker.selectMinutes, this))
+ .bind("dblclick", { fromDoubleClick:true }, $.proxy($.timepicker.selectMinutes, this))
+ .end()
+ .find('.ui-timepicker-hour-cell')
+ .unbind()
+ .bind("click", { fromDoubleClick:false }, $.proxy($.timepicker.selectHours, this))
+ .bind("dblclick", { fromDoubleClick:true }, $.proxy($.timepicker.selectHours, this))
+ .end()
+ .find('.ui-timepicker td a')
+ .unbind()
+ .bind('mouseout', function () {
+ $(this).removeClass('ui-state-hover');
+ if (this.className.indexOf('ui-timepicker-prev') != -1) $(this).removeClass('ui-timepicker-prev-hover');
+ if (this.className.indexOf('ui-timepicker-next') != -1) $(this).removeClass('ui-timepicker-next-hover');
+ })
+ .bind('mouseover', function () {
+ if ( ! self._isDisabledTimepicker(inst.inline ? inst.tpDiv.parent()[0] : inst.input[0])) {
+ $(this).parents('.ui-timepicker-calendar').find('a').removeClass('ui-state-hover');
+ $(this).addClass('ui-state-hover');
+ if (this.className.indexOf('ui-timepicker-prev') != -1) $(this).addClass('ui-timepicker-prev-hover');
+ if (this.className.indexOf('ui-timepicker-next') != -1) $(this).addClass('ui-timepicker-next-hover');
+ }
+ })
+ .end()
+ .find('.' + this._dayOverClass + ' a')
+ .trigger('mouseover')
+ .end()
+ .find('.ui-timepicker-now').bind("click",function(e) {
+ $.timepicker.selectNow(e);
+ }).end()
+ .find('.ui-timepicker-deselect').bind("click",function(e) {
+ $.timepicker.deselectTime(e);
+ }).end()
+ .find('.ui-timepicker-close').bind("click",function(e) {
+ $.timepicker._hideTimepicker();
+ }).end();
+ },
+
+ /* Generate the HTML for the current state of the time picker. */
+ _generateHTML: function (inst) {
+
+ var h, m, row, col, html, hoursHtml, minutesHtml = '',
+ showPeriod = (this._get(inst, 'showPeriod') == true),
+ showPeriodLabels = (this._get(inst, 'showPeriodLabels') == true),
+ showLeadingZero = (this._get(inst, 'showLeadingZero') == true),
+ showHours = (this._get(inst, 'showHours') == true),
+ showMinutes = (this._get(inst, 'showMinutes') == true),
+ amPmText = this._get(inst, 'amPmText'),
+ rows = this._get(inst, 'rows'),
+ amRows = 0,
+ pmRows = 0,
+ amItems = 0,
+ pmItems = 0,
+ amFirstRow = 0,
+ pmFirstRow = 0,
+ hours = Array(),
+ hours_options = this._get(inst, 'hours'),
+ hoursPerRow = null,
+ hourCounter = 0,
+ hourLabel = this._get(inst, 'hourText'),
+ showCloseButton = this._get(inst, 'showCloseButton'),
+ closeButtonText = this._get(inst, 'closeButtonText'),
+ showNowButton = this._get(inst, 'showNowButton'),
+ nowButtonText = this._get(inst, 'nowButtonText'),
+ showDeselectButton = this._get(inst, 'showDeselectButton'),
+ deselectButtonText = this._get(inst, 'deselectButtonText'),
+ showButtonPanel = showCloseButton || showNowButton || showDeselectButton;
+
+
+
+ // prepare all hours and minutes, makes it easier to distribute by rows
+ for (h = hours_options.starts; h <= hours_options.ends; h++) {
+ hours.push (h);
+ }
+ hoursPerRow = Math.ceil(hours.length / rows); // always round up
+
+ if (showPeriodLabels) {
+ for (hourCounter = 0; hourCounter < hours.length; hourCounter++) {
+ if (hours[hourCounter] < 12) {
+ amItems++;
+ }
+ else {
+ pmItems++;
+ }
+ }
+ hourCounter = 0;
+
+ amRows = Math.floor(amItems / hours.length * rows);
+ pmRows = Math.floor(pmItems / hours.length * rows);
+
+ // assign the extra row to the period that is more densly populated
+ if (rows != amRows + pmRows) {
+ // Make sure: AM Has Items and either PM Does Not, AM has no rows yet, or AM is more dense
+ if (amItems && (!pmItems || !amRows || (pmRows && amItems / amRows >= pmItems / pmRows))) {
+ amRows++;
+ } else {
+ pmRows++;
+ }
+ }
+ amFirstRow = Math.min(amRows, 1);
+ pmFirstRow = amRows + 1;
+ hoursPerRow = Math.ceil(Math.max(amItems / amRows, pmItems / pmRows));
+ }
+
+
+ html = '<table class="ui-timepicker-table ui-widget-content ui-corner-all"><tr>';
+
+ if (showHours) {
+
+ html += '<td class="ui-timepicker-hours">' +
+ '<div class="ui-timepicker-title ui-widget-header ui-helper-clearfix ui-corner-all">' +
+ hourLabel +
+ '</div>' +
+ '<table class="ui-timepicker">';
+
+ for (row = 1; row <= rows; row++) {
+ html += '<tr>';
+ // AM
+ if (row == amFirstRow && showPeriodLabels) {
+ html += '<th rowspan="' + amRows.toString() + '" class="periods" scope="row">' + amPmText[0] + '</th>';
+ }
+ // PM
+ if (row == pmFirstRow && showPeriodLabels) {
+ html += '<th rowspan="' + pmRows.toString() + '" class="periods" scope="row">' + amPmText[1] + '</th>';
+ }
+ for (col = 1; col <= hoursPerRow; col++) {
+ if (showPeriodLabels && row < pmFirstRow && hours[hourCounter] >= 12) {
+ html += this._generateHTMLHourCell(inst, undefined, showPeriod, showLeadingZero);
+ } else {
+ html += this._generateHTMLHourCell(inst, hours[hourCounter], showPeriod, showLeadingZero);
+ hourCounter++;
+ }
+ }
+ html += '</tr>';
+ }
+ html += '</tr></table>' + // Close the hours cells table
+ '</td>'; // Close the Hour td
+ }
+
+ if (showMinutes) {
+ html += '<td class="ui-timepicker-minutes">';
+ html += this._generateHTMLMinutes(inst);
+ html += '</td>';
+ }
+
+ html += '</tr>';
+
+
+ if (showButtonPanel) {
+ var buttonPanel = '<tr><td colspan="3"><div class="ui-timepicker-buttonpane ui-widget-content">';
+ if (showNowButton) {
+ buttonPanel += '<button type="button" class="ui-timepicker-now ui-state-default ui-corner-all" '
+ + ' data-timepicker-instance-id="#' + inst.id.replace(/\\\\/g,"\\") + '" >'
+ + nowButtonText + '</button>';
+ }
+ if (showDeselectButton) {
+ buttonPanel += '<button type="button" class="ui-timepicker-deselect ui-state-default ui-corner-all" '
+ + ' data-timepicker-instance-id="#' + inst.id.replace(/\\\\/g,"\\") + '" >'
+ + deselectButtonText + '</button>';
+ }
+ if (showCloseButton) {
+ buttonPanel += '<button type="button" class="ui-timepicker-close ui-state-default ui-corner-all" '
+ + ' data-timepicker-instance-id="#' + inst.id.replace(/\\\\/g,"\\") + '" >'
+ + closeButtonText + '</button>';
+ }
+
+ html += buttonPanel + '</div></td></tr>';
+ }
+ html += '</table>';
+
+ /* IE6 IFRAME FIX (taken from datepicker 1.5.3, fixed in 0.1.2 */
+ html += ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ '<iframe src="javascript:false;" class="ui-timepicker-cover" frameborder="0"></iframe>' : '');
+
+ return html;
+ },
+
+ /* Special function that update the minutes selection in currently visible timepicker
+ * called on hour selection when onMinuteShow is defined */
+ _updateMinuteDisplay: function (inst) {
+ var newHtml = this._generateHTMLMinutes(inst);
+ inst.tpDiv.find('td.ui-timepicker-minutes').html(newHtml);
+ this._rebindDialogEvents(inst);
+ // after the picker html is appended bind the click & double click events (faster in IE this way
+ // then letting the browser interpret the inline events)
+ // yes I know, duplicate code, sorry
+/* .find('.ui-timepicker-minute-cell')
+ .bind("click", { fromDoubleClick:false }, $.proxy($.timepicker.selectMinutes, this))
+ .bind("dblclick", { fromDoubleClick:true }, $.proxy($.timepicker.selectMinutes, this));
+*/
+
+ },
+
+ /*
+ * Generate the minutes table
+ * This is separated from the _generateHTML function because is can be called separately (when hours changes)
+ */
+ _generateHTMLMinutes: function (inst) {
+
+ var m, row, html = '',
+ rows = this._get(inst, 'rows'),
+ minutes = Array(),
+ minutes_options = this._get(inst, 'minutes'),
+ minutesPerRow = null,
+ minuteCounter = 0,
+ showMinutesLeadingZero = (this._get(inst, 'showMinutesLeadingZero') == true),
+ onMinuteShow = this._get(inst, 'onMinuteShow'),
+ minuteLabel = this._get(inst, 'minuteText');
+
+ if ( ! minutes_options.starts) {
+ minutes_options.starts = 0;
+ }
+ if ( ! minutes_options.ends) {
+ minutes_options.ends = 59;
+ }
+ for (m = minutes_options.starts; m <= minutes_options.ends; m += minutes_options.interval) {
+ minutes.push(m);
+ }
+ minutesPerRow = Math.round(minutes.length / rows + 0.49); // always round up
+
+ /*
+ * The minutes table
+ */
+ // if currently selected minute is not enabled, we have a problem and need to select a new minute.
+ if (onMinuteShow &&
+ (onMinuteShow.apply((inst.input ? inst.input[0] : null), [inst.hours , inst.minutes]) == false) ) {
+ // loop minutes and select first available
+ for (minuteCounter = 0; minuteCounter < minutes.length; minuteCounter += 1) {
+ m = minutes[minuteCounter];
+ if (onMinuteShow.apply((inst.input ? inst.input[0] : null), [inst.hours, m])) {
+ inst.minutes = m;
+ break;
+ }
+ }
+ }
+
+
+
+ html += '<div class="ui-timepicker-title ui-widget-header ui-helper-clearfix ui-corner-all">' +
+ minuteLabel +
+ '</div>' +
+ '<table class="ui-timepicker">';
+
+ minuteCounter = 0;
+ for (row = 1; row <= rows; row++) {
+ html += '<tr>';
+ while (minuteCounter < row * minutesPerRow) {
+ var m = minutes[minuteCounter];
+ var displayText = '';
+ if (m !== undefined ) {
+ displayText = (m < 10) && showMinutesLeadingZero ? "0" + m.toString() : m.toString();
+ }
+ html += this._generateHTMLMinuteCell(inst, m, displayText);
+ minuteCounter++;
+ }
+ html += '</tr>';
+ }
+
+ html += '</table>';
+
+ return html;
+ },
+
+ /* Generate the content of a "Hour" cell */
+ _generateHTMLHourCell: function (inst, hour, showPeriod, showLeadingZero) {
+
+ var displayHour = hour;
+ if ((hour > 12) && showPeriod) {
+ displayHour = hour - 12;
+ }
+ if ((displayHour == 0) && showPeriod) {
+ displayHour = 12;
+ }
+ if ((displayHour < 10) && showLeadingZero) {
+ displayHour = '0' + displayHour;
+ }
+
+ var html = "";
+ var enabled = true;
+ var onHourShow = this._get(inst, 'onHourShow'); //custom callback
+
+ if (hour == undefined) {
+ html = '<td><span class="ui-state-default ui-state-disabled"> </span></td>';
+ return html;
+ }
+
+ if (onHourShow) {
+ enabled = onHourShow.apply((inst.input ? inst.input[0] : null), [hour]);
+ }
+
+ if (enabled) {
+ html = '<td class="ui-timepicker-hour-cell" data-timepicker-instance-id="#' + inst.id.replace(/\\\\/g,"\\") + '" data-hour="' + hour.toString() + '">' +
+ '<a class="ui-state-default ' +
+ (hour == inst.hours ? 'ui-state-active' : '') +
+ '">' +
+ displayHour.toString() +
+ '</a></td>';
+ }
+ else {
+ html =
+ '<td>' +
+ '<span class="ui-state-default ui-state-disabled ' +
+ (hour == inst.hours ? ' ui-state-active ' : ' ') +
+ '">' +
+ displayHour.toString() +
+ '</span>' +
+ '</td>';
+ }
+ return html;
+ },
+
+ /* Generate the content of a "Hour" cell */
+ _generateHTMLMinuteCell: function (inst, minute, displayText) {
+ var html = "";
+ var enabled = true;
+ var onMinuteShow = this._get(inst, 'onMinuteShow'); //custom callback
+ if (onMinuteShow) {
+ //NEW: 2011-02-03 we should give the hour as a parameter as well!
+ enabled = onMinuteShow.apply((inst.input ? inst.input[0] : null), [inst.hours,minute]); //trigger callback
+ }
+
+ if (minute == undefined) {
+ html = '<td><span class="ui-state-default ui-state-disabled"> </span></td>';
+ return html;
+ }
+
+ if (enabled) {
+ html = '<td class="ui-timepicker-minute-cell" data-timepicker-instance-id="#' + inst.id.replace(/\\\\/g,"\\") + '" data-minute="' + minute.toString() + '" >' +
+ '<a class="ui-state-default ' +
+ (minute == inst.minutes ? 'ui-state-active' : '') +
+ '" >' +
+ displayText +
+ '</a></td>';
+ }
+ else {
+
+ html = '<td>' +
+ '<span class="ui-state-default ui-state-disabled" >' +
+ displayText +
+ '</span>' +
+ '</td>';
+ }
+ return html;
+ },
+
+
+ /* Enable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _enableTimepicker: function(target) {
+ var $target = $(target),
+ target_id = $target.attr('id'),
+ inst = $.data(target, PROP_NAME);
+
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = false;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = false; }).end();
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().removeClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target_id ? null : value); }); // delete entry
+ },
+
+ /* Disable the time picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _disableTimepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = true;
+
+ inst.trigger.filter('button').
+ each(function() { this.disabled = true; }).end();
+
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().addClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = $target.attr('id');
+ },
+
+ /* Is the first field in a jQuery collection disabled as a timepicker?
+ @param target_id element - the target input field or division or span
+ @return boolean - true if disabled, false if enabled */
+ _isDisabledTimepicker: function (target_id) {
+ if ( ! target_id) { return false; }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] == target_id) { return true; }
+ }
+ return false;
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function (inst, offset, isFixed) {
+ var tpWidth = inst.tpDiv.outerWidth();
+ var tpHeight = inst.tpDiv.outerHeight();
+ var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+ var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+ var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft();
+ var viewHeight = document.documentElement.clientHeight + $(document).scrollTop();
+
+ offset.left -= (this._get(inst, 'isRTL') ? (tpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= Math.min(offset.left, (offset.left + tpWidth > viewWidth && viewWidth > tpWidth) ?
+ Math.abs(offset.left + tpWidth - viewWidth) : 0);
+ offset.top -= Math.min(offset.top, (offset.top + tpHeight > viewHeight && viewHeight > tpHeight) ?
+ Math.abs(tpHeight + inputHeight) : 0);
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function (obj) {
+ var inst = this._getInst(obj);
+ var isRTL = this._get(inst, 'isRTL');
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
+ obj = obj[isRTL ? 'previousSibling' : 'nextSibling'];
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Retrieve the size of left and top borders for an element.
+ @param elem (jQuery object) the element of interest
+ @return (number[2]) the left and top borders */
+ _getBorders: function (elem) {
+ var convert = function (value) {
+ return { thin: 1, medium: 2, thick: 3}[value] || value;
+ };
+ return [parseFloat(convert(elem.css('border-left-width'))),
+ parseFloat(convert(elem.css('border-top-width')))];
+ },
+
+
+ /* Close time picker if clicked elsewhere. */
+ _checkExternalClick: function (event) {
+ if (!$.timepicker._curInst) { return; }
+ var $target = $(event.target);
+ if ($target[0].id != $.timepicker._mainDivId &&
+ $target.parents('#' + $.timepicker._mainDivId).length == 0 &&
+ !$target.hasClass($.timepicker.markerClassName) &&
+ !$target.hasClass($.timepicker._triggerClass) &&
+ $.timepicker._timepickerShowing && !($.timepicker._inDialog && $.blockUI))
+ $.timepicker._hideTimepicker();
+ },
+
+ /* Hide the time picker from view.
+ @param input element - the input field attached to the time picker */
+ _hideTimepicker: function (input) {
+ var inst = this._curInst;
+ if (!inst || (input && inst != $.data(input, PROP_NAME))) { return; }
+ if (this._timepickerShowing) {
+ var showAnim = this._get(inst, 'showAnim');
+ var duration = this._get(inst, 'duration');
+ var postProcess = function () {
+ $.timepicker._tidyDialog(inst);
+ this._curInst = null;
+ };
+ if ($.effects && $.effects[showAnim]) {
+ inst.tpDiv.hide(showAnim, $.timepicker._get(inst, 'showOptions'), duration, postProcess);
+ }
+ else {
+ inst.tpDiv[(showAnim == 'slideDown' ? 'slideUp' :
+ (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess);
+ }
+ if (!showAnim) { postProcess(); }
+ var onClose = this._get(inst, 'onClose');
+ if (onClose) {
+ onClose.apply(
+ (inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
+ }
+ this._timepickerShowing = false;
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+ if ($.blockUI) {
+ $.unblockUI();
+ $('body').append(this.tpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ },
+
+
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function (inst) {
+ inst.tpDiv.removeClass(this._dialogClass).unbind('.ui-timepicker');
+ },
+
+ /* Retrieve the instance data for the target control.
+ @param target element - the target input field or division or span
+ @return object - the associated instance data
+ @throws error if a jQuery problem getting data */
+ _getInst: function (target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw 'Missing instance data for this timepicker';
+ }
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function (inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing time and initialise time picker. */
+ _setTimeFromField: function (inst) {
+ if (inst.input.val() == inst.lastVal) { return; }
+ var defaultTime = this._get(inst, 'defaultTime');
+
+ var timeToParse = defaultTime == 'now' ? this._getCurrentTimeRounded(inst) : defaultTime;
+ if ((inst.inline == false) && (inst.input.val() != '')) { timeToParse = inst.input.val() }
+
+ if (timeToParse instanceof Date) {
+ inst.hours = timeToParse.getHours();
+ inst.minutes = timeToParse.getMinutes();
+ } else {
+ var timeVal = inst.lastVal = timeToParse;
+ if (timeToParse == '') {
+ inst.hours = -1;
+ inst.minutes = -1;
+ } else {
+ var time = this.parseTime(inst, timeVal);
+ inst.hours = time.hours;
+ inst.minutes = time.minutes;
+ }
+ }
+
+
+ $.timepicker._updateTimepicker(inst);
+ },
+
+ /* Update or retrieve the settings for an existing time picker.
+ @param target element - the target input field or division or span
+ @param name object - the new settings to update or
+ string - the name of the setting to change or retrieve,
+ when retrieving also 'all' for all instance settings or
+ 'defaults' for all global defaults
+ @param value any - the new value for the setting
+ (omit if above is an object or to retrieve a value) */
+ _optionTimepicker: function(target, name, value) {
+ var inst = this._getInst(target);
+ if (arguments.length == 2 && typeof name == 'string') {
+ return (name == 'defaults' ? $.extend({}, $.timepicker._defaults) :
+ (inst ? (name == 'all' ? $.extend({}, inst.settings) :
+ this._get(inst, name)) : null));
+ }
+ var settings = name || {};
+ if (typeof name == 'string') {
+ settings = {};
+ settings[name] = value;
+ }
+ if (inst) {
+ if (this._curInst == inst) {
+ this._hideTimepicker();
+ }
+ extendRemove(inst.settings, settings);
+ this._updateTimepicker(inst);
+ }
+ },
+
+
+ /* Set the time for a jQuery selection.
+ @param target element - the target input field or division or span
+ @param time String - the new time */
+ _setTimeTimepicker: function(target, time) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setTime(inst, time);
+ this._updateTimepicker(inst);
+ this._updateAlternate(inst, time);
+ }
+ },
+
+ /* Set the time directly. */
+ _setTime: function(inst, time, noChange) {
+ var origHours = inst.hours;
+ var origMinutes = inst.minutes;
+ var time = this.parseTime(inst, time);
+ inst.hours = time.hours;
+ inst.minutes = time.minutes;
+
+ if ((origHours != inst.hours || origMinutes != inst.minuts) && !noChange) {
+ inst.input.trigger('change');
+ }
+ this._updateTimepicker(inst);
+ this._updateSelectedValue(inst);
+ },
+
+ /* Return the current time, ready to be parsed, rounded to the closest 5 minute */
+ _getCurrentTimeRounded: function (inst) {
+ var currentTime = new Date(),
+ currentMinutes = currentTime.getMinutes(),
+ // round to closest 5
+ adjustedMinutes = Math.round( currentMinutes / 5 ) * 5;
+ currentTime.setMinutes(adjustedMinutes);
+ return currentTime;
+ },
+
+ /*
+ * Parse a time string into hours and minutes
+ */
+ parseTime: function (inst, timeVal) {
+ var retVal = new Object();
+ retVal.hours = -1;
+ retVal.minutes = -1;
+
+ var timeSeparator = this._get(inst, 'timeSeparator'),
+ amPmText = this._get(inst, 'amPmText'),
+ showHours = this._get(inst, 'showHours'),
+ showMinutes = this._get(inst, 'showMinutes'),
+ optionalMinutes = this._get(inst, 'optionalMinutes'),
+ showPeriod = (this._get(inst, 'showPeriod') == true),
+ p = timeVal.indexOf(timeSeparator);
+
+ // check if time separator found
+ if (p != -1) {
+ retVal.hours = parseInt(timeVal.substr(0, p), 10);
+ retVal.minutes = parseInt(timeVal.substr(p + 1), 10);
+ }
+ // check for hours only
+ else if ( (showHours) && ( !showMinutes || optionalMinutes ) ) {
+ retVal.hours = parseInt(timeVal, 10);
+ }
+ // check for minutes only
+ else if ( ( ! showHours) && (showMinutes) ) {
+ retVal.minutes = parseInt(timeVal, 10);
+ }
+
+ if (showHours) {
+ var timeValUpper = timeVal.toUpperCase();
+ if ((retVal.hours < 12) && (showPeriod) && (timeValUpper.indexOf(amPmText[1].toUpperCase()) != -1)) {
+ retVal.hours += 12;
+ }
+ // fix for 12 AM
+ if ((retVal.hours == 12) && (showPeriod) && (timeValUpper.indexOf(amPmText[0].toUpperCase()) != -1)) {
+ retVal.hours = 0;
+ }
+ }
+
+ return retVal;
+ },
+
+ selectNow: function(e) {
+
+ var id = $(e.target).attr("data-timepicker-instance-id"),
+ $target = $(id),
+ inst = this._getInst($target[0]);
+
+ //if (!inst || (input && inst != $.data(input, PROP_NAME))) { return; }
+ var currentTime = new Date();
+ inst.hours = currentTime.getHours();
+ inst.minutes = currentTime.getMinutes();
+ this._updateSelectedValue(inst);
+ this._updateTimepicker(inst);
+ this._hideTimepicker();
+ },
+
+ deselectTime: function(e) {
+ var id = $(e.target).attr("data-timepicker-instance-id"),
+ $target = $(id),
+ inst = this._getInst($target[0]);
+ inst.hours = -1;
+ inst.minutes = -1;
+ this._updateSelectedValue(inst);
+ this._hideTimepicker();
+ },
+
+
+ selectHours: function (event) {
+ var $td = $(event.currentTarget),
+ id = $td.attr("data-timepicker-instance-id"),
+ newHours = $td.attr("data-hour"),
+ fromDoubleClick = event.data.fromDoubleClick,
+ $target = $(id),
+ inst = this._getInst($target[0]),
+ showMinutes = (this._get(inst, 'showMinutes') == true);
+
+ // don't select if disabled
+ if ( $.timepicker._isDisabledTimepicker($target.attr('id')) ) { return false }
+
+ $td.parents('.ui-timepicker-hours:first').find('a').removeClass('ui-state-active');
+ $td.children('a').addClass('ui-state-active');
+ inst.hours = newHours;
+
+ // added for onMinuteShow callback
+ var onMinuteShow = this._get(inst, 'onMinuteShow');
+ if (onMinuteShow) {
+ // this will trigger a callback on selected hour to make sure selected minute is allowed.
+ this._updateMinuteDisplay(inst);
+ }
+
+ this._updateSelectedValue(inst);
+
+ inst._hoursClicked = true;
+ if ((inst._minutesClicked) || (fromDoubleClick) || (showMinutes == false)) {
+ $.timepicker._hideTimepicker();
+ }
+ // return false because if used inline, prevent the url to change to a hashtag
+ return false;
+ },
+
+ selectMinutes: function (event) {
+ var $td = $(event.currentTarget),
+ id = $td.attr("data-timepicker-instance-id"),
+ newMinutes = $td.attr("data-minute"),
+ fromDoubleClick = event.data.fromDoubleClick,
+ $target = $(id),
+ inst = this._getInst($target[0]),
+ showHours = (this._get(inst, 'showHours') == true);
+
+ // don't select if disabled
+ if ( $.timepicker._isDisabledTimepicker($target.attr('id')) ) { return false }
+
+ $td.parents('.ui-timepicker-minutes:first').find('a').removeClass('ui-state-active');
+ $td.children('a').addClass('ui-state-active');
+
+ inst.minutes = newMinutes;
+ this._updateSelectedValue(inst);
+
+ inst._minutesClicked = true;
+ if ((inst._hoursClicked) || (fromDoubleClick) || (showHours == false)) {
+ $.timepicker._hideTimepicker();
+ // return false because if used inline, prevent the url to change to a hashtag
+ return false;
+ }
+
+ // return false because if used inline, prevent the url to change to a hashtag
+ return false;
+ },
+
+ _updateSelectedValue: function (inst) {
+ var newTime = this._getParsedTime(inst);
+ if (inst.input) {
+ inst.input.val(newTime);
+ inst.input.trigger('change');
+ }
+ var onSelect = this._get(inst, 'onSelect');
+ if (onSelect) { onSelect.apply((inst.input ? inst.input[0] : null), [newTime, inst]); } // trigger custom callback
+ this._updateAlternate(inst, newTime);
+ return newTime;
+ },
+
+ /* this function process selected time and return it parsed according to instance options */
+ _getParsedTime: function(inst) {
+
+ if (inst.hours == -1 && inst.minutes == -1) {
+ return '';
+ }
+
+ if ((inst.hours < 0) || (inst.hours > 23)) { inst.hours = 12; }
+ if ((inst.minutes < 0) || (inst.minutes > 59)) { inst.minutes = 0; }
+
+ var period = "",
+ showPeriod = (this._get(inst, 'showPeriod') == true),
+ showLeadingZero = (this._get(inst, 'showLeadingZero') == true),
+ showHours = (this._get(inst, 'showHours') == true),
+ showMinutes = (this._get(inst, 'showMinutes') == true),
+ optionalMinutes = (this._get(inst, 'optionalMinutes') == true),
+ amPmText = this._get(inst, 'amPmText'),
+ selectedHours = inst.hours ? inst.hours : 0,
+ selectedMinutes = inst.minutes ? inst.minutes : 0,
+ displayHours = selectedHours ? selectedHours : 0,
+ parsedTime = '';
+
+ if (showPeriod) {
+ if (inst.hours == 0) {
+ displayHours = 12;
+ }
+ if (inst.hours < 12) {
+ period = amPmText[0];
+ }
+ else {
+ period = amPmText[1];
+ if (displayHours > 12) {
+ displayHours -= 12;
+ }
+ }
+ }
+
+ var h = displayHours.toString();
+ if (showLeadingZero && (displayHours < 10)) { h = '0' + h; }
+
+ var m = selectedMinutes.toString();
+ if (selectedMinutes < 10) { m = '0' + m; }
+
+ if (showHours) {
+ parsedTime += h;
+ }
+ if (showHours && showMinutes && (!optionalMinutes || m != 0)) {
+ parsedTime += this._get(inst, 'timeSeparator');
+ }
+ if (showMinutes && (!optionalMinutes || m != 0)) {
+ parsedTime += m;
+ }
+ if (showHours) {
+ if (period.length > 0) { parsedTime += this._get(inst, 'periodSeparator') + period; }
+ }
+
+ return parsedTime;
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst, newTime) {
+ var altField = this._get(inst, 'altField');
+ if (altField) { // update alternate field too
+ $(altField).each(function(i,e) {
+ $(e).val(newTime);
+ });
+ }
+ },
+
+ /* This might look unused but it's called by the $.fn.timepicker function with param getTime */
+ /* added v 0.2.3 - gitHub issue #5 - Thanks edanuff */
+ _getTimeTimepicker : function(input) {
+ var inst = this._getInst(input);
+ return this._getParsedTime(inst);
+ },
+ _getHourTimepicker: function(input) {
+ var inst = this._getInst(input);
+ if ( inst == undefined) { return -1; }
+ return inst.hours;
+ },
+ _getMinuteTimepicker: function(input) {
+ var inst= this._getInst(input);
+ if ( inst == undefined) { return -1; }
+ return inst.minutes;
+ }
+
+ });
+
+
+
+ /* Invoke the timepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new timepicker functionality
+ @return jQuery object */
+ $.fn.timepicker = function (options) {
+
+ /* Initialise the time picker. */
+ if (!$.timepicker.initialized) {
+ $(document).mousedown($.timepicker._checkExternalClick).
+ find('body').append($.timepicker.tpDiv);
+ $.timepicker.initialized = true;
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && (options == 'getTime' || options == 'getHour' || options == 'getMinute' ))
+ return $.timepicker['_' + options + 'Timepicker'].
+ apply($.timepicker, [this[0]].concat(otherArgs));
+ if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
+ return $.timepicker['_' + options + 'Timepicker'].
+ apply($.timepicker, [this[0]].concat(otherArgs));
+ return this.each(function () {
+ typeof options == 'string' ?
+ $.timepicker['_' + options + 'Timepicker'].
+ apply($.timepicker, [this].concat(otherArgs)) :
+ $.timepicker._attachTimepicker(this, options);
+ });
+ };
+
+ /* jQuery extend now ignores nulls! */
+ function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props)
+ if (props[name] == null || props[name] == undefined)
+ target[name] = props[name];
+ return target;
+ };
+
+ $.timepicker = new Timepicker(); // singleton instance
+ $.timepicker.initialized = false;
+ $.timepicker.uuid = new Date().getTime();
+ $.timepicker.version = "0.2.9";
+
+ // Workaround for #4055
+ // Add another global to avoid noConflict issues with inline event handlers
+ window['TP_jQuery_' + tpuuid] = $;
+
+})(jQuery);
diff --git a/gstudio/static/gstudio/js/markitup/jquery.markitup.js b/gstudio/static/gstudio/js/markitup/jquery.markitup.js new file mode 100644 index 0000000..8c69b78 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/jquery.markitup.js @@ -0,0 +1,574 @@ +// ---------------------------------------------------------------------------- +// markItUp! Universal MarkUp Engine, JQuery plugin +// v 1.1.x +// Dual licensed under the MIT and GPL licenses. +// ---------------------------------------------------------------------------- +// Copyright (C) 2007-2010 Jay Salvat +// http://markitup.jaysalvat.com/ +// ---------------------------------------------------------------------------- +// Permission is hereby granted, free of charge, to any person obtaining a copy +// of this software and associated documentation files (the "Software"), to deal +// in the Software without restriction, including without limitation the rights +// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the Software is +// furnished to do so, subject to the following conditions: +// +// The above copyright notice and this permission notice shall be included in +// all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +// THE SOFTWARE. +// ---------------------------------------------------------------------------- +(function($) { + $.fn.markItUp = function(settings, extraSettings) { + var options, ctrlKey, shiftKey, altKey; + ctrlKey = shiftKey = altKey = false; + + options = { id: '', + nameSpace: '', + root: '', + previewInWindow: '', // 'width=800, height=600, resizable=yes, scrollbars=yes' + previewAutoRefresh: true, + previewPosition: 'after', + previewTemplatePath: '~/templates/preview.html', + previewParserPath: '', + previewParserVar: 'data', + resizeHandle: true, + beforeInsert: '', + afterInsert: '', + onEnter: {}, + onShiftEnter: {}, + onCtrlEnter: {}, + onTab: {}, + markupSet: [ { /* set */ } ] + }; + $.extend(options, settings, extraSettings); + + // compute markItUp! path + if (!options.root) { + $('script').each(function(a, tag) { + miuScript = $(tag).get(0).src.match(/(.*)jquery\.markitup(\.pack)?\.js$/); + if (miuScript !== null) { + options.root = miuScript[1]; + } + }); + } + + return this.each(function() { + var $$, textarea, levels, scrollPosition, caretPosition, caretOffset, + clicked, hash, header, footer, previewWindow, template, iFrame, abort; + $$ = $(this); + textarea = this; + levels = []; + abort = false; + scrollPosition = caretPosition = 0; + caretOffset = -1; + + options.previewParserPath = localize(options.previewParserPath); + options.previewTemplatePath = localize(options.previewTemplatePath); + + // apply the computed path to ~/ + function localize(data, inText) { + if (inText) { + return data.replace(/("|')~\//g, "$1"+options.root); + } + return data.replace(/^~\//, options.root); + } + + // init and build editor + function init() { + id = ''; nameSpace = ''; + if (options.id) { + id = 'id="'+options.id+'"'; + } else if ($$.attr("id")) { + id = 'id="markItUp'+($$.attr("id").substr(0, 1).toUpperCase())+($$.attr("id").substr(1))+'"'; + + } + if (options.nameSpace) { + nameSpace = 'class="'+options.nameSpace+'"'; + } + $$.wrap('<div '+nameSpace+'></div>'); + $$.wrap('<div '+id+' class="markItUp"></div>'); + $$.wrap('<div class="markItUpContainer"></div>'); + $$.addClass("markItUpEditor"); + + // add the header before the textarea + header = $('<div class="markItUpHeader"></div>').insertBefore($$); + $(dropMenus(options.markupSet)).appendTo(header); + + // add the footer after the textarea + footer = $('<div class="markItUpFooter"></div>').insertAfter($$); + + // add the resize handle after textarea + if (options.resizeHandle === true && $.browser.safari !== true) { + resizeHandle = $('<div class="markItUpResizeHandle"></div>') + .insertAfter($$) + .bind("mousedown", function(e) { + var h = $$.height(), y = e.clientY, mouseMove, mouseUp; + mouseMove = function(e) { + $$.css("height", Math.max(20, e.clientY+h-y)+"px"); + return false; + }; + mouseUp = function(e) { + $("html").unbind("mousemove", mouseMove).unbind("mouseup", mouseUp); + return false; + }; + $("html").bind("mousemove", mouseMove).bind("mouseup", mouseUp); + }); + footer.append(resizeHandle); + } + + // listen key events + $$.keydown(keyPressed).keyup(keyPressed); + + // bind an event to catch external calls + $$.bind("insertion", function(e, settings) { + if (settings.target !== false) { + get(); + } + if (textarea === $.markItUp.focused) { + markup(settings); + } + }); + + // remember the last focus + $$.focus(function() { + $.markItUp.focused = this; + }); + } + + // recursively build header with dropMenus from markupset + function dropMenus(markupSet) { + var ul = $('<ul></ul>'), i = 0; + $('li:hover > ul', ul).css('display', 'block'); + $.each(markupSet, function() { + var button = this, t = '', title, li, j; + title = (button.key) ? (button.name||'')+' [Ctrl+'+button.key+']' : (button.name||''); + key = (button.key) ? 'accesskey="'+button.key+'"' : ''; + if (button.separator) { + li = $('<li class="markItUpSeparator">'+(button.separator||'')+'</li>').appendTo(ul); + } else { + i++; + for (j = levels.length -1; j >= 0; j--) { + t += levels[j]+"-"; + } + li = $('<li class="markItUpButton markItUpButton'+t+(i)+' '+(button.className||'')+'"><a href="" '+key+' title="'+title+'">'+(button.name||'')+'</a></li>') + .bind("contextmenu", function() { // prevent contextmenu on mac and allow ctrl+click + return false; + }).click(function() { + return false; + }).bind("focusin", function(){ + $$.focus(); + }).mousedown(function() { + if (button.call) { + eval(button.call)(); + } + setTimeout(function() { markup(button) },1); + return false; + }).hover(function() { + $('> ul', this).show(); + $(document).one('click', function() { // close dropmenu if click outside + $('ul ul', header).hide(); + } + ); + }, function() { + $('> ul', this).hide(); + } + ).appendTo(ul); + if (button.dropMenu) { + levels.push(i); + $(li).addClass('markItUpDropMenu').append(dropMenus(button.dropMenu)); + } + } + }); + levels.pop(); + return ul; + } + + // markItUp! markups + function magicMarkups(string) { + if (string) { + string = string.toString(); + string = string.replace(/\(\!\(([\s\S]*?)\)\!\)/g, + function(x, a) { + var b = a.split('|!|'); + if (altKey === true) { + return (b[1] !== undefined) ? b[1] : b[0]; + } else { + return (b[1] === undefined) ? "" : b[0]; + } + } + ); + // [![prompt]!], [![prompt:!:value]!] + string = string.replace(/\[\!\[([\s\S]*?)\]\!\]/g, + function(x, a) { + var b = a.split(':!:'); + if (abort === true) { + return false; + } + value = prompt(b[0], (b[1]) ? b[1] : ''); + if (value === null) { + abort = true; + } + return value; + } + ); + return string; + } + return ""; + } + + // prepare action + function prepare(action) { + if ($.isFunction(action)) { + action = action(hash); + } + return magicMarkups(action); + } + + // build block to insert + function build(string) { + var openWith = prepare(clicked.openWith); + var placeHolder = prepare(clicked.placeHolder); + var replaceWith = prepare(clicked.replaceWith); + var closeWith = prepare(clicked.closeWith); + if (replaceWith !== "") { + block = openWith + replaceWith + closeWith; + } else if (selection === '' && placeHolder !== '') { + block = openWith + placeHolder + closeWith; + } else { + string = string || selection; + if (string.match(/ $/)) { + block = openWith + string.replace(/ $/, '') + closeWith + ' '; + } else { + block = openWith + string + closeWith; + } + } + return { block:block, + openWith:openWith, + replaceWith:replaceWith, + placeHolder:placeHolder, + closeWith:closeWith + }; + } + + // define markup to insert + function markup(button) { + var len, j, n, i; + hash = clicked = button; + get(); + + $.extend(hash, { line:"", + root:options.root, + textarea:textarea, + selection:(selection||''), + caretPosition:caretPosition, + ctrlKey:ctrlKey, + shiftKey:shiftKey, + altKey:altKey + } + ); + // callbacks before insertion + prepare(options.beforeInsert); + prepare(clicked.beforeInsert); + if (ctrlKey === true && shiftKey === true) { + prepare(clicked.beforeMultiInsert); + } + $.extend(hash, { line:1 }); + + if (ctrlKey === true && shiftKey === true) { + lines = selection.split(/\r?\n/); + for (j = 0, n = lines.length, i = 0; i < n; i++) { + if ($.trim(lines[i]) !== '') { + $.extend(hash, { line:++j, selection:lines[i] } ); + lines[i] = build(lines[i]).block; + } else { + lines[i] = ""; + } + } + string = { block:lines.join('\n')}; + start = caretPosition; + len = string.block.length + (($.browser.opera) ? n-1 : 0); + } else if (ctrlKey === true) { + string = build(selection); + start = caretPosition + string.openWith.length; + len = string.block.length - string.openWith.length - string.closeWith.length; + len = len - (string.block.match(/ $/) ? 1 : 0); + len -= fixIeBug(string.block); + } else if (shiftKey === true) { + string = build(selection); + start = caretPosition; + len = string.block.length; + len -= fixIeBug(string.block); + } else { + string = build(selection); + start = caretPosition + string.block.length ; + len = 0; + start -= fixIeBug(string.block); + } + if ((selection === '' && string.replaceWith === '')) { + caretOffset += fixOperaBug(string.block); + + start = caretPosition + string.openWith.length; + len = string.block.length - string.openWith.length - string.closeWith.length; + + caretOffset = $$.val().substring(caretPosition, $$.val().length).length; + caretOffset -= fixOperaBug($$.val().substring(0, caretPosition)); + } + $.extend(hash, { caretPosition:caretPosition, scrollPosition:scrollPosition } ); + + if (string.block !== selection && abort === false) { + insert(string.block); + set(start, len); + } else { + caretOffset = -1; + } + get(); + + $.extend(hash, { line:'', selection:selection }); + + // callbacks after insertion + if (ctrlKey === true && shiftKey === true) { + prepare(clicked.afterMultiInsert); + } + prepare(clicked.afterInsert); + prepare(options.afterInsert); + + // refresh preview if opened + if (previewWindow && options.previewAutoRefresh) { + refreshPreview(); + } + + // reinit keyevent + shiftKey = altKey = ctrlKey = abort = false; + } + + // Substract linefeed in Opera + function fixOperaBug(string) { + if ($.browser.opera) { + return string.length - string.replace(/\n*/g, '').length; + } + return 0; + } + // Substract linefeed in IE + function fixIeBug(string) { + if ($.browser.msie) { + return string.length - string.replace(/\r/g, '').length; + } + return 0; + } + + // add markup + function insert(block) { + if (document.selection) { + var newSelection = document.selection.createRange(); + newSelection.text = block; + } else { + textarea.value = textarea.value.substring(0, caretPosition) + block + textarea.value.substring(caretPosition + selection.length, textarea.value.length); + } + } + + // set a selection + function set(start, len) { + if (textarea.createTextRange){ + // quick fix to make it work on Opera 9.5 + if ($.browser.opera && $.browser.version >= 9.5 && len == 0) { + return false; + } + range = textarea.createTextRange(); + range.collapse(true); + range.moveStart('character', start); + range.moveEnd('character', len); + range.select(); + } else if (textarea.setSelectionRange ){ + textarea.setSelectionRange(start, start + len); + } + textarea.scrollTop = scrollPosition; + textarea.focus(); + } + + // get the selection + function get() { + textarea.focus(); + + scrollPosition = textarea.scrollTop; + if (document.selection) { + selection = document.selection; + if ($.browser.msie) { // ie + var range = selection.createRange(); + var stored_range = range.duplicate(); + stored_range.moveToElementText(textarea); + stored_range.setEndPoint('EndToEnd', range); + var s = stored_range.text.length - range.text.length; + + caretPosition = s - (textarea.value.substr(0, s).length - textarea.value.substr(0, s).replace(/\r/g, '').length); + selection = range.text; + } else { // opera + caretPosition = textarea.selectionStart; + } + } else { // gecko & webkit + caretPosition = textarea.selectionStart; + selection = textarea.value.substring(caretPosition, textarea.selectionEnd); + } + return selection; + } + + // open preview window + function preview() { + if (!previewWindow || previewWindow.closed) { + if (options.previewInWindow) { + previewWindow = window.open('', 'preview', options.previewInWindow); + $(window).unload(function() { + previewWindow.close(); + }); + } else { + iFrame = $('<iframe class="markItUpPreviewFrame"></iframe>'); + if (options.previewPosition == 'after') { + iFrame.insertAfter(footer); + } else { + iFrame.insertBefore(header); + } + previewWindow = iFrame[iFrame.length - 1].contentWindow || frame[iFrame.length - 1]; + } + } else if (altKey === true) { + if (iFrame) { + iFrame.remove(); + } else { + previewWindow.close(); + } + previewWindow = iFrame = false; + } + if (!options.previewAutoRefresh) { + refreshPreview(); + } + if (options.previewInWindow) { + previewWindow.focus(); + } + } + + // refresh Preview window + function refreshPreview() { + renderPreview(); + } + + function renderPreview() { + var phtml; + if (options.previewParserPath !== '') { + $.ajax({ + type: 'POST', + dataType: 'text', + global: false, + url: options.previewParserPath, + data: options.previewParserVar+'='+encodeURIComponent($$.val()), + success: function(data) { + writeInPreview( localize(data, 1) ); + } + }); + } else { + if (!template) { + $.ajax({ + url: options.previewTemplatePath, + dataType: 'text', + global: false, + success: function(data) { + writeInPreview( localize(data, 1).replace(/<!-- content -->/g, $$.val()) ); + } + }); + } + } + return false; + } + + function writeInPreview(data) { + if (previewWindow.document) { + try { + sp = previewWindow.document.documentElement.scrollTop + } catch(e) { + sp = 0; + } + previewWindow.document.open(); + previewWindow.document.write(data); + previewWindow.document.close(); + previewWindow.document.documentElement.scrollTop = sp; + } + } + + // set keys pressed + function keyPressed(e) { + shiftKey = e.shiftKey; + altKey = e.altKey; + ctrlKey = (!(e.altKey && e.ctrlKey)) ? e.ctrlKey : false; + + if (e.type === 'keydown') { + if (ctrlKey === true) { + li = $("a[accesskey="+String.fromCharCode(e.keyCode)+"]", header).parent('li'); + if (li.length !== 0) { + ctrlKey = false; + setTimeout(function() { + li.triggerHandler('mousedown'); + },1); + return false; + } + } + if (e.keyCode === 13 || e.keyCode === 10) { // Enter key + if (ctrlKey === true) { // Enter + Ctrl + ctrlKey = false; + markup(options.onCtrlEnter); + return options.onCtrlEnter.keepDefault; + } else if (shiftKey === true) { // Enter + Shift + shiftKey = false; + markup(options.onShiftEnter); + return options.onShiftEnter.keepDefault; + } else { // only Enter + markup(options.onEnter); + return options.onEnter.keepDefault; + } + } + if (e.keyCode === 9) { // Tab key + if (shiftKey == true || ctrlKey == true || altKey == true) { + return false; + } + if (caretOffset !== -1) { + get(); + caretOffset = $$.val().length - caretOffset; + set(caretOffset, 0); + caretOffset = -1; + return false; + } else { + markup(options.onTab); + return options.onTab.keepDefault; + } + } + } + } + + init(); + }); + }; + + $.fn.markItUpRemove = function() { + return this.each(function() { + var $$ = $(this).unbind().removeClass('markItUpEditor'); + $$.parent('div').parent('div.markItUp').parent('div').replaceWith($$); + } + ); + }; + + $.markItUp = function(settings) { + var options = { target:false }; + $.extend(options, settings); + if (options.target) { + return $(options.target).each(function() { + $(this).focus(); + $(this).trigger('insertion', [options]); + }); + } else { + $('textarea').trigger('insertion', [options]); + } + }; +})(jQuery); diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/bold.png b/gstudio/static/gstudio/js/markitup/sets/html/images/bold.png Binary files differnew file mode 100644 index 0000000..889ae80 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/bold.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/clean.png b/gstudio/static/gstudio/js/markitup/sets/html/images/clean.png Binary files differnew file mode 100644 index 0000000..7e7cefb --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/clean.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/h1.png b/gstudio/static/gstudio/js/markitup/sets/html/images/h1.png Binary files differnew file mode 100644 index 0000000..9c122e9 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/h1.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/h2.png b/gstudio/static/gstudio/js/markitup/sets/html/images/h2.png Binary files differnew file mode 100644 index 0000000..fbd8765 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/h2.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/h3.png b/gstudio/static/gstudio/js/markitup/sets/html/images/h3.png Binary files differnew file mode 100644 index 0000000..c7836cf --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/h3.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/h4.png b/gstudio/static/gstudio/js/markitup/sets/html/images/h4.png Binary files differnew file mode 100644 index 0000000..4e929ea --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/h4.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/h5.png b/gstudio/static/gstudio/js/markitup/sets/html/images/h5.png Binary files differnew file mode 100644 index 0000000..30cabeb --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/h5.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/h6.png b/gstudio/static/gstudio/js/markitup/sets/html/images/h6.png Binary files differnew file mode 100644 index 0000000..058170a --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/h6.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/image.png b/gstudio/static/gstudio/js/markitup/sets/html/images/image.png Binary files differnew file mode 100644 index 0000000..fc3c393 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/image.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/italic.png b/gstudio/static/gstudio/js/markitup/sets/html/images/italic.png Binary files differnew file mode 100644 index 0000000..8482ac8 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/italic.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/link.png b/gstudio/static/gstudio/js/markitup/sets/html/images/link.png Binary files differnew file mode 100644 index 0000000..25eacb7 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/link.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/list-bullet.png b/gstudio/static/gstudio/js/markitup/sets/html/images/list-bullet.png Binary files differnew file mode 100644 index 0000000..4a8672b --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/list-bullet.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/list-item.png b/gstudio/static/gstudio/js/markitup/sets/html/images/list-item.png Binary files differnew file mode 100644 index 0000000..8cb4d69 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/list-item.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/list-numeric.png b/gstudio/static/gstudio/js/markitup/sets/html/images/list-numeric.png Binary files differnew file mode 100644 index 0000000..33b0b8d --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/list-numeric.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/paragraph.png b/gstudio/static/gstudio/js/markitup/sets/html/images/paragraph.png Binary files differnew file mode 100644 index 0000000..95704fb --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/paragraph.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/picture.png b/gstudio/static/gstudio/js/markitup/sets/html/images/picture.png Binary files differnew file mode 100644 index 0000000..4a158fe --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/picture.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/preview.png b/gstudio/static/gstudio/js/markitup/sets/html/images/preview.png Binary files differnew file mode 100644 index 0000000..a9925a0 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/preview.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/images/stroke.png b/gstudio/static/gstudio/js/markitup/sets/html/images/stroke.png Binary files differnew file mode 100644 index 0000000..612058a --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/images/stroke.png diff --git a/gstudio/static/gstudio/js/markitup/sets/html/set.js b/gstudio/static/gstudio/js/markitup/sets/html/set.js new file mode 100644 index 0000000..1474286 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/set.js @@ -0,0 +1,38 @@ +// ---------------------------------------------------------------------------- +// markItUp! +// ---------------------------------------------------------------------------- +// Copyright (C) 2008 Jay Salvat +// http://markitup.jaysalvat.com/ +// ---------------------------------------------------------------------------- +// Html tags +// http://en.wikipedia.org/wiki/html +// ---------------------------------------------------------------------------- +// Basic set. Feel free to add more tags +// ---------------------------------------------------------------------------- +mySettings = { + onShiftEnter: {keepDefault:false, replaceWith:'<br />\n'}, + onCtrlEnter: {keepDefault:false, openWith:'\n<p>', closeWith:'</p>\n'}, + onTab: {keepDefault:false, openWith:' '}, + markupSet: [ + {name:'Heading 1', key:'1', openWith:'<h1(!( class="[![Class]!]")!)>', closeWith:'</h1>', placeHolder:'Your title here...' }, + {name:'Heading 2', key:'2', openWith:'<h2(!( class="[![Class]!]")!)>', closeWith:'</h2>', placeHolder:'Your title here...' }, + {name:'Heading 3', key:'3', openWith:'<h3(!( class="[![Class]!]")!)>', closeWith:'</h3>', placeHolder:'Your title here...' }, + {name:'Heading 4', key:'4', openWith:'<h4(!( class="[![Class]!]")!)>', closeWith:'</h4>', placeHolder:'Your title here...' }, + {name:'Heading 5', key:'5', openWith:'<h5(!( class="[![Class]!]")!)>', closeWith:'</h5>', placeHolder:'Your title here...' }, + {name:'Heading 6', key:'6', openWith:'<h6(!( class="[![Class]!]")!)>', closeWith:'</h6>', placeHolder:'Your title here...' }, + {name:'Paragraph', openWith:'<p(!( class="[![Class]!]")!)>', closeWith:'</p>' }, + {separator:'---------------' }, + {name:'Bold', key:'B', openWith:'(!(<strong>|!|<b>)!)', closeWith:'(!(</strong>|!|</b>)!)' }, + {name:'Italic', key:'I', openWith:'(!(<em>|!|<i>)!)', closeWith:'(!(</em>|!|</i>)!)' }, + {name:'Stroke through', key:'S', openWith:'<del>', closeWith:'</del>' }, + {separator:'---------------' }, + {name:'Ul', openWith:'<ul>\n', closeWith:'</ul>\n' }, + {name:'Ol', openWith:'<ol>\n', closeWith:'</ol>\n' }, + {name:'Li', openWith:'<li>', closeWith:'</li>' }, + {separator:'---------------' }, + {name:'Picture', key:'P', replaceWith:'<img src="[![Source:!:http://]!]" alt="[![Alternative text]!]" />' }, + {name:'Link', key:'L', openWith:'<a href="[![Link:!:http://]!]"(!( title="[![Title]!]")!)>', closeWith:'</a>', placeHolder:'Your text to link...' }, + {separator:'---------------' }, + {name:'Clean', className:'clean', replaceWith:function(markitup) { return markitup.selection.replace(/<(.*?)>/g, "") } } + ] +}
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/markitup/sets/html/style.css b/gstudio/static/gstudio/js/markitup/sets/html/style.css new file mode 100644 index 0000000..817e503 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/html/style.css @@ -0,0 +1,59 @@ +/* ------------------------------------------------------------------- +// markItUp! +// By Jay Salvat - http://markitup.jaysalvat.com/ +// ------------------------------------------------------------------*/ +.markItUp .markItUpButton1 a { + background-image:url(images/h1.png); +} +.markItUp .markItUpButton2 a { + background-image:url(images/h2.png); +} +.markItUp .markItUpButton3 a { + background-image:url(images/h3.png); +} +.markItUp .markItUpButton4 a { + background-image:url(images/h4.png); +} +.markItUp .markItUpButton5 a { + background-image:url(images/h5.png); +} +.markItUp .markItUpButton6 a { + background-image:url(images/h6.png); +} +.markItUp .markItUpButton7 a { + background-image:url(images/paragraph.png); +} + +.markItUp .markItUpButton8 a { + background-image:url(images/bold.png); +} +.markItUp .markItUpButton9 a { + background-image:url(images/italic.png); +} +.markItUp .markItUpButton10 a { + background-image:url(images/stroke.png); +} + +.markItUp .markItUpButton11 a { + background-image:url(images/list-bullet.png); +} +.markItUp .markItUpButton12 a { + background-image:url(images/list-numeric.png); +} +.markItUp .markItUpButton13 a { + background-image:url(images/list-item.png); +} + +.markItUp .markItUpButton14 a { + background-image:url(images/picture.png); +} +.markItUp .markItUpButton15 a { + background-image:url(images/link.png); +} + +.markItUp .clean a { + background-image:url(images/clean.png); +} +.markItUp .preview a { + background-image:url(images/preview.png); +}
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/bold.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/bold.png Binary files differnew file mode 100644 index 0000000..889ae80 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/bold.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/code.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/code.png Binary files differnew file mode 100644 index 0000000..63fe6ce --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/code.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/h1.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/h1.png Binary files differnew file mode 100644 index 0000000..9c122e9 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/h1.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/h2.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/h2.png Binary files differnew file mode 100644 index 0000000..fbd8765 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/h2.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/h3.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/h3.png Binary files differnew file mode 100644 index 0000000..c7836cf --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/h3.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/h4.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/h4.png Binary files differnew file mode 100644 index 0000000..4e929ea --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/h4.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/h5.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/h5.png Binary files differnew file mode 100644 index 0000000..30cabeb --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/h5.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/h6.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/h6.png Binary files differnew file mode 100644 index 0000000..058170a --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/h6.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/italic.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/italic.png Binary files differnew file mode 100644 index 0000000..8482ac8 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/italic.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/link.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/link.png Binary files differnew file mode 100644 index 0000000..25eacb7 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/link.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/list-bullet.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/list-bullet.png Binary files differnew file mode 100644 index 0000000..4a8672b --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/list-bullet.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/list-numeric.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/list-numeric.png Binary files differnew file mode 100644 index 0000000..33b0b8d --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/list-numeric.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/picture.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/picture.png Binary files differnew file mode 100644 index 0000000..4a158fe --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/picture.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/preview.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/preview.png Binary files differnew file mode 100644 index 0000000..a9925a0 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/preview.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/images/quotes.png b/gstudio/static/gstudio/js/markitup/sets/markdown/images/quotes.png Binary files differnew file mode 100644 index 0000000..e54ebeb --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/images/quotes.png diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/set.js b/gstudio/static/gstudio/js/markitup/sets/markdown/set.js new file mode 100644 index 0000000..7d87ef7 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/set.js @@ -0,0 +1,49 @@ +// ------------------------------------------------------------------- +// markItUp! +// ------------------------------------------------------------------- +// Copyright (C) 2008 Jay Salvat +// http://markitup.jaysalvat.com/ +// ------------------------------------------------------------------- +// MarkDown tags example +// http://en.wikipedia.org/wiki/Markdown +// http://daringfireball.net/projects/markdown/ +// ------------------------------------------------------------------- +// Feel free to add more tags +// ------------------------------------------------------------------- +mySettings = { + onShiftEnter: {keepDefault:false, openWith:'\n\n'}, + markupSet: [ + {name:'Heading 1', key:'1', placeHolder:'Your title here...', closeWith:function(markItUp) { return miu.markdownTitle(markItUp, '=') } }, + {name:'Heading 2', key:'2', placeHolder:'Your title here...', closeWith:function(markItUp) { return miu.markdownTitle(markItUp, '-') } }, + {name:'Heading 3', key:'3', openWith:'### ', placeHolder:'Your title here...' }, + {name:'Heading 4', key:'4', openWith:'#### ', placeHolder:'Your title here...' }, + {name:'Heading 5', key:'5', openWith:'##### ', placeHolder:'Your title here...' }, + {name:'Heading 6', key:'6', openWith:'###### ', placeHolder:'Your title here...' }, + {separator:'---------------' }, + {name:'Bold', key:'B', openWith:'**', closeWith:'**'}, + {name:'Italic', key:'I', openWith:'_', closeWith:'_'}, + {separator:'---------------' }, + {name:'Bulleted List', openWith:'- ' }, + {name:'Numeric List', openWith:function(markItUp) { + return markItUp.line+'. '; + }}, + {separator:'---------------' }, + {name:'Picture', key:'P', replaceWith:'![[![Alternative text]!]]([![Url:!:http://]!] "[![Title]!]")'}, + {name:'Link', key:'L', openWith:'[', closeWith:']([![Url:!:http://]!] "[![Title]!]")', placeHolder:'Your text to link here...' }, + {separator:'---------------'}, + {name:'Quotes', openWith:'> '}, + {name:'Code Block / Code', openWith:'(!(\t|!|`)!)', closeWith:'(!(`)!)'} + ] +} + +// mIu nameSpace to avoid conflict. +miu = { + markdownTitle: function(markItUp, char) { + heading = ''; + n = $.trim(markItUp.selection||markItUp.placeHolder).length; + for(i = 0; i < n; i++) { + heading += char; + } + return '\n'+heading; + } +}
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/markitup/sets/markdown/style.css b/gstudio/static/gstudio/js/markitup/sets/markdown/style.css new file mode 100644 index 0000000..03c3aea --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/markdown/style.css @@ -0,0 +1,54 @@ +/* ------------------------------------------------------------------- +// markItUp! +// By Jay Salvat - http://markitup.jaysalvat.com/ +// ------------------------------------------------------------------*/ +.markItUp .markItUpButton1 a { + background-image:url(images/h1.png); +} +.markItUp .markItUpButton2 a { + background-image:url(images/h2.png); +} +.markItUp .markItUpButton3 a { + background-image:url(images/h3.png); +} +.markItUp .markItUpButton4 a { + background-image:url(images/h4.png); +} +.markItUp .markItUpButton5 a { + background-image:url(images/h5.png); +} +.markItUp .markItUpButton6 a { + background-image:url(images/h6.png); +} + +.markItUp .markItUpButton7 a { + background-image:url(images/bold.png); +} +.markItUp .markItUpButton8 a { + background-image:url(images/italic.png); +} + +.markItUp .markItUpButton9 a { + background-image:url(images/list-bullet.png); +} +.markItUp .markItUpButton10 a { + background-image:url(images/list-numeric.png); +} + +.markItUp .markItUpButton11 a { + background-image:url(images/picture.png); +} +.markItUp .markItUpButton12 a { + background-image:url(images/link.png); +} + +.markItUp .markItUpButton13 a { + background-image:url(images/quotes.png); +} +.markItUp .markItUpButton14 a { + background-image:url(images/code.png); +} + +.markItUp .preview a { + background-image:url(images/preview.png); +}
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/bold.png b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/bold.png Binary files differnew file mode 100644 index 0000000..889ae80 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/bold.png diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/code.png b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/code.png Binary files differnew file mode 100644 index 0000000..63fe6ce --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/code.png diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h1.png b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h1.png Binary files differnew file mode 100644 index 0000000..9c122e9 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h1.png diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h2.png b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h2.png Binary files differnew file mode 100644 index 0000000..fbd8765 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h2.png diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h3.png b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h3.png Binary files differnew file mode 100644 index 0000000..c7836cf --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h3.png diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h4.png b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h4.png Binary files differnew file mode 100644 index 0000000..4e929ea --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h4.png diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h5.png b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h5.png Binary files differnew file mode 100644 index 0000000..30cabeb --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/h5.png diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/italic.png b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/italic.png Binary files differnew file mode 100644 index 0000000..8482ac8 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/italic.png diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/link.png b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/link.png Binary files differnew file mode 100644 index 0000000..25eacb7 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/link.png diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/list-bullet.png b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/list-bullet.png Binary files differnew file mode 100644 index 0000000..4a8672b --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/list-bullet.png diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/list-numeric.png b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/list-numeric.png Binary files differnew file mode 100644 index 0000000..33b0b8d --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/list-numeric.png diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/picture.png b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/picture.png Binary files differnew file mode 100644 index 0000000..4a158fe --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/picture.png diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/preview.png b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/preview.png Binary files differnew file mode 100644 index 0000000..a9925a0 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/preview.png diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/quotes.png b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/quotes.png Binary files differnew file mode 100644 index 0000000..e54ebeb --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/images/quotes.png diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/set.js b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/set.js new file mode 100644 index 0000000..b468ae8 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/set.js @@ -0,0 +1,48 @@ +// ------------------------------------------------------------------- +// markItUp! +// ------------------------------------------------------------------- +// Copyright (C) 2011 Florent Gallaire <fgallaire@gmail.com> +// License GNU GPLv3 or any later version. +// Copyright (C) 2008 Jay Salvat +// http://markitup.jaysalvat.com/ +// ------------------------------------------------------------------- +// ReStrucuredText tags example +// http://docutils.sourceforge.net/docs/user/rst/quickref.html +// http://docutils.sourceforge.net/docs/user/rst/quickstart.html +// ------------------------------------------------------------------- +// Feel free to add more tags +// ------------------------------------------------------------------- +mySettings = { + onShiftEnter: {keepDefault:false, replaceWith:'\n\n'}, + markupSet: [ + {name:'Heading 1', key:'1', placeHolder:'Your title here...', closeWith:function(markItUp) { return miu.markdownTitle(markItUp, '*') } }, + {name:'Heading 2', key:'2', placeHolder:'Your title here...', closeWith:function(markItUp) { return miu.markdownTitle(markItUp, '=') } }, + {name:'Heading 3', key:'3', placeHolder:'Your title here...', closeWith:function(markItUp) { return miu.markdownTitle(markItUp, '-') } }, + {name:'Heading 4', key:'4', placeHolder:'Your title here...', closeWith:function(markItUp) { return miu.markdownTitle(markItUp, '^') } }, + {name:'Heading 5', key:'5', placeHolder:'Your title here...', closeWith:function(markItUp) { return miu.markdownTitle(markItUp, '"') } }, + {separator:'---------------' }, + {name:'Bold', key:'B', openWith:'**', closeWith:'**'}, + {name:'Italic', key:'I', openWith:'*', closeWith:'*'}, + {separator:'---------------' }, + {name:'Bulleted list', openWith:'- '}, + {name:'Numeric list', openWith:'# '}, + {separator:'---------------' }, + {name:'Picture', key:'P', openWith:'\n\n.. image:: ', closeWith:'\n\n', placeHolder:'Your picture here...'}, + {name:'Link', key:'L', openWith:'`', closeWith:' [![Link:!:http://]!]`_', placeHolder:'Your text to link here...'}, + {separator:'---------------'}, + {name:'Quote', openWith:'\t'}, + {name:'Code', openWith:'``', closeWith:'``'} + ] +} + +// mIu nameSpace to avoid conflict. +miu = { + markdownTitle: function(markItUp, char) { + heading = ''; + n = $.trim(markItUp.selection||markItUp.placeHolder).length; + for(i = 0; i < n; i++) { + heading += char; + } + return '\n'+heading; + } +} diff --git a/gstudio/static/gstudio/js/markitup/sets/restructuredtext/style.css b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/style.css new file mode 100644 index 0000000..3da1a52 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/restructuredtext/style.css @@ -0,0 +1,53 @@ +/* ------------------------------------------------------------------- +// Copyright (C) 2011 Florent Gallaire <fgallaire@gmail.com> +// License GNU GPLv3 or any later version. +// markItUp! +// By Jay Salvat - http://markitup.jaysalvat.com/ +// ------------------------------------------------------------------*/ +.markItUp .markItUpButton1 a { + background-image:url(images/h1.png); +} +.markItUp .markItUpButton2 a { + background-image:url(images/h2.png); +} +.markItUp .markItUpButton3 a { + background-image:url(images/h3.png); +} +.markItUp .markItUpButton4 a { + background-image:url(images/h4.png); +} +.markItUp .markItUpButton5 a { + background-image:url(images/h5.png); +} + +.markItUp .markItUpButton6 a { + background-image:url(images/bold.png); +} +.markItUp .markItUpButton7 a { + background-image:url(images/italic.png); +} + +.markItUp .markItUpButton8 a { + background-image:url(images/list-bullet.png); +} +.markItUp .markItUpButton9 a { + background-image:url(images/list-numeric.png); +} + +.markItUp .markItUpButton10 a { + background-image:url(images/picture.png); +} +.markItUp .markItUpButton11 a { + background-image:url(images/link.png); +} + +.markItUp .markItUpButton12 a { + background-image:url(images/quotes.png); +} +.markItUp .markItUpButton13 a { + background-image:url(images/code.png); +} + +.markItUp .preview a { + background-image:url(images/preview.png); +} diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/bold.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/bold.png Binary files differnew file mode 100644 index 0000000..889ae80 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/bold.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/code.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/code.png Binary files differnew file mode 100644 index 0000000..63fe6ce --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/code.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/h1.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/h1.png Binary files differnew file mode 100644 index 0000000..9c122e9 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/h1.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/h2.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/h2.png Binary files differnew file mode 100644 index 0000000..fbd8765 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/h2.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/h3.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/h3.png Binary files differnew file mode 100644 index 0000000..c7836cf --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/h3.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/h4.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/h4.png Binary files differnew file mode 100644 index 0000000..4e929ea --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/h4.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/h5.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/h5.png Binary files differnew file mode 100644 index 0000000..30cabeb --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/h5.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/h6.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/h6.png Binary files differnew file mode 100644 index 0000000..058170a --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/h6.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/italic.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/italic.png Binary files differnew file mode 100644 index 0000000..8482ac8 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/italic.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/link.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/link.png Binary files differnew file mode 100644 index 0000000..25eacb7 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/link.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/list-bullet.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/list-bullet.png Binary files differnew file mode 100644 index 0000000..4a8672b --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/list-bullet.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/list-numeric.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/list-numeric.png Binary files differnew file mode 100644 index 0000000..33b0b8d --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/list-numeric.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/paragraph.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/paragraph.png Binary files differnew file mode 100644 index 0000000..95704fb --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/paragraph.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/picture.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/picture.png Binary files differnew file mode 100644 index 0000000..4a158fe --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/picture.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/preview.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/preview.png Binary files differnew file mode 100644 index 0000000..a9925a0 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/preview.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/quotes.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/quotes.png Binary files differnew file mode 100644 index 0000000..e54ebeb --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/quotes.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/images/stroke.png b/gstudio/static/gstudio/js/markitup/sets/textile/images/stroke.png Binary files differnew file mode 100644 index 0000000..612058a --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/images/stroke.png diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/set.js b/gstudio/static/gstudio/js/markitup/sets/textile/set.js new file mode 100644 index 0000000..dc7b6f6 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/set.js @@ -0,0 +1,37 @@ +// ------------------------------------------------------------------- +// markItUp! +// ------------------------------------------------------------------- +// Copyright (C) 2008 Jay Salvat +// http://markitup.jaysalvat.com/ +// ------------------------------------------------------------------- +// Textile tags example +// http://en.wikipedia.org/wiki/Textile_(markup_language) +// http://www.textism.com/ +// ------------------------------------------------------------------- +// Feel free to add more tags +// ------------------------------------------------------------------- +mySettings = { + onShiftEnter: {keepDefault:false, replaceWith:'\n\n'}, + markupSet: [ + {name:'Heading 1', key:'1', openWith:'h1(!(([![Class]!]))!). ', placeHolder:'Your title here...' }, + {name:'Heading 2', key:'2', openWith:'h2(!(([![Class]!]))!). ', placeHolder:'Your title here...' }, + {name:'Heading 3', key:'3', openWith:'h3(!(([![Class]!]))!). ', placeHolder:'Your title here...' }, + {name:'Heading 4', key:'4', openWith:'h4(!(([![Class]!]))!). ', placeHolder:'Your title here...' }, + {name:'Heading 5', key:'5', openWith:'h5(!(([![Class]!]))!). ', placeHolder:'Your title here...' }, + {name:'Heading 6', key:'6', openWith:'h6(!(([![Class]!]))!). ', placeHolder:'Your title here...' }, + {name:'Paragraph', key:'P', openWith:'p(!(([![Class]!]))!). '}, + {separator:'---------------' }, + {name:'Bold', key:'B', closeWith:'*', openWith:'*'}, + {name:'Italic', key:'I', closeWith:'_', openWith:'_'}, + {name:'Stroke through', key:'S', closeWith:'-', openWith:'-'}, + {separator:'---------------' }, + {name:'Bulleted list', openWith:'(!(* |!|*)!)'}, + {name:'Numeric list', openWith:'(!(# |!|#)!)'}, + {separator:'---------------' }, + {name:'Picture', replaceWith:'![![Source:!:http://]!]([![Alternative text]!])!'}, + {name:'Link', key:'L', openWith:'"', closeWith:'([![Title]!])":[![Link:!:http://]!]', placeHolder:'Your text to link here...' }, + {separator:'---------------' }, + {name:'Quotes', openWith:'bq(!(([![Class]!]))!). '}, + {name:'Code', openWith:'@', closeWith:'@'} + ] +} diff --git a/gstudio/static/gstudio/js/markitup/sets/textile/style.css b/gstudio/static/gstudio/js/markitup/sets/textile/style.css new file mode 100644 index 0000000..6176df5 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/sets/textile/style.css @@ -0,0 +1,60 @@ +/* ------------------------------------------------------------------- +// markItUp! +// By Jay Salvat - http://markitup.jaysalvat.com/ +// ------------------------------------------------------------------*/ +.markItUp .markItUpButton1 a { + background-image:url(images/h1.png); +} +.markItUp .markItUpButton2 a { + background-image:url(images/h2.png); +} +.markItUp .markItUpButton3 a { + background-image:url(images/h3.png); +} +.markItUp .markItUpButton4 a { + background-image:url(images/h4.png); +} +.markItUp .markItUpButton5 a { + background-image:url(images/h5.png); +} +.markItUp .markItUpButton6 a { + background-image:url(images/h6.png); +} +.markItUp .markItUpButton7 a { + background-image:url(images/paragraph.png); +} + +.markItUp .markItUpButton8 a { + background-image:url(images/bold.png); +} +.markItUp .markItUpButton9 a { + background-image:url(images/italic.png); +} +.markItUp .markItUpButton10 a { + background-image:url(images/stroke.png); +} + +.markItUp .markItUpButton11 a { + background-image:url(images/list-bullet.png); +} +.markItUp .markItUpButton12 a { + background-image:url(images/list-numeric.png); +} + +.markItUp .markItUpButton13 a { + background-image:url(images/picture.png); +} +.markItUp .markItUpButton14 a { + background-image:url(images/link.png); +} + +.markItUp .markItUpButton15 a { + background-image:url(images/quotes.png); +} +.markItUp .markItUpButton16 a { + background-image:url(images/code.png); +} + +.markItUp .preview a { + background-image:url(images/preview.png); +}
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/markitup/skins/django/images/handle.png b/gstudio/static/gstudio/js/markitup/skins/django/images/handle.png Binary files differnew file mode 100644 index 0000000..3993b20 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/skins/django/images/handle.png diff --git a/gstudio/static/gstudio/js/markitup/skins/django/images/menu.png b/gstudio/static/gstudio/js/markitup/skins/django/images/menu.png Binary files differnew file mode 100644 index 0000000..44a07af --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/skins/django/images/menu.png diff --git a/gstudio/static/gstudio/js/markitup/skins/django/images/submenu.png b/gstudio/static/gstudio/js/markitup/skins/django/images/submenu.png Binary files differnew file mode 100644 index 0000000..03d1977 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/skins/django/images/submenu.png diff --git a/gstudio/static/gstudio/js/markitup/skins/django/style.css b/gstudio/static/gstudio/js/markitup/skins/django/style.css new file mode 100644 index 0000000..8755e86 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/skins/django/style.css @@ -0,0 +1,128 @@ +/* ------------------------------------------------------------------- +// markItUp! Universal MarkUp Engine, JQuery plugin +// By Jay Salvat - http://markitup.jaysalvat.com/ +// ------------------------------------------------------------------*/ +.markItUp * { + margin:0px; padding:0px; + outline:none; +} +.markItUp a:link, +.markItUp a:visited { + color:#000; + text-decoration:none; +} +.markItUp { + width:800px; + margin:5px 0 5px 0; + padding-left: 106px; +} +.markItUpContainer { + font:11px Verdana, Arial, Helvetica, sans-serif; +} +.markItUpHeader { +/* margin-left: 0px; + padding-left: 0px;*/ + padding-top: 3px; +} +#id_content.markItUpEditor { + font:12px 'Courier New', Courier, monospace; + padding:5px; + width:790px; + height:220px; + clear:both; + line-height:18px; + overflow:auto; +} +.markItUpPreviewFrame { + overflow:auto; + background-color:#FFF; + width:99.9%; + height:300px; + margin:5px 0; +} +.markItUpFooter { + width:100%; +} +.markItUpResizeHandle { + overflow:hidden; + width:22px; height:5px; + margin-left:auto; + margin-right:auto; + background-image:url(images/handle.png); + cursor:n-resize; +} +/***************************************************************************************/ +/* first row of buttons */ +div .markItUpHeader ul { + margin-left: 0px; + padding-left: 0px; +} +.markItUpHeader ul li { + list-style:none; + float:left; + position:relative; +} +.markItUpHeader ul li:hover > ul{ + display:block; +} +.markItUpHeader ul .markItUpDropMenu { + background:transparent url(images/menu.png) no-repeat 115% 50%; + margin-right:5px; +} +.markItUpHeader ul .markItUpDropMenu li { + margin-right:0px; +} +/* next rows of buttons */ +.markItUpHeader ul ul { + display:none; + position:absolute; + top:18px; left:0px; + background:#FFF; + border:1px solid #000; +} +.markItUpHeader ul ul li { + float:none; + border-bottom:1px solid #000; +} +.markItUpHeader ul ul .markItUpDropMenu { + background:#FFF url(images/submenu.png) no-repeat 100% 50%; +} +.markItUpHeader ul .markItUpSeparator { + margin:0 10px; + width:1px; + height:16px; + overflow:hidden; + background-color:#CCC; +} +.markItUpHeader ul ul .markItUpSeparator { + width:auto; height:1px; + margin:0px; +} +/* next rows of buttons */ +.markItUpHeader ul ul ul { + position:absolute; + top:-1px; left:150px; +} +.markItUpHeader ul ul ul li { + float:none; +} +.markItUpHeader ul a { + display:block; + width:16px; height:16px; + text-indent:-10000px; + background-repeat:no-repeat; + padding:3px; + margin:0px; +} +.markItUpHeader ul ul a { + display:block; + padding-left:0px; + text-indent:0; + width:120px; + padding:5px 5px 5px 25px; + background-position:2px 50%; +} +.markItUpHeader ul ul a:hover { + color:#FFF; + background-color:#000; +} diff --git a/gstudio/static/gstudio/js/markitup/templates/preview.css b/gstudio/static/gstudio/js/markitup/templates/preview.css new file mode 100644 index 0000000..ad91a87 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/templates/preview.css @@ -0,0 +1,5 @@ +/* preview style examples */ +body { + background-color:#EFEFEF; + font:70% Verdana, Arial, Helvetica, sans-serif; +}
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/markitup/templates/preview.html b/gstudio/static/gstudio/js/markitup/templates/preview.html new file mode 100644 index 0000000..b8b3702 --- /dev/null +++ b/gstudio/static/gstudio/js/markitup/templates/preview.html @@ -0,0 +1,11 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/html; charset=utf-8" /> +<title>markItUp! preview template</title> +<link rel="stylesheet" type="text/css" href="~/templates/preview.css" /> +</head> +<body> +<!-- content --> +</body> +</html> diff --git a/gstudio/static/gstudio/js/mptt_m2m_selectbox.js b/gstudio/static/gstudio/js/mptt_m2m_selectbox.js new file mode 100644 index 0000000..e7924b6 --- /dev/null +++ b/gstudio/static/gstudio/js/mptt_m2m_selectbox.js @@ -0,0 +1,133 @@ +/*
+ * This is based on the SelectBox.js that comes with Django admin media
+ *
+ */
+
+var SelectBox = {
+ cache: new Object(),
+ init: function(id) {
+ var box = document.getElementById(id);
+ var node;
+ SelectBox.cache[id] = new Array();
+ var cache = SelectBox.cache[id];
+ for (var i = 0; (node = box.options[i]); i++) {
+ cache.push({value: node.value, text: node.text, displayed: 1, tree_id: node.getAttribute('data-tree-id'), left_val: node.getAttribute('data-left-value')});
+ }
+ },
+ redisplay: function(id) {
+ // Repopulate HTML select box from cache
+ var box = document.getElementById(id);
+
+ // for some reason both these steps are neccessary to get browsers to work properly...
+ for (i = 0; i < box.options.length; i++) {
+ box.options[0] = null;
+ }
+ box.options.length = 0;
+
+ SelectBox.sort(id);
+ for (var i = 0, j = SelectBox.cache[id].length; i < j; i++) {
+ var node = SelectBox.cache[id][i];
+ if (node.displayed) {
+ newOpt = new Option(node.text, node.value, false, false);
+ newOpt.setAttribute('data-tree-id', node.tree_id);
+ newOpt.setAttribute('data-left-value', node.left_val);
+ box.options[box.options.length] = newOpt;
+ }
+ }
+ },
+ filter: function(id, text) {
+ // Redisplay the HTML select box, displaying only the choices containing ALL
+ // the words in text. (It's an AND search.)
+ var tokens = text.toLowerCase().split(/\s+/);
+ var node, token;
+ for (var i = 0; (node = SelectBox.cache[id][i]); i++) {
+ node.displayed = 1;
+ for (var j = 0; (token = tokens[j]); j++) {
+ if (node.text.toLowerCase().indexOf(token) == -1) {
+ node.displayed = 0;
+ }
+ }
+ }
+ SelectBox.redisplay(id);
+ },
+ delete_from_cache: function(id, value) {
+ var node, delete_index = null;
+ for (var i = 0; (node = SelectBox.cache[id][i]); i++) {
+ if (node.value == value) {
+ delete_index = i;
+ break;
+ }
+ }
+ var j = SelectBox.cache[id].length - 1;
+ for (var i = delete_index; i < j; i++) {
+ SelectBox.cache[id][i] = SelectBox.cache[id][i+1];
+ }
+ SelectBox.cache[id].length--;
+ },
+ add_to_cache: function(id, option) {
+ // in this case option is an anonymous object, not an html element
+ SelectBox.cache[id].push({value: option.value, text: option.text, displayed: 1, tree_id: option.tree_id, left_val: option.left_val});
+ },
+ cache_contains: function(id, value) {
+ // Check if an item is contained in the cache
+ var node;
+ for (var i = 0; (node = SelectBox.cache[id][i]); i++) {
+ if (node.value == value) {
+ return true;
+ }
+ }
+ return false;
+ },
+ move: function(from, to) {
+ var from_box = document.getElementById(from);
+ var to_box = document.getElementById(to);
+ var option;
+ for (var i = 0; (option = from_box.options[i]); i++) {
+ if (option.selected && SelectBox.cache_contains(from, option.value)) {
+ SelectBox.add_to_cache(to, {value: option.value, text: option.text, displayed: 1, tree_id: option.getAttribute('data-tree-id'), left_val: option.getAttribute('data-left-value')});
+ SelectBox.delete_from_cache(from, option.value);
+ }
+ }
+ SelectBox.redisplay(from);
+ SelectBox.redisplay(to);
+ },
+ move_all: function(from, to) {
+ var from_box = document.getElementById(from);
+ var to_box = document.getElementById(to);
+ var option;
+ for (var i = 0; (option = from_box.options[i]); i++) {
+ if (SelectBox.cache_contains(from, option.value)) {
+ SelectBox.add_to_cache(to, {value: option.value, text: option.text, displayed: 1, tree_id: option.getAttribute('data-tree-id'), left_val: option.getAttribute('data-left-value')});
+ SelectBox.delete_from_cache(from, option.value);
+ }
+ }
+ SelectBox.redisplay(from);
+ SelectBox.redisplay(to);
+ },
+ sort: function(id) {
+ SelectBox.cache[id].sort( function(a, b) {
+ a_tree_id = parseInt(a.tree_id);
+ b_tree_id = parseInt(b.tree_id);
+ a_left_val = parseInt(a.left_val);
+ b_left_val = parseInt(b.left_val);
+ try {
+ if (a_tree_id > b_tree_id) return 1;
+ if (a_tree_id < b_tree_id) return -1;
+ if (a_tree_id == b_tree_id) {
+ if (a_left_val > b_left_val) return 1;
+ if (a_left_val < b_left_val) return -1;
+ }
+ }
+ catch (e) {
+ // silently fail on IE 'unknown' exception
+ }
+ return 0;
+ } );
+ },
+ select_all: function(id) {
+ var box = document.getElementById(id);
+ for (var i = 0; i < box.options.length; i++) {
+ box.options[i].selected = 'selected';
+ }
+ }
+}
diff --git a/gstudio/static/gstudio/js/underscore.js b/gstudio/static/gstudio/js/underscore.js new file mode 100644 index 0000000..b6b2813 --- /dev/null +++ b/gstudio/static/gstudio/js/underscore.js @@ -0,0 +1,981 @@ +// Underscore.js 1.2.3 +// (c) 2009-2011 Jeremy Ashkenas, DocumentCloud Inc. +// Underscore is freely distributable under the MIT license. +// Portions of Underscore are inspired or borrowed from Prototype, +// Oliver Steele's Functional, and John Resig's Micro-Templating. +// For all details and documentation: +// http://documentcloud.github.com/underscore + +(function() { + + // Baseline setup + // -------------- + + // Establish the root object, `window` in the browser, or `global` on the server. + var root = this; + + // Save the previous value of the `_` variable. + var previousUnderscore = root._; + + // Establish the object that gets returned to break out of a loop iteration. + var breaker = {}; + + // Save bytes in the minified (but not gzipped) version: + var ArrayProto = Array.prototype, ObjProto = Object.prototype, FuncProto = Function.prototype; + + // Create quick reference variables for speed access to core prototypes. + var slice = ArrayProto.slice, + concat = ArrayProto.concat, + unshift = ArrayProto.unshift, + toString = ObjProto.toString, + hasOwnProperty = ObjProto.hasOwnProperty; + + // All **ECMAScript 5** native function implementations that we hope to use + // are declared here. + var + nativeForEach = ArrayProto.forEach, + nativeMap = ArrayProto.map, + nativeReduce = ArrayProto.reduce, + nativeReduceRight = ArrayProto.reduceRight, + nativeFilter = ArrayProto.filter, + nativeEvery = ArrayProto.every, + nativeSome = ArrayProto.some, + nativeIndexOf = ArrayProto.indexOf, + nativeLastIndexOf = ArrayProto.lastIndexOf, + nativeIsArray = Array.isArray, + nativeKeys = Object.keys, + nativeBind = FuncProto.bind; + + // Create a safe reference to the Underscore object for use below. + var _ = function(obj) { return new wrapper(obj); }; + + // Export the Underscore object for **Node.js** and **"CommonJS"**, with + // backwards-compatibility for the old `require()` API. If we're not in + // CommonJS, add `_` to the global object. + if (typeof exports !== 'undefined') { + if (typeof module !== 'undefined' && module.exports) { + exports = module.exports = _; + } + exports._ = _; + } else if (typeof define === 'function' && define.amd) { + // Register as a named module with AMD. + define('underscore', function() { + return _; + }); + } else { + // Exported as a string, for Closure Compiler "advanced" mode. + root['_'] = _; + } + + // Current version. + _.VERSION = '1.2.3'; + + // Collection Functions + // -------------------- + + // The cornerstone, an `each` implementation, aka `forEach`. + // Handles objects with the built-in `forEach`, arrays, and raw objects. + // Delegates to **ECMAScript 5**'s native `forEach` if available. + var each = _.each = _.forEach = function(obj, iterator, context) { + if (obj == null) return; + if (nativeForEach && obj.forEach === nativeForEach) { + obj.forEach(iterator, context); + } else if (obj.length === +obj.length) { + for (var i = 0, l = obj.length; i < l; i++) { + if (i in obj && iterator.call(context, obj[i], i, obj) === breaker) return; + } + } else { + for (var key in obj) { + if (hasOwnProperty.call(obj, key)) { + if (iterator.call(context, obj[key], key, obj) === breaker) return; + } + } + } + }; + + // Return the results of applying the iterator to each element. + // Delegates to **ECMAScript 5**'s native `map` if available. + _.map = function(obj, iterator, context) { + var results = []; + if (obj == null) return results; + if (nativeMap && obj.map === nativeMap) return obj.map(iterator, context); + each(obj, function(value, index, list) { + results[results.length] = iterator.call(context, value, index, list); + }); + return results; + }; + + // **Reduce** builds up a single result from a list of values, aka `inject`, + // or `foldl`. Delegates to **ECMAScript 5**'s native `reduce` if available. + _.reduce = _.foldl = _.inject = function(obj, iterator, memo, context) { + var initial = arguments.length > 2; + if (obj == null) obj = []; + if (nativeReduce && obj.reduce === nativeReduce) { + if (context) iterator = _.bind(iterator, context); + return initial ? obj.reduce(iterator, memo) : obj.reduce(iterator); + } + each(obj, function(value, index, list) { + if (!initial) { + memo = value; + initial = true; + } else { + memo = iterator.call(context, memo, value, index, list); + } + }); + if (!initial) throw new TypeError('Reduce of empty array with no initial value'); + return memo; + }; + + // The right-associative version of reduce, also known as `foldr`. + // Delegates to **ECMAScript 5**'s native `reduceRight` if available. + _.reduceRight = _.foldr = function(obj, iterator, memo, context) { + var initial = arguments.length > 2; + if (obj == null) obj = []; + if (nativeReduceRight && obj.reduceRight === nativeReduceRight) { + if (context) iterator = _.bind(iterator, context); + return initial ? obj.reduceRight(iterator, memo) : obj.reduceRight(iterator); + } + var reversed = _.toArray(obj).reverse(); + if (context && !initial) iterator = _.bind(iterator, context); + return initial ? _.reduce(reversed, iterator, memo, context) : _.reduce(reversed, iterator); + }; + + // Return the first value which passes a truth test. Aliased as `detect`. + _.find = _.detect = function(obj, iterator, context) { + var result; + any(obj, function(value, index, list) { + if (iterator.call(context, value, index, list)) { + result = value; + return true; + } + }); + return result; + }; + + // Return all the elements that pass a truth test. + // Delegates to **ECMAScript 5**'s native `filter` if available. + // Aliased as `select`. + _.filter = _.select = function(obj, iterator, context) { + var results = []; + if (obj == null) return results; + if (nativeFilter && obj.filter === nativeFilter) return obj.filter(iterator, context); + each(obj, function(value, index, list) { + if (iterator.call(context, value, index, list)) results[results.length] = value; + }); + return results; + }; + + // Return all the elements for which a truth test fails. + _.reject = function(obj, iterator, context) { + var results = []; + if (obj == null) return results; + each(obj, function(value, index, list) { + if (!iterator.call(context, value, index, list)) results[results.length] = value; + }); + return results; + }; + + // Determine whether all of the elements match a truth test. + // Delegates to **ECMAScript 5**'s native `every` if available. + // Aliased as `all`. + _.every = _.all = function(obj, iterator, context) { + var result = true; + if (obj == null) return result; + if (nativeEvery && obj.every === nativeEvery) return obj.every(iterator, context); + each(obj, function(value, index, list) { + if (!(result = result && iterator.call(context, value, index, list))) return breaker; + }); + return result; + }; + + // Determine if at least one element in the object matches a truth test. + // Delegates to **ECMAScript 5**'s native `some` if available. + // Aliased as `any`. + var any = _.some = _.any = function(obj, iterator, context) { + iterator || (iterator = _.identity); + var result = false; + if (obj == null) return result; + if (nativeSome && obj.some === nativeSome) return obj.some(iterator, context); + each(obj, function(value, index, list) { + if (result || (result = iterator.call(context, value, index, list))) return breaker; + }); + return !!result; + }; + + // Determine if a given value is included in the array or object using `===`. + // Aliased as `contains`. + _.include = _.contains = function(obj, target) { + var found = false; + if (obj == null) return found; + if (nativeIndexOf && obj.indexOf === nativeIndexOf) return obj.indexOf(target) != -1; + found = any(obj, function(value) { + return value === target; + }); + return found; + }; + + // Invoke a method (with arguments) on every item in a collection. + _.invoke = function(obj, method) { + var args = slice.call(arguments, 2); + return _.map(obj, function(value) { + return (method.call ? method || value : value[method]).apply(value, args); + }); + }; + + // Convenience version of a common use case of `map`: fetching a property. + _.pluck = function(obj, key) { + return _.map(obj, function(value){ return value[key]; }); + }; + + // Return the maximum element or (element-based computation). + _.max = function(obj, iterator, context) { + if (!iterator && _.isArray(obj)) return Math.max.apply(Math, obj); + if (!iterator && _.isEmpty(obj)) return -Infinity; + var result = {computed : -Infinity}; + each(obj, function(value, index, list) { + var computed = iterator ? iterator.call(context, value, index, list) : value; + computed >= result.computed && (result = {value : value, computed : computed}); + }); + return result.value; + }; + + // Return the minimum element (or element-based computation). + _.min = function(obj, iterator, context) { + if (!iterator && _.isArray(obj)) return Math.min.apply(Math, obj); + if (!iterator && _.isEmpty(obj)) return Infinity; + var result = {computed : Infinity}; + each(obj, function(value, index, list) { + var computed = iterator ? iterator.call(context, value, index, list) : value; + computed < result.computed && (result = {value : value, computed : computed}); + }); + return result.value; + }; + + // Shuffle an array. + _.shuffle = function(obj) { + var shuffled = [], rand; + each(obj, function(value, index, list) { + if (index == 0) { + shuffled[0] = value; + } else { + rand = Math.floor(Math.random() * (index + 1)); + shuffled[index] = shuffled[rand]; + shuffled[rand] = value; + } + }); + return shuffled; + }; + + // Sort the object's values by a criterion produced by an iterator. + _.sortBy = function(obj, iterator, context) { + return _.pluck(_.map(obj, function(value, index, list) { + return { + value : value, + criteria : iterator.call(context, value, index, list) + }; + }).sort(function(left, right) { + var a = left.criteria, b = right.criteria; + return a < b ? -1 : a > b ? 1 : 0; + }), 'value'); + }; + + // Groups the object's values by a criterion. Pass either a string attribute + // to group by, or a function that returns the criterion. + _.groupBy = function(obj, val) { + var result = {}; + var iterator = _.isFunction(val) ? val : function(obj) { return obj[val]; }; + each(obj, function(value, index) { + var key = iterator(value, index); + (result[key] || (result[key] = [])).push(value); + }); + return result; + }; + + // Use a comparator function to figure out at what index an object should + // be inserted so as to maintain order. Uses binary search. + _.sortedIndex = function(array, obj, iterator) { + iterator || (iterator = _.identity); + var low = 0, high = array.length; + while (low < high) { + var mid = (low + high) >> 1; + iterator(array[mid]) < iterator(obj) ? low = mid + 1 : high = mid; + } + return low; + }; + + // Safely convert anything iterable into a real, live array. + _.toArray = function(iterable) { + if (!iterable) return []; + if (iterable.toArray) return iterable.toArray(); + if (_.isArray(iterable)) return slice.call(iterable); + if (_.isArguments(iterable)) return slice.call(iterable); + return _.values(iterable); + }; + + // Return the number of elements in an object. + _.size = function(obj) { + return _.toArray(obj).length; + }; + + // Array Functions + // --------------- + + // Get the first element of an array. Passing **n** will return the first N + // values in the array. Aliased as `head`. The **guard** check allows it to work + // with `_.map`. + _.first = _.head = function(array, n, guard) { + return (n != null) && !guard ? slice.call(array, 0, n) : array[0]; + }; + + // Returns everything but the last entry of the array. Especcialy useful on + // the arguments object. Passing **n** will return all the values in + // the array, excluding the last N. The **guard** check allows it to work with + // `_.map`. + _.initial = function(array, n, guard) { + return slice.call(array, 0, array.length - ((n == null) || guard ? 1 : n)); + }; + + // Get the last element of an array. Passing **n** will return the last N + // values in the array. The **guard** check allows it to work with `_.map`. + _.last = function(array, n, guard) { + if ((n != null) && !guard) { + return slice.call(array, Math.max(array.length - n, 0)); + } else { + return array[array.length - 1]; + } + }; + + // Returns everything but the first entry of the array. Aliased as `tail`. + // Especially useful on the arguments object. Passing an **index** will return + // the rest of the values in the array from that index onward. The **guard** + // check allows it to work with `_.map`. + _.rest = _.tail = function(array, index, guard) { + return slice.call(array, (index == null) || guard ? 1 : index); + }; + + // Trim out all falsy values from an array. + _.compact = function(array) { + return _.filter(array, function(value){ return !!value; }); + }; + + // Return a completely flattened version of an array. + _.flatten = function(array, shallow) { + return _.reduce(array, function(memo, value) { + if (_.isArray(value)) return memo.concat(shallow ? value : _.flatten(value)); + memo[memo.length] = value; + return memo; + }, []); + }; + + // Return a version of the array that does not contain the specified value(s). + _.without = function(array) { + return _.difference(array, slice.call(arguments, 1)); + }; + + // Produce a duplicate-free version of the array. If the array has already + // been sorted, you have the option of using a faster algorithm. + // Aliased as `unique`. + _.uniq = _.unique = function(array, isSorted, iterator) { + var initial = iterator ? _.map(array, iterator) : array; + var result = []; + _.reduce(initial, function(memo, el, i) { + if (0 == i || (isSorted === true ? _.last(memo) != el : !_.include(memo, el))) { + memo[memo.length] = el; + result[result.length] = array[i]; + } + return memo; + }, []); + return result; + }; + + // Produce an array that contains the union: each distinct element from all of + // the passed-in arrays. + _.union = function() { + return _.uniq(_.flatten(arguments, true)); + }; + + // Produce an array that contains every item shared between all the + // passed-in arrays. (Aliased as "intersect" for back-compat.) + _.intersection = _.intersect = function(array) { + var rest = slice.call(arguments, 1); + return _.filter(_.uniq(array), function(item) { + return _.every(rest, function(other) { + return _.indexOf(other, item) >= 0; + }); + }); + }; + + // Take the difference between one array and a number of other arrays. + // Only the elements present in just the first array will remain. + _.difference = function(array) { + var rest = _.flatten(slice.call(arguments, 1)); + return _.filter(array, function(value){ return !_.include(rest, value); }); + }; + + // Zip together multiple lists into a single array -- elements that share + // an index go together. + _.zip = function() { + var args = slice.call(arguments); + var length = _.max(_.pluck(args, 'length')); + var results = new Array(length); + for (var i = 0; i < length; i++) results[i] = _.pluck(args, "" + i); + return results; + }; + + // If the browser doesn't supply us with indexOf (I'm looking at you, **MSIE**), + // we need this function. Return the position of the first occurrence of an + // item in an array, or -1 if the item is not included in the array. + // Delegates to **ECMAScript 5**'s native `indexOf` if available. + // If the array is large and already in sort order, pass `true` + // for **isSorted** to use binary search. + _.indexOf = function(array, item, isSorted) { + if (array == null) return -1; + var i, l; + if (isSorted) { + i = _.sortedIndex(array, item); + return array[i] === item ? i : -1; + } + if (nativeIndexOf && array.indexOf === nativeIndexOf) return array.indexOf(item); + for (i = 0, l = array.length; i < l; i++) if (i in array && array[i] === item) return i; + return -1; + }; + + // Delegates to **ECMAScript 5**'s native `lastIndexOf` if available. + _.lastIndexOf = function(array, item) { + if (array == null) return -1; + if (nativeLastIndexOf && array.lastIndexOf === nativeLastIndexOf) return array.lastIndexOf(item); + var i = array.length; + while (i--) if (i in array && array[i] === item) return i; + return -1; + }; + + // Generate an integer Array containing an arithmetic progression. A port of + // the native Python `range()` function. See + // [the Python documentation](http://docs.python.org/library/functions.html#range). + _.range = function(start, stop, step) { + if (arguments.length <= 1) { + stop = start || 0; + start = 0; + } + step = arguments[2] || 1; + + var len = Math.max(Math.ceil((stop - start) / step), 0); + var idx = 0; + var range = new Array(len); + + while(idx < len) { + range[idx++] = start; + start += step; + } + + return range; + }; + + // Function (ahem) Functions + // ------------------ + + // Reusable constructor function for prototype setting. + var ctor = function(){}; + + // Create a function bound to a given object (assigning `this`, and arguments, + // optionally). Binding with arguments is also known as `curry`. + // Delegates to **ECMAScript 5**'s native `Function.bind` if available. + // We check for `func.bind` first, to fail fast when `func` is undefined. + _.bind = function bind(func, context) { + var bound, args; + if (func.bind === nativeBind && nativeBind) return nativeBind.apply(func, slice.call(arguments, 1)); + if (!_.isFunction(func)) throw new TypeError; + args = slice.call(arguments, 2); + return bound = function() { + if (!(this instanceof bound)) return func.apply(context, args.concat(slice.call(arguments))); + ctor.prototype = func.prototype; + var self = new ctor; + var result = func.apply(self, args.concat(slice.call(arguments))); + if (Object(result) === result) return result; + return self; + }; + }; + + // Bind all of an object's methods to that object. Useful for ensuring that + // all callbacks defined on an object belong to it. + _.bindAll = function(obj) { + var funcs = slice.call(arguments, 1); + if (funcs.length == 0) funcs = _.functions(obj); + each(funcs, function(f) { obj[f] = _.bind(obj[f], obj); }); + return obj; + }; + + // Memoize an expensive function by storing its results. + _.memoize = function(func, hasher) { + var memo = {}; + hasher || (hasher = _.identity); + return function() { + var key = hasher.apply(this, arguments); + return hasOwnProperty.call(memo, key) ? memo[key] : (memo[key] = func.apply(this, arguments)); + }; + }; + + // Delays a function for the given number of milliseconds, and then calls + // it with the arguments supplied. + _.delay = function(func, wait) { + var args = slice.call(arguments, 2); + return setTimeout(function(){ return func.apply(func, args); }, wait); + }; + + // Defers a function, scheduling it to run after the current call stack has + // cleared. + _.defer = function(func) { + return _.delay.apply(_, [func, 1].concat(slice.call(arguments, 1))); + }; + + // Returns a function, that, when invoked, will only be triggered at most once + // during a given window of time. + _.throttle = function(func, wait) { + var context, args, timeout, throttling, more; + var whenDone = _.debounce(function(){ more = throttling = false; }, wait); + return function() { + context = this; args = arguments; + var later = function() { + timeout = null; + if (more) func.apply(context, args); + whenDone(); + }; + if (!timeout) timeout = setTimeout(later, wait); + if (throttling) { + more = true; + } else { + func.apply(context, args); + } + whenDone(); + throttling = true; + }; + }; + + // Returns a function, that, as long as it continues to be invoked, will not + // be triggered. The function will be called after it stops being called for + // N milliseconds. + _.debounce = function(func, wait) { + var timeout; + return function() { + var context = this, args = arguments; + var later = function() { + timeout = null; + func.apply(context, args); + }; + clearTimeout(timeout); + timeout = setTimeout(later, wait); + }; + }; + + // Returns a function that will be executed at most one time, no matter how + // often you call it. Useful for lazy initialization. + _.once = function(func) { + var ran = false, memo; + return function() { + if (ran) return memo; + ran = true; + return memo = func.apply(this, arguments); + }; + }; + + // Returns the first function passed as an argument to the second, + // allowing you to adjust arguments, run code before and after, and + // conditionally execute the original function. + _.wrap = function(func, wrapper) { + return function() { + var args = concat.apply([func], arguments); + return wrapper.apply(this, args); + }; + }; + + // Returns a function that is the composition of a list of functions, each + // consuming the return value of the function that follows. + _.compose = function() { + var funcs = arguments; + return function() { + var args = arguments; + for (var i = funcs.length - 1; i >= 0; i--) { + args = [funcs[i].apply(this, args)]; + } + return args[0]; + }; + }; + + // Returns a function that will only be executed after being called N times. + _.after = function(times, func) { + if (times <= 0) return func(); + return function() { + if (--times < 1) { return func.apply(this, arguments); } + }; + }; + + // Object Functions + // ---------------- + + // Retrieve the names of an object's properties. + // Delegates to **ECMAScript 5**'s native `Object.keys` + _.keys = nativeKeys || function(obj) { + if (obj !== Object(obj)) throw new TypeError('Invalid object'); + var keys = []; + for (var key in obj) if (hasOwnProperty.call(obj, key)) keys[keys.length] = key; + return keys; + }; + + // Retrieve the values of an object's properties. + _.values = function(obj) { + return _.map(obj, _.identity); + }; + + // Return a sorted list of the function names available on the object. + // Aliased as `methods` + _.functions = _.methods = function(obj) { + var names = []; + for (var key in obj) { + if (_.isFunction(obj[key])) names.push(key); + } + return names.sort(); + }; + + // Extend a given object with all the properties in passed-in object(s). + _.extend = function(obj) { + each(slice.call(arguments, 1), function(source) { + for (var prop in source) { + if (source[prop] !== void 0) obj[prop] = source[prop]; + } + }); + return obj; + }; + + // Fill in a given object with default properties. + _.defaults = function(obj) { + each(slice.call(arguments, 1), function(source) { + for (var prop in source) { + if (obj[prop] == null) obj[prop] = source[prop]; + } + }); + return obj; + }; + + // Create a (shallow-cloned) duplicate of an object. + _.clone = function(obj) { + if (!_.isObject(obj)) return obj; + return _.isArray(obj) ? obj.slice() : _.extend({}, obj); + }; + + // Invokes interceptor with the obj, and then returns obj. + // The primary purpose of this method is to "tap into" a method chain, in + // order to perform operations on intermediate results within the chain. + _.tap = function(obj, interceptor) { + interceptor(obj); + return obj; + }; + + // Internal recursive comparison function. + function eq(a, b, stack) { + // Identical objects are equal. `0 === -0`, but they aren't identical. + // See the Harmony `egal` proposal: http://wiki.ecmascript.org/doku.php?id=harmony:egal. + if (a === b) return a !== 0 || 1 / a == 1 / b; + // A strict comparison is necessary because `null == undefined`. + if (a == null || b == null) return a === b; + // Unwrap any wrapped objects. + if (a._chain) a = a._wrapped; + if (b._chain) b = b._wrapped; + // Invoke a custom `isEqual` method if one is provided. + if (a.isEqual && _.isFunction(a.isEqual)) return a.isEqual(b); + if (b.isEqual && _.isFunction(b.isEqual)) return b.isEqual(a); + // Compare `[[Class]]` names. + var className = toString.call(a); + if (className != toString.call(b)) return false; + switch (className) { + // Strings, numbers, dates, and booleans are compared by value. + case '[object String]': + // Primitives and their corresponding object wrappers are equivalent; thus, `"5"` is + // equivalent to `new String("5")`. + return a == String(b); + case '[object Number]': + // `NaN`s are equivalent, but non-reflexive. An `egal` comparison is performed for + // other numeric values. + return a != +a ? b != +b : (a == 0 ? 1 / a == 1 / b : a == +b); + case '[object Date]': + case '[object Boolean]': + // Coerce dates and booleans to numeric primitive values. Dates are compared by their + // millisecond representations. Note that invalid dates with millisecond representations + // of `NaN` are not equivalent. + return +a == +b; + // RegExps are compared by their source patterns and flags. + case '[object RegExp]': + return a.source == b.source && + a.global == b.global && + a.multiline == b.multiline && + a.ignoreCase == b.ignoreCase; + } + if (typeof a != 'object' || typeof b != 'object') return false; + // Assume equality for cyclic structures. The algorithm for detecting cyclic + // structures is adapted from ES 5.1 section 15.12.3, abstract operation `JO`. + var length = stack.length; + while (length--) { + // Linear search. Performance is inversely proportional to the number of + // unique nested structures. + if (stack[length] == a) return true; + } + // Add the first object to the stack of traversed objects. + stack.push(a); + var size = 0, result = true; + // Recursively compare objects and arrays. + if (className == '[object Array]') { + // Compare array lengths to determine if a deep comparison is necessary. + size = a.length; + result = size == b.length; + if (result) { + // Deep compare the contents, ignoring non-numeric properties. + while (size--) { + // Ensure commutative equality for sparse arrays. + if (!(result = size in a == size in b && eq(a[size], b[size], stack))) break; + } + } + } else { + // Objects with different constructors are not equivalent. + if ('constructor' in a != 'constructor' in b || a.constructor != b.constructor) return false; + // Deep compare objects. + for (var key in a) { + if (hasOwnProperty.call(a, key)) { + // Count the expected number of properties. + size++; + // Deep compare each member. + if (!(result = hasOwnProperty.call(b, key) && eq(a[key], b[key], stack))) break; + } + } + // Ensure that both objects contain the same number of properties. + if (result) { + for (key in b) { + if (hasOwnProperty.call(b, key) && !(size--)) break; + } + result = !size; + } + } + // Remove the first object from the stack of traversed objects. + stack.pop(); + return result; + } + + // Perform a deep comparison to check if two objects are equal. + _.isEqual = function(a, b) { + return eq(a, b, []); + }; + + // Is a given array, string, or object empty? + // An "empty" object has no enumerable own-properties. + _.isEmpty = function(obj) { + if (_.isArray(obj) || _.isString(obj)) return obj.length === 0; + for (var key in obj) if (hasOwnProperty.call(obj, key)) return false; + return true; + }; + + // Is a given value a DOM element? + _.isElement = function(obj) { + return !!(obj && obj.nodeType == 1); + }; + + // Is a given value an array? + // Delegates to ECMA5's native Array.isArray + _.isArray = nativeIsArray || function(obj) { + return toString.call(obj) == '[object Array]'; + }; + + // Is a given variable an object? + _.isObject = function(obj) { + return obj === Object(obj); + }; + + // Is a given variable an arguments object? + _.isArguments = function(obj) { + return toString.call(obj) == '[object Arguments]'; + }; + if (!_.isArguments(arguments)) { + _.isArguments = function(obj) { + return !!(obj && hasOwnProperty.call(obj, 'callee')); + }; + } + + // Is a given value a function? + _.isFunction = function(obj) { + return toString.call(obj) == '[object Function]'; + }; + + // Is a given value a string? + _.isString = function(obj) { + return toString.call(obj) == '[object String]'; + }; + + // Is a given value a number? + _.isNumber = function(obj) { + return toString.call(obj) == '[object Number]'; + }; + + // Is the given value `NaN`? + _.isNaN = function(obj) { + // `NaN` is the only value for which `===` is not reflexive. + return obj !== obj; + }; + + // Is a given value a boolean? + _.isBoolean = function(obj) { + return obj === true || obj === false || toString.call(obj) == '[object Boolean]'; + }; + + // Is a given value a date? + _.isDate = function(obj) { + return toString.call(obj) == '[object Date]'; + }; + + // Is the given value a regular expression? + _.isRegExp = function(obj) { + return toString.call(obj) == '[object RegExp]'; + }; + + // Is a given value equal to null? + _.isNull = function(obj) { + return obj === null; + }; + + // Is a given variable undefined? + _.isUndefined = function(obj) { + return obj === void 0; + }; + + // Utility Functions + // ----------------- + + // Run Underscore.js in *noConflict* mode, returning the `_` variable to its + // previous owner. Returns a reference to the Underscore object. + _.noConflict = function() { + root._ = previousUnderscore; + return this; + }; + + // Keep the identity function around for default iterators. + _.identity = function(value) { + return value; + }; + + // Run a function **n** times. + _.times = function (n, iterator, context) { + for (var i = 0; i < n; i++) iterator.call(context, i); + }; + + // Escape a string for HTML interpolation. + _.escape = function(string) { + return (''+string).replace(/&/g, '&').replace(/</g, '<').replace(/>/g, '>').replace(/"/g, '"').replace(/'/g, ''').replace(/\//g,'/'); + }; + + // Add your own custom functions to the Underscore object, ensuring that + // they're correctly added to the OOP wrapper as well. + _.mixin = function(obj) { + each(_.functions(obj), function(name){ + addToWrapper(name, _[name] = obj[name]); + }); + }; + + // Generate a unique integer id (unique within the entire client session). + // Useful for temporary DOM ids. + var idCounter = 0; + _.uniqueId = function(prefix) { + var id = idCounter++; + return prefix ? prefix + id : id; + }; + + // By default, Underscore uses ERB-style template delimiters, change the + // following template settings to use alternative delimiters. + _.templateSettings = { + evaluate : /<%([\s\S]+?)%>/g, + interpolate : /<%=([\s\S]+?)%>/g, + escape : /<%-([\s\S]+?)%>/g + }; + + // JavaScript micro-templating, similar to John Resig's implementation. + // Underscore templating handles arbitrary delimiters, preserves whitespace, + // and correctly escapes quotes within interpolated code. + _.template = function(str, data) { + var c = _.templateSettings; + var tmpl = 'var __p=[],print=function(){__p.push.apply(__p,arguments);};' + + 'with(obj||{}){__p.push(\'' + + str.replace(/\\/g, '\\\\') + .replace(/'/g, "\\'") + .replace(c.escape, function(match, code) { + return "',_.escape(" + code.replace(/\\'/g, "'") + "),'"; + }) + .replace(c.interpolate, function(match, code) { + return "'," + code.replace(/\\'/g, "'") + ",'"; + }) + .replace(c.evaluate || null, function(match, code) { + return "');" + code.replace(/\\'/g, "'") + .replace(/[\r\n\t]/g, ' ') + ";__p.push('"; + }) + .replace(/\r/g, '\\r') + .replace(/\n/g, '\\n') + .replace(/\t/g, '\\t') + + "');}return __p.join('');"; + var func = new Function('obj', '_', tmpl); + if (data) return func(data, _); + return function(data) { + return func.call(this, data, _); + }; + }; + + // The OOP Wrapper + // --------------- + + // If Underscore is called as a function, it returns a wrapped object that + // can be used OO-style. This wrapper holds altered versions of all the + // underscore functions. Wrapped objects may be chained. + var wrapper = function(obj) { this._wrapped = obj; }; + + // Expose `wrapper.prototype` as `_.prototype` + _.prototype = wrapper.prototype; + + // Helper function to continue chaining intermediate results. + var result = function(obj, chain) { + return chain ? _(obj).chain() : obj; + }; + + // A method to easily add functions to the OOP wrapper. + var addToWrapper = function(name, func) { + wrapper.prototype[name] = function() { + var args = slice.call(arguments); + unshift.call(args, this._wrapped); + return result(func.apply(_, args), this._chain); + }; + }; + + // Add all of the Underscore functions to the wrapper object. + _.mixin(_); + + // Add all mutator Array functions to the wrapper. + each(['pop', 'push', 'reverse', 'shift', 'sort', 'splice', 'unshift'], function(name) { + var method = ArrayProto[name]; + wrapper.prototype[name] = function() { + method.apply(this._wrapped, arguments); + return result(this._wrapped, this._chain); + }; + }); + + // Add all accessor Array functions to the wrapper. + each(['concat', 'join', 'slice'], function(name) { + var method = ArrayProto[name]; + wrapper.prototype[name] = function() { + return result(method.apply(this._wrapped, arguments), this._chain); + }; + }); + + // Start chaining a wrapped Underscore object. + wrapper.prototype.chain = function() { + this._chain = true; + return this; + }; + + // Extracts the result from a wrapped and chained object. + wrapper.prototype.value = function() { + return this._wrapped; + }; + +}).call(this); diff --git a/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-blockquote.png b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-blockquote.png Binary files differnew file mode 100644 index 0000000..65ea205 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-blockquote.png diff --git a/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h1.png b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h1.png Binary files differnew file mode 100644 index 0000000..dea1da3 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h1.png diff --git a/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h2.png b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h2.png Binary files differnew file mode 100644 index 0000000..f4b4274 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h2.png diff --git a/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h3.png b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h3.png Binary files differnew file mode 100644 index 0000000..bd99f76 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h3.png diff --git a/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h4.png b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h4.png Binary files differnew file mode 100644 index 0000000..e06ab3d --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h4.png diff --git a/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h5.png b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h5.png Binary files differnew file mode 100644 index 0000000..360fc60 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h5.png diff --git a/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h6.png b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h6.png Binary files differnew file mode 100644 index 0000000..73e644a --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-h6.png diff --git a/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-p.png b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-p.png Binary files differnew file mode 100644 index 0000000..7f2bf34 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-p.png diff --git a/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-pre.png b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-pre.png Binary files differnew file mode 100644 index 0000000..e026e47 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/iframe/default/lbl-pre.png diff --git a/gstudio/static/gstudio/js/wymeditor/iframe/default/wymiframe.css b/gstudio/static/gstudio/js/wymeditor/iframe/default/wymiframe.css new file mode 100644 index 0000000..769520c --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/iframe/default/wymiframe.css @@ -0,0 +1,90 @@ +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * wymeditor.css + * Main editor css file. + * See the documentation for more info. + * + * File Authors: + * Jean-Francois Hovinne (jf.hovinne a-t wymeditor dotorg) + * Daniel Reszka (d.reszka a-t wymeditor dotorg) +*/ + +/* VISUAL FEEDBACK */ + +/* basic */ + body { background: #e1e8f1;} + +/* make HTML blocs visible */ + p, + h1, + h2, + h3, + h4, + h5, + h6, + ul, + ol, + table, + blockquote, + pre { background: #FFFFFF no-repeat 2px 2px; + padding:8px 5px 5px; + margin:10px; } + td { background: #F0F4F8; } + th { background: #ffffcc; } + ul, + ol { border-left:20px solid #B9C4D0; padding:0px 5px; } + caption { background: #E4E4B0; padding: 5px; font-weight: bold; } + table { font-size: 12px; width: 500px; } + td { width: 25%; } + blockquote { margin-left: 30px; } + pre { background-color:transparent; border: 1px solid white; } + +/* Gecko min height fix */ + p { min-height: 1em; } /*min-height is needed under Firefox, because empty parargraphs */ + *+html p { min-height: auto; } /* but we have to remove it under IE7 because it triggers the 'haslayout' mode */ + td { height: 1.6em; } + +/* labels */ + p { background-image: url(lbl-p.png); } + h1 { background-image: url(lbl-h1.png); } + h2 { background-image: url(lbl-h2.png); } + h3 { background-image: url(lbl-h3.png); } + h4 { background-image: url(lbl-h4.png); } + h5 { background-image: url(lbl-h5.png); } + h6 { background-image: url(lbl-h6.png); } + blockquote{ background-image: url(lbl-blockquote.png); } + pre { background-image: url(lbl-pre.png); } + +/* specific HTML elements */ + caption { text-align: left; } + img { margin-right: 5px; + border-style: solid; + border-color: gray; + border-width: 0; } + a img { border-width: 1px; border-color: blue; } + acronym { border: 1px solid gray; } + span { background-color: #eef; } + +/* visual feedback for non-valid nesting of elements*/ + h1 h1, h1 h2, h1 h3, h1 h4, h1 h5, h1 h6, h1 p, h1 pre, h1 address, + h2 h1, h2 h2, h2 h3, h2 h4, h2 h5, h2 h6, h2 p, h2 pre, h2 address, + h3 h1, h3 h2, h3 h3, h3 h4, h3 h5, h3 h6, h3 p, h3 pre, h3 address, + h4 h1, h4 h2, h4 h3, h4 h4, h4 h5, h4 h6, h4 p, h4 pre, h4 address, + h5 h1, h5 h2, h5 h3, h5 h4, h5 h5, h5 h6, h5 p, h5 pre, h5 address, + h6 h1, h6 h2, h6 h3, h6 h4, h6 h4, h6 h6, h6 p, h6 pre, h6 address, + p h1, p h2, p h3, p h4, p h5, p h6, p pre, p address, + pre h1, pre h2, pre h3, pre h4, pre h5, pre h6, pre p, pre pre, pre address, + address h1, address h2, address h3, address h4, address h5, address h6, + address p, address pre, address address + { background-color: #ff9999 !important; + border: 1px solid red !important; + font-size: 12px !important; + font-weight: normal; } diff --git a/gstudio/static/gstudio/js/wymeditor/iframe/default/wymiframe.html b/gstudio/static/gstudio/js/wymeditor/iframe/default/wymiframe.html new file mode 100644 index 0000000..91a690c --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/iframe/default/wymiframe.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd"> +<!-- + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * wymiframe.html + * Iframe used by designMode. + * See the documentation for more info. + * + * File Authors: + * Jean-Francois Hovinne (jf.hovinne a-t wymeditor dotorg) +--> +<html> +<head> +<title>WYMeditor iframe</title> +<meta http-equiv="X-UA-Compatible" content="IE=EmulateIE7" /> +<link rel="stylesheet" type="text/css" media="screen" href="wymiframe.css" /> +</head> +<body class="wym_iframe"></body> +</html> diff --git a/gstudio/static/gstudio/js/wymeditor/jquery.wymeditor.js b/gstudio/static/gstudio/js/wymeditor/jquery.wymeditor.js new file mode 100644 index 0000000..0667d85 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/jquery.wymeditor.js @@ -0,0 +1,4688 @@ +/** + * @version 0.5-rc1 + * + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File: jquery.wymeditor.js + * + * Main JS file with core classes and functions. + * See the documentation for more info. + * + * About: authors + * + * Jean-Francois Hovinne (jf.hovinne a-t wymeditor dotorg) + * Volker Mische (vmx a-t gmx dotde) + * Scott Lewis (lewiscot a-t gmail dotcom) + * Bermi Ferrer (wymeditor a-t bermi dotorg) + * Daniel Reszka (d.reszka a-t wymeditor dotorg) + * Jonatan Lundin (jonatan.lundin a-t gmail dotcom) + */ + +/* + Namespace: WYMeditor + Global WYMeditor namespace. +*/ +if(!WYMeditor) var WYMeditor = {}; + +//Wrap the Firebug console in WYMeditor.console +(function() { + if ( !window.console || !console.firebug ) { + var names = ["log", "debug", "info", "warn", "error", "assert", "dir", "dirxml", + "group", "groupEnd", "time", "timeEnd", "count", "trace", "profile", "profileEnd"]; + + WYMeditor.console = {}; + for (var i = 0; i < names.length; ++i) + WYMeditor.console[names[i]] = function() {} + + } else WYMeditor.console = window.console; +})(); + +jQuery.extend(WYMeditor, { + +/* + Constants: Global WYMeditor constants. + + VERSION - Defines WYMeditor version. + INSTANCES - An array of loaded WYMeditor.editor instances. + STRINGS - An array of loaded WYMeditor language pairs/values. + SKINS - An array of loaded WYMeditor skins. + NAME - The "name" attribute. + INDEX - A string replaced by the instance index. + WYM_INDEX - A string used to get/set the instance index. + BASE_PATH - A string replaced by WYMeditor's base path. + SKIN_PATH - A string replaced by WYMeditor's skin path. + WYM_PATH - A string replaced by WYMeditor's main JS file path. + SKINS_DEFAULT_PATH - The skins default base path. + SKINS_DEFAULT_CSS - The skins default CSS file. + LANG_DEFAULT_PATH - The language files default path. + IFRAME_BASE_PATH - A string replaced by the designmode iframe's base path. + IFRAME_DEFAULT - The iframe's default base path. + JQUERY_PATH - A string replaced by the computed jQuery path. + DIRECTION - A string replaced by the text direction (rtl or ltr). + LOGO - A string replaced by WYMeditor logo. + TOOLS - A string replaced by the toolbar's HTML. + TOOLS_ITEMS - A string replaced by the toolbar items. + TOOL_NAME - A string replaced by a toolbar item's name. + TOOL_TITLE - A string replaced by a toolbar item's title. + TOOL_CLASS - A string replaced by a toolbar item's class. + CLASSES - A string replaced by the classes panel's HTML. + CLASSES_ITEMS - A string replaced by the classes items. + CLASS_NAME - A string replaced by a class item's name. + CLASS_TITLE - A string replaced by a class item's title. + CONTAINERS - A string replaced by the containers panel's HTML. + CONTAINERS_ITEMS - A string replaced by the containers items. + CONTAINER_NAME - A string replaced by a container item's name. + CONTAINER_TITLE - A string replaced by a container item's title. + CONTAINER_CLASS - A string replaced by a container item's class. + HTML - A string replaced by the HTML view panel's HTML. + IFRAME - A string replaced by the designmode iframe. + STATUS - A string replaced by the status panel's HTML. + DIALOG_TITLE - A string replaced by a dialog's title. + DIALOG_BODY - A string replaced by a dialog's HTML body. + BODY - The BODY element. + STRING - The "string" type. + BODY,DIV,P, + H1,H2,H3,H4,H5,H6, + PRE,BLOCKQUOTE, + A,BR,IMG, + TABLE,TD,TH, + UL,OL,LI - HTML elements string representation. + CLASS,HREF,SRC, + TITLE,ALT - HTML attributes string representation. + DIALOG_LINK - A link dialog type. + DIALOG_IMAGE - An image dialog type. + DIALOG_TABLE - A table dialog type. + DIALOG_PASTE - A 'Paste from Word' dialog type. + BOLD - Command: (un)set selection to <strong>. + ITALIC - Command: (un)set selection to <em>. + CREATE_LINK - Command: open the link dialog or (un)set link. + INSERT_IMAGE - Command: open the image dialog or insert an image. + INSERT_TABLE - Command: open the table dialog. + PASTE - Command: open the paste dialog. + INDENT - Command: nest a list item. + OUTDENT - Command: unnest a list item. + TOGGLE_HTML - Command: display/hide the HTML view. + FORMAT_BLOCK - Command: set a block element to another type. + PREVIEW - Command: open the preview dialog. + UNLINK - Command: unset a link. + INSERT_UNORDEREDLIST- Command: insert an unordered list. + INSERT_ORDEREDLIST - Command: insert an ordered list. + MAIN_CONTAINERS - An array of the main HTML containers used in WYMeditor. + BLOCKS - An array of the HTML block elements. + KEY - Standard key codes. + NODE - Node types. + +*/ + + VERSION : "0.5-rc1", + INSTANCES : [], + STRINGS : [], + SKINS : [], + NAME : "name", + INDEX : "{Wym_Index}", + WYM_INDEX : "wym_index", + BASE_PATH : "{Wym_Base_Path}", + CSS_PATH : "{Wym_Css_Path}", + WYM_PATH : "{Wym_Wym_Path}", + SKINS_DEFAULT_PATH : "skins/", + SKINS_DEFAULT_CSS : "skin.css", + SKINS_DEFAULT_JS : "skin.js", + LANG_DEFAULT_PATH : "lang/", + IFRAME_BASE_PATH : "{Wym_Iframe_Base_Path}", + IFRAME_DEFAULT : "iframe/default/", + JQUERY_PATH : "{Wym_Jquery_Path}", + DIRECTION : "{Wym_Direction}", + LOGO : "{Wym_Logo}", + TOOLS : "{Wym_Tools}", + TOOLS_ITEMS : "{Wym_Tools_Items}", + TOOL_NAME : "{Wym_Tool_Name}", + TOOL_TITLE : "{Wym_Tool_Title}", + TOOL_CLASS : "{Wym_Tool_Class}", + CLASSES : "{Wym_Classes}", + CLASSES_ITEMS : "{Wym_Classes_Items}", + CLASS_NAME : "{Wym_Class_Name}", + CLASS_TITLE : "{Wym_Class_Title}", + CONTAINERS : "{Wym_Containers}", + CONTAINERS_ITEMS : "{Wym_Containers_Items}", + CONTAINER_NAME : "{Wym_Container_Name}", + CONTAINER_TITLE : "{Wym_Containers_Title}", + CONTAINER_CLASS : "{Wym_Container_Class}", + HTML : "{Wym_Html}", + IFRAME : "{Wym_Iframe}", + STATUS : "{Wym_Status}", + DIALOG_TITLE : "{Wym_Dialog_Title}", + DIALOG_BODY : "{Wym_Dialog_Body}", + STRING : "string", + BODY : "body", + DIV : "div", + P : "p", + H1 : "h1", + H2 : "h2", + H3 : "h3", + H4 : "h4", + H5 : "h5", + H6 : "h6", + PRE : "pre", + BLOCKQUOTE : "blockquote", + A : "a", + BR : "br", + IMG : "img", + TABLE : "table", + TD : "td", + TH : "th", + UL : "ul", + OL : "ol", + LI : "li", + CLASS : "class", + HREF : "href", + SRC : "src", + TITLE : "title", + ALT : "alt", + DIALOG_LINK : "Link", + DIALOG_IMAGE : "Image", + DIALOG_TABLE : "Table", + DIALOG_PASTE : "Paste_From_Word", + BOLD : "Bold", + ITALIC : "Italic", + CREATE_LINK : "CreateLink", + INSERT_IMAGE : "InsertImage", + INSERT_TABLE : "InsertTable", + INSERT_HTML : "InsertHTML", + PASTE : "Paste", + INDENT : "Indent", + OUTDENT : "Outdent", + TOGGLE_HTML : "ToggleHtml", + FORMAT_BLOCK : "FormatBlock", + PREVIEW : "Preview", + UNLINK : "Unlink", + INSERT_UNORDEREDLIST: "InsertUnorderedList", + INSERT_ORDEREDLIST : "InsertOrderedList", + + MAIN_CONTAINERS : new Array("p","h1","h2","h3","h4","h5","h6","pre","blockquote"), + + BLOCKS : new Array("address", "blockquote", "div", "dl", + "fieldset", "form", "h1", "h2", "h3", "h4", "h5", "h6", "hr", + "noscript", "ol", "p", "pre", "table", "ul", "dd", "dt", + "li", "tbody", "td", "tfoot", "th", "thead", "tr"), + + KEY : { + BACKSPACE: 8, + ENTER: 13, + END: 35, + HOME: 36, + LEFT: 37, + UP: 38, + RIGHT: 39, + DOWN: 40, + CURSOR: new Array(37, 38, 39, 40), + DELETE: 46 + }, + + NODE : { + ELEMENT: 1, + ATTRIBUTE: 2, + TEXT: 3 + }, + + /* + Class: WYMeditor.editor + WYMeditor editor main class, instanciated for each editor occurrence. + */ + + editor : function(elem, options) { + + /* + Constructor: WYMeditor.editor + + Initializes main values (index, elements, paths, ...) + and call WYMeditor.editor.init which initializes the editor. + + Parameters: + + elem - The HTML element to be replaced by the editor. + options - The hash of options. + + Returns: + + Nothing. + + See Also: + + <WYMeditor.editor.init> + */ + + //store the instance in the INSTANCES array and store the index + this._index = WYMeditor.INSTANCES.push(this) - 1; + //store the element replaced by the editor + this._element = elem; + //store the options + this._options = options; + //store the element's inner value + this._html = jQuery(elem).val(); + + //store the HTML option, if any + if(this._options.html) this._html = this._options.html; + //get or compute the base path (where the main JS file is located) + this._options.basePath = this._options.basePath + || this.computeBasePath(); + //get or set the skin path (where the skin files are located) + this._options.skinPath = this._options.skinPath + || this._options.basePath + WYMeditor.SKINS_DEFAULT_PATH + + this._options.skin + '/'; + //get or compute the main JS file location + this._options.wymPath = this._options.wymPath + || this.computeWymPath(); + //get or set the language files path + this._options.langPath = this._options.langPath + || this._options.basePath + WYMeditor.LANG_DEFAULT_PATH; + //get or set the designmode iframe's base path + this._options.iframeBasePath = this._options.iframeBasePath + || this._options.basePath + WYMeditor.IFRAME_DEFAULT; + //get or compute the jQuery JS file location + this._options.jQueryPath = this._options.jQueryPath + || this.computeJqueryPath(); + + //initialize the editor instance + this.init(); + + } + +}); + + +/********** JQUERY **********/ + +/** + * Replace an HTML element by WYMeditor + * + * @example jQuery(".wymeditor").wymeditor( + * { + * + * } + * ); + * @desc Example description here + * + * @name WYMeditor + * @description WYMeditor is a web-based WYSIWYM XHTML editor + * @param Hash hash A hash of parameters + * @option Integer iExample Description here + * @option String sExample Description here + * + * @type jQuery + * @cat Plugins/WYMeditor + * @author Jean-Francois Hovinne + */ +jQuery.fn.wymeditor = function(options) { + + options = jQuery.extend({ + + html: "", + + basePath: false, + + skinPath: false, + + wymPath: false, + + iframeBasePath: false, + + jQueryPath: false, + + styles: false, + + stylesheet: false, + + skin: "default", + initSkin: true, + loadSkin: true, + + lang: "en", + + direction: "ltr", + + boxHtml: "<div class='wym_box'>" + + "<div class='wym_area_top'>" + + WYMeditor.TOOLS + + "</div>" + + "<div class='wym_area_left'></div>" + + "<div class='wym_area_right'>" + + WYMeditor.CONTAINERS + + WYMeditor.CLASSES + + "</div>" + + "<div class='wym_area_main'>" + + WYMeditor.HTML + + WYMeditor.IFRAME + + WYMeditor.STATUS + + "</div>" + + "<div class='wym_area_bottom'>" + + WYMeditor.LOGO + + "</div>" + + "</div>", + + logoHtml: "<a class='wym_wymeditor_link' " + + "href='http://www.wymeditor.org/'>WYMeditor</a>", + + iframeHtml:"<div class='wym_iframe wym_section'>" + + "<iframe " + + "src='" + + WYMeditor.IFRAME_BASE_PATH + + "wymiframe.html' " + + "onload='this.contentWindow.parent.WYMeditor.INSTANCES[" + + WYMeditor.INDEX + "].initIframe(this)'" + + "></iframe>" + + "</div>", + + editorStyles: [], + + toolsHtml: "<div class='wym_tools wym_section'>" + + "<h2>{Tools}</h2>" + + "<ul>" + + WYMeditor.TOOLS_ITEMS + + "</ul>" + + "</div>", + + toolsItemHtml: "<li class='" + + WYMeditor.TOOL_CLASS + + "'><a href='#' name='" + + WYMeditor.TOOL_NAME + + "' title='" + + WYMeditor.TOOL_TITLE + + "'>" + + WYMeditor.TOOL_TITLE + + "</a></li>", + + toolsItems: [ + {'name': 'Bold', 'title': 'Strong', 'css': 'wym_tools_strong'}, + {'name': 'Italic', 'title': 'Emphasis', 'css': 'wym_tools_emphasis'}, + {'name': 'Superscript', 'title': 'Superscript', + 'css': 'wym_tools_superscript'}, + {'name': 'Subscript', 'title': 'Subscript', + 'css': 'wym_tools_subscript'}, + {'name': 'InsertOrderedList', 'title': 'Ordered_List', + 'css': 'wym_tools_ordered_list'}, + {'name': 'InsertUnorderedList', 'title': 'Unordered_List', + 'css': 'wym_tools_unordered_list'}, + {'name': 'Indent', 'title': 'Indent', 'css': 'wym_tools_indent'}, + {'name': 'Outdent', 'title': 'Outdent', 'css': 'wym_tools_outdent'}, + {'name': 'Undo', 'title': 'Undo', 'css': 'wym_tools_undo'}, + {'name': 'Redo', 'title': 'Redo', 'css': 'wym_tools_redo'}, + {'name': 'CreateLink', 'title': 'Link', 'css': 'wym_tools_link'}, + {'name': 'Unlink', 'title': 'Unlink', 'css': 'wym_tools_unlink'}, + {'name': 'InsertImage', 'title': 'Image', 'css': 'wym_tools_image'}, + {'name': 'InsertTable', 'title': 'Table', 'css': 'wym_tools_table'}, + {'name': 'Paste', 'title': 'Paste_From_Word', + 'css': 'wym_tools_paste'}, + {'name': 'ToggleHtml', 'title': 'HTML', 'css': 'wym_tools_html'}, + {'name': 'Preview', 'title': 'Preview', 'css': 'wym_tools_preview'} + ], + + containersHtml: "<div class='wym_containers wym_section'>" + + "<h2>{Containers}</h2>" + + "<ul>" + + WYMeditor.CONTAINERS_ITEMS + + "</ul>" + + "</div>", + + containersItemHtml:"<li class='" + + WYMeditor.CONTAINER_CLASS + + "'>" + + "<a href='#' name='" + + WYMeditor.CONTAINER_NAME + + "'>" + + WYMeditor.CONTAINER_TITLE + + "</a></li>", + + containersItems: [ + {'name': 'P', 'title': 'Paragraph', 'css': 'wym_containers_p'}, + {'name': 'H1', 'title': 'Heading_1', 'css': 'wym_containers_h1'}, + {'name': 'H2', 'title': 'Heading_2', 'css': 'wym_containers_h2'}, + {'name': 'H3', 'title': 'Heading_3', 'css': 'wym_containers_h3'}, + {'name': 'H4', 'title': 'Heading_4', 'css': 'wym_containers_h4'}, + {'name': 'H5', 'title': 'Heading_5', 'css': 'wym_containers_h5'}, + {'name': 'H6', 'title': 'Heading_6', 'css': 'wym_containers_h6'}, + {'name': 'PRE', 'title': 'Preformatted', 'css': 'wym_containers_pre'}, + {'name': 'BLOCKQUOTE', 'title': 'Blockquote', + 'css': 'wym_containers_blockquote'}, + {'name': 'TH', 'title': 'Table_Header', 'css': 'wym_containers_th'} + ], + + classesHtml: "<div class='wym_classes wym_section'>" + + "<h2>{Classes}</h2><ul>" + + WYMeditor.CLASSES_ITEMS + + "</ul></div>", + + classesItemHtml: "<li class='wym_classes_" + + WYMeditor.CLASS_NAME + + "'><a href='#' name='" + + WYMeditor.CLASS_NAME + + "'>" + + WYMeditor.CLASS_TITLE + + "</a></li>", + + classesItems: [], + + statusHtml: "<div class='wym_status wym_section'>" + + "<h2>{Status}</h2>" + + "</div>", + + htmlHtml: "<div class='wym_html wym_section'>" + + "<h2>{Source_Code}</h2>" + + "<textarea class='wym_html_val'></textarea>" + + "</div>", + + boxSelector: ".wym_box", + toolsSelector: ".wym_tools", + toolsListSelector: " ul", + containersSelector:".wym_containers", + classesSelector: ".wym_classes", + htmlSelector: ".wym_html", + iframeSelector: ".wym_iframe iframe", + iframeBodySelector:".wym_iframe", + statusSelector: ".wym_status", + toolSelector: ".wym_tools a", + containerSelector: ".wym_containers a", + classSelector: ".wym_classes a", + htmlValSelector: ".wym_html_val", + + hrefSelector: ".wym_href", + srcSelector: ".wym_src", + titleSelector: ".wym_title", + altSelector: ".wym_alt", + textSelector: ".wym_text", + + rowsSelector: ".wym_rows", + colsSelector: ".wym_cols", + captionSelector: ".wym_caption", + summarySelector: ".wym_summary", + + submitSelector: ".wym_submit", + cancelSelector: ".wym_cancel", + previewSelector: "", + + dialogTypeSelector: ".wym_dialog_type", + dialogLinkSelector: ".wym_dialog_link", + dialogImageSelector: ".wym_dialog_image", + dialogTableSelector: ".wym_dialog_table", + dialogPasteSelector: ".wym_dialog_paste", + dialogPreviewSelector: ".wym_dialog_preview", + + updateSelector: ".wymupdate", + updateEvent: "click", + + dialogFeatures: "menubar=no,titlebar=no,toolbar=no,resizable=no" + + ",width=560,height=300,top=0,left=0", + dialogFeaturesPreview: "menubar=no,titlebar=no,toolbar=no,resizable=no" + + ",scrollbars=yes,width=560,height=300,top=0,left=0", + + dialogHtml: "<!DOCTYPE html PUBLIC '-//W3C//DTD XHTML 1.0 Strict//EN'" + + " 'http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd'>" + + "<html dir='" + + WYMeditor.DIRECTION + + "'><head>" + + "<link rel='stylesheet' type='text/css' media='screen'" + + " href='" + + WYMeditor.CSS_PATH + + "' />" + + "<title>" + + WYMeditor.DIALOG_TITLE + + "</title>" + + "<script type='text/javascript'" + + " src='" + + WYMeditor.JQUERY_PATH + + "'></script>" + + "<script type='text/javascript'" + + " src='" + + WYMeditor.WYM_PATH + + "'></script>" + + "</head>" + + WYMeditor.DIALOG_BODY + + "</html>", + + dialogLinkHtml: "<body class='wym_dialog wym_dialog_link'" + + " onload='WYMeditor.INIT_DIALOG(" + WYMeditor.INDEX + ")'" + + ">" + + "<form>" + + "<fieldset>" + + "<input type='hidden' class='wym_dialog_type' value='" + + WYMeditor.DIALOG_LINK + + "' />" + + "<legend>{Link}</legend>" + + "<div class='row'>" + + "<label>{URL}</label>" + + "<input type='text' class='wym_href' value='' size='40' />" + + "</div>" + + "<div class='row'>" + + "<label>{Title}</label>" + + "<input type='text' class='wym_title' value='' size='40' />" + + "</div>" + + "<div class='row row-indent'>" + + "<input class='wym_submit' type='button'" + + " value='{Submit}' />" + + "<input class='wym_cancel' type='button'" + + "value='{Cancel}' />" + + "</div>" + + "</fieldset>" + + "</form>" + + "</body>", + + dialogImageHtml: "<body class='wym_dialog wym_dialog_image'" + + " onload='WYMeditor.INIT_DIALOG(" + WYMeditor.INDEX + ")'" + + ">" + + "<form>" + + "<fieldset>" + + "<input type='hidden' class='wym_dialog_type' value='" + + WYMeditor.DIALOG_IMAGE + + "' />" + + "<legend>{Image}</legend>" + + "<div class='row'>" + + "<label>{URL}</label>" + + "<input type='text' class='wym_src' value='' size='40' />" + + "</div>" + + "<div class='row'>" + + "<label>{Alternative_Text}</label>" + + "<input type='text' class='wym_alt' value='' size='40' />" + + "</div>" + + "<div class='row'>" + + "<label>{Title}</label>" + + "<input type='text' class='wym_title' value='' size='40' />" + + "</div>" + + "<div class='row row-indent'>" + + "<input class='wym_submit' type='button'" + + " value='{Submit}' />" + + "<input class='wym_cancel' type='button'" + + "value='{Cancel}' />" + + "</div>" + + "</fieldset>" + + "</form>" + + "</body>", + + dialogTableHtml: "<body class='wym_dialog wym_dialog_table'" + + " onload='WYMeditor.INIT_DIALOG(" + WYMeditor.INDEX + ")'" + + ">" + + "<form>" + + "<fieldset>" + + "<input type='hidden' class='wym_dialog_type' value='" + + WYMeditor.DIALOG_TABLE + + "' />" + + "<legend>{Table}</legend>" + + "<div class='row'>" + + "<label>{Caption}</label>" + + "<input type='text' class='wym_caption' value='' size='40' />" + + "</div>" + + "<div class='row'>" + + "<label>{Summary}</label>" + + "<input type='text' class='wym_summary' value='' size='40' />" + + "</div>" + + "<div class='row'>" + + "<label>{Number_Of_Rows}</label>" + + "<input type='text' class='wym_rows' value='3' size='3' />" + + "</div>" + + "<div class='row'>" + + "<label>{Number_Of_Cols}</label>" + + "<input type='text' class='wym_cols' value='2' size='3' />" + + "</div>" + + "<div class='row row-indent'>" + + "<input class='wym_submit' type='button'" + + " value='{Submit}' />" + + "<input class='wym_cancel' type='button'" + + "value='{Cancel}' />" + + "</div>" + + "</fieldset>" + + "</form>" + + "</body>", + + dialogPasteHtml: "<body class='wym_dialog wym_dialog_paste'" + + " onload='WYMeditor.INIT_DIALOG(" + WYMeditor.INDEX + ")'" + + ">" + + "<form>" + + "<input type='hidden' class='wym_dialog_type' value='" + + WYMeditor.DIALOG_PASTE + + "' />" + + "<fieldset>" + + "<legend>{Paste_From_Word}</legend>" + + "<div class='row'>" + + "<textarea class='wym_text' rows='10' cols='50'></textarea>" + + "</div>" + + "<div class='row'>" + + "<input class='wym_submit' type='button'" + + " value='{Submit}' />" + + "<input class='wym_cancel' type='button'" + + "value='{Cancel}' />" + + "</div>" + + "</fieldset>" + + "</form>" + + "</body>", + + dialogPreviewHtml: "<body class='wym_dialog wym_dialog_preview'" + + " onload='WYMeditor.INIT_DIALOG(" + WYMeditor.INDEX + ")'" + + "></body>", + + dialogStyles: [], + + stringDelimiterLeft: "{", + stringDelimiterRight:"}", + + preInit: null, + preBind: null, + postInit: null, + + preInitDialog: null, + postInitDialog: null + + }, options); + + return this.each(function() { + + new WYMeditor.editor(jQuery(this),options); + }); +}; + +/* @name extend + * @description Returns the WYMeditor instance based on its index + */ +jQuery.extend({ + wymeditors: function(i) { + return (WYMeditor.INSTANCES[i]); + } +}); + + +/********** WYMeditor **********/ + +/* @name Wymeditor + * @description WYMeditor class + */ + +/* @name init + * @description Initializes a WYMeditor instance + */ +WYMeditor.editor.prototype.init = function() { + + //load subclass - browser specific + //unsupported browsers: do nothing + if (jQuery.browser.msie) { + var WymClass = new WYMeditor.WymClassExplorer(this); + } + else if (jQuery.browser.mozilla) { + var WymClass = new WYMeditor.WymClassMozilla(this); + } + else if (jQuery.browser.opera) { + var WymClass = new WYMeditor.WymClassOpera(this); + } + else if (jQuery.browser.safari) { + var WymClass = new WYMeditor.WymClassSafari(this); + } + + if(WymClass) { + + if(jQuery.isFunction(this._options.preInit)) this._options.preInit(this); + + var SaxListener = new WYMeditor.XhtmlSaxListener(); + jQuery.extend(SaxListener, WymClass); + this.parser = new WYMeditor.XhtmlParser(SaxListener); + + if(this._options.styles || this._options.stylesheet){ + this.configureEditorUsingRawCss(); + } + + this.helper = new WYMeditor.XmlHelper(); + + //extend the Wymeditor object + //don't use jQuery.extend since 1.1.4 + //jQuery.extend(this, WymClass); + for (var prop in WymClass) { this[prop] = WymClass[prop]; } + + //load wymbox + this._box = jQuery(this._element).hide().after(this._options.boxHtml).next().addClass('wym_box_' + this._index); + + //store the instance index in wymbox and element replaced by editor instance + //but keep it compatible with jQuery < 1.2.3, see #122 + if( jQuery.isFunction( jQuery.fn.data ) ) { + jQuery.data(this._box.get(0), WYMeditor.WYM_INDEX, this._index); + jQuery.data(this._element.get(0), WYMeditor.WYM_INDEX, this._index); + } + + var h = WYMeditor.Helper; + + //construct the iframe + var iframeHtml = this._options.iframeHtml; + iframeHtml = h.replaceAll(iframeHtml, WYMeditor.INDEX, this._index); + iframeHtml = h.replaceAll(iframeHtml, WYMeditor.IFRAME_BASE_PATH, this._options.iframeBasePath); + + //construct wymbox + var boxHtml = jQuery(this._box).html(); + + boxHtml = h.replaceAll(boxHtml, WYMeditor.LOGO, this._options.logoHtml); + boxHtml = h.replaceAll(boxHtml, WYMeditor.TOOLS, this._options.toolsHtml); + boxHtml = h.replaceAll(boxHtml, WYMeditor.CONTAINERS,this._options.containersHtml); + boxHtml = h.replaceAll(boxHtml, WYMeditor.CLASSES, this._options.classesHtml); + boxHtml = h.replaceAll(boxHtml, WYMeditor.HTML, this._options.htmlHtml); + boxHtml = h.replaceAll(boxHtml, WYMeditor.IFRAME, iframeHtml); + boxHtml = h.replaceAll(boxHtml, WYMeditor.STATUS, this._options.statusHtml); + + //construct tools list + var aTools = eval(this._options.toolsItems); + var sTools = ""; + + for(var i = 0; i < aTools.length; i++) { + var oTool = aTools[i]; + if(oTool.name && oTool.title) + var sTool = this._options.toolsItemHtml; + var sTool = h.replaceAll(sTool, WYMeditor.TOOL_NAME, oTool.name); + sTool = h.replaceAll(sTool, WYMeditor.TOOL_TITLE, this._options.stringDelimiterLeft + + oTool.title + + this._options.stringDelimiterRight); + sTool = h.replaceAll(sTool, WYMeditor.TOOL_CLASS, oTool.css); + sTools += sTool; + } + + boxHtml = h.replaceAll(boxHtml, WYMeditor.TOOLS_ITEMS, sTools); + + //construct classes list + var aClasses = eval(this._options.classesItems); + var sClasses = ""; + + for(var i = 0; i < aClasses.length; i++) { + var oClass = aClasses[i]; + if(oClass.name && oClass.title) + var sClass = this._options.classesItemHtml; + sClass = h.replaceAll(sClass, WYMeditor.CLASS_NAME, oClass.name); + sClass = h.replaceAll(sClass, WYMeditor.CLASS_TITLE, oClass.title); + sClasses += sClass; + } + + boxHtml = h.replaceAll(boxHtml, WYMeditor.CLASSES_ITEMS, sClasses); + + //construct containers list + var aContainers = eval(this._options.containersItems); + var sContainers = ""; + + for(var i = 0; i < aContainers.length; i++) { + var oContainer = aContainers[i]; + if(oContainer.name && oContainer.title) + var sContainer = this._options.containersItemHtml; + sContainer = h.replaceAll(sContainer, WYMeditor.CONTAINER_NAME, oContainer.name); + sContainer = h.replaceAll(sContainer, WYMeditor.CONTAINER_TITLE, + this._options.stringDelimiterLeft + + oContainer.title + + this._options.stringDelimiterRight); + sContainer = h.replaceAll(sContainer, WYMeditor.CONTAINER_CLASS, oContainer.css); + sContainers += sContainer; + } + + boxHtml = h.replaceAll(boxHtml, WYMeditor.CONTAINERS_ITEMS, sContainers); + + //l10n + boxHtml = this.replaceStrings(boxHtml); + + //load html in wymbox + jQuery(this._box).html(boxHtml); + + //hide the html value + jQuery(this._box).find(this._options.htmlSelector).hide(); + + //enable the skin + this.loadSkin(); + + } +}; + +WYMeditor.editor.prototype.bindEvents = function() { + + //copy the instance + var wym = this; + + //handle click event on tools buttons + jQuery(this._box).find(this._options.toolSelector).click(function() { + wym._iframe.contentWindow.focus(); //See #154 + wym.exec(jQuery(this).attr(WYMeditor.NAME)); + return(false); + }); + + //handle click event on containers buttons + jQuery(this._box).find(this._options.containerSelector).click(function() { + wym.container(jQuery(this).attr(WYMeditor.NAME)); + return(false); + }); + + //handle keyup event on html value: set the editor value + //handle focus/blur events to check if the element has focus, see #147 + jQuery(this._box).find(this._options.htmlValSelector) + .keyup(function() { jQuery(wym._doc.body).html(jQuery(this).val());}) + .focus(function() { jQuery(this).toggleClass('hasfocus'); }) + .blur(function() { jQuery(this).toggleClass('hasfocus'); }); + + //handle click event on classes buttons + jQuery(this._box).find(this._options.classSelector).click(function() { + + var aClasses = eval(wym._options.classesItems); + var sName = jQuery(this).attr(WYMeditor.NAME); + + var oClass = WYMeditor.Helper.findByName(aClasses, sName); + + if(oClass) { + var jqexpr = oClass.expr; + wym.toggleClass(sName, jqexpr); + } + wym._iframe.contentWindow.focus(); //See #154 + return(false); + }); + + //handle event on update element + jQuery(this._options.updateSelector) + .bind(this._options.updateEvent, function() { + wym.update(); + }); +}; + +WYMeditor.editor.prototype.ready = function() { + return(this._doc != null); +}; + + +/********** METHODS **********/ + +/* @name box + * @description Returns the WYMeditor container + */ +WYMeditor.editor.prototype.box = function() { + return(this._box); +}; + +/* @name html + * @description Get/Set the html value + */ +WYMeditor.editor.prototype.html = function(html) { + + if(typeof html === 'string') jQuery(this._doc.body).html(html); + else return(jQuery(this._doc.body).html()); +}; + +/* @name xhtml + * @description Cleans up the HTML + */ +WYMeditor.editor.prototype.xhtml = function() { + return this.parser.parse(this.html()); +}; + +/* @name exec + * @description Executes a button command + */ +WYMeditor.editor.prototype.exec = function(cmd) { + + //base function for execCommand + //open a dialog or exec + switch(cmd) { + case WYMeditor.CREATE_LINK: + var container = this.container(); + if(container || this._selected_image) this.dialog(WYMeditor.DIALOG_LINK); + break; + + case WYMeditor.INSERT_IMAGE: + this.dialog(WYMeditor.DIALOG_IMAGE); + break; + + case WYMeditor.INSERT_TABLE: + this.dialog(WYMeditor.DIALOG_TABLE); + break; + + case WYMeditor.PASTE: + this.dialog(WYMeditor.DIALOG_PASTE); + break; + + case WYMeditor.TOGGLE_HTML: + this.update(); + this.toggleHtml(); + break; + + case WYMeditor.PREVIEW: + this.dialog(WYMeditor.PREVIEW, this._options.dialogFeaturesPreview); + break; + + default: + this._exec(cmd); + break; + } +}; + +/* @name container + * @description Get/Set the selected container + */ +WYMeditor.editor.prototype.container = function(sType) { + + if(sType) { + + var container = null; + + if(sType.toLowerCase() == WYMeditor.TH) { + + container = this.container(); + + //find the TD or TH container + switch(container.tagName.toLowerCase()) { + + case WYMeditor.TD: case WYMeditor.TH: + break; + default: + var aTypes = new Array(WYMeditor.TD,WYMeditor.TH); + container = this.findUp(this.container(), aTypes); + break; + } + + //if it exists, switch + if(container!=null) { + + sType = (container.tagName.toLowerCase() == WYMeditor.TD)? WYMeditor.TH: WYMeditor.TD; + this.switchTo(container,sType); + this.update(); + } + } else { + + //set the container type + var aTypes=new Array(WYMeditor.P,WYMeditor.H1,WYMeditor.H2,WYMeditor.H3,WYMeditor.H4,WYMeditor.H5, + WYMeditor.H6,WYMeditor.PRE,WYMeditor.BLOCKQUOTE); + container = this.findUp(this.container(), aTypes); + + if(container) { + + var newNode = null; + + //blockquotes must contain a block level element + if(sType.toLowerCase() == WYMeditor.BLOCKQUOTE) { + + var blockquote = this.findUp(this.container(), WYMeditor.BLOCKQUOTE); + + if(blockquote == null) { + + newNode = this._doc.createElement(sType); + container.parentNode.insertBefore(newNode,container); + newNode.appendChild(container); + this.setFocusToNode(newNode.firstChild); + + } else { + + var nodes = blockquote.childNodes; + var lgt = nodes.length; + var firstNode = null; + + if(lgt > 0) firstNode = nodes.item(0); + for(var x=0; x<lgt; x++) { + blockquote.parentNode.insertBefore(nodes.item(0),blockquote); + } + blockquote.parentNode.removeChild(blockquote); + if(firstNode) this.setFocusToNode(firstNode); + } + } + + else this.switchTo(container,sType); + + this.update(); + } + } + } + else return(this.selected()); +}; + +/* @name toggleClass + * @description Toggles class on selected element, or one of its parents + */ +WYMeditor.editor.prototype.toggleClass = function(sClass, jqexpr) { + + var container = (this._selected_image + ? this._selected_image + : jQuery(this.selected())); + container = jQuery(container).parentsOrSelf(jqexpr); + jQuery(container).toggleClass(sClass); + + if(!jQuery(container).attr(WYMeditor.CLASS)) jQuery(container).removeAttr(this._class); + +}; + +/* @name findUp + * @description Returns the first parent or self container, based on its type + */ +WYMeditor.editor.prototype.findUp = function(node, filter) { + + //filter is a string or an array of strings + + if(node) { + + var tagname = node.tagName.toLowerCase(); + + if(typeof(filter) == WYMeditor.STRING) { + + while(tagname != filter && tagname != WYMeditor.BODY) { + + node = node.parentNode; + tagname = node.tagName.toLowerCase(); + } + + } else { + + var bFound = false; + + while(!bFound && tagname != WYMeditor.BODY) { + for(var i = 0; i < filter.length; i++) { + if(tagname == filter[i]) { + bFound = true; + break; + } + } + if(!bFound) { + node = node.parentNode; + tagname = node.tagName.toLowerCase(); + } + } + } + + if(tagname != WYMeditor.BODY) return(node); + else return(null); + + } else return(null); +}; + +/* @name switchTo + * @description Switch the node's type + */ +WYMeditor.editor.prototype.switchTo = function(node,sType) { + + var newNode = this._doc.createElement(sType); + var html = jQuery(node).html(); + node.parentNode.replaceChild(newNode,node); + jQuery(newNode).html(html); + this.setFocusToNode(newNode); +}; + +WYMeditor.editor.prototype.replaceStrings = function(sVal) { + //check if the language file has already been loaded + //if not, get it via a synchronous ajax call + if(!WYMeditor.STRINGS[this._options.lang]) { + try { + eval(jQuery.ajax({url:this._options.langPath + + this._options.lang + '.js', async:false}).responseText); + } catch(e) { + WYMeditor.console.error("WYMeditor: error while parsing language file."); + return sVal; + } + } + + //replace all the strings in sVal and return it + for (var key in WYMeditor.STRINGS[this._options.lang]) { + sVal = WYMeditor.Helper.replaceAll(sVal, this._options.stringDelimiterLeft + key + + this._options.stringDelimiterRight, + WYMeditor.STRINGS[this._options.lang][key]); + }; + return(sVal); +}; + +WYMeditor.editor.prototype.encloseString = function(sVal) { + + return(this._options.stringDelimiterLeft + + sVal + + this._options.stringDelimiterRight); +}; + +/* @name status + * @description Prints a status message + */ +WYMeditor.editor.prototype.status = function(sMessage) { + + //print status message + jQuery(this._box).find(this._options.statusSelector).html(sMessage); +}; + +/* @name update + * @description Updates the element and textarea values + */ +WYMeditor.editor.prototype.update = function() { + + var html = this.xhtml(); + jQuery(this._element).val(html); + jQuery(this._box).find(this._options.htmlValSelector).not('.hasfocus').val(html); //#147 +}; + +/* @name dialog + * @description Opens a dialog box + */ +WYMeditor.editor.prototype.dialog = function( dialogType, dialogFeatures, bodyHtml ) { + + var features = dialogFeatures || this._wym._options.dialogFeatures; + var wDialog = window.open('', 'dialog', features); + + if(wDialog) { + + var sBodyHtml = ""; + + switch( dialogType ) { + + case(WYMeditor.DIALOG_LINK): + sBodyHtml = this._options.dialogLinkHtml; + break; + case(WYMeditor.DIALOG_IMAGE): + sBodyHtml = this._options.dialogImageHtml; + break; + case(WYMeditor.DIALOG_TABLE): + sBodyHtml = this._options.dialogTableHtml; + break; + case(WYMeditor.DIALOG_PASTE): + sBodyHtml = this._options.dialogPasteHtml; + break; + case(WYMeditor.PREVIEW): + sBodyHtml = this._options.dialogPreviewHtml; + break; + + default: + sBodyHtml = bodyHtml; + } + + var h = WYMeditor.Helper; + + //construct the dialog + var dialogHtml = this._options.dialogHtml; + dialogHtml = h.replaceAll(dialogHtml, WYMeditor.BASE_PATH, this._options.basePath); + dialogHtml = h.replaceAll(dialogHtml, WYMeditor.DIRECTION, this._options.direction); + dialogHtml = h.replaceAll(dialogHtml, WYMeditor.CSS_PATH, this._options.skinPath + WYMeditor.SKINS_DEFAULT_CSS); + dialogHtml = h.replaceAll(dialogHtml, WYMeditor.WYM_PATH, this._options.wymPath); + dialogHtml = h.replaceAll(dialogHtml, WYMeditor.JQUERY_PATH, this._options.jQueryPath); + dialogHtml = h.replaceAll(dialogHtml, WYMeditor.DIALOG_TITLE, this.encloseString( dialogType )); + dialogHtml = h.replaceAll(dialogHtml, WYMeditor.DIALOG_BODY, sBodyHtml); + dialogHtml = h.replaceAll(dialogHtml, WYMeditor.INDEX, this._index); + + dialogHtml = this.replaceStrings(dialogHtml); + + var doc = wDialog.document; + doc.write(dialogHtml); + doc.close(); + } +}; + +/* @name toggleHtml + * @description Shows/Hides the HTML + */ +WYMeditor.editor.prototype.toggleHtml = function() { + jQuery(this._box).find(this._options.htmlSelector).toggle(); +}; + +WYMeditor.editor.prototype.uniqueStamp = function() { + var now = new Date(); + return("wym-" + now.getTime()); +}; + +WYMeditor.editor.prototype.paste = function(sData) { + + var sTmp; + var container = this.selected(); + + //split the data, using double newlines as the separator + var aP = sData.split(this._newLine + this._newLine); + var rExp = new RegExp(this._newLine, "g"); + + //add a P for each item + if(container && container.tagName.toLowerCase() != WYMeditor.BODY) { + for(x = aP.length - 1; x >= 0; x--) { + sTmp = aP[x]; + //simple newlines are replaced by a break + sTmp = sTmp.replace(rExp, "<br />"); + jQuery(container).after("<p>" + sTmp + "</p>"); + } + } else { + for(x = 0; x < aP.length; x++) { + sTmp = aP[x]; + //simple newlines are replaced by a break + sTmp = sTmp.replace(rExp, "<br />"); + jQuery(this._doc.body).append("<p>" + sTmp + "</p>"); + } + + } +}; + +WYMeditor.editor.prototype.insert = function(html) { + // Do we have a selection? + if (this._iframe.contentWindow.getSelection().focusNode != null) { + // Overwrite selection with provided html + this._exec( WYMeditor.INSERT_HTML, html); + } else { + // Fall back to the internal paste function if there's no selection + this.paste(html) + } +}; + +WYMeditor.editor.prototype.wrap = function(left, right) { + // Do we have a selection? + if (this._iframe.contentWindow.getSelection().focusNode != null) { + // Wrap selection with provided html + this._exec( WYMeditor.INSERT_HTML, left + this._iframe.contentWindow.getSelection().toString() + right); + } +}; + +WYMeditor.editor.prototype.unwrap = function() { + // Do we have a selection? + if (this._iframe.contentWindow.getSelection().focusNode != null) { + // Unwrap selection + this._exec( WYMeditor.INSERT_HTML, this._iframe.contentWindow.getSelection().toString() ); + } +}; + +WYMeditor.editor.prototype.setFocusToNode = function(node, toStart) { + var range = this._doc.createRange(), + selection = this._iframe.contentWindow.getSelection(); + toStart = toStart ? 0 : 1; + + range.selectNodeContents(node); + selection.addRange(range); + selection.collapse(node, toStart); + this._iframe.contentWindow.focus(); +}; + +WYMeditor.editor.prototype.addCssRules = function(doc, aCss) { + var styles = doc.styleSheets[0]; + if(styles) { + for(var i = 0; i < aCss.length; i++) { + var oCss = aCss[i]; + if(oCss.name && oCss.css) this.addCssRule(styles, oCss); + } + } +}; + +/********** CONFIGURATION **********/ + +WYMeditor.editor.prototype.computeBasePath = function() { + return jQuery(jQuery.grep(jQuery('script'), function(s){ + return (s.src && s.src.match(/jquery\.wymeditor(\.pack|\.min|\.packed)?\.js(\?.*)?$/ )) + })).attr('src').replace(/jquery\.wymeditor(\.pack|\.min|\.packed)?\.js(\?.*)?$/, ''); +}; + +WYMeditor.editor.prototype.computeWymPath = function() { + return jQuery(jQuery.grep(jQuery('script'), function(s){ + return (s.src && s.src.match(/jquery\.wymeditor(\.pack|\.min|\.packed)?\.js(\?.*)?$/ )) + })).attr('src'); +}; + +WYMeditor.editor.prototype.computeJqueryPath = function() { + return jQuery(jQuery.grep(jQuery('script'), function(s){ + return (s.src && s.src.match(/jquery(-(.*)){0,1}(\.pack|\.min|\.packed)?\.js(\?.*)?$/ )) + })).attr('src'); +}; + +WYMeditor.editor.prototype.computeCssPath = function() { + return jQuery(jQuery.grep(jQuery('link'), function(s){ + return (s.href && s.href.match(/wymeditor\/skins\/(.*)screen\.css(\?.*)?$/ )) + })).attr('href'); +}; + +WYMeditor.editor.prototype.configureEditorUsingRawCss = function() { + + var CssParser = new WYMeditor.WymCssParser(); + if(this._options.stylesheet){ + CssParser.parse(jQuery.ajax({url: this._options.stylesheet,async:false}).responseText); + }else{ + CssParser.parse(this._options.styles, false); + } + + if(this._options.classesItems.length == 0) { + this._options.classesItems = CssParser.css_settings.classesItems; + } + if(this._options.editorStyles.length == 0) { + this._options.editorStyles = CssParser.css_settings.editorStyles; + } + if(this._options.dialogStyles.length == 0) { + this._options.dialogStyles = CssParser.css_settings.dialogStyles; + } +}; + +/********** EVENTS **********/ + +WYMeditor.editor.prototype.listen = function() { + //don't use jQuery.find() on the iframe body + //because of MSIE + jQuery + expando issue (#JQ1143) + //jQuery(this._doc.body).find("*").bind("mouseup", this.mouseup); + + jQuery(this._doc.body).bind("mousedown", this.mousedown); +}; + +WYMeditor.editor.prototype.mousedown = function(evt) { + var wym = WYMeditor.INSTANCES[this.ownerDocument.title]; + wym._selected_image = (evt.target.tagName.toLowerCase() == WYMeditor.IMG) ? evt.target : null; +}; + +/********** SKINS **********/ + +/* + * Function: WYMeditor.loadCss + * Loads a stylesheet in the document. + * + * Parameters: + * href - The CSS path. + */ +WYMeditor.loadCss = function(href) { + + var link = document.createElement('link'); + link.rel = 'stylesheet'; + link.href = href; + + var head = jQuery('head').get(0); + head.appendChild(link); +}; + +/* + * Function: WYMeditor.editor.loadSkin + * Loads the skin CSS and initialization script (if needed). + */ +WYMeditor.editor.prototype.loadSkin = function() { + + //does the user want to automatically load the CSS (default: yes)? + //we also test if it hasn't been already loaded by another instance + //see below for a better (second) test + if(this._options.loadSkin && !WYMeditor.SKINS[this._options.skin]) { + + //check if it hasn't been already loaded + //so we don't load it more than once + //(we check the existing <link> elements) + + var found = false; + var rExp = new RegExp(this._options.skin + + '\/' + WYMeditor.SKINS_DEFAULT_CSS + '$'); + + jQuery('link').each( function() { + if(this.href.match(rExp)) found = true; + }); + + //load it, using the skin path + if(!found) WYMeditor.loadCss( this._options.skinPath + + WYMeditor.SKINS_DEFAULT_CSS ); + } + + //put the classname (ex. wym_skin_default) on wym_box + jQuery(this._box).addClass( "wym_skin_" + this._options.skin ); + + //does the user want to use some JS to initialize the skin (default: yes)? + //also check if it hasn't already been loaded by another instance + if(this._options.initSkin && !WYMeditor.SKINS[this._options.skin]) { + + eval(jQuery.ajax({url:this._options.skinPath + + WYMeditor.SKINS_DEFAULT_JS, async:false}).responseText); + } + + //init the skin, if needed + if(WYMeditor.SKINS[this._options.skin] + && WYMeditor.SKINS[this._options.skin].init) + WYMeditor.SKINS[this._options.skin].init(this); + +}; + + +/********** DIALOGS **********/ + +WYMeditor.INIT_DIALOG = function(index) { + + var wym = window.opener.WYMeditor.INSTANCES[index]; + var doc = window.document; + var selected = wym.selected(); + var dialogType = jQuery(wym._options.dialogTypeSelector).val(); + var sStamp = wym.uniqueStamp(); + + switch(dialogType) { + + case WYMeditor.DIALOG_LINK: + //ensure that we select the link to populate the fields + if(selected && selected.tagName && selected.tagName.toLowerCase != WYMeditor.A) + selected = jQuery(selected).parentsOrSelf(WYMeditor.A); + + //fix MSIE selection if link image has been clicked + if(!selected && wym._selected_image) + selected = jQuery(wym._selected_image).parentsOrSelf(WYMeditor.A); + break; + + } + + //pre-init functions + if(jQuery.isFunction(wym._options.preInitDialog)) + wym._options.preInitDialog(wym,window); + + //add css rules from options + var styles = doc.styleSheets[0]; + var aCss = eval(wym._options.dialogStyles); + + wym.addCssRules(doc, aCss); + + //auto populate fields if selected container (e.g. A) + if(selected) { + jQuery(wym._options.hrefSelector).val(jQuery(selected).attr(WYMeditor.HREF)); + jQuery(wym._options.srcSelector).val(jQuery(selected).attr(WYMeditor.SRC)); + jQuery(wym._options.titleSelector).val(jQuery(selected).attr(WYMeditor.TITLE)); + jQuery(wym._options.altSelector).val(jQuery(selected).attr(WYMeditor.ALT)); + } + + //auto populate image fields if selected image + if(wym._selected_image) { + jQuery(wym._options.dialogImageSelector + " " + wym._options.srcSelector) + .val(jQuery(wym._selected_image).attr(WYMeditor.SRC)); + jQuery(wym._options.dialogImageSelector + " " + wym._options.titleSelector) + .val(jQuery(wym._selected_image).attr(WYMeditor.TITLE)); + jQuery(wym._options.dialogImageSelector + " " + wym._options.altSelector) + .val(jQuery(wym._selected_image).attr(WYMeditor.ALT)); + } + + jQuery(wym._options.dialogLinkSelector + " " + + wym._options.submitSelector).click(function() { + + var sUrl = jQuery(wym._options.hrefSelector).val(); + if(sUrl.length > 0) { + var link; + + if (selected[0] && selected[0].tagName.toLowerCase() == WYMeditor.A) { + link = selected; + } else { + wym._exec(WYMeditor.CREATE_LINK, sStamp); + link = jQuery("a[href=" + sStamp + "]", wym._doc.body); + } + + link.attr(WYMeditor.HREF, sUrl) + .attr(WYMeditor.TITLE, jQuery(wym._options.titleSelector).val()); + + } + window.close(); + }); + + jQuery(wym._options.dialogImageSelector + " " + + wym._options.submitSelector).click(function() { + + var sUrl = jQuery(wym._options.srcSelector).val(); + if(sUrl.length > 0) { + + wym._exec(WYMeditor.INSERT_IMAGE, sStamp); + + jQuery("img[src$=" + sStamp + "]", wym._doc.body) + .attr(WYMeditor.SRC, sUrl) + .attr(WYMeditor.TITLE, jQuery(wym._options.titleSelector).val()) + .attr(WYMeditor.ALT, jQuery(wym._options.altSelector).val()); + } + window.close(); + }); + + jQuery(wym._options.dialogTableSelector + " " + + wym._options.submitSelector).click(function() { + + var iRows = jQuery(wym._options.rowsSelector).val(); + var iCols = jQuery(wym._options.colsSelector).val(); + + if(iRows > 0 && iCols > 0) { + + var table = wym._doc.createElement(WYMeditor.TABLE); + var newRow = null; + var newCol = null; + + var sCaption = jQuery(wym._options.captionSelector).val(); + + //we create the caption + var newCaption = table.createCaption(); + newCaption.innerHTML = sCaption; + + //we create the rows and cells + for(x=0; x<iRows; x++) { + newRow = table.insertRow(x); + for(y=0; y<iCols; y++) {newRow.insertCell(y);} + } + + //set the summary attr + jQuery(table).attr('summary', + jQuery(wym._options.summarySelector).val()); + + //append the table after the selected container + var node = jQuery(wym.findUp(wym.container(), + WYMeditor.MAIN_CONTAINERS)).get(0); + if(!node || !node.parentNode) jQuery(wym._doc.body).append(table); + else jQuery(node).after(table); + } + window.close(); + }); + + jQuery(wym._options.dialogPasteSelector + " " + + wym._options.submitSelector).click(function() { + + var sText = jQuery(wym._options.textSelector).val(); + wym.paste(sText); + window.close(); + }); + + jQuery(wym._options.dialogPreviewSelector + " " + + wym._options.previewSelector) + .html(wym.xhtml()); + + //cancel button + jQuery(wym._options.cancelSelector).mousedown(function() { + window.close(); + }); + + //pre-init functions + if(jQuery.isFunction(wym._options.postInitDialog)) + wym._options.postInitDialog(wym,window); + +}; + +/********** XHTML LEXER/PARSER **********/ + +/* +* @name xml +* @description Use these methods to generate XML and XHTML compliant tags and +* escape tag attributes correctly +* @author Bermi Ferrer - http://bermi.org +* @author David Heinemeier Hansson http://loudthinking.com +*/ +WYMeditor.XmlHelper = function() +{ + this._entitiesDiv = document.createElement('div'); + return this; +}; + + +/* +* @name tag +* @description +* Returns an empty HTML tag of type *name* which by default is XHTML +* compliant. Setting *open* to true will create an open tag compatible +* with HTML 4.0 and below. Add HTML attributes by passing an attributes +* array to *options*. For attributes with no value like (disabled and +* readonly), give it a value of true in the *options* array. +* +* Examples: +* +* this.tag('br') +* # => <br /> +* this.tag ('br', false, true) +* # => <br> +* this.tag ('input', jQuery({type:'text',disabled:true }) ) +* # => <input type="text" disabled="disabled" /> +*/ +WYMeditor.XmlHelper.prototype.tag = function(name, options, open) +{ + options = options || false; + open = open || false; + return '<'+name+(options ? this.tagOptions(options) : '')+(open ? '>' : ' />'); +}; + +/* +* @name contentTag +* @description +* Returns a XML block tag of type *name* surrounding the *content*. Add +* XML attributes by passing an attributes array to *options*. For attributes +* with no value like (disabled and readonly), give it a value of true in +* the *options* array. You can use symbols or strings for the attribute names. +* +* this.contentTag ('p', 'Hello world!' ) +* # => <p>Hello world!</p> +* this.contentTag('div', this.contentTag('p', "Hello world!"), jQuery({class : "strong"})) +* # => <div class="strong"><p>Hello world!</p></div> +* this.contentTag("select", options, jQuery({multiple : true})) +* # => <select multiple="multiple">...options...</select> +*/ +WYMeditor.XmlHelper.prototype.contentTag = function(name, content, options) +{ + options = options || false; + return '<'+name+(options ? this.tagOptions(options) : '')+'>'+content+'</'+name+'>'; +}; + +/* +* @name cdataSection +* @description +* Returns a CDATA section for the given +content+. CDATA sections +* are used to escape blocks of text containing characters which would +* otherwise be recognized as markup. CDATA sections begin with the string +* <tt><![CDATA[</tt> and } with (and may not contain) the string +* <tt>]]></tt>. +*/ +WYMeditor.XmlHelper.prototype.cdataSection = function(content) +{ + return '<![CDATA['+content+']]>'; +}; + + +/* +* @name escapeOnce +* @description +* Returns the escaped +xml+ without affecting existing escaped entities. +* +* this.escapeOnce( "1 > 2 & 3") +* # => "1 > 2 & 3" +*/ +WYMeditor.XmlHelper.prototype.escapeOnce = function(xml) +{ + return this._fixDoubleEscape(this.escapeEntities(xml)); +}; + +/* +* @name _fixDoubleEscape +* @description +* Fix double-escaped entities, such as &amp;, &#123;, etc. +*/ +WYMeditor.XmlHelper.prototype._fixDoubleEscape = function(escaped) +{ + return escaped.replace(/&([a-z]+|(#\d+));/ig, "&$1;"); +}; + +/* +* @name tagOptions +* @description +* Takes an array like the one generated by Tag.parseAttributes +* [["src", "http://www.editam.com/?a=b&c=d&f=g"], ["title", "Editam, <Simplified> CMS"]] +* or an object like {src:"http://www.editam.com/?a=b&c=d&f=g", title:"Editam, <Simplified> CMS"} +* and returns a string properly escaped like +* ' src = "http://www.editam.com/?a=b&c=d&f=g" title = "Editam, <Simplified> CMS"' +* which is valid for strict XHTML +*/ +WYMeditor.XmlHelper.prototype.tagOptions = function(options) +{ + var xml = this; + xml._formated_options = ''; + + for (var key in options) { + var formated_options = ''; + var value = options[key]; + if(typeof value != 'function' && value.length > 0) { + + if(parseInt(key) == key && typeof value == 'object'){ + key = value.shift(); + value = value.pop(); + } + if(key != '' && value != ''){ + xml._formated_options += ' '+key+'="'+xml.escapeOnce(value)+'"'; + } + } + } + return xml._formated_options; +}; + +/* +* @name escapeEntities +* @description +* Escapes XML/HTML entities <, >, & and ". If seccond parameter is set to false it +* will not escape ". If set to true it will also escape ' +*/ +WYMeditor.XmlHelper.prototype.escapeEntities = function(string, escape_quotes) +{ + this._entitiesDiv.innerHTML = string; + this._entitiesDiv.textContent = string; + var result = this._entitiesDiv.innerHTML; + if(typeof escape_quotes == 'undefined'){ + if(escape_quotes != false) result = result.replace('"', '"'); + if(escape_quotes == true) result = result.replace('"', '''); + } + return result; +}; + +/* +* Parses a string conatining tag attributes and values an returns an array formated like +* [["src", "http://www.editam.com"], ["title", "Editam, Simplified CMS"]] +*/ +WYMeditor.XmlHelper.prototype.parseAttributes = function(tag_attributes) +{ + // Use a compounded regex to match single quoted, double quoted and unquoted attribute pairs + var result = []; + var matches = tag_attributes.split(/((=\s*")(")("))|((=\s*\')(\')(\'))|((=\s*[^>\s]*))/g); + if(matches.toString() != tag_attributes){ + for (var k in matches) { + var v = matches[k]; + if(typeof v != 'function' && v.length != 0){ + var re = new RegExp('(\\w+)\\s*'+v); + if(match = tag_attributes.match(re) ){ + var value = v.replace(/^[\s=]+/, ""); + var delimiter = value.charAt(0); + delimiter = delimiter == '"' ? '"' : (delimiter=="'"?"'":''); + if(delimiter != ''){ + value = delimiter == '"' ? value.replace(/^"|"+$/g, '') : value.replace(/^'|'+$/g, ''); + } + tag_attributes = tag_attributes.replace(match[0],''); + result.push([match[1] , value]); + } + } + } + } + return result; +}; + +/** +* XhtmlValidator for validating tag attributes +* +* @author Bermi Ferrer - http://bermi.org +*/ +WYMeditor.XhtmlValidator = { + "_attributes": + { + "core": + { + "except":[ + "base", + "head", + "html", + "meta", + "param", + "script", + "style", + "title" + ], + "attributes":[ + "class", + "id", + "style", + "title", + "accesskey", + "tabindex" + ] + }, + "language": + { + "except":[ + "base", + "br", + "hr", + "iframe", + "param", + "script" + ], + "attributes": + { + "dir":[ + "ltr", + "rtl" + ], + "0":"lang", + "1":"xml:lang" + } + }, + "keyboard": + { + "attributes": + { + "accesskey":/^(\w){1}$/, + "tabindex":/^(\d)+$/ + } + } + }, + "_events": + { + "window": + { + "only":[ + "body" + ], + "attributes":[ + "onload", + "onunload" + ] + }, + "form": + { + "only":[ + "form", + "input", + "textarea", + "select", + "a", + "label", + "button" + ], + "attributes":[ + "onchange", + "onsubmit", + "onreset", + "onselect", + "onblur", + "onfocus" + ] + }, + "keyboard": + { + "except":[ + "base", + "bdo", + "br", + "frame", + "frameset", + "head", + "html", + "iframe", + "meta", + "param", + "script", + "style", + "title" + ], + "attributes":[ + "onkeydown", + "onkeypress", + "onkeyup" + ] + }, + "mouse": + { + "except":[ + "base", + "bdo", + "br", + "head", + "html", + "meta", + "param", + "script", + "style", + "title" + ], + "attributes":[ + "onclick", + "ondblclick", + "onmousedown", + "onmousemove", + "onmouseover", + "onmouseout", + "onmouseup" + ] + } + }, + "_tags": + { + "a": + { + "attributes": + { + "0":"charset", + "1":"coords", + "2":"href", + "3":"hreflang", + "4":"name", + "rel":/^(alternate|designates|stylesheet|start|next|prev|contents|index|glossary|copyright|chapter|section|subsection|appendix|help|bookmark| |shortcut|icon)+$/, + "rev":/^(alternate|designates|stylesheet|start|next|prev|contents|index|glossary|copyright|chapter|section|subsection|appendix|help|bookmark| |shortcut|icon)+$/, + "shape":/^(rect|rectangle|circ|circle|poly|polygon)$/, + "5":"type" + } + }, + "0":"abbr", + "1":"acronym", + "2":"address", + "area": + { + "attributes": + { + "0":"alt", + "1":"coords", + "2":"href", + "nohref":/^(true|false)$/, + "shape":/^(rect|rectangle|circ|circle|poly|polygon)$/ + }, + "required":[ + "alt" + ] + }, + "3":"b", + "base": + { + "attributes":[ + "href" + ], + "required":[ + "href" + ] + }, + "bdo": + { + "attributes": + { + "dir":/^(ltr|rtl)$/ + }, + "required":[ + "dir" + ] + }, + "4":"big", + "blockquote": + { + "attributes":[ + "cite" + ] + }, + "5":"body", + "6":"br", + "button": + { + "attributes": + { + "disabled":/^(disabled)$/, + "type":/^(button|reset|submit)$/, + "0":"value" + }, + "inside":"form" + }, + "7":"caption", + "8":"cite", + "9":"code", + "col": + { + "attributes": + { + "align":/^(right|left|center|justify)$/, + "0":"char", + "1":"charoff", + "span":/^(\d)+$/, + "valign":/^(top|middle|bottom|baseline)$/, + "2":"width" + }, + "inside":"colgroup" + }, + "colgroup": + { + "attributes": + { + "align":/^(right|left|center|justify)$/, + "0":"char", + "1":"charoff", + "span":/^(\d)+$/, + "valign":/^(top|middle|bottom|baseline)$/, + "2":"width" + } + }, + "10":"dd", + "del": + { + "attributes": + { + "0":"cite", + "datetime":/^([0-9]){8}/ + } + }, + "11":"div", + "12":"dfn", + "13":"dl", + "14":"dt", + "15":"em", + "fieldset": + { + "inside":"form" + }, + "form": + { + "attributes": + { + "0":"action", + "1":"accept", + "2":"accept-charset", + "3":"enctype", + "method":/^(get|post)$/ + }, + "required":[ + "action" + ] + }, + "head": + { + "attributes":[ + "profile" + ] + }, + "16":"h1", + "17":"h2", + "18":"h3", + "19":"h4", + "20":"h5", + "21":"h6", + "22":"hr", + "html": + { + "attributes":[ + "xmlns" + ] + }, + "23":"i", + "img": + { + "attributes":[ + "alt", + "src", + "height", + "ismap", + "longdesc", + "usemap", + "width" + ], + "required":[ + "alt", + "src" + ] + }, + "input": + { + "attributes": + { + "0":"accept", + "1":"alt", + "checked":/^(checked)$/, + "disabled":/^(disabled)$/, + "maxlength":/^(\d)+$/, + "2":"name", + "readonly":/^(readonly)$/, + "size":/^(\d)+$/, + "3":"src", + "type":/^(button|checkbox|file|hidden|image|password|radio|reset|submit|text)$/, + "4":"value" + }, + "inside":"form" + }, + "ins": + { + "attributes": + { + "0":"cite", + "datetime":/^([0-9]){8}/ + } + }, + "24":"kbd", + "label": + { + "attributes":[ + "for" + ], + "inside":"form" + }, + "25":"legend", + "26":"li", + "link": + { + "attributes": + { + "0":"charset", + "1":"href", + "2":"hreflang", + "media":/^(all|braille|print|projection|screen|speech|,|;| )+$/i, + //next comment line required by Opera! + /*"rel":/^(alternate|appendix|bookmark|chapter|contents|copyright|glossary|help|home|index|next|prev|section|start|stylesheet|subsection| |shortcut|icon)+$/i,*/ + "rel":/^(alternate|appendix|bookmark|chapter|contents|copyright|glossary|help|home|index|next|prev|section|start|stylesheet|subsection| |shortcut|icon)+$/i, + "rev":/^(alternate|appendix|bookmark|chapter|contents|copyright|glossary|help|home|index|next|prev|section|start|stylesheet|subsection| |shortcut|icon)+$/i, + "3":"type" + }, + "inside":"head" + }, + "map": + { + "attributes":[ + "id", + "name" + ], + "required":[ + "id" + ] + }, + "meta": + { + "attributes": + { + "0":"content", + "http-equiv":/^(content\-type|expires|refresh|set\-cookie)$/i, + "1":"name", + "2":"scheme" + }, + "required":[ + "content" + ] + }, + "27":"noscript", + "object": + { + "attributes":[ + "archive", + "classid", + "codebase", + "codetype", + "data", + "declare", + "height", + "name", + "standby", + "type", + "usemap", + "width" + ] + }, + "28":"ol", + "optgroup": + { + "attributes": + { + "0":"label", + "disabled": /^(disabled)$/ + }, + "required":[ + "label" + ] + }, + "option": + { + "attributes": + { + "0":"label", + "disabled":/^(disabled)$/, + "selected":/^(selected)$/, + "1":"value" + }, + "inside":"select" + }, + "29":"p", + "param": + { + "attributes": + { + "0":"type", + "valuetype":/^(data|ref|object)$/, + "1":"valuetype", + "2":"value" + }, + "required":[ + "name" + ] + }, + "30":"pre", + "q": + { + "attributes":[ + "cite" + ] + }, + "31":"samp", + "script": + { + "attributes": + { + "type":/^(text\/ecmascript|text\/javascript|text\/jscript|text\/vbscript|text\/vbs|text\/xml)$/, + "0":"charset", + "defer":/^(defer)$/, + "1":"src" + }, + "required":[ + "type" + ] + }, + "select": + { + "attributes": + { + "disabled":/^(disabled)$/, + "multiple":/^(multiple)$/, + "0":"name", + "1":"size" + }, + "inside":"form" + }, + "32":"small", + "33":"span", + "34":"strong", + "style": + { + "attributes": + { + "0":"type", + "media":/^(screen|tty|tv|projection|handheld|print|braille|aural|all)$/ + }, + "required":[ + "type" + ] + }, + "35":"sub", + "36":"sup", + "table": + { + "attributes": + { + "0":"border", + "1":"cellpadding", + "2":"cellspacing", + "frame":/^(void|above|below|hsides|lhs|rhs|vsides|box|border)$/, + "rules":/^(none|groups|rows|cols|all)$/, + "3":"summary", + "4":"width" + } + }, + "tbody": + { + "attributes": + { + "align":/^(right|left|center|justify)$/, + "0":"char", + "1":"charoff", + "valign":/^(top|middle|bottom|baseline)$/ + } + }, + "td": + { + "attributes": + { + "0":"abbr", + "align":/^(left|right|center|justify|char)$/, + "1":"axis", + "2":"char", + "3":"charoff", + "colspan":/^(\d)+$/, + "4":"headers", + "rowspan":/^(\d)+$/, + "scope":/^(col|colgroup|row|rowgroup)$/, + "valign":/^(top|middle|bottom|baseline)$/ + } + }, + "textarea": + { + "attributes":[ + "cols", + "rows", + "disabled", + "name", + "readonly" + ], + "required":[ + "cols", + "rows" + ], + "inside":"form" + }, + "tfoot": + { + "attributes": + { + "align":/^(right|left|center|justify)$/, + "0":"char", + "1":"charoff", + "valign":/^(top|middle|bottom)$/, + "2":"baseline" + } + }, + "th": + { + "attributes": + { + "0":"abbr", + "align":/^(left|right|center|justify|char)$/, + "1":"axis", + "2":"char", + "3":"charoff", + "colspan":/^(\d)+$/, + "4":"headers", + "rowspan":/^(\d)+$/, + "scope":/^(col|colgroup|row|rowgroup)$/, + "valign":/^(top|middle|bottom|baseline)$/ + } + }, + "thead": + { + "attributes": + { + "align":/^(right|left|center|justify)$/, + "0":"char", + "1":"charoff", + "valign":/^(top|middle|bottom|baseline)$/ + } + }, + "37":"title", + "tr": + { + "attributes": + { + "align":/^(right|left|center|justify|char)$/, + "0":"char", + "1":"charoff", + "valign":/^(top|middle|bottom|baseline)$/ + } + }, + "38":"tt", + "39":"ul", + "40":"var" + }, + + // Temporary skiped attributes + skiped_attributes : [], + skiped_attribute_values : [], + + getValidTagAttributes: function(tag, attributes) + { + var valid_attributes = {}; + var possible_attributes = this.getPossibleTagAttributes(tag); + for(var attribute in attributes) { + var value = attributes[attribute]; + var h = WYMeditor.Helper; + if(!h.contains(this.skiped_attributes, attribute) && !h.contains(this.skiped_attribute_values, value)){ + if (typeof value != 'function' && h.contains(possible_attributes, attribute)) { + if (this.doesAttributeNeedsValidation(tag, attribute)) { + if(this.validateAttribute(tag, attribute, value)){ + valid_attributes[attribute] = value; + } + }else{ + valid_attributes[attribute] = value; + } + } + } + } + return valid_attributes; + }, + getUniqueAttributesAndEventsForTag : function(tag) + { + var result = []; + + if (this._tags[tag] && this._tags[tag]['attributes']) { + for (k in this._tags[tag]['attributes']) { + result.push(parseInt(k) == k ? this._tags[tag]['attributes'][k] : k); + } + } + return result; + }, + getDefaultAttributesAndEventsForTags : function() + { + var result = []; + for (var key in this._events){ + result.push(this._events[key]); + } + for (var key in this._attributes){ + result.push(this._attributes[key]); + } + return result; + }, + isValidTag : function(tag) + { + if(this._tags[tag]){ + return true; + } + for(var key in this._tags){ + if(this._tags[key] == tag){ + return true; + } + } + return false; + }, + getDefaultAttributesAndEventsForTag : function(tag) + { + var default_attributes = []; + if (this.isValidTag(tag)) { + var default_attributes_and_events = this.getDefaultAttributesAndEventsForTags(); + + for(var key in default_attributes_and_events) { + var defaults = default_attributes_and_events[key]; + if(typeof defaults == 'object'){ + var h = WYMeditor.Helper; + if ((defaults['except'] && h.contains(defaults['except'], tag)) || (defaults['only'] && !h.contains(defaults['only'], tag))) { + continue; + } + + var tag_defaults = defaults['attributes'] ? defaults['attributes'] : defaults['events']; + for(var k in tag_defaults) { + default_attributes.push(typeof tag_defaults[k] != 'string' ? k : tag_defaults[k]); + } + } + } + } + return default_attributes; + }, + doesAttributeNeedsValidation: function(tag, attribute) + { + return this._tags[tag] && ((this._tags[tag]['attributes'] && this._tags[tag]['attributes'][attribute]) || (this._tags[tag]['required'] && + WYMeditor.Helper.contains(this._tags[tag]['required'], attribute))); + }, + validateAttribute : function(tag, attribute, value) + { + if ( this._tags[tag] && + (this._tags[tag]['attributes'] && this._tags[tag]['attributes'][attribute] && value.length > 0 && !value.match(this._tags[tag]['attributes'][attribute])) || // invalid format + (this._tags[tag] && this._tags[tag]['required'] && WYMeditor.Helper.contains(this._tags[tag]['required'], attribute) && value.length == 0) // required attribute + ) { + return false; + } + return typeof this._tags[tag] != 'undefined'; + }, + getPossibleTagAttributes : function(tag) + { + if (!this._possible_tag_attributes) { + this._possible_tag_attributes = {}; + } + if (!this._possible_tag_attributes[tag]) { + this._possible_tag_attributes[tag] = this.getUniqueAttributesAndEventsForTag(tag).concat(this.getDefaultAttributesAndEventsForTag(tag)); + } + return this._possible_tag_attributes[tag]; + } +}; + + +/** +* Compounded regular expression. Any of +* the contained patterns could match and +* when one does, it's label is returned. +* +* Constructor. Starts with no patterns. +* @param boolean case True for case sensitive, false +* for insensitive. +* @access public +* @author Marcus Baker (http://lastcraft.com) +* @author Bermi Ferrer (http://bermi.org) +*/ +WYMeditor.ParallelRegex = function(case_sensitive) +{ + this._case = case_sensitive; + this._patterns = []; + this._labels = []; + this._regex = null; + return this; +}; + + +/** +* Adds a pattern with an optional label. +* @param string pattern Perl style regex, but ( and ) +* lose the usual meaning. +* @param string label Label of regex to be returned +* on a match. +* @access public +*/ +WYMeditor.ParallelRegex.prototype.addPattern = function(pattern, label) +{ + label = label || true; + var count = this._patterns.length; + this._patterns[count] = pattern; + this._labels[count] = label; + this._regex = null; +}; + +/** +* Attempts to match all patterns at once against +* a string. +* @param string subject String to match against. +* +* @return boolean True on success. +* @return string match First matched portion of +* subject. +* @access public +*/ +WYMeditor.ParallelRegex.prototype.match = function(subject) +{ + if (this._patterns.length == 0) { + return [false, '']; + } + var matches = subject.match(this._getCompoundedRegex()); + + if(!matches){ + return [false, '']; + } + var match = matches[0]; + for (var i = 1; i < matches.length; i++) { + if (matches[i]) { + return [this._labels[i-1], match]; + } + } + return [true, matches[0]]; +}; + +/** +* Compounds the patterns into a single +* regular expression separated with the +* "or" operator. Caches the regex. +* Will automatically escape (, ) and / tokens. +* @param array patterns List of patterns in order. +* @access private +*/ +WYMeditor.ParallelRegex.prototype._getCompoundedRegex = function() +{ + if (this._regex == null) { + for (var i = 0, count = this._patterns.length; i < count; i++) { + this._patterns[i] = '(' + this._untokenizeRegex(this._tokenizeRegex(this._patterns[i]).replace(/([\/\(\)])/g,'\\$1')) + ')'; + } + this._regex = new RegExp(this._patterns.join("|") ,this._getPerlMatchingFlags()); + } + return this._regex; +}; + +/** +* Escape lookahead/lookbehind blocks +*/ +WYMeditor.ParallelRegex.prototype._tokenizeRegex = function(regex) +{ + return regex. + replace(/\(\?(i|m|s|x|U)\)/, '~~~~~~Tk1\$1~~~~~~'). + replace(/\(\?(\-[i|m|s|x|U])\)/, '~~~~~~Tk2\$1~~~~~~'). + replace(/\(\?\=(.*)\)/, '~~~~~~Tk3\$1~~~~~~'). + replace(/\(\?\!(.*)\)/, '~~~~~~Tk4\$1~~~~~~'). + replace(/\(\?\<\=(.*)\)/, '~~~~~~Tk5\$1~~~~~~'). + replace(/\(\?\<\!(.*)\)/, '~~~~~~Tk6\$1~~~~~~'). + replace(/\(\?\:(.*)\)/, '~~~~~~Tk7\$1~~~~~~'); +}; + +/** +* Unscape lookahead/lookbehind blocks +*/ +WYMeditor.ParallelRegex.prototype._untokenizeRegex = function(regex) +{ + return regex. + replace(/~~~~~~Tk1(.{1})~~~~~~/, "(?\$1)"). + replace(/~~~~~~Tk2(.{2})~~~~~~/, "(?\$1)"). + replace(/~~~~~~Tk3(.*)~~~~~~/, "(?=\$1)"). + replace(/~~~~~~Tk4(.*)~~~~~~/, "(?!\$1)"). + replace(/~~~~~~Tk5(.*)~~~~~~/, "(?<=\$1)"). + replace(/~~~~~~Tk6(.*)~~~~~~/, "(?<!\$1)"). + replace(/~~~~~~Tk7(.*)~~~~~~/, "(?:\$1)"); +}; + + +/** +* Accessor for perl regex mode flags to use. +* @return string Perl regex flags. +* @access private +*/ +WYMeditor.ParallelRegex.prototype._getPerlMatchingFlags = function() +{ + return (this._case ? "m" : "mi"); +}; + + + +/** +* States for a stack machine. +* +* Constructor. Starts in named state. +* @param string start Starting state name. +* @access public +* @author Marcus Baker (http://lastcraft.com) +* @author Bermi Ferrer (http://bermi.org) +*/ +WYMeditor.StateStack = function(start) +{ + this._stack = [start]; + return this; +}; + +/** +* Accessor for current state. +* @return string State. +* @access public +*/ +WYMeditor.StateStack.prototype.getCurrent = function() +{ + return this._stack[this._stack.length - 1]; +}; + +/** +* Adds a state to the stack and sets it +* to be the current state. +* @param string state New state. +* @access public +*/ +WYMeditor.StateStack.prototype.enter = function(state) +{ + this._stack.push(state); +}; + +/** +* Leaves the current state and reverts +* to the previous one. +* @return boolean False if we drop off +* the bottom of the list. +* @access public +*/ +WYMeditor.StateStack.prototype.leave = function() +{ + if (this._stack.length == 1) { + return false; + } + this._stack.pop(); + return true; +}; + + +// GLOBALS +WYMeditor.LEXER_ENTER = 1; +WYMeditor.LEXER_MATCHED = 2; +WYMeditor.LEXER_UNMATCHED = 3; +WYMeditor.LEXER_EXIT = 4; +WYMeditor.LEXER_SPECIAL = 5; + + +/** +* Accepts text and breaks it into tokens. +* Some optimisation to make the sure the +* content is only scanned by the PHP regex +* parser once. Lexer modes must not start +* with leading underscores. +* +* Sets up the lexer in case insensitive matching +* by default. +* @param Parser parser Handling strategy by reference. +* @param string start Starting handler. +* @param boolean case True for case sensitive. +* @access public +* @author Marcus Baker (http://lastcraft.com) +* @author Bermi Ferrer (http://bermi.org) +*/ +WYMeditor.Lexer = function(parser, start, case_sensitive) +{ + start = start || 'accept'; + this._case = case_sensitive || false; + this._regexes = {}; + this._parser = parser; + this._mode = new WYMeditor.StateStack(start); + this._mode_handlers = {}; + this._mode_handlers[start] = start; + return this; +}; + +/** +* Adds a token search pattern for a particular +* parsing mode. The pattern does not change the +* current mode. +* @param string pattern Perl style regex, but ( and ) +* lose the usual meaning. +* @param string mode Should only apply this +* pattern when dealing with +* this type of input. +* @access public +*/ +WYMeditor.Lexer.prototype.addPattern = function(pattern, mode) +{ + var mode = mode || "accept"; + if (typeof this._regexes[mode] == 'undefined') { + this._regexes[mode] = new WYMeditor.ParallelRegex(this._case); + } + this._regexes[mode].addPattern(pattern); + if (typeof this._mode_handlers[mode] == 'undefined') { + this._mode_handlers[mode] = mode; + } +}; + +/** +* Adds a pattern that will enter a new parsing +* mode. Useful for entering parenthesis, strings, +* tags, etc. +* @param string pattern Perl style regex, but ( and ) +* lose the usual meaning. +* @param string mode Should only apply this +* pattern when dealing with +* this type of input. +* @param string new_mode Change parsing to this new +* nested mode. +* @access public +*/ +WYMeditor.Lexer.prototype.addEntryPattern = function(pattern, mode, new_mode) +{ + if (typeof this._regexes[mode] == 'undefined') { + this._regexes[mode] = new WYMeditor.ParallelRegex(this._case); + } + this._regexes[mode].addPattern(pattern, new_mode); + if (typeof this._mode_handlers[new_mode] == 'undefined') { + this._mode_handlers[new_mode] = new_mode; + } +}; + +/** +* Adds a pattern that will exit the current mode +* and re-enter the previous one. +* @param string pattern Perl style regex, but ( and ) +* lose the usual meaning. +* @param string mode Mode to leave. +* @access public +*/ +WYMeditor.Lexer.prototype.addExitPattern = function(pattern, mode) +{ + if (typeof this._regexes[mode] == 'undefined') { + this._regexes[mode] = new WYMeditor.ParallelRegex(this._case); + } + this._regexes[mode].addPattern(pattern, "__exit"); + if (typeof this._mode_handlers[mode] == 'undefined') { + this._mode_handlers[mode] = mode; + } +}; + +/** +* Adds a pattern that has a special mode. Acts as an entry +* and exit pattern in one go, effectively calling a special +* parser handler for this token only. +* @param string pattern Perl style regex, but ( and ) +* lose the usual meaning. +* @param string mode Should only apply this +* pattern when dealing with +* this type of input. +* @param string special Use this mode for this one token. +* @access public +*/ +WYMeditor.Lexer.prototype.addSpecialPattern = function(pattern, mode, special) +{ + if (typeof this._regexes[mode] == 'undefined') { + this._regexes[mode] = new WYMeditor.ParallelRegex(this._case); + } + this._regexes[mode].addPattern(pattern, '_'+special); + if (typeof this._mode_handlers[special] == 'undefined') { + this._mode_handlers[special] = special; + } +}; + +/** +* Adds a mapping from a mode to another handler. +* @param string mode Mode to be remapped. +* @param string handler New target handler. +* @access public +*/ +WYMeditor.Lexer.prototype.mapHandler = function(mode, handler) +{ + this._mode_handlers[mode] = handler; +}; + +/** +* Splits the page text into tokens. Will fail +* if the handlers report an error or if no +* content is consumed. If successful then each +* unparsed and parsed token invokes a call to the +* held listener. +* @param string raw Raw HTML text. +* @return boolean True on success, else false. +* @access public +*/ +WYMeditor.Lexer.prototype.parse = function(raw) +{ + if (typeof this._parser == 'undefined') { + return false; + } + + var length = raw.length; + var parsed; + while (typeof (parsed = this._reduce(raw)) == 'object') { + var raw = parsed[0]; + var unmatched = parsed[1]; + var matched = parsed[2]; + var mode = parsed[3]; + + if (! this._dispatchTokens(unmatched, matched, mode)) { + return false; + } + + if (raw == '') { + return true; + } + if (raw.length == length) { + return false; + } + length = raw.length; + } + if (! parsed ) { + return false; + } + + return this._invokeParser(raw, WYMeditor.LEXER_UNMATCHED); +}; + +/** +* Sends the matched token and any leading unmatched +* text to the parser changing the lexer to a new +* mode if one is listed. +* @param string unmatched Unmatched leading portion. +* @param string matched Actual token match. +* @param string mode Mode after match. A boolean +* false mode causes no change. +* @return boolean False if there was any error +* from the parser. +* @access private +*/ +WYMeditor.Lexer.prototype._dispatchTokens = function(unmatched, matched, mode) +{ + mode = mode || false; + + if (! this._invokeParser(unmatched, WYMeditor.LEXER_UNMATCHED)) { + return false; + } + + if (typeof mode == 'boolean') { + return this._invokeParser(matched, WYMeditor.LEXER_MATCHED); + } + if (this._isModeEnd(mode)) { + if (! this._invokeParser(matched, WYMeditor.LEXER_EXIT)) { + return false; + } + return this._mode.leave(); + } + if (this._isSpecialMode(mode)) { + this._mode.enter(this._decodeSpecial(mode)); + if (! this._invokeParser(matched, WYMeditor.LEXER_SPECIAL)) { + return false; + } + return this._mode.leave(); + } + this._mode.enter(mode); + + return this._invokeParser(matched, WYMeditor.LEXER_ENTER); +}; + +/** +* Tests to see if the new mode is actually to leave +* the current mode and pop an item from the matching +* mode stack. +* @param string mode Mode to test. +* @return boolean True if this is the exit mode. +* @access private +*/ +WYMeditor.Lexer.prototype._isModeEnd = function(mode) +{ + return (mode === "__exit"); +}; + +/** +* Test to see if the mode is one where this mode +* is entered for this token only and automatically +* leaves immediately afterwoods. +* @param string mode Mode to test. +* @return boolean True if this is the exit mode. +* @access private +*/ +WYMeditor.Lexer.prototype._isSpecialMode = function(mode) +{ + return (mode.substring(0,1) == "_"); +}; + +/** +* Strips the magic underscore marking single token +* modes. +* @param string mode Mode to decode. +* @return string Underlying mode name. +* @access private +*/ +WYMeditor.Lexer.prototype._decodeSpecial = function(mode) +{ + return mode.substring(1); +}; + +/** +* Calls the parser method named after the current +* mode. Empty content will be ignored. The lexer +* has a parser handler for each mode in the lexer. +* @param string content Text parsed. +* @param boolean is_match Token is recognised rather +* than unparsed data. +* @access private +*/ +WYMeditor.Lexer.prototype._invokeParser = function(content, is_match) +{ + + if (content === '') { + return true; + } + var current = this._mode.getCurrent(); + var handler = this._mode_handlers[current]; + var result; + eval('result = this._parser.' + handler + '(content, is_match);'); + return result; +}; + +/** +* Tries to match a chunk of text and if successful +* removes the recognised chunk and any leading +* unparsed data. Empty strings will not be matched. +* @param string raw The subject to parse. This is the +* content that will be eaten. +* @return array/boolean Three item list of unparsed +* content followed by the +* recognised token and finally the +* action the parser is to take. +* True if no match, false if there +* is a parsing error. +* @access private +*/ +WYMeditor.Lexer.prototype._reduce = function(raw) +{ + var matched = this._regexes[this._mode.getCurrent()].match(raw); + var match = matched[1]; + var action = matched[0]; + if (action) { + var unparsed_character_count = raw.indexOf(match); + var unparsed = raw.substr(0, unparsed_character_count); + raw = raw.substring(unparsed_character_count + match.length); + return [raw, unparsed, match, action]; + } + return true; +}; + + + +/** +* This are the rules for breaking the XHTML code into events +* handled by the provided parser. +* +* @author Marcus Baker (http://lastcraft.com) +* @author Bermi Ferrer (http://bermi.org) +*/ +WYMeditor.XhtmlLexer = function(parser) +{ + jQuery.extend(this, new WYMeditor.Lexer(parser, 'Text')); + + this.mapHandler('Text', 'Text'); + + this.addTokens(); + + this.init(); + + return this; +}; + + +WYMeditor.XhtmlLexer.prototype.init = function() +{ +}; + +WYMeditor.XhtmlLexer.prototype.addTokens = function() +{ + this.addCommentTokens('Text'); + this.addScriptTokens('Text'); + this.addCssTokens('Text'); + this.addTagTokens('Text'); +}; + +WYMeditor.XhtmlLexer.prototype.addCommentTokens = function(scope) +{ + this.addEntryPattern("<!--", scope, 'Comment'); + this.addExitPattern("-->", 'Comment'); +}; + +WYMeditor.XhtmlLexer.prototype.addScriptTokens = function(scope) +{ + this.addEntryPattern("<script", scope, 'Script'); + this.addExitPattern("</script>", 'Script'); +}; + +WYMeditor.XhtmlLexer.prototype.addCssTokens = function(scope) +{ + this.addEntryPattern("<style", scope, 'Css'); + this.addExitPattern("</style>", 'Css'); +}; + +WYMeditor.XhtmlLexer.prototype.addTagTokens = function(scope) +{ + this.addSpecialPattern("<\\s*[a-z0-9:\-]+\\s*>", scope, 'OpeningTag'); + this.addEntryPattern("<[a-z0-9:\-]+"+'[\\\/ \\\>]+', scope, 'OpeningTag'); + this.addInTagDeclarationTokens('OpeningTag'); + + this.addSpecialPattern("</\\s*[a-z0-9:\-]+\\s*>", scope, 'ClosingTag'); + +}; + +WYMeditor.XhtmlLexer.prototype.addInTagDeclarationTokens = function(scope) +{ + this.addSpecialPattern('\\s+', scope, 'Ignore'); + + this.addAttributeTokens(scope); + + this.addExitPattern('/>', scope); + this.addExitPattern('>', scope); + +}; + +WYMeditor.XhtmlLexer.prototype.addAttributeTokens = function(scope) +{ + this.addSpecialPattern("\\s*[a-z-_0-9]*:?[a-z-_0-9]+\\s*(?=\=)\\s*", scope, 'TagAttributes'); + + this.addEntryPattern('=\\s*"', scope, 'DoubleQuotedAttribute'); + this.addPattern("\\\\\"", 'DoubleQuotedAttribute'); + this.addExitPattern('"', 'DoubleQuotedAttribute'); + + this.addEntryPattern("=\\s*'", scope, 'SingleQuotedAttribute'); + this.addPattern("\\\\'", 'SingleQuotedAttribute'); + this.addExitPattern("'", 'SingleQuotedAttribute'); + + this.addSpecialPattern('=\\s*[^>\\s]*', scope, 'UnquotedAttribute'); +}; + + + +/** +* XHTML Parser. +* +* This XHTML parser will trigger the events available on on +* current SaxListener +* +* @author Bermi Ferrer (http://bermi.org) +*/ +WYMeditor.XhtmlParser = function(Listener, mode) +{ + var mode = mode || 'Text'; + this._Lexer = new WYMeditor.XhtmlLexer(this); + this._Listener = Listener; + this._mode = mode; + this._matches = []; + this._last_match = ''; + this._current_match = ''; + + return this; +}; + +WYMeditor.XhtmlParser.prototype.parse = function(raw) +{ + this._Lexer.parse(this.beforeParsing(raw)); + return this.afterParsing(this._Listener.getResult()); +}; + +WYMeditor.XhtmlParser.prototype.beforeParsing = function(raw) +{ + if(raw.match(/class="MsoNormal"/) || raw.match(/ns = "urn:schemas-microsoft-com/)){ + // Usefull for cleaning up content pasted from other sources (MSWord) + this._Listener.avoidStylingTagsAndAttributes(); + } + return this._Listener.beforeParsing(raw); +}; + +WYMeditor.XhtmlParser.prototype.afterParsing = function(parsed) +{ + if(this._Listener._avoiding_tags_implicitly){ + this._Listener.allowStylingTagsAndAttributes(); + } + return this._Listener.afterParsing(parsed); +}; + + +WYMeditor.XhtmlParser.prototype.Ignore = function(match, state) +{ + return true; +}; + +WYMeditor.XhtmlParser.prototype.Text = function(text) +{ + this._Listener.addContent(text); + return true; +}; + +WYMeditor.XhtmlParser.prototype.Comment = function(match, status) +{ + return this._addNonTagBlock(match, status, 'addComment'); +}; + +WYMeditor.XhtmlParser.prototype.Script = function(match, status) +{ + return this._addNonTagBlock(match, status, 'addScript'); +}; + +WYMeditor.XhtmlParser.prototype.Css = function(match, status) +{ + return this._addNonTagBlock(match, status, 'addCss'); +}; + +WYMeditor.XhtmlParser.prototype._addNonTagBlock = function(match, state, type) +{ + switch (state){ + case WYMeditor.LEXER_ENTER: + this._non_tag = match; + break; + case WYMeditor.LEXER_UNMATCHED: + this._non_tag += match; + break; + case WYMeditor.LEXER_EXIT: + switch(type) { + case 'addComment': + this._Listener.addComment(this._non_tag+match); + break; + case 'addScript': + this._Listener.addScript(this._non_tag+match); + break; + case 'addCss': + this._Listener.addCss(this._non_tag+match); + break; + } + } + return true; +}; + +WYMeditor.XhtmlParser.prototype.OpeningTag = function(match, state) +{ + switch (state){ + case WYMeditor.LEXER_ENTER: + this._tag = this.normalizeTag(match); + this._tag_attributes = {}; + break; + case WYMeditor.LEXER_SPECIAL: + this._callOpenTagListener(this.normalizeTag(match)); + break; + case WYMeditor.LEXER_EXIT: + this._callOpenTagListener(this._tag, this._tag_attributes); + } + return true; +}; + +WYMeditor.XhtmlParser.prototype.ClosingTag = function(match, state) +{ + this._callCloseTagListener(this.normalizeTag(match)); + return true; +}; + +WYMeditor.XhtmlParser.prototype._callOpenTagListener = function(tag, attributes) +{ + var attributes = attributes || {}; + this.autoCloseUnclosedBeforeNewOpening(tag); + + if(this._Listener.isBlockTag(tag)){ + this._Listener._tag_stack.push(tag); + this._Listener.fixNestingBeforeOpeningBlockTag(tag, attributes); + this._Listener.openBlockTag(tag, attributes); + this._increaseOpenTagCounter(tag); + }else if(this._Listener.isInlineTag(tag)){ + this._Listener.inlineTag(tag, attributes); + }else{ + this._Listener.openUnknownTag(tag, attributes); + this._increaseOpenTagCounter(tag); + } + this._Listener.last_tag = tag; + this._Listener.last_tag_opened = true; + this._Listener.last_tag_attributes = attributes; +}; + +WYMeditor.XhtmlParser.prototype._callCloseTagListener = function(tag) +{ + if(this._decreaseOpenTagCounter(tag)){ + this.autoCloseUnclosedBeforeTagClosing(tag); + + if(this._Listener.isBlockTag(tag)){ + var expected_tag = this._Listener._tag_stack.pop(); + if(expected_tag == false){ + return; + }else if(expected_tag != tag){ + tag = expected_tag; + } + this._Listener.closeBlockTag(tag); + }else{ + this._Listener.closeUnknownTag(tag); + } + }else{ + this._Listener.closeUnopenedTag(tag); + } + this._Listener.last_tag = tag; + this._Listener.last_tag_opened = false; +}; + +WYMeditor.XhtmlParser.prototype._increaseOpenTagCounter = function(tag) +{ + this._Listener._open_tags[tag] = this._Listener._open_tags[tag] || 0; + this._Listener._open_tags[tag]++; +}; + +WYMeditor.XhtmlParser.prototype._decreaseOpenTagCounter = function(tag) +{ + if(this._Listener._open_tags[tag]){ + this._Listener._open_tags[tag]--; + if(this._Listener._open_tags[tag] == 0){ + this._Listener._open_tags[tag] = undefined; + } + return true; + } + return false; +}; + +WYMeditor.XhtmlParser.prototype.autoCloseUnclosedBeforeNewOpening = function(new_tag) +{ + this._autoCloseUnclosed(new_tag, false); +}; + +WYMeditor.XhtmlParser.prototype.autoCloseUnclosedBeforeTagClosing = function(tag) +{ + this._autoCloseUnclosed(tag, true); +}; + +WYMeditor.XhtmlParser.prototype._autoCloseUnclosed = function(new_tag, closing) +{ + var closing = closing || false; + if(this._Listener._open_tags){ + for (var tag in this._Listener._open_tags) { + var counter = this._Listener._open_tags[tag]; + if(counter > 0 && this._Listener.shouldCloseTagAutomatically(tag, new_tag, closing)){ + this._callCloseTagListener(tag, true); + } + } + } +}; + +WYMeditor.XhtmlParser.prototype.getTagReplacements = function() +{ + return this._Listener.getTagReplacements(); +}; + +WYMeditor.XhtmlParser.prototype.normalizeTag = function(tag) +{ + tag = tag.replace(/^([\s<\/>]*)|([\s<\/>]*)$/gm,'').toLowerCase(); + var tags = this._Listener.getTagReplacements(); + if(tags[tag]){ + return tags[tag]; + } + return tag; +}; + +WYMeditor.XhtmlParser.prototype.TagAttributes = function(match, state) +{ + if(WYMeditor.LEXER_SPECIAL == state){ + this._current_attribute = match; + } + return true; +}; + +WYMeditor.XhtmlParser.prototype.DoubleQuotedAttribute = function(match, state) +{ + if(WYMeditor.LEXER_UNMATCHED == state){ + this._tag_attributes[this._current_attribute] = match; + } + return true; +}; + +WYMeditor.XhtmlParser.prototype.SingleQuotedAttribute = function(match, state) +{ + if(WYMeditor.LEXER_UNMATCHED == state){ + this._tag_attributes[this._current_attribute] = match; + } + return true; +}; + +WYMeditor.XhtmlParser.prototype.UnquotedAttribute = function(match, state) +{ + this._tag_attributes[this._current_attribute] = match.replace(/^=/,''); + return true; +}; + + + +/** +* XHTML Sax parser. +* +* @author Bermi Ferrer (http://bermi.org) +*/ +WYMeditor.XhtmlSaxListener = function() +{ + this.output = ''; + this.helper = new WYMeditor.XmlHelper(); + this._open_tags = {}; + this.validator = WYMeditor.XhtmlValidator; + this._tag_stack = []; + this.avoided_tags = []; + + this.entities = { + ' ':' ','¡':'¡','¢':'¢', + '£':'£','¤':'¤','¥':'¥', + '¦':'¦','§':'§','¨':'¨', + '©':'©','ª':'ª','«':'«', + '¬':'¬','­':'­','®':'®', + '¯':'¯','°':'°','±':'±', + '²':'²','³':'³','´':'´', + 'µ':'µ','¶':'¶','·':'·', + '¸':'¸','¹':'¹','º':'º', + '»':'»','¼':'¼','½':'½', + '¾':'¾','¿':'¿','À':'À', + 'Á':'Á','Â':'Â','Ã':'Ã', + 'Ä':'Ä','Å':'Å','Æ':'Æ', + 'Ç':'Ç','È':'È','É':'É', + 'Ê':'Ê','Ë':'Ë','Ì':'Ì', + 'Í':'Í','Î':'Î','Ï':'Ï', + 'Ð':'Ð','Ñ':'Ñ','Ò':'Ò', + 'Ó':'Ó','Ô':'Ô','Õ':'Õ', + 'Ö':'Ö','×':'×','Ø':'Ø', + 'Ù':'Ù','Ú':'Ú','Û':'Û', + 'Ü':'Ü','Ý':'Ý','Þ':'Þ', + 'ß':'ß','à':'à','á':'á', + 'â':'â','ã':'ã','ä':'ä', + 'å':'å','æ':'æ','ç':'ç', + 'è':'è','é':'é','ê':'ê', + 'ë':'ë','ì':'ì','í':'í', + 'î':'î','ï':'ï','ð':'ð', + 'ñ':'ñ','ò':'ò','ó':'ó', + 'ô':'ô','õ':'õ','ö':'ö', + '÷':'÷','ø':'ø','ù':'ù', + 'ú':'ú','û':'û','ü':'ü', + 'ý':'ý','þ':'þ','ÿ':'ÿ', + 'Œ':'Œ','œ':'œ','Š':'Š', + 'š':'š','Ÿ':'Ÿ','ƒ':'ƒ', + 'ˆ':'ˆ','˜':'˜','Α':'Α', + 'Β':'Β','Γ':'Γ','Δ':'Δ', + 'Ε':'Ε','Ζ':'Ζ','Η':'Η', + 'Θ':'Θ','Ι':'Ι','Κ':'Κ', + 'Λ':'Λ','Μ':'Μ','Ν':'Ν', + 'Ξ':'Ξ','Ο':'Ο','Π':'Π', + 'Ρ':'Ρ','Σ':'Σ','Τ':'Τ', + 'Υ':'Υ','Φ':'Φ','Χ':'Χ', + 'Ψ':'Ψ','Ω':'Ω','α':'α', + 'β':'β','γ':'γ','δ':'δ', + 'ε':'ε','ζ':'ζ','η':'η', + 'θ':'θ','ι':'ι','κ':'κ', + 'λ':'λ','μ':'μ','ν':'ν', + 'ξ':'ξ','ο':'ο','π':'π', + 'ρ':'ρ','ς':'ς','σ':'σ', + 'τ':'τ','υ':'υ','φ':'φ', + 'χ':'χ','ψ':'ψ','ω':'ω', + 'ϑ':'ϑ','ϒ':'ϒ','ϖ':'ϖ', + ' ':' ',' ':' ',' ':' ', + '‌':'‌','‍':'‍','‎':'‎', + '‏':'‏','–':'–','—':'—', + '‘':'‘','’':'’','‚':'‚', + '“':'“','”':'”','„':'„', + '†':'†','‡':'‡','•':'•', + '…':'…','‰':'‰','′':'′', + '″':'″','‹':'‹','›':'›', + '‾':'‾','⁄':'⁄','€':'€', + 'ℑ':'ℑ','℘':'℘','ℜ':'ℜ', + '™':'™','ℵ':'ℵ','←':'←', + '↑':'↑','→':'→','↓':'↓', + '↔':'↔','↵':'↵','⇐':'⇐', + '⇑':'⇑','⇒':'⇒','⇓':'⇓', + '⇔':'⇔','∀':'∀','∂':'∂', + '∃':'∃','∅':'∅','∇':'∇', + '∈':'∈','∉':'∉','∋':'∋', + '∏':'∏','∑':'∑','−':'−', + '∗':'∗','√':'√','∝':'∝', + '∞':'∞','∠':'∠','∧':'∧', + '∨':'∨','∩':'∩','∪':'∪', + '∫':'∫','∴':'∴','∼':'∼', + '≅':'≅','≈':'≈','≠':'≠', + '≡':'≡','≤':'≤','≥':'≥', + '⊂':'⊂','⊃':'⊃','⊄':'⊄', + '⊆':'⊆','⊇':'⊇','⊕':'⊕', + '⊗':'⊗','⊥':'⊥','⋅':'⋅', + '⌈':'⌈','⌉':'⌉','⌊':'⌊', + '⌋':'⌋','⟨':'〈','⟩':'〉', + '◊':'◊','♠':'♠','♣':'♣', + '♥':'♥','♦':'♦'}; + + this.block_tags = ["a", "abbr", "acronym", "address", "area", "b", + "base", "bdo", "big", "blockquote", "body", "button", + "caption", "cite", "code", "col", "colgroup", "dd", "del", "div", + "dfn", "dl", "dt", "em", "fieldset", "form", "head", "h1", "h2", + "h3", "h4", "h5", "h6", "html", "i", "ins", + "kbd", "label", "legend", "li", "map", "noscript", + "object", "ol", "optgroup", "option", "p", "param", "pre", "q", + "samp", "script", "select", "small", "span", "strong", "style", + "sub", "sup", "table", "tbody", "td", "textarea", "tfoot", "th", + "thead", "title", "tr", "tt", "ul", "var", "extends"]; + + + this.inline_tags = ["br", "hr", "img", "input"]; + + return this; +}; + +WYMeditor.XhtmlSaxListener.prototype.shouldCloseTagAutomatically = function(tag, now_on_tag, closing) +{ + var closing = closing || false; + if(tag == 'td'){ + if((closing && now_on_tag == 'tr') || (!closing && now_on_tag == 'td')){ + return true; + } + } + if(tag == 'option'){ + if((closing && now_on_tag == 'select') || (!closing && now_on_tag == 'option')){ + return true; + } + } + return false; +}; + +WYMeditor.XhtmlSaxListener.prototype.beforeParsing = function(raw) +{ + this.output = ''; + return raw; +}; + +WYMeditor.XhtmlSaxListener.prototype.afterParsing = function(xhtml) +{ + xhtml = this.replaceNamedEntities(xhtml); + xhtml = this.joinRepeatedEntities(xhtml); + xhtml = this.removeEmptyTags(xhtml); + xhtml = this.removeBrInPre(xhtml); + return xhtml; +}; + +WYMeditor.XhtmlSaxListener.prototype.replaceNamedEntities = function(xhtml) +{ + for (var entity in this.entities) { + xhtml = xhtml.replace(new RegExp(entity, 'g'), this.entities[entity]); + } + return xhtml; +}; + +WYMeditor.XhtmlSaxListener.prototype.joinRepeatedEntities = function(xhtml) +{ + var tags = 'em|strong|sub|sup|acronym|pre|del|address'; + return xhtml.replace(new RegExp('<\/('+tags+')><\\1>' ,''),''). + replace(new RegExp('(\s*<('+tags+')>\s*){2}(.*)(\s*<\/\\2>\s*){2}' ,''),'<\$2>\$3<\$2>'); +}; + +WYMeditor.XhtmlSaxListener.prototype.removeEmptyTags = function(xhtml) +{ + return xhtml.replace(new RegExp('<('+this.block_tags.join("|").replace(/\|td/,'').replace(/\|th/, '')+')>(<br \/>| | |\\s)*<\/\\1>' ,'g'),''); +}; + +WYMeditor.XhtmlSaxListener.prototype.removeBrInPre = function(xhtml) +{ + var matches = xhtml.match(new RegExp('<pre[^>]*>(.*?)<\/pre>','gmi')); + if(matches) { + for(var i=0; i<matches.length; i++) { + xhtml = xhtml.replace(matches[i], matches[i].replace(new RegExp('<br \/>', 'g'), String.fromCharCode(13,10))); + } + } + return xhtml; +}; + +WYMeditor.XhtmlSaxListener.prototype.getResult = function() +{ + return this.output; +}; + +WYMeditor.XhtmlSaxListener.prototype.getTagReplacements = function() +{ + return {'b':'strong', 'i':'em'}; +}; + +WYMeditor.XhtmlSaxListener.prototype.addContent = function(text) +{ + this.output += text; +}; + +WYMeditor.XhtmlSaxListener.prototype.addComment = function(text) +{ + if(this.remove_comments){ + this.output += text; + } +}; + +WYMeditor.XhtmlSaxListener.prototype.addScript = function(text) +{ + if(!this.remove_scripts){ + this.output += text; + } +}; + +WYMeditor.XhtmlSaxListener.prototype.addCss = function(text) +{ + if(!this.remove_embeded_styles){ + this.output += text; + } +}; + +WYMeditor.XhtmlSaxListener.prototype.openBlockTag = function(tag, attributes) +{ + this.output += this.helper.tag(tag, this.validator.getValidTagAttributes(tag, attributes), true); +}; + +WYMeditor.XhtmlSaxListener.prototype.inlineTag = function(tag, attributes) +{ + this.output += this.helper.tag(tag, this.validator.getValidTagAttributes(tag, attributes)); +}; + +WYMeditor.XhtmlSaxListener.prototype.openUnknownTag = function(tag, attributes) +{ + //this.output += this.helper.tag(tag, attributes, true); +}; + +WYMeditor.XhtmlSaxListener.prototype.closeBlockTag = function(tag) +{ + this.output = this.output.replace(/<br \/>$/, '')+this._getClosingTagContent('before', tag)+"</"+tag+">"+this._getClosingTagContent('after', tag); +}; + +WYMeditor.XhtmlSaxListener.prototype.closeUnknownTag = function(tag) +{ + //this.output += "</"+tag+">"; +}; + +WYMeditor.XhtmlSaxListener.prototype.closeUnopenedTag = function(tag) +{ + this.output += "</"+tag+">"; +}; + +WYMeditor.XhtmlSaxListener.prototype.avoidStylingTagsAndAttributes = function() +{ + this.avoided_tags = ['div','span']; + this.validator.skiped_attributes = ['style']; + this.validator.skiped_attribute_values = ['MsoNormal','main1']; // MS Word attributes for class + this._avoiding_tags_implicitly = true; +}; + +WYMeditor.XhtmlSaxListener.prototype.allowStylingTagsAndAttributes = function() +{ + this.avoided_tags = []; + this.validator.skiped_attributes = []; + this.validator.skiped_attribute_values = []; + this._avoiding_tags_implicitly = false; +}; + +WYMeditor.XhtmlSaxListener.prototype.isBlockTag = function(tag) +{ + return !WYMeditor.Helper.contains(this.avoided_tags, tag) && WYMeditor.Helper.contains(this.block_tags, tag); +}; + +WYMeditor.XhtmlSaxListener.prototype.isInlineTag = function(tag) +{ + return !WYMeditor.Helper.contains(this.avoided_tags, tag) && WYMeditor.Helper.contains(this.inline_tags, tag); +}; + +WYMeditor.XhtmlSaxListener.prototype.insertContentAfterClosingTag = function(tag, content) +{ + this._insertContentWhenClosingTag('after', tag, content); +}; + +WYMeditor.XhtmlSaxListener.prototype.insertContentBeforeClosingTag = function(tag, content) +{ + this._insertContentWhenClosingTag('before', tag, content); +}; + +WYMeditor.XhtmlSaxListener.prototype.fixNestingBeforeOpeningBlockTag = function(tag, attributes) +{ + if(tag != 'li' && (tag == 'ul' || tag == 'ol') && this.last_tag && !this.last_tag_opened && this.last_tag == 'li'){ + this.output = this.output.replace(/<\/li>$/, ''); + this.insertContentAfterClosingTag(tag, '</li>'); + } +}; + +WYMeditor.XhtmlSaxListener.prototype._insertContentWhenClosingTag = function(position, tag, content) +{ + if(!this['_insert_'+position+'_closing']){ + this['_insert_'+position+'_closing'] = []; + } + if(!this['_insert_'+position+'_closing'][tag]){ + this['_insert_'+position+'_closing'][tag] = []; + } + this['_insert_'+position+'_closing'][tag].push(content); +}; + +WYMeditor.XhtmlSaxListener.prototype._getClosingTagContent = function(position, tag) +{ + if( this['_insert_'+position+'_closing'] && + this['_insert_'+position+'_closing'][tag] && + this['_insert_'+position+'_closing'][tag].length > 0){ + return this['_insert_'+position+'_closing'][tag].pop(); + } + return ''; +}; + + +/********** CSS PARSER **********/ + + +WYMeditor.WymCssLexer = function(parser, only_wym_blocks) +{ + var only_wym_blocks = (typeof only_wym_blocks == 'undefined' ? true : only_wym_blocks); + + jQuery.extend(this, new WYMeditor.Lexer(parser, (only_wym_blocks?'Ignore':'WymCss'))); + + this.mapHandler('WymCss', 'Ignore'); + + if(only_wym_blocks == true){ + this.addEntryPattern("/\\\x2a[<\\s]*WYMeditor[>\\s]*\\\x2a/", 'Ignore', 'WymCss'); + this.addExitPattern("/\\\x2a[<\/\\s]*WYMeditor[>\\s]*\\\x2a/", 'WymCss'); + } + + this.addSpecialPattern("[\\sa-z1-6]*\\\x2e[a-z-_0-9]+", 'WymCss', 'WymCssStyleDeclaration'); + + this.addEntryPattern("/\\\x2a", 'WymCss', 'WymCssComment'); + this.addExitPattern("\\\x2a/", 'WymCssComment'); + + this.addEntryPattern("\x7b", 'WymCss', 'WymCssStyle'); + this.addExitPattern("\x7d", 'WymCssStyle'); + + this.addEntryPattern("/\\\x2a", 'WymCssStyle', 'WymCssFeedbackStyle'); + this.addExitPattern("\\\x2a/", 'WymCssFeedbackStyle'); + + return this; +}; + +WYMeditor.WymCssParser = function() +{ + this._in_style = false; + this._has_title = false; + this.only_wym_blocks = true; + this.css_settings = {'classesItems':[], 'editorStyles':[], 'dialogStyles':[]}; + return this; +}; + +WYMeditor.WymCssParser.prototype.parse = function(raw, only_wym_blocks) +{ + var only_wym_blocks = (typeof only_wym_blocks == 'undefined' ? this.only_wym_blocks : only_wym_blocks); + this._Lexer = new WYMeditor.WymCssLexer(this, only_wym_blocks); + this._Lexer.parse(raw); +}; + +WYMeditor.WymCssParser.prototype.Ignore = function(match, state) +{ + return true; +}; + +WYMeditor.WymCssParser.prototype.WymCssComment = function(text, status) +{ + if(text.match(/end[a-z0-9\s]*wym[a-z0-9\s]*/mi)){ + return false; + } + if(status == WYMeditor.LEXER_UNMATCHED){ + if(!this._in_style){ + this._has_title = true; + this._current_item = {'title':WYMeditor.Helper.trim(text)}; + }else{ + if(this._current_item[this._current_element]){ + if(!this._current_item[this._current_element].expressions){ + this._current_item[this._current_element].expressions = [text]; + }else{ + this._current_item[this._current_element].expressions.push(text); + } + } + } + this._in_style = true; + } + return true; +}; + +WYMeditor.WymCssParser.prototype.WymCssStyle = function(match, status) +{ + if(status == WYMeditor.LEXER_UNMATCHED){ + match = WYMeditor.Helper.trim(match); + if(match != ''){ + this._current_item[this._current_element].style = match; + } + }else if (status == WYMeditor.LEXER_EXIT){ + this._in_style = false; + this._has_title = false; + this.addStyleSetting(this._current_item); + } + return true; +}; + +WYMeditor.WymCssParser.prototype.WymCssFeedbackStyle = function(match, status) +{ + if(status == WYMeditor.LEXER_UNMATCHED){ + this._current_item[this._current_element].feedback_style = match.replace(/^([\s\/\*]*)|([\s\/\*]*)$/gm,''); + } + return true; +}; + +WYMeditor.WymCssParser.prototype.WymCssStyleDeclaration = function(match) +{ + match = match.replace(/^([\s\.]*)|([\s\.*]*)$/gm, ''); + + var tag = ''; + if(match.indexOf('.') > 0){ + var parts = match.split('.'); + this._current_element = parts[1]; + var tag = parts[0]; + }else{ + this._current_element = match; + } + + if(!this._has_title){ + this._current_item = {'title':(!tag?'':tag.toUpperCase()+': ')+this._current_element}; + this._has_title = true; + } + + if(!this._current_item[this._current_element]){ + this._current_item[this._current_element] = {'name':this._current_element}; + } + if(tag){ + if(!this._current_item[this._current_element].tags){ + this._current_item[this._current_element].tags = [tag]; + }else{ + this._current_item[this._current_element].tags.push(tag); + } + } + return true; +}; + +WYMeditor.WymCssParser.prototype.addStyleSetting = function(style_details) +{ + for (var name in style_details){ + var details = style_details[name]; + if(typeof details == 'object' && name != 'title'){ + + this.css_settings.classesItems.push({ + 'name': WYMeditor.Helper.trim(details.name), + 'title': style_details.title, + 'expr' : WYMeditor.Helper.trim((details.expressions||details.tags).join(', ')) + }); + if(details.feedback_style){ + this.css_settings.editorStyles.push({ + 'name': '.'+ WYMeditor.Helper.trim(details.name), + 'css': details.feedback_style + }); + } + if(details.style){ + this.css_settings.dialogStyles.push({ + 'name': '.'+ WYMeditor.Helper.trim(details.name), + 'css': details.style + }); + } + } + } +}; + +/********** HELPERS **********/ + +// Returns true if it is a text node with whitespaces only +jQuery.fn.isPhantomNode = function() { + if (this[0].nodeType == 3) + return !(/[^\t\n\r ]/.test(this[0].data)); + + return false; +}; + +WYMeditor.isPhantomNode = function(n) { + if (n.nodeType == 3) + return !(/[^\t\n\r ]/.test(n.data)); + + return false; +}; + +WYMeditor.isPhantomString = function(str) { + return !(/[^\t\n\r ]/.test(str)); +}; + +// Returns the Parents or the node itself +// jqexpr = a jQuery expression +jQuery.fn.parentsOrSelf = function(jqexpr) { + var n = this; + + if (n[0].nodeType == 3) + n = n.parents().slice(0,1); + +// if (n.is(jqexpr)) // XXX should work, but doesn't (probably a jQuery bug) + if (n.filter(jqexpr).size() == 1) + return n; + else + return n.parents(jqexpr).slice(0,1); +}; + +// String & array helpers + +WYMeditor.Helper = { + + //replace all instances of 'old' by 'rep' in 'str' string + replaceAll: function(str, old, rep) { + var rExp = new RegExp(old, "g"); + return(str.replace(rExp, rep)); + }, + + //insert 'inserted' at position 'pos' in 'str' string + insertAt: function(str, inserted, pos) { + return(str.substr(0,pos) + inserted + str.substring(pos)); + }, + + //trim 'str' string + trim: function(str) { + return str.replace(/^(\s*)|(\s*)$/gm,''); + }, + + //return true if 'arr' array contains 'elem', or false + contains: function(arr, elem) { + for (var i = 0; i < arr.length; i++) { + if (arr[i] === elem) return true; + } + return false; + }, + + //return 'item' position in 'arr' array, or -1 + indexOf: function(arr, item) { + var ret=-1; + for(var i = 0; i < arr.length; i++) { + if (arr[i] == item) { + ret = i; + break; + } + } + return(ret); + }, + + //return 'item' object in 'arr' array, checking its 'name' property, or null + findByName: function(arr, name) { + for(var i = 0; i < arr.length; i++) { + var item = arr[i]; + if(item.name == name) return(item); + } + return(null); + } +}; + + +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * jquery.wymeditor.explorer.js + * MSIE specific class and functions. + * See the documentation for more info. + * + * File Authors: + * Jean-Francois Hovinne (jf.hovinne a-t wymeditor dotorg) + * Bermi Ferrer (wymeditor a-t bermi dotorg) + * Frédéric Palluel-Lafleur (fpalluel a-t gmail dotcom) + * Jonatan Lundin (jonatan.lundin a-t gmail dotcom) + */ + +WYMeditor.WymClassExplorer = function(wym) { + + this._wym = wym; + this._class = "className"; + this._newLine = "\r\n"; + +}; + +WYMeditor.WymClassExplorer.prototype.initIframe = function(iframe) { + + //This function is executed twice, though it is called once! + //But MSIE needs that, otherwise designMode won't work. + //Weird. + + this._iframe = iframe; + this._doc = iframe.contentWindow.document; + + //add css rules from options + var styles = this._doc.styleSheets[0]; + var aCss = eval(this._options.editorStyles); + + this.addCssRules(this._doc, aCss); + + this._doc.title = this._wym._index; + + //set the text direction + jQuery('html', this._doc).attr('dir', this._options.direction); + + //init html value + jQuery(this._doc.body).html(this._wym._html); + + //handle events + var wym = this; + + this._doc.body.onfocus = function() + {wym._doc.designMode = "on"; wym._doc = iframe.contentWindow.document;}; + this._doc.onbeforedeactivate = function() {wym.saveCaret();}; + this._doc.onkeyup = function() { + wym.saveCaret(); + wym.keyup(); + }; + this._doc.onclick = function() {wym.saveCaret();}; + + this._doc.body.onbeforepaste = function() { + wym._iframe.contentWindow.event.returnValue = false; + }; + + this._doc.body.onpaste = function() { + wym._iframe.contentWindow.event.returnValue = false; + wym.paste(window.clipboardData.getData("Text")); + }; + + //callback can't be executed twice, so we check + if(this._initialized) { + + //pre-bind functions + if(jQuery.isFunction(this._options.preBind)) this._options.preBind(this); + + //bind external events + this._wym.bindEvents(); + + //post-init functions + if(jQuery.isFunction(this._options.postInit)) this._options.postInit(this); + + //add event listeners to doc elements, e.g. images + this.listen(); + } + + this._initialized = true; + + //init designMode + this._doc.designMode="on"; + try{ + // (bermi's note) noticed when running unit tests on IE6 + // Is this really needed, it trigger an unexisting property on IE6 + this._doc = iframe.contentWindow.document; + }catch(e){} +}; + +WYMeditor.WymClassExplorer.prototype._exec = function(cmd,param) { + + switch(cmd) { + + case WYMeditor.INDENT: case WYMeditor.OUTDENT: + + var container = this.findUp(this.container(), WYMeditor.LI); + if(container) { + var ancestor = container.parentNode.parentNode; + if(container.parentNode.childNodes.length>1 + || ancestor.tagName.toLowerCase() == WYMeditor.OL + || ancestor.tagName.toLowerCase() == WYMeditor.UL) + this._doc.execCommand(cmd); + } + break; + default: + if(param) this._doc.execCommand(cmd,false,param); + else this._doc.execCommand(cmd); + break; + } + +}; + +WYMeditor.WymClassExplorer.prototype.selected = function() { + + var caretPos = this._iframe.contentWindow.document.caretPos; + if(caretPos!=null) { + if(caretPos.parentElement!=undefined) + return(caretPos.parentElement()); + } +}; + +WYMeditor.WymClassExplorer.prototype.saveCaret = function() { + + this._doc.caretPos = this._doc.selection.createRange(); +}; + +WYMeditor.WymClassExplorer.prototype.addCssRule = function(styles, oCss) { + + styles.addRule(oCss.name, oCss.css); +}; + +WYMeditor.WymClassExplorer.prototype.insert = function(html) { + + // Get the current selection + var range = this._doc.selection.createRange(); + + // Check if the current selection is inside the editor + if ( jQuery(range.parentElement()).parents( this._options.iframeBodySelector ).is('*') ) { + try { + // Overwrite selection with provided html + range.pasteHTML(html); + } catch (e) { } + } else { + // Fall back to the internal paste function if there's no selection + this.paste(html); + } +}; + +WYMeditor.WymClassExplorer.prototype.wrap = function(left, right) { + + // Get the current selection + var range = this._doc.selection.createRange(); + + // Check if the current selection is inside the editor + if ( jQuery(range.parentElement()).parents( this._options.iframeBodySelector ).is('*') ) { + try { + // Overwrite selection with provided html + range.pasteHTML(left + range.text + right); + } catch (e) { } + } +}; + +WYMeditor.WymClassExplorer.prototype.unwrap = function() { + + // Get the current selection + var range = this._doc.selection.createRange(); + + // Check if the current selection is inside the editor + if ( jQuery(range.parentElement()).parents( this._options.iframeBodySelector ).is('*') ) { + try { + // Unwrap selection + var text = range.text; + this._exec( 'Cut' ); + range.pasteHTML( text ); + } catch (e) { } + } +}; + +//keyup handler +WYMeditor.WymClassExplorer.prototype.keyup = function() { + this._selected_image = null; +}; + +WYMeditor.WymClassExplorer.prototype.setFocusToNode = function(node, toStart) { + var range = this._doc.selection.createRange(); + toStart = toStart ? true : false; + + range.moveToElementText(node); + range.collapse(toStart); + range.select(); + node.focus(); +}; + +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * jquery.wymeditor.mozilla.js + * Gecko specific class and functions. + * See the documentation for more info. + * + * File Authors: + * Jean-Francois Hovinne (jf.hovinne a-t wymeditor dotorg) + * Volker Mische (vmx a-t gmx dotde) + * Bermi Ferrer (wymeditor a-t bermi dotorg) + * Frédéric Palluel-Lafleur (fpalluel a-t gmail dotcom) + * Jonatan Lundin (jonatan.lundin a-t gmail dotcom) + */ + +WYMeditor.WymClassMozilla = function(wym) { + + this._wym = wym; + this._class = "class"; + this._newLine = "\n"; +}; + +WYMeditor.WymClassMozilla.prototype.initIframe = function(iframe) { + var wym = this; + + this._iframe = iframe; + this._doc = iframe.contentDocument; + + //add css rules from options + + var styles = this._doc.styleSheets[0]; + var aCss = eval(this._options.editorStyles); + + this.addCssRules(this._doc, aCss); + + this._doc.title = this._wym._index; + + //set the text direction + jQuery('html', this._doc).attr('dir', this._options.direction); + + //init html value + this.html(this._wym._html); + + //init designMode + this.enableDesignMode(); + + //pre-bind functions + if(jQuery.isFunction(this._options.preBind)) this._options.preBind(this); + + //bind external events + this._wym.bindEvents(); + + //bind editor keydown events + jQuery(this._doc).bind("keydown", this.keydown); + + //bind editor keyup events + jQuery(this._doc).bind("keyup", this.keyup); + + //bind editor focus events (used to reset designmode - Gecko bug) + jQuery(this._doc).bind("focus", function () { + // Fix scope + wym.enableDesignMode.call(wym); + }); + + //post-init functions + if(jQuery.isFunction(this._options.postInit)) this._options.postInit(this); + + //add event listeners to doc elements, e.g. images + this.listen(); +}; + +/* @name html + * @description Get/Set the html value + */ +WYMeditor.WymClassMozilla.prototype.html = function(html) { + + if(typeof html === 'string') { + + //disable designMode + try { this._doc.designMode = "off"; } catch(e) { }; + + //replace em by i and strong by bold + //(designMode issue) + html = html.replace(/<em(\b[^>]*)>/gi, "<i$1>") + .replace(/<\/em>/gi, "</i>") + .replace(/<strong(\b[^>]*)>/gi, "<b$1>") + .replace(/<\/strong>/gi, "</b>"); + + //update the html body + jQuery(this._doc.body).html(html); + + //re-init designMode + this.enableDesignMode(); + } + else return(jQuery(this._doc.body).html()); +}; + +WYMeditor.WymClassMozilla.prototype._exec = function(cmd,param) { + + if(!this.selected()) return(false); + + switch(cmd) { + + case WYMeditor.INDENT: case WYMeditor.OUTDENT: + + var focusNode = this.selected(); + var sel = this._iframe.contentWindow.getSelection(); + var anchorNode = sel.anchorNode; + if(anchorNode.nodeName == "#text") anchorNode = anchorNode.parentNode; + + focusNode = this.findUp(focusNode, WYMeditor.BLOCKS); + anchorNode = this.findUp(anchorNode, WYMeditor.BLOCKS); + + if(focusNode && focusNode == anchorNode + && focusNode.tagName.toLowerCase() == WYMeditor.LI) { + + var ancestor = focusNode.parentNode.parentNode; + + if(focusNode.parentNode.childNodes.length>1 + || ancestor.tagName.toLowerCase() == WYMeditor.OL + || ancestor.tagName.toLowerCase() == WYMeditor.UL) + this._doc.execCommand(cmd,'',null); + } + + break; + + default: + + if(param) this._doc.execCommand(cmd,'',param); + else this._doc.execCommand(cmd,'',null); + } + + //set to P if parent = BODY + var container = this.selected(); + if(container.tagName.toLowerCase() == WYMeditor.BODY) + this._exec(WYMeditor.FORMAT_BLOCK, WYMeditor.P); +}; + +/* @name selected + * @description Returns the selected container + */ +WYMeditor.WymClassMozilla.prototype.selected = function() { + + var sel = this._iframe.contentWindow.getSelection(); + var node = sel.focusNode; + if(node) { + if(node.nodeName == "#text") return(node.parentNode); + else return(node); + } else return(null); +}; + +WYMeditor.WymClassMozilla.prototype.addCssRule = function(styles, oCss) { + + styles.insertRule(oCss.name + " {" + oCss.css + "}", + styles.cssRules.length); +}; + + +//keydown handler, mainly used for keyboard shortcuts +WYMeditor.WymClassMozilla.prototype.keydown = function(evt) { + + //'this' is the doc + var wym = WYMeditor.INSTANCES[this.title]; + var container = null; + + if(evt.ctrlKey){ + if(evt.keyCode == 66){ + //CTRL+b => STRONG + wym._exec(WYMeditor.BOLD); + return false; + } + if(evt.keyCode == 73){ + //CTRL+i => EMPHASIS + wym._exec(WYMeditor.ITALIC); + return false; + } + } + + else if(evt.keyCode == 13) { + if(!evt.shiftKey){ + //fix PRE bug #73 + container = wym.selected(); + if(container && container.tagName.toLowerCase() == WYMeditor.PRE) { + evt.preventDefault(); + wym.insert('<p></p>'); + } + } + } +}; + +//keyup handler, mainly used for cleanups +WYMeditor.WymClassMozilla.prototype.keyup = function(evt) { + + //'this' is the doc + var wym = WYMeditor.INSTANCES[this.title]; + + wym._selected_image = null; + var container = null; + + if(evt.keyCode == 13 && !evt.shiftKey) { + + //RETURN key + //cleanup <br><br> between paragraphs + jQuery(wym._doc.body).children(WYMeditor.BR).remove(); + } + + if(evt.keyCode != 8 + && evt.keyCode != 17 + && evt.keyCode != 46 + && evt.keyCode != 224 + && !evt.metaKey + && !evt.ctrlKey) { + + //NOT BACKSPACE, NOT DELETE, NOT CTRL, NOT COMMAND + //text nodes replaced by P + + container = wym.selected(); + var name = container.tagName.toLowerCase(); + + //fix forbidden main containers + if( + name == "strong" || + name == "b" || + name == "em" || + name == "i" || + name == "sub" || + name == "sup" || + name == "a" + + ) name = container.parentNode.tagName.toLowerCase(); + + if(name == WYMeditor.BODY) wym._exec(WYMeditor.FORMAT_BLOCK, WYMeditor.P); + } +}; + +WYMeditor.WymClassMozilla.prototype.enableDesignMode = function() { + if(this._doc.designMode == "off") { + try { + this._doc.designMode = "on"; + this._doc.execCommand("styleWithCSS", '', false); + } catch(e) { } + } +}; + +WYMeditor.WymClassMozilla.prototype.openBlockTag = function(tag, attributes) +{ + var attributes = this.validator.getValidTagAttributes(tag, attributes); + + // Handle Mozilla styled spans + if(tag == 'span' && attributes.style){ + var new_tag = this.getTagForStyle(attributes.style); + if(new_tag){ + this._tag_stack.pop(); + var tag = new_tag; + this._tag_stack.push(new_tag); + attributes.style = ''; + }else{ + return; + } + } + + this.output += this.helper.tag(tag, attributes, true); +}; + +WYMeditor.WymClassMozilla.prototype.getTagForStyle = function(style) { + + if(/bold/.test(style)) return 'strong'; + if(/italic/.test(style)) return 'em'; + if(/sub/.test(style)) return 'sub'; + if(/super/.test(style)) return 'sup'; + return false; +}; + +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * jquery.wymeditor.opera.js + * Opera specific class and functions. + * See the documentation for more info. + * + * File Authors: + * Jean-Francois Hovinne (jf.hovinne a-t wymeditor dotorg) + */ + +WYMeditor.WymClassOpera = function(wym) { + + this._wym = wym; + this._class = "class"; + this._newLine = "\r\n"; +}; + +WYMeditor.WymClassOpera.prototype.initIframe = function(iframe) { + + this._iframe = iframe; + this._doc = iframe.contentWindow.document; + + //add css rules from options + var styles = this._doc.styleSheets[0]; + var aCss = eval(this._options.editorStyles); + + this.addCssRules(this._doc, aCss); + + this._doc.title = this._wym._index; + + //set the text direction + jQuery('html', this._doc).attr('dir', this._options.direction); + + //init designMode + this._doc.designMode = "on"; + + //init html value + this.html(this._wym._html); + + //pre-bind functions + if(jQuery.isFunction(this._options.preBind)) this._options.preBind(this); + + //bind external events + this._wym.bindEvents(); + + //bind editor keydown events + jQuery(this._doc).bind("keydown", this.keydown); + + //bind editor events + jQuery(this._doc).bind("keyup", this.keyup); + + //post-init functions + if(jQuery.isFunction(this._options.postInit)) this._options.postInit(this); + + //add event listeners to doc elements, e.g. images + this.listen(); +}; + +WYMeditor.WymClassOpera.prototype._exec = function(cmd,param) { + + if(param) this._doc.execCommand(cmd,false,param); + else this._doc.execCommand(cmd); + +}; + +WYMeditor.WymClassOpera.prototype.selected = function() { + + var sel=this._iframe.contentWindow.getSelection(); + var node=sel.focusNode; + if(node) { + if(node.nodeName=="#text")return(node.parentNode); + else return(node); + } else return(null); +}; + +WYMeditor.WymClassOpera.prototype.addCssRule = function(styles, oCss) { + + styles.insertRule(oCss.name + " {" + oCss.css + "}", + styles.cssRules.length); +}; + +//keydown handler +WYMeditor.WymClassOpera.prototype.keydown = function(evt) { + + //'this' is the doc + var wym = WYMeditor.INSTANCES[this.title]; + var sel = wym._iframe.contentWindow.getSelection(); + startNode = sel.getRangeAt(0).startContainer; + + //Get a P instead of no container + if(!jQuery(startNode).parentsOrSelf( + WYMeditor.MAIN_CONTAINERS.join(","))[0] + && !jQuery(startNode).parentsOrSelf('li') + && evt.keyCode != WYMeditor.KEY.ENTER + && evt.keyCode != WYMeditor.KEY.LEFT + && evt.keyCode != WYMeditor.KEY.UP + && evt.keyCode != WYMeditor.KEY.RIGHT + && evt.keyCode != WYMeditor.KEY.DOWN + && evt.keyCode != WYMeditor.KEY.BACKSPACE + && evt.keyCode != WYMeditor.KEY.DELETE) + wym._exec(WYMeditor.FORMAT_BLOCK, WYMeditor.P); + +}; + +//keyup handler +WYMeditor.WymClassOpera.prototype.keyup = function(evt) { + + //'this' is the doc + var wym = WYMeditor.INSTANCES[this.title]; + wym._selected_image = null; +}; +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * jquery.wymeditor.safari.js + * Safari specific class and functions. + * See the documentation for more info. + * + * File Authors: + * Jean-Francois Hovinne (jf.hovinne a-t wymeditor dotorg) + * Scott Lewis (lewiscot a-t gmail dotcom) + */ + +WYMeditor.WymClassSafari = function(wym) { + + this._wym = wym; + this._class = "class"; + this._newLine = "\n"; +}; + +WYMeditor.WymClassSafari.prototype.initIframe = function(iframe) { + + this._iframe = iframe; + this._doc = iframe.contentDocument; + + //add css rules from options + + var styles = this._doc.styleSheets[0]; + var aCss = eval(this._options.editorStyles); + + this.addCssRules(this._doc, aCss); + + this._doc.title = this._wym._index; + + //set the text direction + jQuery('html', this._doc).attr('dir', this._options.direction); + + //init designMode + this._doc.designMode = "on"; + + //init html value + this.html(this._wym._html); + + //pre-bind functions + if(jQuery.isFunction(this._options.preBind)) this._options.preBind(this); + + //bind external events + this._wym.bindEvents(); + + //bind editor keydown events + jQuery(this._doc).bind("keydown", this.keydown); + + //bind editor keyup events + jQuery(this._doc).bind("keyup", this.keyup); + + //post-init functions + if(jQuery.isFunction(this._options.postInit)) this._options.postInit(this); + + //add event listeners to doc elements, e.g. images + this.listen(); +}; + +WYMeditor.WymClassSafari.prototype._exec = function(cmd,param) { + + if(!this.selected()) return(false); + + switch(cmd) { + + case WYMeditor.INDENT: case WYMeditor.OUTDENT: + + var focusNode = this.selected(); + var sel = this._iframe.contentWindow.getSelection(); + var anchorNode = sel.anchorNode; + if(anchorNode.nodeName == "#text") anchorNode = anchorNode.parentNode; + + focusNode = this.findUp(focusNode, WYMeditor.BLOCKS); + anchorNode = this.findUp(anchorNode, WYMeditor.BLOCKS); + + if(focusNode && focusNode == anchorNode + && focusNode.tagName.toLowerCase() == WYMeditor.LI) { + + var ancestor = focusNode.parentNode.parentNode; + + if(focusNode.parentNode.childNodes.length>1 + || ancestor.tagName.toLowerCase() == WYMeditor.OL + || ancestor.tagName.toLowerCase() == WYMeditor.UL) + this._doc.execCommand(cmd,'',null); + } + + break; + + case WYMeditor.INSERT_ORDEREDLIST: case WYMeditor.INSERT_UNORDEREDLIST: + + this._doc.execCommand(cmd,'',null); + + //Safari creates lists in e.g. paragraphs. + //Find the container, and remove it. + var focusNode = this.selected(); + var container = this.findUp(focusNode, WYMeditor.MAIN_CONTAINERS); + if(container) jQuery(container).replaceWith(jQuery(container).html()); + + break; + + default: + + if(param) this._doc.execCommand(cmd,'',param); + else this._doc.execCommand(cmd,'',null); + } + + //set to P if parent = BODY + var container = this.selected(); + if(container && container.tagName.toLowerCase() == WYMeditor.BODY) + this._exec(WYMeditor.FORMAT_BLOCK, WYMeditor.P); + +}; + +/* @name selected + * @description Returns the selected container + */ +WYMeditor.WymClassSafari.prototype.selected = function() { + + var sel = this._iframe.contentWindow.getSelection(); + var node = sel.focusNode; + if(node) { + if(node.nodeName == "#text") return(node.parentNode); + else return(node); + } else return(null); +}; + +WYMeditor.WymClassSafari.prototype.addCssRule = function(styles, oCss) { + + styles.insertRule(oCss.name + " {" + oCss.css + "}", + styles.cssRules.length); +}; + + +//keydown handler, mainly used for keyboard shortcuts +WYMeditor.WymClassSafari.prototype.keydown = function(evt) { + + //'this' is the doc + var wym = WYMeditor.INSTANCES[this.title]; + + if(evt.ctrlKey){ + if(evt.keyCode == 66){ + //CTRL+b => STRONG + wym._exec(WYMeditor.BOLD); + return false; + } + if(evt.keyCode == 73){ + //CTRL+i => EMPHASIS + wym._exec(WYMeditor.ITALIC); + return false; + } + } +}; + +//keyup handler, mainly used for cleanups +WYMeditor.WymClassSafari.prototype.keyup = function(evt) { + + //'this' is the doc + var wym = WYMeditor.INSTANCES[this.title]; + + wym._selected_image = null; + var container = null; + + if(evt.keyCode == 13 && !evt.shiftKey) { + + //RETURN key + //cleanup <br><br> between paragraphs + jQuery(wym._doc.body).children(WYMeditor.BR).remove(); + + //fix PRE bug #73 + container = wym.selected(); + if(container && container.tagName.toLowerCase() == WYMeditor.PRE) + wym._exec(WYMeditor.FORMAT_BLOCK, WYMeditor.P); //create P after PRE + } + + //fix #112 + if(evt.keyCode == 13 && evt.shiftKey) { + wym._exec('InsertLineBreak'); + } + + if(evt.keyCode != 8 + && evt.keyCode != 17 + && evt.keyCode != 46 + && evt.keyCode != 224 + && !evt.metaKey + && !evt.ctrlKey) { + + //NOT BACKSPACE, NOT DELETE, NOT CTRL, NOT COMMAND + //text nodes replaced by P + + container = wym.selected(); + var name = container.tagName.toLowerCase(); + + //fix forbidden main containers + if( + name == "strong" || + name == "b" || + name == "em" || + name == "i" || + name == "sub" || + name == "sup" || + name == "a" || + name == "span" //fix #110 + + ) name = container.parentNode.tagName.toLowerCase(); + + if(name == WYMeditor.BODY || name == WYMeditor.DIV) wym._exec(WYMeditor.FORMAT_BLOCK, WYMeditor.P); //fix #110 for DIV + } +}; + +WYMeditor.WymClassSafari.prototype.openBlockTag = function(tag, attributes) +{ + var attributes = this.validator.getValidTagAttributes(tag, attributes); + + // Handle Safari styled spans + if(tag == 'span' && attributes.style) { + var new_tag = this.getTagForStyle(attributes.style); + if(new_tag){ + this._tag_stack.pop(); + var tag = new_tag; + this._tag_stack.push(new_tag); + attributes.style = ''; + + //should fix #125 - also removed the xhtml() override + if(typeof attributes['class'] == 'string') + attributes['class'] = attributes['class'].replace(/apple-style-span/gi, ''); + + } else { + return; + } + } + + this.output += this.helper.tag(tag, attributes, true); +}; + +WYMeditor.WymClassSafari.prototype.getTagForStyle = function(style) { + + if(/bold/.test(style)) return 'strong'; + if(/italic/.test(style)) return 'em'; + if(/sub/.test(style)) return 'sub'; + if(/super/.test(style)) return 'sup'; + return false; +}; diff --git a/gstudio/static/gstudio/js/wymeditor/jquery.wymeditor.min.js b/gstudio/static/gstudio/js/wymeditor/jquery.wymeditor.min.js new file mode 100644 index 0000000..a7f9018 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/jquery.wymeditor.min.js @@ -0,0 +1 @@ +if(!WYMeditor){var WYMeditor={}}(function(){if(!window.console||!console.firebug){var b=["log","debug","info","warn","error","assert","dir","dirxml","group","groupEnd","time","timeEnd","count","trace","profile","profileEnd"];WYMeditor.console={};for(var a=0;a<b.length;++a){WYMeditor.console[b[a]]=function(){}}}else{WYMeditor.console=window.console}})();jQuery.extend(WYMeditor,{VERSION:"0.5-rc1",INSTANCES:[],STRINGS:[],SKINS:[],NAME:"name",INDEX:"{Wym_Index}",WYM_INDEX:"wym_index",BASE_PATH:"{Wym_Base_Path}",CSS_PATH:"{Wym_Css_Path}",WYM_PATH:"{Wym_Wym_Path}",SKINS_DEFAULT_PATH:"skins/",SKINS_DEFAULT_CSS:"skin.css",SKINS_DEFAULT_JS:"skin.js",LANG_DEFAULT_PATH:"lang/",IFRAME_BASE_PATH:"{Wym_Iframe_Base_Path}",IFRAME_DEFAULT:"iframe/default/",JQUERY_PATH:"{Wym_Jquery_Path}",DIRECTION:"{Wym_Direction}",LOGO:"{Wym_Logo}",TOOLS:"{Wym_Tools}",TOOLS_ITEMS:"{Wym_Tools_Items}",TOOL_NAME:"{Wym_Tool_Name}",TOOL_TITLE:"{Wym_Tool_Title}",TOOL_CLASS:"{Wym_Tool_Class}",CLASSES:"{Wym_Classes}",CLASSES_ITEMS:"{Wym_Classes_Items}",CLASS_NAME:"{Wym_Class_Name}",CLASS_TITLE:"{Wym_Class_Title}",CONTAINERS:"{Wym_Containers}",CONTAINERS_ITEMS:"{Wym_Containers_Items}",CONTAINER_NAME:"{Wym_Container_Name}",CONTAINER_TITLE:"{Wym_Containers_Title}",CONTAINER_CLASS:"{Wym_Container_Class}",HTML:"{Wym_Html}",IFRAME:"{Wym_Iframe}",STATUS:"{Wym_Status}",DIALOG_TITLE:"{Wym_Dialog_Title}",DIALOG_BODY:"{Wym_Dialog_Body}",STRING:"string",BODY:"body",DIV:"div",P:"p",H1:"h1",H2:"h2",H3:"h3",H4:"h4",H5:"h5",H6:"h6",PRE:"pre",BLOCKQUOTE:"blockquote",A:"a",BR:"br",IMG:"img",TABLE:"table",TD:"td",TH:"th",UL:"ul",OL:"ol",LI:"li",CLASS:"class",HREF:"href",SRC:"src",TITLE:"title",ALT:"alt",DIALOG_LINK:"Link",DIALOG_IMAGE:"Image",DIALOG_TABLE:"Table",DIALOG_PASTE:"Paste_From_Word",BOLD:"Bold",ITALIC:"Italic",CREATE_LINK:"CreateLink",INSERT_IMAGE:"InsertImage",INSERT_TABLE:"InsertTable",INSERT_HTML:"InsertHTML",PASTE:"Paste",INDENT:"Indent",OUTDENT:"Outdent",TOGGLE_HTML:"ToggleHtml",FORMAT_BLOCK:"FormatBlock",PREVIEW:"Preview",UNLINK:"Unlink",INSERT_UNORDEREDLIST:"InsertUnorderedList",INSERT_ORDEREDLIST:"InsertOrderedList",MAIN_CONTAINERS:new Array("p","h1","h2","h3","h4","h5","h6","pre","blockquote"),BLOCKS:new Array("address","blockquote","div","dl","fieldset","form","h1","h2","h3","h4","h5","h6","hr","noscript","ol","p","pre","table","ul","dd","dt","li","tbody","td","tfoot","th","thead","tr"),KEY:{BACKSPACE:8,ENTER:13,END:35,HOME:36,LEFT:37,UP:38,RIGHT:39,DOWN:40,CURSOR:new Array(37,38,39,40),DELETE:46},NODE:{ELEMENT:1,ATTRIBUTE:2,TEXT:3},editor:function(b,a){this._index=WYMeditor.INSTANCES.push(this)-1;this._element=b;this._options=a;this._html=jQuery(b).val();if(this._options.html){this._html=this._options.html}this._options.basePath=this._options.basePath||this.computeBasePath();this._options.skinPath=this._options.skinPath||this._options.basePath+WYMeditor.SKINS_DEFAULT_PATH+this._options.skin+"/";this._options.wymPath=this._options.wymPath||this.computeWymPath();this._options.langPath=this._options.langPath||this._options.basePath+WYMeditor.LANG_DEFAULT_PATH;this._options.iframeBasePath=this._options.iframeBasePath||this._options.basePath+WYMeditor.IFRAME_DEFAULT;this._options.jQueryPath=this._options.jQueryPath||this.computeJqueryPath();this.init()}});jQuery.fn.wymeditor=function(a){a=jQuery.extend({html:"",basePath:false,skinPath:false,wymPath:false,iframeBasePath:false,jQueryPath:false,styles:false,stylesheet:false,skin:"default",initSkin:true,loadSkin:true,lang:"en",direction:"ltr",boxHtml:"<div class='wym_box'><div class='wym_area_top'>"+WYMeditor.TOOLS+"</div><div class='wym_area_left'></div><div class='wym_area_right'>"+WYMeditor.CONTAINERS+WYMeditor.CLASSES+"</div><div class='wym_area_main'>"+WYMeditor.HTML+WYMeditor.IFRAME+WYMeditor.STATUS+"</div><div class='wym_area_bottom'>"+WYMeditor.LOGO+"</div></div>",logoHtml:"<a class='wym_wymeditor_link' href='http://www.wymeditor.org/'>WYMeditor</a>",iframeHtml:"<div class='wym_iframe wym_section'><iframe src='"+WYMeditor.IFRAME_BASE_PATH+"wymiframe.html' onload='this.contentWindow.parent.WYMeditor.INSTANCES["+WYMeditor.INDEX+"].initIframe(this)'></iframe></div>",editorStyles:[],toolsHtml:"<div class='wym_tools wym_section'><h2>{Tools}</h2><ul>"+WYMeditor.TOOLS_ITEMS+"</ul></div>",toolsItemHtml:"<li class='"+WYMeditor.TOOL_CLASS+"'><a href='#' name='"+WYMeditor.TOOL_NAME+"' title='"+WYMeditor.TOOL_TITLE+"'>"+WYMeditor.TOOL_TITLE+"</a></li>",toolsItems:[{name:"Bold",title:"Strong",css:"wym_tools_strong"},{name:"Italic",title:"Emphasis",css:"wym_tools_emphasis"},{name:"Superscript",title:"Superscript",css:"wym_tools_superscript"},{name:"Subscript",title:"Subscript",css:"wym_tools_subscript"},{name:"InsertOrderedList",title:"Ordered_List",css:"wym_tools_ordered_list"},{name:"InsertUnorderedList",title:"Unordered_List",css:"wym_tools_unordered_list"},{name:"Indent",title:"Indent",css:"wym_tools_indent"},{name:"Outdent",title:"Outdent",css:"wym_tools_outdent"},{name:"Undo",title:"Undo",css:"wym_tools_undo"},{name:"Redo",title:"Redo",css:"wym_tools_redo"},{name:"CreateLink",title:"Link",css:"wym_tools_link"},{name:"Unlink",title:"Unlink",css:"wym_tools_unlink"},{name:"InsertImage",title:"Image",css:"wym_tools_image"},{name:"InsertTable",title:"Table",css:"wym_tools_table"},{name:"Paste",title:"Paste_From_Word",css:"wym_tools_paste"},{name:"ToggleHtml",title:"HTML",css:"wym_tools_html"},{name:"Preview",title:"Preview",css:"wym_tools_preview"}],containersHtml:"<div class='wym_containers wym_section'><h2>{Containers}</h2><ul>"+WYMeditor.CONTAINERS_ITEMS+"</ul></div>",containersItemHtml:"<li class='"+WYMeditor.CONTAINER_CLASS+"'><a href='#' name='"+WYMeditor.CONTAINER_NAME+"'>"+WYMeditor.CONTAINER_TITLE+"</a></li>",containersItems:[{name:"P",title:"Paragraph",css:"wym_containers_p"},{name:"H1",title:"Heading_1",css:"wym_containers_h1"},{name:"H2",title:"Heading_2",css:"wym_containers_h2"},{name:"H3",title:"Heading_3",css:"wym_containers_h3"},{name:"H4",title:"Heading_4",css:"wym_containers_h4"},{name:"H5",title:"Heading_5",css:"wym_containers_h5"},{name:"H6",title:"Heading_6",css:"wym_containers_h6"},{name:"PRE",title:"Preformatted",css:"wym_containers_pre"},{name:"BLOCKQUOTE",title:"Blockquote",css:"wym_containers_blockquote"},{name:"TH",title:"Table_Header",css:"wym_containers_th"}],classesHtml:"<div class='wym_classes wym_section'><h2>{Classes}</h2><ul>"+WYMeditor.CLASSES_ITEMS+"</ul></div>",classesItemHtml:"<li class='wym_classes_"+WYMeditor.CLASS_NAME+"'><a href='#' name='"+WYMeditor.CLASS_NAME+"'>"+WYMeditor.CLASS_TITLE+"</a></li>",classesItems:[],statusHtml:"<div class='wym_status wym_section'><h2>{Status}</h2></div>",htmlHtml:"<div class='wym_html wym_section'><h2>{Source_Code}</h2><textarea class='wym_html_val'></textarea></div>",boxSelector:".wym_box",toolsSelector:".wym_tools",toolsListSelector:" ul",containersSelector:".wym_containers",classesSelector:".wym_classes",htmlSelector:".wym_html",iframeSelector:".wym_iframe iframe",iframeBodySelector:".wym_iframe",statusSelector:".wym_status",toolSelector:".wym_tools a",containerSelector:".wym_containers a",classSelector:".wym_classes a",htmlValSelector:".wym_html_val",hrefSelector:".wym_href",srcSelector:".wym_src",titleSelector:".wym_title",altSelector:".wym_alt",textSelector:".wym_text",rowsSelector:".wym_rows",colsSelector:".wym_cols",captionSelector:".wym_caption",summarySelector:".wym_summary",submitSelector:".wym_submit",cancelSelector:".wym_cancel",previewSelector:"",dialogTypeSelector:".wym_dialog_type",dialogLinkSelector:".wym_dialog_link",dialogImageSelector:".wym_dialog_image",dialogTableSelector:".wym_dialog_table",dialogPasteSelector:".wym_dialog_paste",dialogPreviewSelector:".wym_dialog_preview",updateSelector:".wymupdate",updateEvent:"click",dialogFeatures:"menubar=no,titlebar=no,toolbar=no,resizable=no,width=560,height=300,top=0,left=0",dialogFeaturesPreview:"menubar=no,titlebar=no,toolbar=no,resizable=no,scrollbars=yes,width=560,height=300,top=0,left=0",dialogHtml:"<!DOCTYPE html PUBLIC '-//W3C//DTD XHTML 1.0 Strict//EN' 'http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd'><html dir='"+WYMeditor.DIRECTION+"'><head><link rel='stylesheet' type='text/css' media='screen' href='"+WYMeditor.CSS_PATH+"' /><title>"+WYMeditor.DIALOG_TITLE+"</title><script type='text/javascript' src='"+WYMeditor.JQUERY_PATH+"'><\/script><script type='text/javascript' src='"+WYMeditor.WYM_PATH+"'><\/script></head>"+WYMeditor.DIALOG_BODY+"</html>",dialogLinkHtml:"<body class='wym_dialog wym_dialog_link' onload='WYMeditor.INIT_DIALOG("+WYMeditor.INDEX+")'><form><fieldset><input type='hidden' class='wym_dialog_type' value='"+WYMeditor.DIALOG_LINK+"' /><legend>{Link}</legend><div class='row'><label>{URL}</label><input type='text' class='wym_href' value='' size='40' /></div><div class='row'><label>{Title}</label><input type='text' class='wym_title' value='' size='40' /></div><div class='row row-indent'><input class='wym_submit' type='button' value='{Submit}' /><input class='wym_cancel' type='button'value='{Cancel}' /></div></fieldset></form></body>",dialogImageHtml:"<body class='wym_dialog wym_dialog_image' onload='WYMeditor.INIT_DIALOG("+WYMeditor.INDEX+")'><form><fieldset><input type='hidden' class='wym_dialog_type' value='"+WYMeditor.DIALOG_IMAGE+"' /><legend>{Image}</legend><div class='row'><label>{URL}</label><input type='text' class='wym_src' value='' size='40' /></div><div class='row'><label>{Alternative_Text}</label><input type='text' class='wym_alt' value='' size='40' /></div><div class='row'><label>{Title}</label><input type='text' class='wym_title' value='' size='40' /></div><div class='row row-indent'><input class='wym_submit' type='button' value='{Submit}' /><input class='wym_cancel' type='button'value='{Cancel}' /></div></fieldset></form></body>",dialogTableHtml:"<body class='wym_dialog wym_dialog_table' onload='WYMeditor.INIT_DIALOG("+WYMeditor.INDEX+")'><form><fieldset><input type='hidden' class='wym_dialog_type' value='"+WYMeditor.DIALOG_TABLE+"' /><legend>{Table}</legend><div class='row'><label>{Caption}</label><input type='text' class='wym_caption' value='' size='40' /></div><div class='row'><label>{Summary}</label><input type='text' class='wym_summary' value='' size='40' /></div><div class='row'><label>{Number_Of_Rows}</label><input type='text' class='wym_rows' value='3' size='3' /></div><div class='row'><label>{Number_Of_Cols}</label><input type='text' class='wym_cols' value='2' size='3' /></div><div class='row row-indent'><input class='wym_submit' type='button' value='{Submit}' /><input class='wym_cancel' type='button'value='{Cancel}' /></div></fieldset></form></body>",dialogPasteHtml:"<body class='wym_dialog wym_dialog_paste' onload='WYMeditor.INIT_DIALOG("+WYMeditor.INDEX+")'><form><input type='hidden' class='wym_dialog_type' value='"+WYMeditor.DIALOG_PASTE+"' /><fieldset><legend>{Paste_From_Word}</legend><div class='row'><textarea class='wym_text' rows='10' cols='50'></textarea></div><div class='row'><input class='wym_submit' type='button' value='{Submit}' /><input class='wym_cancel' type='button'value='{Cancel}' /></div></fieldset></form></body>",dialogPreviewHtml:"<body class='wym_dialog wym_dialog_preview' onload='WYMeditor.INIT_DIALOG("+WYMeditor.INDEX+")'></body>",dialogStyles:[],stringDelimiterLeft:"{",stringDelimiterRight:"}",preInit:null,preBind:null,postInit:null,preInitDialog:null,postInitDialog:null},a);return this.each(function(){new WYMeditor.editor(jQuery(this),a)})};jQuery.extend({wymeditors:function(a){return(WYMeditor.INSTANCES[a])}});WYMeditor.editor.prototype.init=function(){if(jQuery.browser.msie){var WymClass=new WYMeditor.WymClassExplorer(this)}else{if(jQuery.browser.mozilla){var WymClass=new WYMeditor.WymClassMozilla(this)}else{if(jQuery.browser.opera){var WymClass=new WYMeditor.WymClassOpera(this)}else{if(jQuery.browser.safari){var WymClass=new WYMeditor.WymClassSafari(this)}}}}if(WymClass){if(jQuery.isFunction(this._options.preInit)){this._options.preInit(this)}var SaxListener=new WYMeditor.XhtmlSaxListener();jQuery.extend(SaxListener,WymClass);this.parser=new WYMeditor.XhtmlParser(SaxListener);if(this._options.styles||this._options.stylesheet){this.configureEditorUsingRawCss()}this.helper=new WYMeditor.XmlHelper();for(var prop in WymClass){this[prop]=WymClass[prop]}this._box=jQuery(this._element).hide().after(this._options.boxHtml).next().addClass("wym_box_"+this._index);if(jQuery.isFunction(jQuery.fn.data)){jQuery.data(this._box.get(0),WYMeditor.WYM_INDEX,this._index);jQuery.data(this._element.get(0),WYMeditor.WYM_INDEX,this._index)}var h=WYMeditor.Helper;var iframeHtml=this._options.iframeHtml;iframeHtml=h.replaceAll(iframeHtml,WYMeditor.INDEX,this._index);iframeHtml=h.replaceAll(iframeHtml,WYMeditor.IFRAME_BASE_PATH,this._options.iframeBasePath);var boxHtml=jQuery(this._box).html();boxHtml=h.replaceAll(boxHtml,WYMeditor.LOGO,this._options.logoHtml);boxHtml=h.replaceAll(boxHtml,WYMeditor.TOOLS,this._options.toolsHtml);boxHtml=h.replaceAll(boxHtml,WYMeditor.CONTAINERS,this._options.containersHtml);boxHtml=h.replaceAll(boxHtml,WYMeditor.CLASSES,this._options.classesHtml);boxHtml=h.replaceAll(boxHtml,WYMeditor.HTML,this._options.htmlHtml);boxHtml=h.replaceAll(boxHtml,WYMeditor.IFRAME,iframeHtml);boxHtml=h.replaceAll(boxHtml,WYMeditor.STATUS,this._options.statusHtml);var aTools=eval(this._options.toolsItems);var sTools="";for(var i=0;i<aTools.length;i++){var oTool=aTools[i];if(oTool.name&&oTool.title){var sTool=this._options.toolsItemHtml}var sTool=h.replaceAll(sTool,WYMeditor.TOOL_NAME,oTool.name);sTool=h.replaceAll(sTool,WYMeditor.TOOL_TITLE,this._options.stringDelimiterLeft+oTool.title+this._options.stringDelimiterRight);sTool=h.replaceAll(sTool,WYMeditor.TOOL_CLASS,oTool.css);sTools+=sTool}boxHtml=h.replaceAll(boxHtml,WYMeditor.TOOLS_ITEMS,sTools);var aClasses=eval(this._options.classesItems);var sClasses="";for(var i=0;i<aClasses.length;i++){var oClass=aClasses[i];if(oClass.name&&oClass.title){var sClass=this._options.classesItemHtml}sClass=h.replaceAll(sClass,WYMeditor.CLASS_NAME,oClass.name);sClass=h.replaceAll(sClass,WYMeditor.CLASS_TITLE,oClass.title);sClasses+=sClass}boxHtml=h.replaceAll(boxHtml,WYMeditor.CLASSES_ITEMS,sClasses);var aContainers=eval(this._options.containersItems);var sContainers="";for(var i=0;i<aContainers.length;i++){var oContainer=aContainers[i];if(oContainer.name&&oContainer.title){var sContainer=this._options.containersItemHtml}sContainer=h.replaceAll(sContainer,WYMeditor.CONTAINER_NAME,oContainer.name);sContainer=h.replaceAll(sContainer,WYMeditor.CONTAINER_TITLE,this._options.stringDelimiterLeft+oContainer.title+this._options.stringDelimiterRight);sContainer=h.replaceAll(sContainer,WYMeditor.CONTAINER_CLASS,oContainer.css);sContainers+=sContainer}boxHtml=h.replaceAll(boxHtml,WYMeditor.CONTAINERS_ITEMS,sContainers);boxHtml=this.replaceStrings(boxHtml);jQuery(this._box).html(boxHtml);jQuery(this._box).find(this._options.htmlSelector).hide();this.loadSkin()}};WYMeditor.editor.prototype.bindEvents=function(){var wym=this;jQuery(this._box).find(this._options.toolSelector).click(function(){wym._iframe.contentWindow.focus();wym.exec(jQuery(this).attr(WYMeditor.NAME));return(false)});jQuery(this._box).find(this._options.containerSelector).click(function(){wym.container(jQuery(this).attr(WYMeditor.NAME));return(false)});jQuery(this._box).find(this._options.htmlValSelector).keyup(function(){jQuery(wym._doc.body).html(jQuery(this).val())}).focus(function(){jQuery(this).toggleClass("hasfocus")}).blur(function(){jQuery(this).toggleClass("hasfocus")});jQuery(this._box).find(this._options.classSelector).click(function(){var aClasses=eval(wym._options.classesItems);var sName=jQuery(this).attr(WYMeditor.NAME);var oClass=WYMeditor.Helper.findByName(aClasses,sName);if(oClass){var jqexpr=oClass.expr;wym.toggleClass(sName,jqexpr)}wym._iframe.contentWindow.focus();return(false)});jQuery(this._options.updateSelector).bind(this._options.updateEvent,function(){wym.update()})};WYMeditor.editor.prototype.ready=function(){return(this._doc!=null)};WYMeditor.editor.prototype.box=function(){return(this._box)};WYMeditor.editor.prototype.html=function(a){if(typeof a==="string"){jQuery(this._doc.body).html(a)}else{return(jQuery(this._doc.body).html())}};WYMeditor.editor.prototype.xhtml=function(){return this.parser.parse(this.html())};WYMeditor.editor.prototype.exec=function(b){switch(b){case WYMeditor.CREATE_LINK:var a=this.container();if(a||this._selected_image){this.dialog(WYMeditor.DIALOG_LINK)}break;case WYMeditor.INSERT_IMAGE:this.dialog(WYMeditor.DIALOG_IMAGE);break;case WYMeditor.INSERT_TABLE:this.dialog(WYMeditor.DIALOG_TABLE);break;case WYMeditor.PASTE:this.dialog(WYMeditor.DIALOG_PASTE);break;case WYMeditor.TOGGLE_HTML:this.update();this.toggleHtml();break;case WYMeditor.PREVIEW:this.dialog(WYMeditor.PREVIEW,this._options.dialogFeaturesPreview);break;default:this._exec(b);break}};WYMeditor.editor.prototype.container=function(a){if(a){var d=null;if(a.toLowerCase()==WYMeditor.TH){d=this.container();switch(d.tagName.toLowerCase()){case WYMeditor.TD:case WYMeditor.TH:break;default:var e=new Array(WYMeditor.TD,WYMeditor.TH);d=this.findUp(this.container(),e);break}if(d!=null){a=(d.tagName.toLowerCase()==WYMeditor.TD)?WYMeditor.TH:WYMeditor.TD;this.switchTo(d,a);this.update()}}else{var e=new Array(WYMeditor.P,WYMeditor.H1,WYMeditor.H2,WYMeditor.H3,WYMeditor.H4,WYMeditor.H5,WYMeditor.H6,WYMeditor.PRE,WYMeditor.BLOCKQUOTE);d=this.findUp(this.container(),e);if(d){var i=null;if(a.toLowerCase()==WYMeditor.BLOCKQUOTE){var f=this.findUp(this.container(),WYMeditor.BLOCKQUOTE);if(f==null){i=this._doc.createElement(a);d.parentNode.insertBefore(i,d);i.appendChild(d);this.setFocusToNode(i.firstChild)}else{var c=f.childNodes;var g=c.length;var b=null;if(g>0){b=c.item(0)}for(var h=0;h<g;h++){f.parentNode.insertBefore(c.item(0),f)}f.parentNode.removeChild(f);if(b){this.setFocusToNode(b)}}}else{this.switchTo(d,a)}this.update()}}}else{return(this.selected())}};WYMeditor.editor.prototype.toggleClass=function(c,b){var a=(this._selected_image?this._selected_image:jQuery(this.selected()));a=jQuery(a).parentsOrSelf(b);jQuery(a).toggleClass(c);if(!jQuery(a).attr(WYMeditor.CLASS)){jQuery(a).removeAttr(this._class)}};WYMeditor.editor.prototype.findUp=function(d,c){if(d){var e=d.tagName.toLowerCase();if(typeof(c)==WYMeditor.STRING){while(e!=c&&e!=WYMeditor.BODY){d=d.parentNode;e=d.tagName.toLowerCase()}}else{var b=false;while(!b&&e!=WYMeditor.BODY){for(var a=0;a<c.length;a++){if(e==c[a]){b=true;break}}if(!b){d=d.parentNode;e=d.tagName.toLowerCase()}}}if(e!=WYMeditor.BODY){return(d)}else{return(null)}}else{return(null)}};WYMeditor.editor.prototype.switchTo=function(c,d){var b=this._doc.createElement(d);var a=jQuery(c).html();c.parentNode.replaceChild(b,c);jQuery(b).html(a);this.setFocusToNode(b)};WYMeditor.editor.prototype.replaceStrings=function(sVal){if(!WYMeditor.STRINGS[this._options.lang]){try{eval(jQuery.ajax({url:this._options.langPath+this._options.lang+".js",async:false}).responseText)}catch(e){WYMeditor.console.error("WYMeditor: error while parsing language file.");return sVal}}for(var key in WYMeditor.STRINGS[this._options.lang]){sVal=WYMeditor.Helper.replaceAll(sVal,this._options.stringDelimiterLeft+key+this._options.stringDelimiterRight,WYMeditor.STRINGS[this._options.lang][key])}return(sVal)};WYMeditor.editor.prototype.encloseString=function(a){return(this._options.stringDelimiterLeft+a+this._options.stringDelimiterRight)};WYMeditor.editor.prototype.status=function(a){jQuery(this._box).find(this._options.statusSelector).html(a)};WYMeditor.editor.prototype.update=function(){var a=this.xhtml();jQuery(this._element).val(a);jQuery(this._box).find(this._options.htmlValSelector).not(".hasfocus").val(a)};WYMeditor.editor.prototype.dialog=function(j,c,f){var a=c||this._wym._options.dialogFeatures;var d=window.open("","dialog",a);if(d){var b="";switch(j){case (WYMeditor.DIALOG_LINK):b=this._options.dialogLinkHtml;break;case (WYMeditor.DIALOG_IMAGE):b=this._options.dialogImageHtml;break;case (WYMeditor.DIALOG_TABLE):b=this._options.dialogTableHtml;break;case (WYMeditor.DIALOG_PASTE):b=this._options.dialogPasteHtml;break;case (WYMeditor.PREVIEW):b=this._options.dialogPreviewHtml;break;default:b=f}var e=WYMeditor.Helper;var g=this._options.dialogHtml;g=e.replaceAll(g,WYMeditor.BASE_PATH,this._options.basePath);g=e.replaceAll(g,WYMeditor.DIRECTION,this._options.direction);g=e.replaceAll(g,WYMeditor.CSS_PATH,this._options.skinPath+WYMeditor.SKINS_DEFAULT_CSS);g=e.replaceAll(g,WYMeditor.WYM_PATH,this._options.wymPath);g=e.replaceAll(g,WYMeditor.JQUERY_PATH,this._options.jQueryPath);g=e.replaceAll(g,WYMeditor.DIALOG_TITLE,this.encloseString(j));g=e.replaceAll(g,WYMeditor.DIALOG_BODY,b);g=e.replaceAll(g,WYMeditor.INDEX,this._index);g=this.replaceStrings(g);var i=d.document;i.write(g);i.close()}};WYMeditor.editor.prototype.toggleHtml=function(){jQuery(this._box).find(this._options.htmlSelector).toggle()};WYMeditor.editor.prototype.uniqueStamp=function(){var a=new Date();return("wym-"+a.getTime())};WYMeditor.editor.prototype.paste=function(b){var e;var a=this.selected();var c=b.split(this._newLine+this._newLine);var d=new RegExp(this._newLine,"g");if(a&&a.tagName.toLowerCase()!=WYMeditor.BODY){for(x=c.length-1;x>=0;x--){e=c[x];e=e.replace(d,"<br />");jQuery(a).after("<p>"+e+"</p>")}}else{for(x=0;x<c.length;x++){e=c[x];e=e.replace(d,"<br />");jQuery(this._doc.body).append("<p>"+e+"</p>")}}};WYMeditor.editor.prototype.insert=function(a){if(this._iframe.contentWindow.getSelection().focusNode!=null){this._exec(WYMeditor.INSERT_HTML,a)}else{this.paste(a)}};WYMeditor.editor.prototype.wrap=function(b,a){if(this._iframe.contentWindow.getSelection().focusNode!=null){this._exec(WYMeditor.INSERT_HTML,b+this._iframe.contentWindow.getSelection().toString()+a)}};WYMeditor.editor.prototype.unwrap=function(){if(this._iframe.contentWindow.getSelection().focusNode!=null){this._exec(WYMeditor.INSERT_HTML,this._iframe.contentWindow.getSelection().toString())}};WYMeditor.editor.prototype.setFocusToNode=function(d,b){var a=this._doc.createRange(),c=this._iframe.contentWindow.getSelection();b=b?0:1;a.selectNodeContents(d);c.addRange(a);c.collapse(d,b);this._iframe.contentWindow.focus()};WYMeditor.editor.prototype.addCssRules=function(e,c){var b=e.styleSheets[0];if(b){for(var a=0;a<c.length;a++){var d=c[a];if(d.name&&d.css){this.addCssRule(b,d)}}}};WYMeditor.editor.prototype.computeBasePath=function(){return jQuery(jQuery.grep(jQuery("script"),function(a){return(a.src&&a.src.match(/jquery\.wymeditor(\.pack|\.min|\.packed)?\.js(\?.*)?$/))})).attr("src").replace(/jquery\.wymeditor(\.pack|\.min|\.packed)?\.js(\?.*)?$/,"")};WYMeditor.editor.prototype.computeWymPath=function(){return jQuery(jQuery.grep(jQuery("script"),function(a){return(a.src&&a.src.match(/jquery\.wymeditor(\.pack|\.min|\.packed)?\.js(\?.*)?$/))})).attr("src")};WYMeditor.editor.prototype.computeJqueryPath=function(){return jQuery(jQuery.grep(jQuery("script"),function(a){return(a.src&&a.src.match(/jquery(-(.*)){0,1}(\.pack|\.min|\.packed)?\.js(\?.*)?$/))})).attr("src")};WYMeditor.editor.prototype.computeCssPath=function(){return jQuery(jQuery.grep(jQuery("link"),function(a){return(a.href&&a.href.match(/wymeditor\/skins\/(.*)screen\.css(\?.*)?$/))})).attr("href")};WYMeditor.editor.prototype.configureEditorUsingRawCss=function(){var a=new WYMeditor.WymCssParser();if(this._options.stylesheet){a.parse(jQuery.ajax({url:this._options.stylesheet,async:false}).responseText)}else{a.parse(this._options.styles,false)}if(this._options.classesItems.length==0){this._options.classesItems=a.css_settings.classesItems}if(this._options.editorStyles.length==0){this._options.editorStyles=a.css_settings.editorStyles}if(this._options.dialogStyles.length==0){this._options.dialogStyles=a.css_settings.dialogStyles}};WYMeditor.editor.prototype.listen=function(){jQuery(this._doc.body).bind("mousedown",this.mousedown)};WYMeditor.editor.prototype.mousedown=function(a){var b=WYMeditor.INSTANCES[this.ownerDocument.title];b._selected_image=(a.target.tagName.toLowerCase()==WYMeditor.IMG)?a.target:null};WYMeditor.loadCss=function(a){var c=document.createElement("link");c.rel="stylesheet";c.href=a;var b=jQuery("head").get(0);b.appendChild(c)};WYMeditor.editor.prototype.loadSkin=function(){if(this._options.loadSkin&&!WYMeditor.SKINS[this._options.skin]){var found=false;var rExp=new RegExp(this._options.skin+"/"+WYMeditor.SKINS_DEFAULT_CSS+"$");jQuery("link").each(function(){if(this.href.match(rExp)){found=true}});if(!found){WYMeditor.loadCss(this._options.skinPath+WYMeditor.SKINS_DEFAULT_CSS)}}jQuery(this._box).addClass("wym_skin_"+this._options.skin);if(this._options.initSkin&&!WYMeditor.SKINS[this._options.skin]){eval(jQuery.ajax({url:this._options.skinPath+WYMeditor.SKINS_DEFAULT_JS,async:false}).responseText)}if(WYMeditor.SKINS[this._options.skin]&&WYMeditor.SKINS[this._options.skin].init){WYMeditor.SKINS[this._options.skin].init(this)}};WYMeditor.INIT_DIALOG=function(index){var wym=window.opener.WYMeditor.INSTANCES[index];var doc=window.document;var selected=wym.selected();var dialogType=jQuery(wym._options.dialogTypeSelector).val();var sStamp=wym.uniqueStamp();switch(dialogType){case WYMeditor.DIALOG_LINK:if(selected&&selected.tagName&&selected.tagName.toLowerCase!=WYMeditor.A){selected=jQuery(selected).parentsOrSelf(WYMeditor.A)}if(!selected&&wym._selected_image){selected=jQuery(wym._selected_image).parentsOrSelf(WYMeditor.A)}break}if(jQuery.isFunction(wym._options.preInitDialog)){wym._options.preInitDialog(wym,window)}var styles=doc.styleSheets[0];var aCss=eval(wym._options.dialogStyles);wym.addCssRules(doc,aCss);if(selected){jQuery(wym._options.hrefSelector).val(jQuery(selected).attr(WYMeditor.HREF));jQuery(wym._options.srcSelector).val(jQuery(selected).attr(WYMeditor.SRC));jQuery(wym._options.titleSelector).val(jQuery(selected).attr(WYMeditor.TITLE));jQuery(wym._options.altSelector).val(jQuery(selected).attr(WYMeditor.ALT))}if(wym._selected_image){jQuery(wym._options.dialogImageSelector+" "+wym._options.srcSelector).val(jQuery(wym._selected_image).attr(WYMeditor.SRC));jQuery(wym._options.dialogImageSelector+" "+wym._options.titleSelector).val(jQuery(wym._selected_image).attr(WYMeditor.TITLE));jQuery(wym._options.dialogImageSelector+" "+wym._options.altSelector).val(jQuery(wym._selected_image).attr(WYMeditor.ALT))}jQuery(wym._options.dialogLinkSelector+" "+wym._options.submitSelector).click(function(){var sUrl=jQuery(wym._options.hrefSelector).val();if(sUrl.length>0){var link;if(selected[0]&&selected[0].tagName.toLowerCase()==WYMeditor.A){link=selected}else{wym._exec(WYMeditor.CREATE_LINK,sStamp);link=jQuery("a[href="+sStamp+"]",wym._doc.body)}link.attr(WYMeditor.HREF,sUrl).attr(WYMeditor.TITLE,jQuery(wym._options.titleSelector).val())}window.close()});jQuery(wym._options.dialogImageSelector+" "+wym._options.submitSelector).click(function(){var sUrl=jQuery(wym._options.srcSelector).val();if(sUrl.length>0){wym._exec(WYMeditor.INSERT_IMAGE,sStamp);jQuery("img[src$="+sStamp+"]",wym._doc.body).attr(WYMeditor.SRC,sUrl).attr(WYMeditor.TITLE,jQuery(wym._options.titleSelector).val()).attr(WYMeditor.ALT,jQuery(wym._options.altSelector).val())}window.close()});jQuery(wym._options.dialogTableSelector+" "+wym._options.submitSelector).click(function(){var iRows=jQuery(wym._options.rowsSelector).val();var iCols=jQuery(wym._options.colsSelector).val();if(iRows>0&&iCols>0){var table=wym._doc.createElement(WYMeditor.TABLE);var newRow=null;var newCol=null;var sCaption=jQuery(wym._options.captionSelector).val();var newCaption=table.createCaption();newCaption.innerHTML=sCaption;for(x=0;x<iRows;x++){newRow=table.insertRow(x);for(y=0;y<iCols;y++){newRow.insertCell(y)}}jQuery(table).attr("summary",jQuery(wym._options.summarySelector).val());var node=jQuery(wym.findUp(wym.container(),WYMeditor.MAIN_CONTAINERS)).get(0);if(!node||!node.parentNode){jQuery(wym._doc.body).append(table)}else{jQuery(node).after(table)}}window.close()});jQuery(wym._options.dialogPasteSelector+" "+wym._options.submitSelector).click(function(){var sText=jQuery(wym._options.textSelector).val();wym.paste(sText);window.close()});jQuery(wym._options.dialogPreviewSelector+" "+wym._options.previewSelector).html(wym.xhtml());jQuery(wym._options.cancelSelector).mousedown(function(){window.close()});if(jQuery.isFunction(wym._options.postInitDialog)){wym._options.postInitDialog(wym,window)}};WYMeditor.XmlHelper=function(){this._entitiesDiv=document.createElement("div");return this};WYMeditor.XmlHelper.prototype.tag=function(c,b,a){b=b||false;a=a||false;return"<"+c+(b?this.tagOptions(b):"")+(a?">":" />")};WYMeditor.XmlHelper.prototype.contentTag=function(b,c,a){a=a||false;return"<"+b+(a?this.tagOptions(a):"")+">"+c+"</"+b+">"};WYMeditor.XmlHelper.prototype.cdataSection=function(a){return"<![CDATA["+a+"]]>"};WYMeditor.XmlHelper.prototype.escapeOnce=function(a){return this._fixDoubleEscape(this.escapeEntities(a))};WYMeditor.XmlHelper.prototype._fixDoubleEscape=function(a){return a.replace(/&([a-z]+|(#\d+));/ig,"&$1;")};WYMeditor.XmlHelper.prototype.tagOptions=function(b){var a=this;a._formated_options="";for(var c in b){var d="";var e=b[c];if(typeof e!="function"&&e.length>0){if(parseInt(c)==c&&typeof e=="object"){c=e.shift();e=e.pop()}if(c!=""&&e!=""){a._formated_options+=" "+c+'="'+a.escapeOnce(e)+'"'}}}return a._formated_options};WYMeditor.XmlHelper.prototype.escapeEntities=function(c,b){this._entitiesDiv.innerHTML=c;this._entitiesDiv.textContent=c;var a=this._entitiesDiv.innerHTML;if(typeof b=="undefined"){if(b!=false){a=a.replace('"',""")}if(b==true){a=a.replace('"',"'")}}return a};WYMeditor.XmlHelper.prototype.parseAttributes=function(h){var a=[];var g=h.split(/((=\s*")(")("))|((=\s*\')(\')(\'))|((=\s*[^>\s]*))/g);if(g.toString()!=h){for(var d in g){var c=g[d];if(typeof c!="function"&&c.length!=0){var e=new RegExp("(\\w+)\\s*"+c);if(match=h.match(e)){var f=c.replace(/^[\s=]+/,"");var b=f.charAt(0);b=b=='"'?'"':(b=="'"?"'":"");if(b!=""){f=b=='"'?f.replace(/^"|"+$/g,""):f.replace(/^'|'+$/g,"")}h=h.replace(match[0],"");a.push([match[1],f])}}}}return a};WYMeditor.XhtmlValidator={_attributes:{core:{except:["base","head","html","meta","param","script","style","title"],attributes:["class","id","style","title","accesskey","tabindex"]},language:{except:["base","br","hr","iframe","param","script"],attributes:{dir:["ltr","rtl"],"0":"lang","1":"xml:lang"}},keyboard:{attributes:{accesskey:/^(\w){1}$/,tabindex:/^(\d)+$/}}},_events:{window:{only:["body"],attributes:["onload","onunload"]},form:{only:["form","input","textarea","select","a","label","button"],attributes:["onchange","onsubmit","onreset","onselect","onblur","onfocus"]},keyboard:{except:["base","bdo","br","frame","frameset","head","html","iframe","meta","param","script","style","title"],attributes:["onkeydown","onkeypress","onkeyup"]},mouse:{except:["base","bdo","br","head","html","meta","param","script","style","title"],attributes:["onclick","ondblclick","onmousedown","onmousemove","onmouseover","onmouseout","onmouseup"]}},_tags:{a:{attributes:{"0":"charset","1":"coords","2":"href","3":"hreflang","4":"name",rel:/^(alternate|designates|stylesheet|start|next|prev|contents|index|glossary|copyright|chapter|section|subsection|appendix|help|bookmark| |shortcut|icon)+$/,rev:/^(alternate|designates|stylesheet|start|next|prev|contents|index|glossary|copyright|chapter|section|subsection|appendix|help|bookmark| |shortcut|icon)+$/,shape:/^(rect|rectangle|circ|circle|poly|polygon)$/,"5":"type"}},"0":"abbr","1":"acronym","2":"address",area:{attributes:{"0":"alt","1":"coords","2":"href",nohref:/^(true|false)$/,shape:/^(rect|rectangle|circ|circle|poly|polygon)$/},required:["alt"]},"3":"b",base:{attributes:["href"],required:["href"]},bdo:{attributes:{dir:/^(ltr|rtl)$/},required:["dir"]},"4":"big",blockquote:{attributes:["cite"]},"5":"body","6":"br",button:{attributes:{disabled:/^(disabled)$/,type:/^(button|reset|submit)$/,"0":"value"},inside:"form"},"7":"caption","8":"cite","9":"code",col:{attributes:{align:/^(right|left|center|justify)$/,"0":"char","1":"charoff",span:/^(\d)+$/,valign:/^(top|middle|bottom|baseline)$/,"2":"width"},inside:"colgroup"},colgroup:{attributes:{align:/^(right|left|center|justify)$/,"0":"char","1":"charoff",span:/^(\d)+$/,valign:/^(top|middle|bottom|baseline)$/,"2":"width"}},"10":"dd",del:{attributes:{"0":"cite",datetime:/^([0-9]){8}/}},"11":"div","12":"dfn","13":"dl","14":"dt","15":"em",fieldset:{inside:"form"},form:{attributes:{"0":"action","1":"accept","2":"accept-charset","3":"enctype",method:/^(get|post)$/},required:["action"]},head:{attributes:["profile"]},"16":"h1","17":"h2","18":"h3","19":"h4","20":"h5","21":"h6","22":"hr",html:{attributes:["xmlns"]},"23":"i",img:{attributes:["alt","src","height","ismap","longdesc","usemap","width"],required:["alt","src"]},input:{attributes:{"0":"accept","1":"alt",checked:/^(checked)$/,disabled:/^(disabled)$/,maxlength:/^(\d)+$/,"2":"name",readonly:/^(readonly)$/,size:/^(\d)+$/,"3":"src",type:/^(button|checkbox|file|hidden|image|password|radio|reset|submit|text)$/,"4":"value"},inside:"form"},ins:{attributes:{"0":"cite",datetime:/^([0-9]){8}/}},"24":"kbd",label:{attributes:["for"],inside:"form"},"25":"legend","26":"li",link:{attributes:{"0":"charset","1":"href","2":"hreflang",media:/^(all|braille|print|projection|screen|speech|,|;| )+$/i,rel:/^(alternate|appendix|bookmark|chapter|contents|copyright|glossary|help|home|index|next|prev|section|start|stylesheet|subsection| |shortcut|icon)+$/i,rev:/^(alternate|appendix|bookmark|chapter|contents|copyright|glossary|help|home|index|next|prev|section|start|stylesheet|subsection| |shortcut|icon)+$/i,"3":"type"},inside:"head"},map:{attributes:["id","name"],required:["id"]},meta:{attributes:{"0":"content","http-equiv":/^(content\-type|expires|refresh|set\-cookie)$/i,"1":"name","2":"scheme"},required:["content"]},"27":"noscript",object:{attributes:["archive","classid","codebase","codetype","data","declare","height","name","standby","type","usemap","width"]},"28":"ol",optgroup:{attributes:{"0":"label",disabled:/^(disabled)$/},required:["label"]},option:{attributes:{"0":"label",disabled:/^(disabled)$/,selected:/^(selected)$/,"1":"value"},inside:"select"},"29":"p",param:{attributes:{"0":"type",valuetype:/^(data|ref|object)$/,"1":"valuetype","2":"value"},required:["name"]},"30":"pre",q:{attributes:["cite"]},"31":"samp",script:{attributes:{type:/^(text\/ecmascript|text\/javascript|text\/jscript|text\/vbscript|text\/vbs|text\/xml)$/,"0":"charset",defer:/^(defer)$/,"1":"src"},required:["type"]},select:{attributes:{disabled:/^(disabled)$/,multiple:/^(multiple)$/,"0":"name","1":"size"},inside:"form"},"32":"small","33":"span","34":"strong",style:{attributes:{"0":"type",media:/^(screen|tty|tv|projection|handheld|print|braille|aural|all)$/},required:["type"]},"35":"sub","36":"sup",table:{attributes:{"0":"border","1":"cellpadding","2":"cellspacing",frame:/^(void|above|below|hsides|lhs|rhs|vsides|box|border)$/,rules:/^(none|groups|rows|cols|all)$/,"3":"summary","4":"width"}},tbody:{attributes:{align:/^(right|left|center|justify)$/,"0":"char","1":"charoff",valign:/^(top|middle|bottom|baseline)$/}},td:{attributes:{"0":"abbr",align:/^(left|right|center|justify|char)$/,"1":"axis","2":"char","3":"charoff",colspan:/^(\d)+$/,"4":"headers",rowspan:/^(\d)+$/,scope:/^(col|colgroup|row|rowgroup)$/,valign:/^(top|middle|bottom|baseline)$/}},textarea:{attributes:["cols","rows","disabled","name","readonly"],required:["cols","rows"],inside:"form"},tfoot:{attributes:{align:/^(right|left|center|justify)$/,"0":"char","1":"charoff",valign:/^(top|middle|bottom)$/,"2":"baseline"}},th:{attributes:{"0":"abbr",align:/^(left|right|center|justify|char)$/,"1":"axis","2":"char","3":"charoff",colspan:/^(\d)+$/,"4":"headers",rowspan:/^(\d)+$/,scope:/^(col|colgroup|row|rowgroup)$/,valign:/^(top|middle|bottom|baseline)$/}},thead:{attributes:{align:/^(right|left|center|justify)$/,"0":"char","1":"charoff",valign:/^(top|middle|bottom|baseline)$/}},"37":"title",tr:{attributes:{align:/^(right|left|center|justify|char)$/,"0":"char","1":"charoff",valign:/^(top|middle|bottom|baseline)$/}},"38":"tt","39":"ul","40":"var"},skiped_attributes:[],skiped_attribute_values:[],getValidTagAttributes:function(a,b){var c={};var g=this.getPossibleTagAttributes(a);for(var e in b){var f=b[e];var d=WYMeditor.Helper;if(!d.contains(this.skiped_attributes,e)&&!d.contains(this.skiped_attribute_values,f)){if(typeof f!="function"&&d.contains(g,e)){if(this.doesAttributeNeedsValidation(a,e)){if(this.validateAttribute(a,e,f)){c[e]=f}}else{c[e]=f}}}}return c},getUniqueAttributesAndEventsForTag:function(b){var a=[];if(this._tags[b]&&this._tags[b]["attributes"]){for(k in this._tags[b]["attributes"]){a.push(parseInt(k)==k?this._tags[b]["attributes"][k]:k)}}return a},getDefaultAttributesAndEventsForTags:function(){var a=[];for(var b in this._events){a.push(this._events[b])}for(var b in this._attributes){a.push(this._attributes[b])}return a},isValidTag:function(a){if(this._tags[a]){return true}for(var b in this._tags){if(this._tags[b]==a){return true}}return false},getDefaultAttributesAndEventsForTag:function(a){var i=[];if(this.isValidTag(a)){var g=this.getDefaultAttributesAndEventsForTags();for(var d in g){var f=g[d];if(typeof f=="object"){var e=WYMeditor.Helper;if((f.except&&e.contains(f.except,a))||(f.only&&!e.contains(f.only,a))){continue}var c=f.attributes?f.attributes:f.events;for(var b in c){i.push(typeof c[b]!="string"?b:c[b])}}}}return i},doesAttributeNeedsValidation:function(a,b){return this._tags[a]&&((this._tags[a]["attributes"]&&this._tags[a]["attributes"][b])||(this._tags[a]["required"]&&WYMeditor.Helper.contains(this._tags[a]["required"],b)))},validateAttribute:function(a,b,c){if(this._tags[a]&&(this._tags[a]["attributes"]&&this._tags[a]["attributes"][b]&&c.length>0&&!c.match(this._tags[a]["attributes"][b]))||(this._tags[a]&&this._tags[a]["required"]&&WYMeditor.Helper.contains(this._tags[a]["required"],b)&&c.length==0)){return false}return typeof this._tags[a]!="undefined"},getPossibleTagAttributes:function(a){if(!this._possible_tag_attributes){this._possible_tag_attributes={}}if(!this._possible_tag_attributes[a]){this._possible_tag_attributes[a]=this.getUniqueAttributesAndEventsForTag(a).concat(this.getDefaultAttributesAndEventsForTag(a))}return this._possible_tag_attributes[a]}};WYMeditor.ParallelRegex=function(a){this._case=a;this._patterns=[];this._labels=[];this._regex=null;return this};WYMeditor.ParallelRegex.prototype.addPattern=function(c,a){a=a||true;var b=this._patterns.length;this._patterns[b]=c;this._labels[b]=a;this._regex=null};WYMeditor.ParallelRegex.prototype.match=function(c){if(this._patterns.length==0){return[false,""]}var d=c.match(this._getCompoundedRegex());if(!d){return[false,""]}var a=d[0];for(var b=1;b<d.length;b++){if(d[b]){return[this._labels[b-1],a]}}return[true,d[0]]};WYMeditor.ParallelRegex.prototype._getCompoundedRegex=function(){if(this._regex==null){for(var a=0,b=this._patterns.length;a<b;a++){this._patterns[a]="("+this._untokenizeRegex(this._tokenizeRegex(this._patterns[a]).replace(/([\/\(\)])/g,"\\$1"))+")"}this._regex=new RegExp(this._patterns.join("|"),this._getPerlMatchingFlags())}return this._regex};WYMeditor.ParallelRegex.prototype._tokenizeRegex=function(a){return a.replace(/\(\?(i|m|s|x|U)\)/,"~~~~~~Tk1$1~~~~~~").replace(/\(\?(\-[i|m|s|x|U])\)/,"~~~~~~Tk2$1~~~~~~").replace(/\(\?\=(.*)\)/,"~~~~~~Tk3$1~~~~~~").replace(/\(\?\!(.*)\)/,"~~~~~~Tk4$1~~~~~~").replace(/\(\?\<\=(.*)\)/,"~~~~~~Tk5$1~~~~~~").replace(/\(\?\<\!(.*)\)/,"~~~~~~Tk6$1~~~~~~").replace(/\(\?\:(.*)\)/,"~~~~~~Tk7$1~~~~~~")};WYMeditor.ParallelRegex.prototype._untokenizeRegex=function(a){return a.replace(/~~~~~~Tk1(.{1})~~~~~~/,"(?$1)").replace(/~~~~~~Tk2(.{2})~~~~~~/,"(?$1)").replace(/~~~~~~Tk3(.*)~~~~~~/,"(?=$1)").replace(/~~~~~~Tk4(.*)~~~~~~/,"(?!$1)").replace(/~~~~~~Tk5(.*)~~~~~~/,"(?<=$1)").replace(/~~~~~~Tk6(.*)~~~~~~/,"(?<!$1)").replace(/~~~~~~Tk7(.*)~~~~~~/,"(?:$1)")};WYMeditor.ParallelRegex.prototype._getPerlMatchingFlags=function(){return(this._case?"m":"mi")};WYMeditor.StateStack=function(a){this._stack=[a];return this};WYMeditor.StateStack.prototype.getCurrent=function(){return this._stack[this._stack.length-1]};WYMeditor.StateStack.prototype.enter=function(a){this._stack.push(a)};WYMeditor.StateStack.prototype.leave=function(){if(this._stack.length==1){return false}this._stack.pop();return true};WYMeditor.LEXER_ENTER=1;WYMeditor.LEXER_MATCHED=2;WYMeditor.LEXER_UNMATCHED=3;WYMeditor.LEXER_EXIT=4;WYMeditor.LEXER_SPECIAL=5;WYMeditor.Lexer=function(c,b,a){b=b||"accept";this._case=a||false;this._regexes={};this._parser=c;this._mode=new WYMeditor.StateStack(b);this._mode_handlers={};this._mode_handlers[b]=b;return this};WYMeditor.Lexer.prototype.addPattern=function(a,b){var b=b||"accept";if(typeof this._regexes[b]=="undefined"){this._regexes[b]=new WYMeditor.ParallelRegex(this._case)}this._regexes[b].addPattern(a);if(typeof this._mode_handlers[b]=="undefined"){this._mode_handlers[b]=b}};WYMeditor.Lexer.prototype.addEntryPattern=function(b,c,a){if(typeof this._regexes[c]=="undefined"){this._regexes[c]=new WYMeditor.ParallelRegex(this._case)}this._regexes[c].addPattern(b,a);if(typeof this._mode_handlers[a]=="undefined"){this._mode_handlers[a]=a}};WYMeditor.Lexer.prototype.addExitPattern=function(a,b){if(typeof this._regexes[b]=="undefined"){this._regexes[b]=new WYMeditor.ParallelRegex(this._case)}this._regexes[b].addPattern(a,"__exit");if(typeof this._mode_handlers[b]=="undefined"){this._mode_handlers[b]=b}};WYMeditor.Lexer.prototype.addSpecialPattern=function(b,c,a){if(typeof this._regexes[c]=="undefined"){this._regexes[c]=new WYMeditor.ParallelRegex(this._case)}this._regexes[c].addPattern(b,"_"+a);if(typeof this._mode_handlers[a]=="undefined"){this._mode_handlers[a]=a}};WYMeditor.Lexer.prototype.mapHandler=function(b,a){this._mode_handlers[b]=a};WYMeditor.Lexer.prototype.parse=function(d){if(typeof this._parser=="undefined"){return false}var e=d.length;var c;while(typeof(c=this._reduce(d))=="object"){var d=c[0];var b=c[1];var a=c[2];var f=c[3];if(!this._dispatchTokens(b,a,f)){return false}if(d==""){return true}if(d.length==e){return false}e=d.length}if(!c){return false}return this._invokeParser(d,WYMeditor.LEXER_UNMATCHED)};WYMeditor.Lexer.prototype._dispatchTokens=function(b,a,c){c=c||false;if(!this._invokeParser(b,WYMeditor.LEXER_UNMATCHED)){return false}if(typeof c=="boolean"){return this._invokeParser(a,WYMeditor.LEXER_MATCHED)}if(this._isModeEnd(c)){if(!this._invokeParser(a,WYMeditor.LEXER_EXIT)){return false}return this._mode.leave()}if(this._isSpecialMode(c)){this._mode.enter(this._decodeSpecial(c));if(!this._invokeParser(a,WYMeditor.LEXER_SPECIAL)){return false}return this._mode.leave()}this._mode.enter(c);return this._invokeParser(a,WYMeditor.LEXER_ENTER)};WYMeditor.Lexer.prototype._isModeEnd=function(a){return(a==="__exit")};WYMeditor.Lexer.prototype._isSpecialMode=function(a){return(a.substring(0,1)=="_")};WYMeditor.Lexer.prototype._decodeSpecial=function(a){return a.substring(1)};WYMeditor.Lexer.prototype._invokeParser=function(content,is_match){if(content===""){return true}var current=this._mode.getCurrent();var handler=this._mode_handlers[current];var result;eval("result = this._parser."+handler+"(content, is_match);");return result};WYMeditor.Lexer.prototype._reduce=function(c){var a=this._regexes[this._mode.getCurrent()].match(c);var b=a[1];var e=a[0];if(e){var f=c.indexOf(b);var d=c.substr(0,f);c=c.substring(f+b.length);return[c,d,b,e]}return true};WYMeditor.XhtmlLexer=function(a){jQuery.extend(this,new WYMeditor.Lexer(a,"Text"));this.mapHandler("Text","Text");this.addTokens();this.init();return this};WYMeditor.XhtmlLexer.prototype.init=function(){};WYMeditor.XhtmlLexer.prototype.addTokens=function(){this.addCommentTokens("Text");this.addScriptTokens("Text");this.addCssTokens("Text");this.addTagTokens("Text")};WYMeditor.XhtmlLexer.prototype.addCommentTokens=function(a){this.addEntryPattern("<!--",a,"Comment");this.addExitPattern("-->","Comment")};WYMeditor.XhtmlLexer.prototype.addScriptTokens=function(a){this.addEntryPattern("<script",a,"Script");this.addExitPattern("<\/script>","Script")};WYMeditor.XhtmlLexer.prototype.addCssTokens=function(a){this.addEntryPattern("<style",a,"Css");this.addExitPattern("</style>","Css")};WYMeditor.XhtmlLexer.prototype.addTagTokens=function(a){this.addSpecialPattern("<\\s*[a-z0-9:-]+\\s*>",a,"OpeningTag");this.addEntryPattern("<[a-z0-9:-]+[\\/ \\>]+",a,"OpeningTag");this.addInTagDeclarationTokens("OpeningTag");this.addSpecialPattern("</\\s*[a-z0-9:-]+\\s*>",a,"ClosingTag")};WYMeditor.XhtmlLexer.prototype.addInTagDeclarationTokens=function(a){this.addSpecialPattern("\\s+",a,"Ignore");this.addAttributeTokens(a);this.addExitPattern("/>",a);this.addExitPattern(">",a)};WYMeditor.XhtmlLexer.prototype.addAttributeTokens=function(a){this.addSpecialPattern("\\s*[a-z-_0-9]*:?[a-z-_0-9]+\\s*(?==)\\s*",a,"TagAttributes");this.addEntryPattern('=\\s*"',a,"DoubleQuotedAttribute");this.addPattern('\\\\"',"DoubleQuotedAttribute");this.addExitPattern('"',"DoubleQuotedAttribute");this.addEntryPattern("=\\s*'",a,"SingleQuotedAttribute");this.addPattern("\\\\'","SingleQuotedAttribute");this.addExitPattern("'","SingleQuotedAttribute");this.addSpecialPattern("=\\s*[^>\\s]*",a,"UnquotedAttribute")};WYMeditor.XhtmlParser=function(a,b){var b=b||"Text";this._Lexer=new WYMeditor.XhtmlLexer(this);this._Listener=a;this._mode=b;this._matches=[];this._last_match="";this._current_match="";return this};WYMeditor.XhtmlParser.prototype.parse=function(a){this._Lexer.parse(this.beforeParsing(a));return this.afterParsing(this._Listener.getResult())};WYMeditor.XhtmlParser.prototype.beforeParsing=function(a){if(a.match(/class="MsoNormal"/)||a.match(/ns = "urn:schemas-microsoft-com/)){this._Listener.avoidStylingTagsAndAttributes()}return this._Listener.beforeParsing(a)};WYMeditor.XhtmlParser.prototype.afterParsing=function(a){if(this._Listener._avoiding_tags_implicitly){this._Listener.allowStylingTagsAndAttributes()}return this._Listener.afterParsing(a)};WYMeditor.XhtmlParser.prototype.Ignore=function(a,b){return true};WYMeditor.XhtmlParser.prototype.Text=function(a){this._Listener.addContent(a);return true};WYMeditor.XhtmlParser.prototype.Comment=function(b,a){return this._addNonTagBlock(b,a,"addComment")};WYMeditor.XhtmlParser.prototype.Script=function(b,a){return this._addNonTagBlock(b,a,"addScript")};WYMeditor.XhtmlParser.prototype.Css=function(b,a){return this._addNonTagBlock(b,a,"addCss")};WYMeditor.XhtmlParser.prototype._addNonTagBlock=function(a,c,b){switch(c){case WYMeditor.LEXER_ENTER:this._non_tag=a;break;case WYMeditor.LEXER_UNMATCHED:this._non_tag+=a;break;case WYMeditor.LEXER_EXIT:switch(b){case"addComment":this._Listener.addComment(this._non_tag+a);break;case"addScript":this._Listener.addScript(this._non_tag+a);break;case"addCss":this._Listener.addCss(this._non_tag+a);break}}return true};WYMeditor.XhtmlParser.prototype.OpeningTag=function(a,b){switch(b){case WYMeditor.LEXER_ENTER:this._tag=this.normalizeTag(a);this._tag_attributes={};break;case WYMeditor.LEXER_SPECIAL:this._callOpenTagListener(this.normalizeTag(a));break;case WYMeditor.LEXER_EXIT:this._callOpenTagListener(this._tag,this._tag_attributes)}return true};WYMeditor.XhtmlParser.prototype.ClosingTag=function(a,b){this._callCloseTagListener(this.normalizeTag(a));return true};WYMeditor.XhtmlParser.prototype._callOpenTagListener=function(a,b){var b=b||{};this.autoCloseUnclosedBeforeNewOpening(a);if(this._Listener.isBlockTag(a)){this._Listener._tag_stack.push(a);this._Listener.fixNestingBeforeOpeningBlockTag(a,b);this._Listener.openBlockTag(a,b);this._increaseOpenTagCounter(a)}else{if(this._Listener.isInlineTag(a)){this._Listener.inlineTag(a,b)}else{this._Listener.openUnknownTag(a,b);this._increaseOpenTagCounter(a)}}this._Listener.last_tag=a;this._Listener.last_tag_opened=true;this._Listener.last_tag_attributes=b};WYMeditor.XhtmlParser.prototype._callCloseTagListener=function(a){if(this._decreaseOpenTagCounter(a)){this.autoCloseUnclosedBeforeTagClosing(a);if(this._Listener.isBlockTag(a)){var b=this._Listener._tag_stack.pop();if(b==false){return}else{if(b!=a){a=b}}this._Listener.closeBlockTag(a)}else{this._Listener.closeUnknownTag(a)}}else{this._Listener.closeUnopenedTag(a)}this._Listener.last_tag=a;this._Listener.last_tag_opened=false};WYMeditor.XhtmlParser.prototype._increaseOpenTagCounter=function(a){this._Listener._open_tags[a]=this._Listener._open_tags[a]||0;this._Listener._open_tags[a]++};WYMeditor.XhtmlParser.prototype._decreaseOpenTagCounter=function(a){if(this._Listener._open_tags[a]){this._Listener._open_tags[a]--;if(this._Listener._open_tags[a]==0){this._Listener._open_tags[a]=undefined}return true}return false};WYMeditor.XhtmlParser.prototype.autoCloseUnclosedBeforeNewOpening=function(a){this._autoCloseUnclosed(a,false)};WYMeditor.XhtmlParser.prototype.autoCloseUnclosedBeforeTagClosing=function(a){this._autoCloseUnclosed(a,true)};WYMeditor.XhtmlParser.prototype._autoCloseUnclosed=function(c,d){var d=d||false;if(this._Listener._open_tags){for(var a in this._Listener._open_tags){var b=this._Listener._open_tags[a];if(b>0&&this._Listener.shouldCloseTagAutomatically(a,c,d)){this._callCloseTagListener(a,true)}}}};WYMeditor.XhtmlParser.prototype.getTagReplacements=function(){return this._Listener.getTagReplacements()};WYMeditor.XhtmlParser.prototype.normalizeTag=function(a){a=a.replace(/^([\s<\/>]*)|([\s<\/>]*)$/gm,"").toLowerCase();var b=this._Listener.getTagReplacements();if(b[a]){return b[a]}return a};WYMeditor.XhtmlParser.prototype.TagAttributes=function(a,b){if(WYMeditor.LEXER_SPECIAL==b){this._current_attribute=a}return true};WYMeditor.XhtmlParser.prototype.DoubleQuotedAttribute=function(a,b){if(WYMeditor.LEXER_UNMATCHED==b){this._tag_attributes[this._current_attribute]=a}return true};WYMeditor.XhtmlParser.prototype.SingleQuotedAttribute=function(a,b){if(WYMeditor.LEXER_UNMATCHED==b){this._tag_attributes[this._current_attribute]=a}return true};WYMeditor.XhtmlParser.prototype.UnquotedAttribute=function(a,b){this._tag_attributes[this._current_attribute]=a.replace(/^=/,"");return true};WYMeditor.XhtmlSaxListener=function(){this.output="";this.helper=new WYMeditor.XmlHelper();this._open_tags={};this.validator=WYMeditor.XhtmlValidator;this._tag_stack=[];this.avoided_tags=[];this.entities={" ":" ","¡":"¡","¢":"¢","£":"£","¤":"¤","¥":"¥","¦":"¦","§":"§","¨":"¨","©":"©","ª":"ª","«":"«","¬":"¬","­":"­","®":"®","¯":"¯","°":"°","±":"±","²":"²","³":"³","´":"´","µ":"µ","¶":"¶","·":"·","¸":"¸","¹":"¹","º":"º","»":"»","¼":"¼","½":"½","¾":"¾","¿":"¿","À":"À","Á":"Á","Â":"Â","Ã":"Ã","Ä":"Ä","Å":"Å","Æ":"Æ","Ç":"Ç","È":"È","É":"É","Ê":"Ê","Ë":"Ë","Ì":"Ì","Í":"Í","Î":"Î","Ï":"Ï","Ð":"Ð","Ñ":"Ñ","Ò":"Ò","Ó":"Ó","Ô":"Ô","Õ":"Õ","Ö":"Ö","×":"×","Ø":"Ø","Ù":"Ù","Ú":"Ú","Û":"Û","Ü":"Ü","Ý":"Ý","Þ":"Þ","ß":"ß","à":"à","á":"á","â":"â","ã":"ã","ä":"ä","å":"å","æ":"æ","ç":"ç","è":"è","é":"é","ê":"ê","ë":"ë","ì":"ì","í":"í","î":"î","ï":"ï","ð":"ð","ñ":"ñ","ò":"ò","ó":"ó","ô":"ô","õ":"õ","ö":"ö","÷":"÷","ø":"ø","ù":"ù","ú":"ú","û":"û","ü":"ü","ý":"ý","þ":"þ","ÿ":"ÿ","Œ":"Œ","œ":"œ","Š":"Š","š":"š","Ÿ":"Ÿ","ƒ":"ƒ","ˆ":"ˆ","˜":"˜","Α":"Α","Β":"Β","Γ":"Γ","Δ":"Δ","Ε":"Ε","Ζ":"Ζ","Η":"Η","Θ":"Θ","Ι":"Ι","Κ":"Κ","Λ":"Λ","Μ":"Μ","Ν":"Ν","Ξ":"Ξ","Ο":"Ο","Π":"Π","Ρ":"Ρ","Σ":"Σ","Τ":"Τ","Υ":"Υ","Φ":"Φ","Χ":"Χ","Ψ":"Ψ","Ω":"Ω","α":"α","β":"β","γ":"γ","δ":"δ","ε":"ε","ζ":"ζ","η":"η","θ":"θ","ι":"ι","κ":"κ","λ":"λ","μ":"μ","ν":"ν","ξ":"ξ","ο":"ο","π":"π","ρ":"ρ","ς":"ς","σ":"σ","τ":"τ","υ":"υ","φ":"φ","χ":"χ","ψ":"ψ","ω":"ω","ϑ":"ϑ","ϒ":"ϒ","ϖ":"ϖ"," ":" "," ":" "," ":" ","‌":"‌","‍":"‍","‎":"‎","‏":"‏","–":"–","—":"—","‘":"‘","’":"’","‚":"‚","“":"“","”":"”","„":"„","†":"†","‡":"‡","•":"•","…":"…","‰":"‰","′":"′","″":"″","‹":"‹","›":"›","‾":"‾","⁄":"⁄","€":"€","ℑ":"ℑ","℘":"℘","ℜ":"ℜ","™":"™","ℵ":"ℵ","←":"←","↑":"↑","→":"→","↓":"↓","↔":"↔","↵":"↵","⇐":"⇐","⇑":"⇑","⇒":"⇒","⇓":"⇓","⇔":"⇔","∀":"∀","∂":"∂","∃":"∃","∅":"∅","∇":"∇","∈":"∈","∉":"∉","∋":"∋","∏":"∏","∑":"∑","−":"−","∗":"∗","√":"√","∝":"∝","∞":"∞","∠":"∠","∧":"∧","∨":"∨","∩":"∩","∪":"∪","∫":"∫","∴":"∴","∼":"∼","≅":"≅","≈":"≈","≠":"≠","≡":"≡","≤":"≤","≥":"≥","⊂":"⊂","⊃":"⊃","⊄":"⊄","⊆":"⊆","⊇":"⊇","⊕":"⊕","⊗":"⊗","⊥":"⊥","⋅":"⋅","⌈":"⌈","⌉":"⌉","⌊":"⌊","⌋":"⌋","⟨":"〈","⟩":"〉","◊":"◊","♠":"♠","♣":"♣","♥":"♥","♦":"♦"};this.block_tags=["a","abbr","acronym","address","area","b","base","bdo","big","blockquote","body","button","caption","cite","code","col","colgroup","dd","del","div","dfn","dl","dt","em","fieldset","form","head","h1","h2","h3","h4","h5","h6","html","i","ins","kbd","label","legend","li","map","noscript","object","ol","optgroup","option","p","param","pre","q","samp","script","select","small","span","strong","style","sub","sup","table","tbody","td","textarea","tfoot","th","thead","title","tr","tt","ul","var","extends"];this.inline_tags=["br","hr","img","input"];return this};WYMeditor.XhtmlSaxListener.prototype.shouldCloseTagAutomatically=function(a,c,b){var b=b||false;if(a=="td"){if((b&&c=="tr")||(!b&&c=="td")){return true}}if(a=="option"){if((b&&c=="select")||(!b&&c=="option")){return true}}return false};WYMeditor.XhtmlSaxListener.prototype.beforeParsing=function(a){this.output="";return a};WYMeditor.XhtmlSaxListener.prototype.afterParsing=function(a){a=this.replaceNamedEntities(a);a=this.joinRepeatedEntities(a);a=this.removeEmptyTags(a);a=this.removeBrInPre(a);return a};WYMeditor.XhtmlSaxListener.prototype.replaceNamedEntities=function(b){for(var a in this.entities){b=b.replace(new RegExp(a,"g"),this.entities[a])}return b};WYMeditor.XhtmlSaxListener.prototype.joinRepeatedEntities=function(b){var a="em|strong|sub|sup|acronym|pre|del|address";return b.replace(new RegExp("</("+a+")><\\1>",""),"").replace(new RegExp("(s*<("+a+")>s*){2}(.*)(s*</\\2>s*){2}",""),"<$2>$3<$2>")};WYMeditor.XhtmlSaxListener.prototype.removeEmptyTags=function(a){return a.replace(new RegExp("<("+this.block_tags.join("|").replace(/\|td/,"").replace(/\|th/,"")+")>(<br />| | |\\s)*</\\1>","g"),"")};WYMeditor.XhtmlSaxListener.prototype.removeBrInPre=function(c){var b=c.match(new RegExp("<pre[^>]*>(.*?)</pre>","gmi"));if(b){for(var a=0;a<b.length;a++){c=c.replace(b[a],b[a].replace(new RegExp("<br />","g"),String.fromCharCode(13,10)))}}return c};WYMeditor.XhtmlSaxListener.prototype.getResult=function(){return this.output};WYMeditor.XhtmlSaxListener.prototype.getTagReplacements=function(){return{b:"strong",i:"em"}};WYMeditor.XhtmlSaxListener.prototype.addContent=function(a){this.output+=a};WYMeditor.XhtmlSaxListener.prototype.addComment=function(a){if(this.remove_comments){this.output+=a}};WYMeditor.XhtmlSaxListener.prototype.addScript=function(a){if(!this.remove_scripts){this.output+=a}};WYMeditor.XhtmlSaxListener.prototype.addCss=function(a){if(!this.remove_embeded_styles){this.output+=a}};WYMeditor.XhtmlSaxListener.prototype.openBlockTag=function(a,b){this.output+=this.helper.tag(a,this.validator.getValidTagAttributes(a,b),true)};WYMeditor.XhtmlSaxListener.prototype.inlineTag=function(a,b){this.output+=this.helper.tag(a,this.validator.getValidTagAttributes(a,b))};WYMeditor.XhtmlSaxListener.prototype.openUnknownTag=function(a,b){};WYMeditor.XhtmlSaxListener.prototype.closeBlockTag=function(a){this.output=this.output.replace(/<br \/>$/,"")+this._getClosingTagContent("before",a)+"</"+a+">"+this._getClosingTagContent("after",a)};WYMeditor.XhtmlSaxListener.prototype.closeUnknownTag=function(a){};WYMeditor.XhtmlSaxListener.prototype.closeUnopenedTag=function(a){this.output+="</"+a+">"};WYMeditor.XhtmlSaxListener.prototype.avoidStylingTagsAndAttributes=function(){this.avoided_tags=["div","span"];this.validator.skiped_attributes=["style"];this.validator.skiped_attribute_values=["MsoNormal","main1"];this._avoiding_tags_implicitly=true};WYMeditor.XhtmlSaxListener.prototype.allowStylingTagsAndAttributes=function(){this.avoided_tags=[];this.validator.skiped_attributes=[];this.validator.skiped_attribute_values=[];this._avoiding_tags_implicitly=false};WYMeditor.XhtmlSaxListener.prototype.isBlockTag=function(a){return !WYMeditor.Helper.contains(this.avoided_tags,a)&&WYMeditor.Helper.contains(this.block_tags,a)};WYMeditor.XhtmlSaxListener.prototype.isInlineTag=function(a){return !WYMeditor.Helper.contains(this.avoided_tags,a)&&WYMeditor.Helper.contains(this.inline_tags,a)};WYMeditor.XhtmlSaxListener.prototype.insertContentAfterClosingTag=function(a,b){this._insertContentWhenClosingTag("after",a,b)};WYMeditor.XhtmlSaxListener.prototype.insertContentBeforeClosingTag=function(a,b){this._insertContentWhenClosingTag("before",a,b)};WYMeditor.XhtmlSaxListener.prototype.fixNestingBeforeOpeningBlockTag=function(a,b){if(a!="li"&&(a=="ul"||a=="ol")&&this.last_tag&&!this.last_tag_opened&&this.last_tag=="li"){this.output=this.output.replace(/<\/li>$/,"");this.insertContentAfterClosingTag(a,"</li>")}};WYMeditor.XhtmlSaxListener.prototype._insertContentWhenClosingTag=function(b,a,c){if(!this["_insert_"+b+"_closing"]){this["_insert_"+b+"_closing"]=[]}if(!this["_insert_"+b+"_closing"][a]){this["_insert_"+b+"_closing"][a]=[]}this["_insert_"+b+"_closing"][a].push(c)};WYMeditor.XhtmlSaxListener.prototype._getClosingTagContent=function(b,a){if(this["_insert_"+b+"_closing"]&&this["_insert_"+b+"_closing"][a]&&this["_insert_"+b+"_closing"][a].length>0){return this["_insert_"+b+"_closing"][a].pop()}return""};WYMeditor.WymCssLexer=function(b,a){var a=(typeof a=="undefined"?true:a);jQuery.extend(this,new WYMeditor.Lexer(b,(a?"Ignore":"WymCss")));this.mapHandler("WymCss","Ignore");if(a==true){this.addEntryPattern("/\\\x2a[<\\s]*WYMeditor[>\\s]*\\\x2a/","Ignore","WymCss");this.addExitPattern("/\\\x2a[</\\s]*WYMeditor[>\\s]*\\\x2a/","WymCss")}this.addSpecialPattern("[\\sa-z1-6]*\\\x2e[a-z-_0-9]+","WymCss","WymCssStyleDeclaration");this.addEntryPattern("/\\\x2a","WymCss","WymCssComment");this.addExitPattern("\\\x2a/","WymCssComment");this.addEntryPattern("\x7b","WymCss","WymCssStyle");this.addExitPattern("\x7d","WymCssStyle");this.addEntryPattern("/\\\x2a","WymCssStyle","WymCssFeedbackStyle");this.addExitPattern("\\\x2a/","WymCssFeedbackStyle");return this};WYMeditor.WymCssParser=function(){this._in_style=false;this._has_title=false;this.only_wym_blocks=true;this.css_settings={classesItems:[],editorStyles:[],dialogStyles:[]};return this};WYMeditor.WymCssParser.prototype.parse=function(a,b){var b=(typeof b=="undefined"?this.only_wym_blocks:b);this._Lexer=new WYMeditor.WymCssLexer(this,b);this._Lexer.parse(a)};WYMeditor.WymCssParser.prototype.Ignore=function(a,b){return true};WYMeditor.WymCssParser.prototype.WymCssComment=function(b,a){if(b.match(/end[a-z0-9\s]*wym[a-z0-9\s]*/mi)){return false}if(a==WYMeditor.LEXER_UNMATCHED){if(!this._in_style){this._has_title=true;this._current_item={title:WYMeditor.Helper.trim(b)}}else{if(this._current_item[this._current_element]){if(!this._current_item[this._current_element].expressions){this._current_item[this._current_element].expressions=[b]}else{this._current_item[this._current_element].expressions.push(b)}}}this._in_style=true}return true};WYMeditor.WymCssParser.prototype.WymCssStyle=function(b,a){if(a==WYMeditor.LEXER_UNMATCHED){b=WYMeditor.Helper.trim(b);if(b!=""){this._current_item[this._current_element].style=b}}else{if(a==WYMeditor.LEXER_EXIT){this._in_style=false;this._has_title=false;this.addStyleSetting(this._current_item)}}return true};WYMeditor.WymCssParser.prototype.WymCssFeedbackStyle=function(b,a){if(a==WYMeditor.LEXER_UNMATCHED){this._current_item[this._current_element].feedback_style=b.replace(/^([\s\/\*]*)|([\s\/\*]*)$/gm,"")}return true};WYMeditor.WymCssParser.prototype.WymCssStyleDeclaration=function(b){b=b.replace(/^([\s\.]*)|([\s\.*]*)$/gm,"");var a="";if(b.indexOf(".")>0){var c=b.split(".");this._current_element=c[1];var a=c[0]}else{this._current_element=b}if(!this._has_title){this._current_item={title:(!a?"":a.toUpperCase()+": ")+this._current_element};this._has_title=true}if(!this._current_item[this._current_element]){this._current_item[this._current_element]={name:this._current_element}}if(a){if(!this._current_item[this._current_element].tags){this._current_item[this._current_element].tags=[a]}else{this._current_item[this._current_element].tags.push(a)}}return true};WYMeditor.WymCssParser.prototype.addStyleSetting=function(a){for(var b in a){var c=a[b];if(typeof c=="object"&&b!="title"){this.css_settings.classesItems.push({name:WYMeditor.Helper.trim(c.name),title:a.title,expr:WYMeditor.Helper.trim((c.expressions||c.tags).join(", "))});if(c.feedback_style){this.css_settings.editorStyles.push({name:"."+WYMeditor.Helper.trim(c.name),css:c.feedback_style})}if(c.style){this.css_settings.dialogStyles.push({name:"."+WYMeditor.Helper.trim(c.name),css:c.style})}}}};jQuery.fn.isPhantomNode=function(){if(this[0].nodeType==3){return !(/[^\t\n\r ]/.test(this[0].data))}return false};WYMeditor.isPhantomNode=function(a){if(a.nodeType==3){return !(/[^\t\n\r ]/.test(a.data))}return false};WYMeditor.isPhantomString=function(a){return !(/[^\t\n\r ]/.test(a))};jQuery.fn.parentsOrSelf=function(b){var a=this;if(a[0].nodeType==3){a=a.parents().slice(0,1)}if(a.filter(b).size()==1){return a}else{return a.parents(b).slice(0,1)}};WYMeditor.Helper={replaceAll:function(d,a,c){var b=new RegExp(a,"g");return(d.replace(b,c))},insertAt:function(b,a,c){return(b.substr(0,c)+a+b.substring(c))},trim:function(a){return a.replace(/^(\s*)|(\s*)$/gm,"")},contains:function(a,c){for(var b=0;b<a.length;b++){if(a[b]===c){return true}}return false},indexOf:function(a,d){var b=-1;for(var c=0;c<a.length;c++){if(a[c]==d){b=c;break}}return(b)},findByName:function(a,b){for(var c=0;c<a.length;c++){var d=a[c];if(d.name==b){return(d)}}return(null)}};WYMeditor.WymClassExplorer=function(a){this._wym=a;this._class="className";this._newLine="\r\n"};WYMeditor.WymClassExplorer.prototype.initIframe=function(iframe){this._iframe=iframe;this._doc=iframe.contentWindow.document;var styles=this._doc.styleSheets[0];var aCss=eval(this._options.editorStyles);this.addCssRules(this._doc,aCss);this._doc.title=this._wym._index;jQuery("html",this._doc).attr("dir",this._options.direction);jQuery(this._doc.body).html(this._wym._html);var wym=this;this._doc.body.onfocus=function(){wym._doc.designMode="on";wym._doc=iframe.contentWindow.document};this._doc.onbeforedeactivate=function(){wym.saveCaret()};this._doc.onkeyup=function(){wym.saveCaret();wym.keyup()};this._doc.onclick=function(){wym.saveCaret()};this._doc.body.onbeforepaste=function(){wym._iframe.contentWindow.event.returnValue=false};this._doc.body.onpaste=function(){wym._iframe.contentWindow.event.returnValue=false;wym.paste(window.clipboardData.getData("Text"))};if(this._initialized){if(jQuery.isFunction(this._options.preBind)){this._options.preBind(this)}this._wym.bindEvents();if(jQuery.isFunction(this._options.postInit)){this._options.postInit(this)}this.listen()}this._initialized=true;this._doc.designMode="on";try{this._doc=iframe.contentWindow.document}catch(e){}};WYMeditor.WymClassExplorer.prototype._exec=function(c,d){switch(c){case WYMeditor.INDENT:case WYMeditor.OUTDENT:var a=this.findUp(this.container(),WYMeditor.LI);if(a){var b=a.parentNode.parentNode;if(a.parentNode.childNodes.length>1||b.tagName.toLowerCase()==WYMeditor.OL||b.tagName.toLowerCase()==WYMeditor.UL){this._doc.execCommand(c)}}break;default:if(d){this._doc.execCommand(c,false,d)}else{this._doc.execCommand(c)}break}};WYMeditor.WymClassExplorer.prototype.selected=function(){var a=this._iframe.contentWindow.document.caretPos;if(a!=null){if(a.parentElement!=undefined){return(a.parentElement())}}};WYMeditor.WymClassExplorer.prototype.saveCaret=function(){this._doc.caretPos=this._doc.selection.createRange()};WYMeditor.WymClassExplorer.prototype.addCssRule=function(a,b){a.addRule(b.name,b.css)};WYMeditor.WymClassExplorer.prototype.insert=function(b){var a=this._doc.selection.createRange();if(jQuery(a.parentElement()).parents(this._options.iframeBodySelector).is("*")){try{a.pasteHTML(b)}catch(c){}}else{this.paste(b)}};WYMeditor.WymClassExplorer.prototype.wrap=function(d,b){var a=this._doc.selection.createRange();if(jQuery(a.parentElement()).parents(this._options.iframeBodySelector).is("*")){try{a.pasteHTML(d+a.text+b)}catch(c){}}};WYMeditor.WymClassExplorer.prototype.unwrap=function(){var a=this._doc.selection.createRange();if(jQuery(a.parentElement()).parents(this._options.iframeBodySelector).is("*")){try{var c=a.text;this._exec("Cut");a.pasteHTML(c)}catch(b){}}};WYMeditor.WymClassExplorer.prototype.keyup=function(){this._selected_image=null};WYMeditor.WymClassExplorer.prototype.setFocusToNode=function(c,b){var a=this._doc.selection.createRange();b=b?true:false;a.moveToElementText(c);a.collapse(b);a.select();c.focus()};WYMeditor.WymClassMozilla=function(a){this._wym=a;this._class="class";this._newLine="\n"};WYMeditor.WymClassMozilla.prototype.initIframe=function(iframe){var wym=this;this._iframe=iframe;this._doc=iframe.contentDocument;var styles=this._doc.styleSheets[0];var aCss=eval(this._options.editorStyles);this.addCssRules(this._doc,aCss);this._doc.title=this._wym._index;jQuery("html",this._doc).attr("dir",this._options.direction);this.html(this._wym._html);this.enableDesignMode();if(jQuery.isFunction(this._options.preBind)){this._options.preBind(this)}this._wym.bindEvents();jQuery(this._doc).bind("keydown",this.keydown);jQuery(this._doc).bind("keyup",this.keyup);jQuery(this._doc).bind("focus",function(){wym.enableDesignMode.call(wym)});if(jQuery.isFunction(this._options.postInit)){this._options.postInit(this)}this.listen()};WYMeditor.WymClassMozilla.prototype.html=function(a){if(typeof a==="string"){try{this._doc.designMode="off"}catch(b){}a=a.replace(/<em(\b[^>]*)>/gi,"<i$1>").replace(/<\/em>/gi,"</i>").replace(/<strong(\b[^>]*)>/gi,"<b$1>").replace(/<\/strong>/gi,"</b>");jQuery(this._doc.body).html(a);this.enableDesignMode()}else{return(jQuery(this._doc.body).html())}};WYMeditor.WymClassMozilla.prototype._exec=function(e,g){if(!this.selected()){return(false)}switch(e){case WYMeditor.INDENT:case WYMeditor.OUTDENT:var f=this.selected();var d=this._iframe.contentWindow.getSelection();var b=d.anchorNode;if(b.nodeName=="#text"){b=b.parentNode}f=this.findUp(f,WYMeditor.BLOCKS);b=this.findUp(b,WYMeditor.BLOCKS);if(f&&f==b&&f.tagName.toLowerCase()==WYMeditor.LI){var c=f.parentNode.parentNode;if(f.parentNode.childNodes.length>1||c.tagName.toLowerCase()==WYMeditor.OL||c.tagName.toLowerCase()==WYMeditor.UL){this._doc.execCommand(e,"",null)}}break;default:if(g){this._doc.execCommand(e,"",g)}else{this._doc.execCommand(e,"",null)}}var a=this.selected();if(a.tagName.toLowerCase()==WYMeditor.BODY){this._exec(WYMeditor.FORMAT_BLOCK,WYMeditor.P)}};WYMeditor.WymClassMozilla.prototype.selected=function(){var b=this._iframe.contentWindow.getSelection();var a=b.focusNode;if(a){if(a.nodeName=="#text"){return(a.parentNode)}else{return(a)}}else{return(null)}};WYMeditor.WymClassMozilla.prototype.addCssRule=function(a,b){a.insertRule(b.name+" {"+b.css+"}",a.cssRules.length)};WYMeditor.WymClassMozilla.prototype.keydown=function(b){var c=WYMeditor.INSTANCES[this.title];var a=null;if(b.ctrlKey){if(b.keyCode==66){c._exec(WYMeditor.BOLD);return false}if(b.keyCode==73){c._exec(WYMeditor.ITALIC);return false}}else{if(b.keyCode==13){if(!b.shiftKey){a=c.selected();if(a&&a.tagName.toLowerCase()==WYMeditor.PRE){b.preventDefault();c.insert("<p></p>")}}}}};WYMeditor.WymClassMozilla.prototype.keyup=function(b){var d=WYMeditor.INSTANCES[this.title];d._selected_image=null;var a=null;if(b.keyCode==13&&!b.shiftKey){jQuery(d._doc.body).children(WYMeditor.BR).remove()}if(b.keyCode!=8&&b.keyCode!=17&&b.keyCode!=46&&b.keyCode!=224&&!b.metaKey&&!b.ctrlKey){a=d.selected();var c=a.tagName.toLowerCase();if(c=="strong"||c=="b"||c=="em"||c=="i"||c=="sub"||c=="sup"||c=="a"){c=a.parentNode.tagName.toLowerCase()}if(c==WYMeditor.BODY){d._exec(WYMeditor.FORMAT_BLOCK,WYMeditor.P)}}};WYMeditor.WymClassMozilla.prototype.enableDesignMode=function(){if(this._doc.designMode=="off"){try{this._doc.designMode="on";this._doc.execCommand("styleWithCSS","",false)}catch(a){}}};WYMeditor.WymClassMozilla.prototype.openBlockTag=function(a,c){var c=this.validator.getValidTagAttributes(a,c);if(a=="span"&&c.style){var b=this.getTagForStyle(c.style);if(b){this._tag_stack.pop();var a=b;this._tag_stack.push(b);c.style=""}else{return}}this.output+=this.helper.tag(a,c,true)};WYMeditor.WymClassMozilla.prototype.getTagForStyle=function(a){if(/bold/.test(a)){return"strong"}if(/italic/.test(a)){return"em"}if(/sub/.test(a)){return"sub"}if(/super/.test(a)){return"sup"}return false};WYMeditor.WymClassOpera=function(a){this._wym=a;this._class="class";this._newLine="\r\n"};WYMeditor.WymClassOpera.prototype.initIframe=function(iframe){this._iframe=iframe;this._doc=iframe.contentWindow.document;var styles=this._doc.styleSheets[0];var aCss=eval(this._options.editorStyles);this.addCssRules(this._doc,aCss);this._doc.title=this._wym._index;jQuery("html",this._doc).attr("dir",this._options.direction);this._doc.designMode="on";this.html(this._wym._html);if(jQuery.isFunction(this._options.preBind)){this._options.preBind(this)}this._wym.bindEvents();jQuery(this._doc).bind("keydown",this.keydown);jQuery(this._doc).bind("keyup",this.keyup);if(jQuery.isFunction(this._options.postInit)){this._options.postInit(this)}this.listen()};WYMeditor.WymClassOpera.prototype._exec=function(a,b){if(b){this._doc.execCommand(a,false,b)}else{this._doc.execCommand(a)}};WYMeditor.WymClassOpera.prototype.selected=function(){var b=this._iframe.contentWindow.getSelection();var a=b.focusNode;if(a){if(a.nodeName=="#text"){return(a.parentNode)}else{return(a)}}else{return(null)}};WYMeditor.WymClassOpera.prototype.addCssRule=function(a,b){a.insertRule(b.name+" {"+b.css+"}",a.cssRules.length)};WYMeditor.WymClassOpera.prototype.keydown=function(a){var c=WYMeditor.INSTANCES[this.title];var b=c._iframe.contentWindow.getSelection();startNode=b.getRangeAt(0).startContainer;if(!jQuery(startNode).parentsOrSelf(WYMeditor.MAIN_CONTAINERS.join(","))[0]&&!jQuery(startNode).parentsOrSelf("li")&&a.keyCode!=WYMeditor.KEY.ENTER&&a.keyCode!=WYMeditor.KEY.LEFT&&a.keyCode!=WYMeditor.KEY.UP&&a.keyCode!=WYMeditor.KEY.RIGHT&&a.keyCode!=WYMeditor.KEY.DOWN&&a.keyCode!=WYMeditor.KEY.BACKSPACE&&a.keyCode!=WYMeditor.KEY.DELETE){c._exec(WYMeditor.FORMAT_BLOCK,WYMeditor.P)}};WYMeditor.WymClassOpera.prototype.keyup=function(a){var b=WYMeditor.INSTANCES[this.title];b._selected_image=null};WYMeditor.WymClassSafari=function(a){this._wym=a;this._class="class";this._newLine="\n"};WYMeditor.WymClassSafari.prototype.initIframe=function(iframe){this._iframe=iframe;this._doc=iframe.contentDocument;var styles=this._doc.styleSheets[0];var aCss=eval(this._options.editorStyles);this.addCssRules(this._doc,aCss);this._doc.title=this._wym._index;jQuery("html",this._doc).attr("dir",this._options.direction);this._doc.designMode="on";this.html(this._wym._html);if(jQuery.isFunction(this._options.preBind)){this._options.preBind(this)}this._wym.bindEvents();jQuery(this._doc).bind("keydown",this.keydown);jQuery(this._doc).bind("keyup",this.keyup);if(jQuery.isFunction(this._options.postInit)){this._options.postInit(this)}this.listen()};WYMeditor.WymClassSafari.prototype._exec=function(e,g){if(!this.selected()){return(false)}switch(e){case WYMeditor.INDENT:case WYMeditor.OUTDENT:var f=this.selected();var d=this._iframe.contentWindow.getSelection();var b=d.anchorNode;if(b.nodeName=="#text"){b=b.parentNode}f=this.findUp(f,WYMeditor.BLOCKS);b=this.findUp(b,WYMeditor.BLOCKS);if(f&&f==b&&f.tagName.toLowerCase()==WYMeditor.LI){var c=f.parentNode.parentNode;if(f.parentNode.childNodes.length>1||c.tagName.toLowerCase()==WYMeditor.OL||c.tagName.toLowerCase()==WYMeditor.UL){this._doc.execCommand(e,"",null)}}break;case WYMeditor.INSERT_ORDEREDLIST:case WYMeditor.INSERT_UNORDEREDLIST:this._doc.execCommand(e,"",null);var f=this.selected();var a=this.findUp(f,WYMeditor.MAIN_CONTAINERS);if(a){jQuery(a).replaceWith(jQuery(a).html())}break;default:if(g){this._doc.execCommand(e,"",g)}else{this._doc.execCommand(e,"",null)}}var a=this.selected();if(a&&a.tagName.toLowerCase()==WYMeditor.BODY){this._exec(WYMeditor.FORMAT_BLOCK,WYMeditor.P)}};WYMeditor.WymClassSafari.prototype.selected=function(){var b=this._iframe.contentWindow.getSelection();var a=b.focusNode;if(a){if(a.nodeName=="#text"){return(a.parentNode)}else{return(a)}}else{return(null)}};WYMeditor.WymClassSafari.prototype.addCssRule=function(a,b){a.insertRule(b.name+" {"+b.css+"}",a.cssRules.length)};WYMeditor.WymClassSafari.prototype.keydown=function(a){var b=WYMeditor.INSTANCES[this.title];if(a.ctrlKey){if(a.keyCode==66){b._exec(WYMeditor.BOLD);return false}if(a.keyCode==73){b._exec(WYMeditor.ITALIC);return false}}};WYMeditor.WymClassSafari.prototype.keyup=function(b){var d=WYMeditor.INSTANCES[this.title];d._selected_image=null;var a=null;if(b.keyCode==13&&!b.shiftKey){jQuery(d._doc.body).children(WYMeditor.BR).remove();a=d.selected();if(a&&a.tagName.toLowerCase()==WYMeditor.PRE){d._exec(WYMeditor.FORMAT_BLOCK,WYMeditor.P)}}if(b.keyCode==13&&b.shiftKey){d._exec("InsertLineBreak")}if(b.keyCode!=8&&b.keyCode!=17&&b.keyCode!=46&&b.keyCode!=224&&!b.metaKey&&!b.ctrlKey){a=d.selected();var c=a.tagName.toLowerCase();if(c=="strong"||c=="b"||c=="em"||c=="i"||c=="sub"||c=="sup"||c=="a"||c=="span"){c=a.parentNode.tagName.toLowerCase()}if(c==WYMeditor.BODY||c==WYMeditor.DIV){d._exec(WYMeditor.FORMAT_BLOCK,WYMeditor.P)}}};WYMeditor.WymClassSafari.prototype.openBlockTag=function(a,c){var c=this.validator.getValidTagAttributes(a,c);if(a=="span"&&c.style){var b=this.getTagForStyle(c.style);if(b){this._tag_stack.pop();var a=b;this._tag_stack.push(b);c.style="";if(typeof c["class"]=="string"){c["class"]=c["class"].replace(/apple-style-span/gi,"")}}else{return}}this.output+=this.helper.tag(a,c,true)};WYMeditor.WymClassSafari.prototype.getTagForStyle=function(a){if(/bold/.test(a)){return"strong"}if(/italic/.test(a)){return"em"}if(/sub/.test(a)){return"sub"}if(/super/.test(a)){return"sup"}return false};
\ No newline at end of file diff --git a/gstudio/static/gstudio/js/wymeditor/jquery.wymeditor.pack.js b/gstudio/static/gstudio/js/wymeditor/jquery.wymeditor.pack.js new file mode 100644 index 0000000..17b3268 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/jquery.wymeditor.pack.js @@ -0,0 +1 @@ +eval(function(p,a,c,k,e,d){e=function(c){return(c<a?'':e(parseInt(c/a)))+((c=c%a)>35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)d[e(c)]=k[c]||e(c);k=[function(e){return d[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}('if(!f)l f={};(j(){if(!2l.4O||!4O.rD){l aj=["rC","rB","rA","rz","9w","ry","3z","rx","rw","rv","ru","rt","58","rs","cK","rr"];f.4O={};1h(l i=0;i<aj.Y;++i)f.4O[aj[i]]=j(){}}V f.4O=2l.4O})();D.53(f,{rq:"0.5-rp",2w:[],7U:[],5h:[],7Z:"F",3N:"{ro}",a2:"rn",dE:"{rm}",9s:"{rl}",9r:"{rk}",eX:"dw/",7E:"3a.1b",dm:"3a.js",eW:"3H/",a1:"{rj}",eV:"1K/3R/",9q:"{ri}",9t:"{rh}",a0:"{rg}",9Z:"{rf}",9R:"{rd}",9T:"{rc}",81:"{rb}",9S:"{ra}",9X:"{r9}",9O:"{r8}",80:"{r7}",9P:"{r6}",9Y:"{r5}",9I:"{r4}",9L:"{r3}",9K:"{r2}",9J:"{r1}",82:"{r0}",9W:"{qZ}",9V:"{qY}",9p:"{qX}",9o:"{qW}",dO:"3Q",3t:"1j",an:"N",P:"p",9F:"h1",9E:"h2",9D:"h3",9C:"h4",9B:"h5",9A:"h6",5q:"41",6b:"2J",A:"a",88:"br",du:"6Q",de:"3j",6d:"4F",5l:"5I",6o:"2I",6p:"ol",6r:"li",dP:"I",9c:"1P",7C:"1U",61:"M",7B:"5b",64:"aa",7R:"a9",7Q:"a7",7P:"a5",8a:"eU",89:"eT",9d:"eM",9b:"eL",dU:"eK",7L:"qV",dT:"eJ",6t:"ai",6s:"ah",dS:"eI",4q:"qU",7O:"af",qT:"ag",ar:"eP",as:"eQ",6n:1f 6c("p","h1","h2","h3","h4","h5","h6","41","2J"),5t:1f 6c("6L","2J","N","dl","2U","1M","h1","h2","h3","h4","h5","h6","hr","8E","ol","p","41","3j","2I","dd","dt","li","8D","4F","8C","5I","8B","6P"),3T:{av:8,aA:13,qS:35,qR:36,az:37,ay:38,ax:39,aw:40,qQ:1f 6c(37,38,39,40),au:46},qP:{qO:1,qN:2,qM:3},1g:j(5C,1Q){c.3f=f.2w.1X(c)-1;c.7T=5C;c.B=1Q;c.4R=D(5C).1H();if(c.B.O)c.4R=c.B.O;c.B.4L=c.B.4L||c.dz();c.B.5i=c.B.5i||c.B.4L+f.eX+c.B.3a+\'/\';c.B.7N=c.B.7N||c.dy();c.B.9x=c.B.9x||c.B.4L+f.eW;c.B.83=c.B.83||c.B.4L+f.eV;c.B.7M=c.B.7M||c.dx();c.56()}});D.fn.5k=j(1Q){1Q=D.53({O:"",4L:J,5i:J,7N:J,83:J,7M:J,1D:J,3p:J,3a:"3R",dn:R,7F:R,3H:"en",4S:"92",1u:"<N I=\'eH\'>"+"<N I=\'qL\'>"+f.9Z+"</N>"+"<N I=\'qK\'></N>"+"<N I=\'qJ\'>"+f.9Y+f.9X+"</N>"+"<N I=\'qI\'>"+f.82+f.9W+f.9V+"</N>"+"<N I=\'qH\'>"+f.a0+"</N>"+"</N>",ec:"<a I=\'qG\' "+"1P=\'91://ex.5k.ew/\'>f</a>",4n:"<N I=\'ae 5o\'>"+"<1K "+"1U=\'"+f.a1+"qF.O\' "+"4K=\'c.1B.qE.f.2w["+f.3N+"].5w(c)\'"+"></1K>"+"</N>",3g:[],eb:"<N I=\'ad 5o\'>"+"<h2>{qD}</h2>"+"<2I>"+f.9R+"</2I>"+"</N>",e5:"<li I=\'"+f.9S+"\'><a 1P=\'#\' F=\'"+f.9T+"\' M=\'"+f.81+"\'>"+f.81+"</a></li>",e6:[{\'F\':\'eU\',\'M\':\'qC\',\'1b\':\'qB\'},{\'F\':\'eT\',\'M\':\'qA\',\'1b\':\'qz\'},{\'F\':\'eS\',\'M\':\'eS\',\'1b\':\'qy\'},{\'F\':\'eR\',\'M\':\'eR\',\'1b\':\'qx\'},{\'F\':\'eQ\',\'M\':\'qw\',\'1b\':\'qv\'},{\'F\':\'eP\',\'M\':\'qu\',\'1b\':\'qt\'},{\'F\':\'ai\',\'M\':\'ai\',\'1b\':\'qs\'},{\'F\':\'ah\',\'M\':\'ah\',\'1b\':\'qr\'},{\'F\':\'eO\',\'M\':\'eO\',\'1b\':\'qq\'},{\'F\':\'eN\',\'M\':\'eN\',\'1b\':\'qp\'},{\'F\':\'eM\',\'M\':\'aa\',\'1b\':\'qo\'},{\'F\':\'ag\',\'M\':\'ag\',\'1b\':\'qn\'},{\'F\':\'eL\',\'M\':\'a9\',\'1b\':\'qm\'},{\'F\':\'eK\',\'M\':\'a7\',\'1b\':\'ql\'},{\'F\':\'eJ\',\'M\':\'a5\',\'1b\':\'qk\'},{\'F\':\'eI\',\'M\':\'82\',\'1b\':\'qj\'},{\'F\':\'af\',\'M\':\'af\',\'1b\':\'qi\'}],ea:"<N I=\'ac 5o\'>"+"<h2>{qh}</h2>"+"<2I>"+f.9I+"</2I>"+"</N>",e2:"<li I=\'"+f.9J+"\'>"+"<a 1P=\'#\' F=\'"+f.9L+"\'>"+f.9K+"</a></li>",e3:[{\'F\':\'P\',\'M\':\'qg\',\'1b\':\'qf\'},{\'F\':\'9F\',\'M\':\'qe\',\'1b\':\'qd\'},{\'F\':\'9E\',\'M\':\'qc\',\'1b\':\'qb\'},{\'F\':\'9D\',\'M\':\'qa\',\'1b\':\'q9\'},{\'F\':\'9C\',\'M\':\'q8\',\'1b\':\'q7\'},{\'F\':\'9B\',\'M\':\'q6\',\'1b\':\'q5\'},{\'F\':\'9A\',\'M\':\'q4\',\'1b\':\'q3\'},{\'F\':\'5q\',\'M\':\'q2\',\'1b\':\'q1\'},{\'F\':\'6b\',\'M\':\'q0\',\'1b\':\'pZ\'},{\'F\':\'5l\',\'M\':\'pY\',\'1b\':\'pX\'}],e9:"<N I=\'ab 5o\'>"+"<h2>{pW}</h2><2I>"+f.9O+"</2I></N>",e4:"<li I=\'pV"+f.80+"\'><a 1P=\'#\' F=\'"+f.80+"\'>"+f.9P+"</a></li>",3W:[],e7:"<N I=\'eF 5o\'>"+"<h2>{pU}</h2>"+"</N>",e8:"<N I=\'eG 5o\'>"+"<h2>{pT}</h2>"+"<4G I=\'eE\'></4G>"+"</N>",pS:".eH",pR:".ad",pQ:" 2I",pP:".ac",pO:".ab",9l:".eG",pN:".ae 1K",6w:".ae",dN:".eF",e0:".ad a",dZ:".ac a",dY:".ab a",9v:".eE",9e:".es",7D:".ep",60:".a8",7A:".eo",d6:".ee",dg:".eh",df:".eg",dc:".ej",d9:".ei",5Z:".6h",d2:".6g",d3:"",dk:".6i",di:".et",63:".er",dh:".ek",d7:".ef",d4:".ed",dX:".pM",dW:"4e",7S:"eD=no,eC=no,eB=no,eA=no"+",4J=ez,7h=ey,3o=0,2k=0",dR:"eD=no,eC=no,eB=no,eA=no"+",pL=pK,4J=ez,7h=ey,3o=0,2k=0",1I:"<!pJ O pI \'-//pH//ev pG 1.0 pF//pE\'"+" \'91://ex.pD.ew/pC/eu/ev/eu-pB.pA\'>"+"<O 3z=\'"+f.9t+"\'><2T>"+"<2u 7w=\'3p\' 1e=\'X/1b\' 8Z=\'7f\'"+" 1P=\'"+f.9s+"\' />"+"<M>"+f.9p+"</M>"+"<2h 1e=\'X/90\'"+" 1U=\'"+f.9q+"\'></2h>"+"<2h 1e=\'X/90\'"+" 1U=\'"+f.9r+"\'></2h>"+"</2T>"+f.9o+"</O>",dK:"<1j I=\'6f et\'"+" 4K=\'f.5g("+f.3N+")\'"+">"+"<1M>"+"<2U>"+"<1y 1e=\'5V\' I=\'6i\' Q=\'"+f.64+"\' />"+"<3k>{aa}</3k>"+"<N I=\'1O\'>"+"<1p>{eq}</1p>"+"<1y 1e=\'X\' I=\'es\' Q=\'\' 2G=\'40\' />"+"</N>"+"<N I=\'1O\'>"+"<1p>{el}</1p>"+"<1y 1e=\'X\' I=\'a8\' Q=\'\' 2G=\'40\' />"+"</N>"+"<N I=\'1O 1O-a6\'>"+"<1y I=\'6h\' 1e=\'2t\'"+" Q=\'{86}\' />"+"<1y I=\'6g\' 1e=\'2t\'"+"Q=\'{85}\' />"+"</N>"+"</2U>"+"</1M>"+"</1j>",dJ:"<1j I=\'6f er\'"+" 4K=\'f.5g("+f.3N+")\'"+">"+"<1M>"+"<2U>"+"<1y 1e=\'5V\' I=\'6i\' Q=\'"+f.7R+"\' />"+"<3k>{a9}</3k>"+"<N I=\'1O\'>"+"<1p>{eq}</1p>"+"<1y 1e=\'X\' I=\'ep\' Q=\'\' 2G=\'40\' />"+"</N>"+"<N I=\'1O\'>"+"<1p>{pz}</1p>"+"<1y 1e=\'X\' I=\'eo\' Q=\'\' 2G=\'40\' />"+"</N>"+"<N I=\'1O\'>"+"<1p>{el}</1p>"+"<1y 1e=\'X\' I=\'a8\' Q=\'\' 2G=\'40\' />"+"</N>"+"<N I=\'1O 1O-a6\'>"+"<1y I=\'6h\' 1e=\'2t\'"+" Q=\'{86}\' />"+"<1y I=\'6g\' 1e=\'2t\'"+"Q=\'{85}\' />"+"</N>"+"</2U>"+"</1M>"+"</1j>",dI:"<1j I=\'6f ek\'"+" 4K=\'f.5g("+f.3N+")\'"+">"+"<1M>"+"<2U>"+"<1y 1e=\'5V\' I=\'6i\' Q=\'"+f.7Q+"\' />"+"<3k>{a7}</3k>"+"<N I=\'1O\'>"+"<1p>{py}</1p>"+"<1y 1e=\'X\' I=\'ej\' Q=\'\' 2G=\'40\' />"+"</N>"+"<N I=\'1O\'>"+"<1p>{px}</1p>"+"<1y 1e=\'X\' I=\'ei\' Q=\'\' 2G=\'40\' />"+"</N>"+"<N I=\'1O\'>"+"<1p>{pw}</1p>"+"<1y 1e=\'X\' I=\'eh\' Q=\'3\' 2G=\'3\' />"+"</N>"+"<N I=\'1O\'>"+"<1p>{pv}</1p>"+"<1y 1e=\'X\' I=\'eg\' Q=\'2\' 2G=\'3\' />"+"</N>"+"<N I=\'1O 1O-a6\'>"+"<1y I=\'6h\' 1e=\'2t\'"+" Q=\'{86}\' />"+"<1y I=\'6g\' 1e=\'2t\'"+"Q=\'{85}\' />"+"</N>"+"</2U>"+"</1M>"+"</1j>",dH:"<1j I=\'6f ef\'"+" 4K=\'f.5g("+f.3N+")\'"+">"+"<1M>"+"<1y 1e=\'5V\' I=\'6i\' Q=\'"+f.7P+"\' />"+"<2U>"+"<3k>{a5}</3k>"+"<N I=\'1O\'>"+"<4G I=\'ee\' 7d=\'10\' 7e=\'50\'></4G>"+"</N>"+"<N I=\'1O\'>"+"<1y I=\'6h\' 1e=\'2t\'"+" Q=\'{86}\' />"+"<1y I=\'6g\' 1e=\'2t\'"+"Q=\'{85}\' />"+"</N>"+"</2U>"+"</1M>"+"</1j>",dG:"<1j I=\'6f ed\'"+" 4K=\'f.5g("+f.3N+")\'"+"></1j>",4A:[],69:"{",68:"}",a4:1a,3y:1a,3w:1a,9f:1a,97:1a},1Q);o c.dq(j(){1f f.1g(D(c),1Q)})};D.53({pu:j(i){o(f.2w[i])}});f.1g.u.56=j(){if(D.84.pt){l 4o=1f f.2D(c)}V if(D.84.ps){l 4o=1f f.2C(c)}V if(D.84.pr){l 4o=1f f.3S(c)}V if(D.84.pq){l 4o=1f f.3d(c)}if(4o){if(D.2A(c.B.a4))c.B.a4(c);l a3=1f f.1l();D.53(a3,4o);c.3Z=1f f.1t(a3);if(c.B.1D||c.B.3p){c.dv()}c.4P=1f f.2W();1h(l 6U in 4o){c[6U]=4o[6U]}c.2p=D(c.7T).e1().5G(c.B.1u).5U().do(\'pp\'+c.3f);if(D.2A(D.fn.4z)){D.4z(c.2p.5W(0),f.a2,c.3f);D.4z(c.7T.5W(0),f.a2,c.3f)}l h=f.1L;l 4n=c.B.4n;4n=h.1k(4n,f.3N,c.3f);4n=h.1k(4n,f.a1,c.B.83);l 1u=D(c.2p).O();1u=h.1k(1u,f.a0,c.B.ec);1u=h.1k(1u,f.9Z,c.B.eb);1u=h.1k(1u,f.9Y,c.B.ea);1u=h.1k(1u,f.9X,c.B.e9);1u=h.1k(1u,f.82,c.B.e8);1u=h.1k(1u,f.9W,4n);1u=h.1k(1u,f.9V,c.B.e7);l 9U=2B(c.B.e6);l 9Q="";1h(l i=0;i<9U.Y;i++){l 5n=9U[i];if(5n.F&&5n.M)l 4m=c.B.e5;l 4m=h.1k(4m,f.9T,5n.F);4m=h.1k(4m,f.81,c.B.69+5n.M+c.B.68);4m=h.1k(4m,f.9S,5n.1b);9Q+=4m}1u=h.1k(1u,f.9R,9Q);l 6e=2B(c.B.3W);l 9N="";1h(l i=0;i<6e.Y;i++){l 4k=6e[i];if(4k.F&&4k.M)l 4j=c.B.e4;4j=h.1k(4j,f.80,4k.F);4j=h.1k(4j,f.9P,4k.M);9N+=4j}1u=h.1k(1u,f.9O,9N);l 9M=2B(c.B.e3);l 9H="";1h(l i=0;i<9M.Y;i++){l 5m=9M[i];if(5m.F&&5m.M)l 4l=c.B.e2;4l=h.1k(4l,f.9L,5m.F);4l=h.1k(4l,f.9K,c.B.69+5m.M+c.B.68);4l=h.1k(4l,f.9J,5m.1b);9H+=4l}1u=h.1k(1u,f.9I,9H);1u=c.9n(1u);D(c.2p).O(1u);D(c.2p).4g(c.B.9l).e1();c.7F()}};f.1g.u.5v=j(){l E=c;D(c.2p).4g(c.B.e0).4e(j(){E.1E.1B.4W();E.dV(D(c).1v(f.7Z));o(J)});D(c.2p).4g(c.B.dZ).4e(j(){E.L(D(c).1v(f.7Z));o(J)});D(c.2p).4g(c.B.9v).2x(j(){D(E.H.1j).O(D(c).1H())}).4W(j(){D(c).6a(\'9u\')}).po(j(){D(c).6a(\'9u\')});D(c.2p).4g(c.B.dY).4e(j(){l 6e=2B(E.B.3W);l 9G=D(c).1v(f.7Z);l 4k=f.1L.aL(6e,9G);if(4k){l 4y=4k.aT;E.6a(9G,4y)}E.1E.1B.4W();o(J)});D(c.B.dX).3x(c.B.dW,j(){E.67()})};f.1g.u.pn=j(){o(c.H!=1a)};f.1g.u.ct=j(){o(c.2p)};f.1g.u.O=j(O){if(1q O===\'3Q\')D(c.H.1j).O(O);V o(D(c.H.1j).O())};f.1g.u.1s=j(){o c.3Z.3X(c.O())};f.1g.u.dV=j(1F){3e(1F){1i f.9d:l L=c.L();if(L||c.2j)c.4M(f.64);1n;1i f.9b:c.4M(f.7R);1n;1i f.dU:c.4M(f.7Q);1n;1i f.dT:c.4M(f.7P);1n;1i f.dS:c.67();c.dC();1n;1i f.7O:c.4M(f.7O,c.B.dR);1n;3R:c.1C(1F);1n}};f.1g.u.L=j(3q){if(3q){l L=1a;if(3q.1o()==f.5l){L=c.L();3e(L.1r.1o()){1i f.6d:1i f.5l:1n;3R:l 7Y=1f 6c(f.6d,f.5l);L=c.2N(c.L(),7Y);1n}if(L!=1a){3q=(L.1r.1o()==f.6d)?f.5l:f.6d;c.9y(L,3q);c.67()}}V{l 7Y=1f 6c(f.P,f.9F,f.9E,f.9D,f.9C,f.9B,f.9A,f.5q,f.6b);L=c.2N(c.L(),7Y);if(L){l 3O=1a;if(3q.1o()==f.6b){l 2J=c.2N(c.L(),f.6b);if(2J==1a){3O=c.H.5Y(3q);L.1z.dQ(3O,L);3O.dr(L);c.5y(3O.pm)}V{l 7X=2J.6q;l 9z=7X.Y;l 7W=1a;if(9z>0)7W=7X.4v(0);1h(l x=0;x<9z;x++){2J.1z.dQ(7X.4v(0),2J)}2J.1z.pl(2J);if(7W)c.5y(7W)}}V c.9y(L,3q);c.67()}}}V o(c.1d())};f.1g.u.6a=j(4j,4y){l L=(c.2j?c.2j:D(c.1d()));L=D(L).4V(4y);D(L).6a(4j);if(!D(L).1v(f.dP))D(L).pk(c.5x)};f.1g.u.2N=j(1c,51){if(1c){l 4i=1c.1r.1o();if(1q(51)==f.dO){77(4i!=51&&4i!=f.3t){1c=1c.1z;4i=1c.1r.1o()}}V{l 7V=J;77(!7V&&4i!=f.3t){1h(l i=0;i<51.Y;i++){if(4i==51[i]){7V=R;1n}}if(!7V){1c=1c.1z;4i=1c.1r.1o()}}}if(4i!=f.3t)o(1c);V o(1a)}V o(1a)};f.1g.u.9y=j(1c,3q){l 3O=c.H.5Y(3q);l O=D(1c).O();1c.1z.pj(3O,1c);D(3O).O(O);c.5y(3O)};f.1g.u.9n=j(4N){if(!f.7U[c.B.3H]){4u{2B(D.9j({9i:c.B.9x+c.B.3H+\'.js\',9h:J}).9g)}4t(e){f.4O.9w("f: 9w 77 ph cX cI.");o 4N}}1h(l 1T in f.7U[c.B.3H]){4N=f.1L.1k(4N,c.B.69+1T+c.B.68,f.7U[c.B.3H][1T])};o(4N)};f.1g.u.dD=j(4N){o(c.B.69+4N+c.B.68)};f.1g.u.2n=j(dM){D(c.2p).4g(c.B.dN).O(dM)};f.1g.u.67=j(){l O=c.1s();D(c.7T).1H(O);D(c.2p).4g(c.B.9v).by(\'.9u\').1H(O);};f.1g.u.4M=j(65,7S,dF){l dL=7S||c.1V.B.7S;l 9m=2l.5X(\'\',\'4M\',dL);if(9m){l 4h="";3e(65){1i(f.64):4h=c.B.dK;1n;1i(f.7R):4h=c.B.dJ;1n;1i(f.7Q):4h=c.B.dI;1n;1i(f.7P):4h=c.B.dH;1n;1i(f.7O):4h=c.B.dG;1n;3R:4h=dF}l h=f.1L;l 1I=c.B.1I;1I=h.1k(1I,f.dE,c.B.4L);1I=h.1k(1I,f.9t,c.B.4S);1I=h.1k(1I,f.9s,c.B.5i+f.7E);1I=h.1k(1I,f.9r,c.B.7N);1I=h.1k(1I,f.9q,c.B.7M);1I=h.1k(1I,f.9p,c.dD(65));1I=h.1k(1I,f.9o,4h);1I=h.1k(1I,f.3N,c.3f);1I=c.9n(1I);l 4f=9m.3A;4f.pg(1I);4f.5e()}};f.1g.u.dC=j(){D(c.2p).4g(c.B.9l).pf()};f.1g.u.dj=j(){l dB=1f pe();o("E-"+dB.pd())};f.1g.u.5B=j(dA){l 3M;l L=c.1d();l aP=dA.8m(c.4s+c.4s);l 4x=1f 2O(c.4s,"g");if(L&&L.1r.1o()!=f.3t){1h(x=aP.Y-1;x>=0;x--){3M=aP[x];3M=3M.S(4x,"<br />");D(L).5G("<p>"+3M+"</p>")}}V{1h(x=0;x<aP.Y;x++){3M=aP[x];3M=3M.S(4x,"<br />");D(c.H.1j).d8("<p>"+3M+"</p>")}}};f.1g.u.8e=j(O){if(c.1E.1B.2z().1x!=1a){c.1C(f.7L,O)}V{c.5B(O)}};f.1g.u.aE=j(2k,2E){if(c.1E.1B.2z().1x!=1a){c.1C(f.7L,2k+c.1E.1B.2z().93()+2E)}};f.1g.u.aD=j(){if(c.1E.1B.2z().1x!=1a){c.1C(f.7L,c.1E.1B.2z().93())}};f.1g.u.5y=j(1c,3U){l 1S=c.H.4Y(),3V=c.1E.1B.2z();3U=3U?0:1;1S.pc(1c);3V.pb(1S);3V.aC(1c,3U);c.1E.1B.4W()};f.1g.u.4T=j(4f,2r){l 1D=4f.4U[0];if(1D){1h(l i=0;i<2r.Y;i++){l 1Y=2r[i];if(1Y.F&&1Y.1b)c.5r(1D,1Y)}}};f.1g.u.dz=j(){o D(D.7G(D(\'2h\'),j(s){o(s.1U&&s.1U.K(/7K\\.5k(\\.7J|\\.7I|\\.7H)?\\.js(\\?.*)?$/))})).1v(\'1U\').S(/7K\\.5k(\\.7J|\\.7I|\\.7H)?\\.js(\\?.*)?$/,\'\')};f.1g.u.dy=j(){o D(D.7G(D(\'2h\'),j(s){o(s.1U&&s.1U.K(/7K\\.5k(\\.7J|\\.7I|\\.7H)?\\.js(\\?.*)?$/))})).1v(\'1U\')};f.1g.u.dx=j(){o D(D.7G(D(\'2h\'),j(s){o(s.1U&&s.1U.K(/7K(-(.*)){0,1}(\\.7J|\\.7I|\\.7H)?\\.js(\\?.*)?$/))})).1v(\'1U\')};f.1g.u.pa=j(){o D(D.7G(D(\'2u\'),j(s){o(s.1P&&s.1P.K(/5k\\/dw\\/(.*)7f\\.1b(\\?.*)?$/))})).1v(\'1P\')};f.1g.u.dv=j(){l 5j=1f f.3D();if(c.B.3p){5j.3X(D.9j({9i:c.B.3p,9h:J}).9g)}V{5j.3X(c.B.1D,J)}if(c.B.3W.Y==0){c.B.3W=5j.4B.3W}if(c.B.3g.Y==0){c.B.3g=5j.4B.3g}if(c.B.4A.Y==0){c.B.4A=5j.4B.4A}};f.1g.u.5u=j(){D(c.H.1j).3x("7z",c.7z)};f.1g.u.7z=j(W){l E=f.2w[c.p9.M];E.2j=(W.ds.1r.1o()==f.du)?W.ds:1a};f.dp=j(1P){l 2u=3A.5Y(\'2u\');2u.7w=\'3p\';2u.1P=1P;l 2T=D(\'2T\').5W(0);2T.dr(2u)};f.1g.u.7F=j(){if(c.B.7F&&!f.5h[c.B.3a]){l 9k=J;l 4x=1f 2O(c.B.3a+\'\\/\'+f.7E+\'$\');D(\'2u\').dq(j(){if(c.1P.K(4x))9k=R});if(!9k)f.dp(c.B.5i+f.7E)}D(c.2p).do("p8"+c.B.3a);if(c.B.dn&&!f.5h[c.B.3a]){2B(D.9j({9i:c.B.5i+f.dm,9h:J}).9g)}if(f.5h[c.B.3a]&&f.5h[c.B.3a].56)f.5h[c.B.3a].56(c)};f.5g=j(5a){l E=2l.p7.f.2w[5a];l 4f=2l.3A;l 1d=E.1d();l 65=D(E.B.dk).1H();l 62=E.dj();3e(65){1i f.64:if(1d&&1d.1r&&1d.1r.1o!=f.A)1d=D(1d).4V(f.A);if(!1d&&E.2j)1d=D(E.2j).4V(f.A);1n}if(D.2A(E.B.9f))E.B.9f(E,2l);l 1D=4f.4U[0];l 2r=2B(E.B.4A);E.4T(4f,2r);if(1d){D(E.B.9e).1H(D(1d).1v(f.9c));D(E.B.7D).1H(D(1d).1v(f.7C));D(E.B.60).1H(D(1d).1v(f.61));D(E.B.7A).1H(D(1d).1v(f.7B))}if(E.2j){D(E.B.63+" "+E.B.7D).1H(D(E.2j).1v(f.7C));D(E.B.63+" "+E.B.60).1H(D(E.2j).1v(f.61));D(E.B.63+" "+E.B.7A).1H(D(E.2j).1v(f.7B))}D(E.B.di+" "+E.B.5Z).4e(j(){l 5f=D(E.B.9e).1H();if(5f.Y>0){l 2u;if(1d[0]&&1d[0].1r.1o()==f.A){2u=1d}V{E.1C(f.9d,62);2u=D("a[1P="+62+"]",E.H.1j)}2u.1v(f.9c,5f).1v(f.61,D(E.B.60).1H())}2l.5e()});D(E.B.63+" "+E.B.5Z).4e(j(){l 5f=D(E.B.7D).1H();if(5f.Y>0){E.1C(f.9b,62);D("6Q[1U$="+62+"]",E.H.1j).1v(f.7C,5f).1v(f.61,D(E.B.60).1H()).1v(f.7B,D(E.B.7A).1H())}2l.5e()});D(E.B.dh+" "+E.B.5Z).4e(j(){l 9a=D(E.B.dg).1H();l 99=D(E.B.df).1H();if(9a>0&&99>0){l 3j=E.H.5Y(f.de);l 98=1a;l p6=1a;l da=D(E.B.dc).1H();l db=3j.p5();db.94=da;1h(x=0;x<9a;x++){98=3j.p4(x);1h(y=0;y<99;y++){98.p3(y)}}D(3j).1v(\'cr\',D(E.B.d9).1H());l 1c=D(E.2N(E.L(),f.6n)).5W(0);if(!1c||!1c.1z)D(E.H.1j).d8(3j);V D(1c).5G(3j)}2l.5e()});D(E.B.d7+" "+E.B.5Z).4e(j(){l d5=D(E.B.d6).1H();E.5B(d5);2l.5e()});D(E.B.d4+" "+E.B.d3).O(E.1s());D(E.B.d2).7z(j(){2l.5e()});if(D.2A(E.B.97))E.B.97(E,2l)};f.2W=j(){c.7y=3A.5Y(\'N\');o c};f.2W.u.C=j(F,1Q,5X){1Q=1Q||J;5X=5X||J;o\'<\'+F+(1Q?c.96(1Q):\'\')+(5X?\'>\':\' />\')};f.2W.u.p2=j(F,2b,1Q){1Q=1Q||J;o\'<\'+F+(1Q?c.96(1Q):\'\')+\'>\'+2b+\'</\'+F+\'>\'};f.2W.u.p1=j(2b){o\'<![p0[\'+2b+\']]>\'};f.2W.u.cZ=j(3L){o c.d1(c.cY(3L))};f.2W.u.d1=j(d0){o d0.S(/&oZ;([a-z]+|(#\\d+));/ig,"&$1;")};f.2W.u.96=j(1Q){l 3L=c;3L.95=\'\';1h(l 1T in 1Q){l oY=\'\';l Q=1Q[1T];if(1q Q!=\'j\'&&Q.Y>0){if(ck(1T)==1T&&1q Q==\'4C\'){1T=Q.oX();Q=Q.4Q()}if(1T!=\'\'&&Q!=\'\'){3L.95+=\' \'+1T+\'="\'+3L.cZ(Q)+\'"\'}}}o 3L.95};f.2W.u.cY=j(3Q,7x){c.7y.94=3Q;c.7y.oW=3Q;l 1N=c.7y.94;if(1q 7x==\'2d\'){if(7x!=J)1N=1N.S(\'"\',\'&oV;\');if(7x==R)1N=1N.S(\'"\',\'&#oU;\')}o 1N};f.2W.u.oT=j(5c){l 1N=[];l 2g=5c.8m(/((=\\s*")(")("))|((=\\s*\\\')(\\\')(\\\'))|((=\\s*[^>\\s]*))/g);if(2g.93()!=5c){1h(l k in 2g){l v=2g[k];if(1q v!=\'j\'&&v.Y!=0){l re=1f 2O(\'(\\\\w+)\\\\s*\'+v);if(K=5c.K(re)){l Q=v.S(/^[\\s=]+/,"");l 5d=Q.oS(0);5d=5d==\'"\'?\'"\':(5d=="\'"?"\'":\'\');if(5d!=\'\'){Q=5d==\'"\'?Q.S(/^"|"+$/g,\'\'):Q.S(/^\'|\'+$/g,\'\')}5c=5c.S(K[0],\'\');1N.1X([K[1],Q])}}}}o 1N};f.bz={"8V":{"oR":{"59":["55","2T","O","7i","1R","2h","1m","M"],"G":["I","id","1m","M","cW","cV"]},"cX":{"59":["55","br","hr","1K","1R","2h"],"G":{"3z":["92","cL"],"0":"3H","1":"3L:3H"}},"cU":{"G":{"cW":/^(\\w){1}$/,"cV":/^(\\d)+$/}}},"8W":{"2l":{"7b":["1j"],"G":["4K","oQ"]},"1M":{"7b":["1M","1y","4G","4X","a","1p","2t"],"G":["oP","oO","oN","oM","oL","aK"]},"cU":{"59":["55","6S","br","cu","oK","2T","O","1K","7i","1R","2h","1m","M"],"G":["oJ","oI","aJ"]},"oH":{"59":["55","6S","br","2T","O","7i","1R","2h","1m","M"],"G":["aI","oG","oF","oE","oD","oC","oB"]}},"1J":{"a":{"G":{"0":"7g","1":"cS","2":"1P","3":"cE","4":"F","7w":/^(7v|cT|3p|2L|5U|7n|7r|5a|7p|7q|7s|7m|7l|7u|7o|7t||7k|7j)+$/,"cD":/^(7v|cT|3p|2L|5U|7n|7r|5a|7p|7q|7s|7m|7l|7u|7o|7t||7k|7j)+$/,"cR":/^(cQ|cP|8F|cO|cN|cM)$/,"5":"1e"}},"0":"6T","1":"8y","2":"6L","bv":{"G":{"0":"5b","1":"cS","2":"1P","oA":/^(R|J)$/,"cR":/^(cQ|cP|8F|cO|cN|cM)$/},"2c":["5b"]},"3":"b","55":{"G":["1P"],"2c":["1P"]},"6S":{"G":{"3z":/^(92|cL)$/},"2c":["3z"]},"4":"bu","2J":{"G":["54"]},"5":"1j","6":"br","2t":{"G":{"2Z":/^(2Z)$/,"1e":/^(2t|cH|cG)$/,"0":"Q"},"3K":"1M"},"7":"bt","8":"54","9":"bs","6R":{"G":{"4d":/^(2E|2k|4c|4b)$/,"0":"2Y","1":"4a","3r":/^(\\d)+$/,"49":/^(3o|48|47|45)$/,"2":"4J"},"3K":"5K"},"5K":{"G":{"4d":/^(2E|2k|4c|4b)$/,"0":"2Y","1":"4a","3r":/^(\\d)+$/,"49":/^(3o|48|47|45)$/,"2":"4J"}},"10":"dd","8x":{"G":{"0":"54","cF":/^([0-9]){8}/}},"11":"N","12":"bq","13":"dl","14":"dt","15":"em","2U":{"3K":"1M"},"1M":{"G":{"0":"5N","1":"5Q","2":"5Q-7g","3":"oz","oy":/^(5W|ox)$/},"2c":["5N"]},"2T":{"G":["cK"]},"16":"h1","17":"h2","18":"h3","19":"h4","20":"h5","21":"h6","22":"hr","O":{"G":["ow"]},"23":"i","6Q":{"G":["5b","1U","7h","ov","ou","cB","4J"],"2c":["5b","1U"]},"1y":{"G":{"0":"5Q","1":"5b","cJ":/^(cJ)$/,"2Z":/^(2Z)$/,"ot":/^(\\d)+$/,"2":"F","8X":/^(8X)$/,"2G":/^(\\d)+$/,"3":"1U","1e":/^(2t|os|cI|5V|bx|oq|op|cH|cG|X)$/,"4":"Q"},"3K":"1M"},"bp":{"G":{"0":"54","cF":/^([0-9]){8}/}},"24":"bo","1p":{"G":["1h"],"3K":"1M"},"25":"3k","26":"li","2u":{"G":{"0":"7g","1":"1P","2":"cE","8Z":/^(8Y|cv|cw|cx|7f|oo|,|;|)+$/i,"7w":/^(7v|7u|7t|7s|7r|7q|7p|7o|cC|5a|5U|7n|7m|2L|3p|7l||7k|7j)+$/i,"cD":/^(7v|7u|7t|7s|7r|7q|7p|7o|cC|5a|5U|7n|7m|2L|3p|7l||7k|7j)+$/i,"3":"1e"},"3K":"2T"},"bn":{"G":["id","F"],"2c":["id"]},"7i":{"G":{"0":"2b","91-bw":/^(2b\\-1e|om|ok|oj\\-oi)$/i,"1":"F","2":"oh"},"2c":["2b"]},"27":"8E","4C":{"G":["og","of","oe","od","4z","oc","7h","F","ob","1e","cB","4J"]},"28":"ol","bm":{"G":{"0":"1p","2Z":/^(2Z)$/},"2c":["1p"]},"6O":{"G":{"0":"1p","2Z":/^(2Z)$/,"1d":/^(1d)$/,"1":"Q"},"3K":"4X"},"29":"p","1R":{"G":{"0":"1e","cA":/^(4z|oa|4C)$/,"1":"cA","2":"Q"},"2c":["F"]},"30":"41","q":{"G":["54"]},"31":"bl","2h":{"G":{"1e":/^(X\\/o9|X\\/90|X\\/o8|X\\/o7|X\\/o6|X\\/3L)$/,"0":"7g","cz":/^(cz)$/,"1":"1U"},"2c":["1e"]},"4X":{"G":{"2Z":/^(2Z)$/,"cy":/^(cy)$/,"0":"F","1":"2G"},"3K":"1M"},"32":"bk","33":"3r","34":"3c","1m":{"G":{"0":"1e","8Z":/^(7f|o5|o4|cx|o3|cw|cv|o2|8Y)$/},"2c":["1e"]},"35":"3b","36":"3P","3j":{"G":{"0":"cs","1":"o1","2":"o0","cu":/^(nZ|nY|nX|nW|nV|nU|nT|ct|cs)$/,"nS":/^(nR|nQ|7d|7e|8Y)$/,"3":"cr","4":"4J"}},"8D":{"G":{"4d":/^(2E|2k|4c|4b)$/,"0":"2Y","1":"4a","49":/^(3o|48|47|45)$/}},"4F":{"G":{"0":"6T","4d":/^(2k|2E|4c|4b|2Y)$/,"1":"cq","2":"2Y","3":"4a","cp":/^(\\d)+$/,"4":"co","cn":/^(\\d)+$/,"1G":/^(6R|5K|1O|cm)$/,"49":/^(3o|48|47|45)$/}},"4G":{"G":["7e","7d","2Z","F","8X"],"2c":["7e","7d"],"3K":"1M"},"8C":{"G":{"4d":/^(2E|2k|4c|4b)$/,"0":"2Y","1":"4a","49":/^(3o|48|47)$/,"2":"45"}},"5I":{"G":{"0":"6T","4d":/^(2k|2E|4c|4b|2Y)$/,"1":"cq","2":"2Y","3":"4a","cp":/^(\\d)+$/,"4":"co","cn":/^(\\d)+$/,"1G":/^(6R|5K|1O|cm)$/,"49":/^(3o|48|47|45)$/}},"8B":{"G":{"4d":/^(2E|2k|4c|4b)$/,"0":"2Y","1":"4a","49":/^(3o|48|47|45)$/}},"37":"M","6P":{"G":{"4d":/^(2E|2k|4c|4b|2Y)$/,"0":"2Y","1":"4a","49":/^(3o|48|47|45)$/}},"38":"bj","39":"2I","40":"l"},6G:[],6F:[],5p:j(C,G){l 7c={};l cl=c.cf(C);1h(l 2i in G){l Q=G[2i];l h=f.1L;if(!h.2F(c.6G,2i)&&!h.2F(c.6F,Q)){if(1q Q!=\'j\'&&h.2F(cl,2i)){if(c.ch(C,2i)){if(c.cg(C,2i,Q)){7c[2i]=Q}}V{7c[2i]=Q}}}}o 7c},ce:j(C){l 1N=[];if(c.1J[C]&&c.1J[C][\'G\']){1h(k in c.1J[C][\'G\']){1N.1X(ck(k)==k?c.1J[C][\'G\'][k]:k)}}o 1N},ci:j(){l 1N=[];1h(l 1T in c.8W){1N.1X(c.8W[1T])}1h(l 1T in c.8V){1N.1X(c.8V[1T])}o 1N},cj:j(C){if(c.1J[C]){o R}1h(l 1T in c.1J){if(c.1J[1T]==C){o R}}o J},cd:j(C){l 8T=[];if(c.cj(C)){l 8U=c.ci();1h(l 1T in 8U){l 3J=8U[1T];if(1q 3J==\'4C\'){l h=f.1L;if((3J[\'59\']&&h.2F(3J[\'59\'],C))||(3J[\'7b\']&&!h.2F(3J[\'7b\'],C))){nP}l 7a=3J[\'G\']?3J[\'G\']:3J[\'nO\'];1h(l k in 7a){8T.1X(1q 7a[k]!=\'3Q\'?k:7a[k])}}}}o 8T},ch:j(C,2i){o c.1J[C]&&((c.1J[C][\'G\']&&c.1J[C][\'G\'][2i])||(c.1J[C][\'2c\']&&f.1L.2F(c.1J[C][\'2c\'],2i)))},cg:j(C,2i,Q){if(c.1J[C]&&(c.1J[C][\'G\']&&c.1J[C][\'G\'][2i]&&Q.Y>0&&!Q.K(c.1J[C][\'G\'][2i]))||(c.1J[C]&&c.1J[C][\'2c\']&&f.1L.2F(c.1J[C][\'2c\'],2i)&&Q.Y==0)){o J}o 1q c.1J[C]!=\'2d\'},cf:j(C){if(!c.5T){c.5T={}}if(!c.5T[C]){c.5T[C]=c.ce(C).nN(c.cd(C))}o c.5T[C]}};f.2X=j(78){c.4I=78;c.44=[];c.8S=[];c.5S=1a;o c};f.2X.u.43=j(3n,1p){1p=1p||R;l 58=c.44.Y;c.44[58]=3n;c.8S[58]=1p;c.5S=1a};f.2X.u.K=j(cc){if(c.44.Y==0){o[J,\'\']}l 2g=cc.K(c.cb());if(!2g){o[J,\'\']}l K=2g[0];1h(l i=1;i<2g.Y;i++){if(2g[i]){o[c.8S[i-1],K]}}o[R,2g[0]]};f.2X.u.cb=j(){if(c.5S==1a){1h(l i=0,58=c.44.Y;i<58;i++){c.44[i]=\'(\'+c.c9(c.ca(c.44[i]).S(/([\\/\\(\\)])/g,\'\\\\$1\'))+\')\'}c.5S=1f 2O(c.44.6u("|"),c.c1())}o c.5S};f.2X.u.ca=j(79){o 79.S(/\\(\\?(i|m|s|x|U)\\)/,\'~~~~~~c8\\$1~~~~~~\').S(/\\(\\?(\\-[i|m|s|x|U])\\)/,\'~~~~~~c7\\$1~~~~~~\').S(/\\(\\?\\=(.*)\\)/,\'~~~~~~c6\\$1~~~~~~\').S(/\\(\\?\\!(.*)\\)/,\'~~~~~~c5\\$1~~~~~~\').S(/\\(\\?\\<\\=(.*)\\)/,\'~~~~~~c4\\$1~~~~~~\').S(/\\(\\?\\<\\!(.*)\\)/,\'~~~~~~c3\\$1~~~~~~\').S(/\\(\\?\\:(.*)\\)/,\'~~~~~~c2\\$1~~~~~~\')};f.2X.u.c9=j(79){o 79.S(/~~~~~~c8(.{1})~~~~~~/,"(?\\$1)").S(/~~~~~~c7(.{2})~~~~~~/,"(?\\$1)").S(/~~~~~~c6(.*)~~~~~~/,"(?=\\$1)").S(/~~~~~~c5(.*)~~~~~~/,"(?!\\$1)").S(/~~~~~~c4(.*)~~~~~~/,"(?<=\\$1)").S(/~~~~~~c3(.*)~~~~~~/,"(?<!\\$1)").S(/~~~~~~c2(.*)~~~~~~/,"(?:\\$1)")};f.2X.u.c1=j(){o(c.4I?"m":"mi")};f.5R=j(2L){c.57=[2L];o c};f.5R.u.8O=j(){o c.57[c.57.Y-1]};f.5R.u.8Q=j(2a){c.57.1X(2a)};f.5R.u.8R=j(){if(c.57.Y==1){o J}c.57.4Q();o R};f.71=1;f.bZ=2;f.3E=3;f.5E=4;f.6Y=5;f.2f=j(3Z,2L,78){2L=2L||\'5Q\';c.4I=78||J;c.2o={};c.8P=3Z;c.42=1f f.5R(2L);c.2K={};c.2K[2L]=2L;o c};f.2f.u.43=j(3n,T){l T=T||"5Q";if(1q c.2o[T]==\'2d\'){c.2o[T]=1f f.2X(c.4I)}c.2o[T].43(3n);if(1q c.2K[T]==\'2d\'){c.2K[T]=T}};f.2f.u.2Q=j(3n,T,5P){if(1q c.2o[T]==\'2d\'){c.2o[T]=1f f.2X(c.4I)}c.2o[T].43(3n,5P);if(1q c.2K[5P]==\'2d\'){c.2K[5P]=5P}};f.2f.u.2H=j(3n,T){if(1q c.2o[T]==\'2d\'){c.2o[T]=1f f.2X(c.4I)}c.2o[T].43(3n,"bX");if(1q c.2K[T]==\'2d\'){c.2K[T]=T}};f.2f.u.4E=j(3n,T,5O){if(1q c.2o[T]==\'2d\'){c.2o[T]=1f f.2X(c.4I)}c.2o[T].43(3n,\'bV\'+5O);if(1q c.2K[5O]==\'2d\'){c.2K[5O]=5O}};f.2f.u.8q=j(T,75){c.2K[T]=75};f.2f.u.3X=j(1w){if(1q c.8P==\'2d\'){o J}l Y=1w.Y;l 3I;77(1q(3I=c.bR(1w))==\'4C\'){l 1w=3I[0];l 76=3I[1];l 3m=3I[2];l T=3I[3];if(!c.c0(76,3m,T)){o J}if(1w==\'\'){o R}if(1w.Y==Y){o J}Y=1w.Y}if(!3I){o J}o c.4H(1w,f.3E)};f.2f.u.c0=j(76,3m,T){T=T||J;if(!c.4H(76,f.3E)){o J}if(1q T==\'nM\'){o c.4H(3m,f.bZ)}if(c.bY(T)){if(!c.4H(3m,f.5E)){o J}o c.42.8R()}if(c.bW(T)){c.42.8Q(c.bU(T));if(!c.4H(3m,f.6Y)){o J}o c.42.8R()}c.42.8Q(T);o c.4H(3m,f.71)};f.2f.u.bY=j(T){o(T==="bX")};f.2f.u.bW=j(T){o(T.6y(0,1)=="bV")};f.2f.u.bU=j(T){o T.6y(1)};f.2f.u.4H=j(2b,bS){if(2b===\'\'){o R}l bT=c.42.8O();l 75=c.2K[bT];l 1N;2B(\'1N = c.8P.\'+75+\'(2b, bS);\');o 1N};f.2f.u.bR=j(1w){l 3m=c.2o[c.42.8O()].K(1w);l K=3m[1];l 5N=3m[0];if(5N){l 8N=1w.8h(K);l bQ=1w.aN(0,8N);1w=1w.6y(8N+K.Y);o[1w,bQ,K,5N]}o R};f.3l=j(3Z){D.53(c,1f f.2f(3Z,\'3h\'));c.8q(\'3h\',\'3h\');c.bP();c.56();o c};f.3l.u.56=j(){};f.3l.u.bP=j(){c.bO(\'3h\');c.bN(\'3h\');c.bM(\'3h\');c.bL(\'3h\')};f.3l.u.bO=j(1G){c.2Q("<!--",1G,\'8M\');c.2H("-->",\'8M\')};f.3l.u.bN=j(1G){c.2Q("<2h",1G,\'8L\');c.2H("</2h>",\'8L\')};f.3l.u.bM=j(1G){c.2Q("<1m",1G,\'8K\');c.2H("</1m>",\'8K\')};f.3l.u.bL=j(1G){c.4E("<\\\\s*[a-5F-9:\\-]+\\\\s*>",1G,\'72\');c.2Q("<[a-5F-9:\\-]+"+\'[\\\\\\/ \\\\\\>]+\',1G,\'72\');c.bK(\'72\');c.4E("</\\\\s*[a-5F-9:\\-]+\\\\s*>",1G,\'bG\')};f.3l.u.bK=j(1G){c.4E(\'\\\\s+\',1G,\'52\');c.bJ(1G);c.2H(\'/>\',1G);c.2H(\'>\',1G)};f.3l.u.bJ=j(1G){c.4E("\\\\s*[a-z-8p-9]*:?[a-z-8p-9]+\\\\s*(?=\\=)\\\\s*",1G,\'bB\');c.2Q(\'=\\\\s*"\',1G,\'6X\');c.43("\\\\\\\\\\"",\'6X\');c.2H(\'"\',\'6X\');c.2Q("=\\\\s*\'",1G,\'6W\');c.43("\\\\\\\\\'",\'6W\');c.2H("\'",\'6W\');c.4E(\'=\\\\s*[^>\\\\s]*\',1G,\'bA\')};f.1t=j(bI,T){l T=T||\'3h\';c.6D=1f f.3l(c);c.Z=bI;c.42=T;c.nL=[];c.nK=\'\';c.nJ=\'\';o c};f.1t.u.3X=j(1w){c.6D.3X(c.6N(1w));o c.6M(c.Z.bb())};f.1t.u.6N=j(1w){if(1w.K(/I="b3"/)||1w.K(/ns = "nI:nH-nG-nF/)){c.Z.b4()}o c.Z.6N(1w)};f.1t.u.6M=j(3I){if(c.Z.8w){c.Z.b2()}o c.Z.6M(3I)};f.1t.u.52=j(K,2a){o R};f.1t.u.3h=j(X){c.Z.ba(X);o R};f.1t.u.8M=j(K,2n){o c.74(K,2n,\'6J\')};f.1t.u.8L=j(K,2n){o c.74(K,2n,\'6I\')};f.1t.u.8K=j(K,2n){o c.74(K,2n,\'6H\')};f.1t.u.74=j(K,2a,1e){3e(2a){1i f.71:c.5M=K;1n;1i f.3E:c.5M+=K;1n;1i f.5E:3e(1e){1i\'6J\':c.Z.6J(c.5M+K);1n;1i\'6I\':c.Z.6I(c.5M+K);1n;1i\'6H\':c.Z.6H(c.5M+K);1n}}o R};f.1t.u.72=j(K,2a){3e(2a){1i f.71:c.bH=c.6Z(K);c.5L={};1n;1i f.6Y:c.8J(c.6Z(K));1n;1i f.5E:c.8J(c.bH,c.5L)}o R};f.1t.u.bG=j(K,2a){c.8G(c.6Z(K));o R};f.1t.u.8J=j(C,G){l G=G||{};c.bE(C);if(c.Z.8v(C)){c.Z.4p.1X(C);c.Z.aY(C,G);c.Z.6k(C,G);c.8I(C)}V if(c.Z.b1(C)){c.Z.b9(C,G)}V{c.Z.b8(C,G);c.8I(C)}c.Z.6E=C;c.Z.8t=R;c.Z.nE=G};f.1t.u.8G=j(C){if(c.bF(C)){c.bD(C);if(c.Z.8v(C)){l 70=c.Z.4p.4Q();if(70==J){o}V if(70!=C){C=70}c.Z.b7(C)}V{c.Z.b6(C)}}V{c.Z.b5(C)}c.Z.6E=C;c.Z.8t=J};f.1t.u.8I=j(C){c.Z.2V[C]=c.Z.2V[C]||0;c.Z.2V[C]++};f.1t.u.bF=j(C){if(c.Z.2V[C]){c.Z.2V[C]--;if(c.Z.2V[C]==0){c.Z.2V[C]=2d}o R}o J};f.1t.u.bE=j(2v){c.8H(2v,J)};f.1t.u.bD=j(C){c.8H(C,R)};f.1t.u.8H=j(2v,2S){l 2S=2S||J;if(c.Z.2V){1h(l C in c.Z.2V){l bC=c.Z.2V[C];if(bC>0&&c.Z.bi(C,2v,2S)){c.8G(C,R)}}}};f.1t.u.6K=j(){o c.Z.6K()};f.1t.u.6Z=j(C){C=C.S(/^([\\s<\\/>]*)|([\\s<\\/>]*)$/gm,\'\').1o();l 3i=c.Z.6K();if(3i[C]){o 3i[C]}o C};f.1t.u.bB=j(K,2a){if(f.6Y==2a){c.6V=K}o R};f.1t.u.6X=j(K,2a){if(f.3E==2a){c.5L[c.6V]=K}o R};f.1t.u.6W=j(K,2a){if(f.3E==2a){c.5L[c.6V]=K}o R};f.1t.u.bA=j(K,2a){c.5L[c.6V]=K.S(/^=/,\'\');o R};f.1l=j(){c.1W=\'\';c.4P=1f f.2W();c.2V={};c.3s=f.bz;c.4p=[];c.5H=[];c.8A={\'&bd;\':\'&#be;\',\'&nD;\':\'&#nC;\',\'&nB;\':\'&#nA;\',\'&nz;\':\'&#ny;\',\'&nx;\':\'&#nw;\',\'&nv;\':\'&#nt;\',\'&nr;\':\'&#nq;\',\'&np;\':\'&#nn;\',\'&nm;\':\'&#nl;\',\'&nk;\':\'&#nj;\',\'&nh;\':\'&#ng;\',\'&nf;\':\'&#nd;\',\'&by;\':\'&#nc;\',\'&nb;\':\'&#na;\',\'&n9;\':\'&#n8;\',\'&n7;\':\'&#n6;\',\'&n5;\':\'&#n4;\',\'&n3;\':\'&#n2;\',\'&n1;\':\'&#n0;\',\'&mZ;\':\'&#mY;\',\'&mX;\':\'&#mW;\',\'&mV;\':\'&#mU;\',\'&mT;\':\'&#mS;\',\'&mR;\':\'&#mQ;\',\'&mP;\':\'&#mO;\',\'&mN;\':\'&#mM;\',\'&mL;\':\'&#mK;\',\'&mJ;\':\'&#mI;\',\'&mH;\':\'&#mG;\',\'&mF;\':\'&#mE;\',\'&mD;\':\'&#mC;\',\'&mB;\':\'&#mA;\',\'&mz;\':\'&#my;\',\'&mx;\':\'&#mw;\',\'&mv;\':\'&#mt;\',\'&ms;\':\'&#mr;\',\'&mq;\':\'&#mp;\',\'&mo;\':\'&#mn;\',\'&mm;\':\'&#ml;\',\'&mk;\':\'&#mj;\',\'&mh;\':\'&#mg;\',\'&mf;\':\'&#me;\',\'&md;\':\'&#mc;\',\'&mb;\':\'&#ma;\',\'&m9;\':\'&#m8;\',\'&m7;\':\'&#m6;\',\'&m5;\':\'&#m4;\',\'&m3;\':\'&#m2;\',\'&m1;\':\'&#m0;\',\'&lZ;\':\'&#lY;\',\'&lX;\':\'&#lW;\',\'&lV;\':\'&#lU;\',\'&lT;\':\'&#lS;\',\'&lR;\':\'&#lQ;\',\'&lP;\':\'&#lO;\',\'&lN;\':\'&#lM;\',\'&lL;\':\'&#lK;\',\'&lJ;\':\'&#lI;\',\'&lH;\':\'&#lG;\',\'&lF;\':\'&#lE;\',\'&lD;\':\'&#lC;\',\'&lB;\':\'&#lA;\',\'&lz;\':\'&#ly;\',\'&lx;\':\'&#lw;\',\'&lv;\':\'W\',\'&lu;\':\'&#lt;\',\'&ls;\':\'&#lr;\',\'&lq;\':\'&#lp;\',\'&lo;\':\'&#ln;\',\'&lm;\':\'&#ll;\',\'&lk;\':\'&#lj;\',\'&lh;\':\'&#lg;\',\'&lf;\':\'&#ld;\',\'&lc;\':\'&#lb;\',\'&la;\':\'&#l9;\',\'&l8;\':\'&#l7;\',\'&l6;\':\'&#l5;\',\'&l4;\':\'&#l3;\',\'&l2;\':\'&#l1;\',\'&l0;\':\'&#kZ;\',\'&kY;\':\'&#kX;\',\'&kW;\':\'&#kV;\',\'&kU;\':\'&#kT;\',\'&kS;\':\'&#kR;\',\'&kQ;\':\'&#kP;\',\'&kO;\':\'&#kN;\',\'&kM;\':\'&#kL;\',\'&kK;\':\'&#kJ;\',\'&kI;\':\'&#kH;\',\'&kG;\':\'&#kF;\',\'&kE;\':\'&#kD;\',\'&kC;\':\'&#kB;\',\'&kA;\':\'&#kz;\',\'&ky;\':\'&#kx;\',\'&kw;\':\'&#kv;\',\'&ku;\':\'&#kt;\',\'&ks;\':\'&#kr;\',\'&kq;\':\'&#kp;\',\'&ko;\':\'&#kn;\',\'&km;\':\'&#kl;\',\'&kk;\':\'&#kj;\',\'&ki;\':\'&#kh;\',\'&8F;\':\'&#kg;\',\'&kf;\':\'&#ke;\',\'&kd;\':\'&#kc;\',\'&kb;\':\'&#ka;\',\'&k9;\':\'&#k8;\',\'&k7;\':\'&#k6;\',\'&k5;\':\'&#k4;\',\'&k3;\':\'&#k2;\',\'&k1;\':\'&#k0;\',\'&jZ;\':\'&#jY;\',\'&jX;\':\'&#jW;\',\'&jV;\':\'&#jU;\',\'&jT;\':\'&#jS;\',\'&jR;\':\'&#jQ;\',\'&jP;\':\'&#jO;\',\'&jN;\':\'&#jM;\',\'&jL;\':\'&#jK;\',\'&jJ;\':\'&#jI;\',\'&jH;\':\'&#jG;\',\'&jF;\':\'&#jE;\',\'&jD;\':\'&#jC;\',\'&jB;\':\'&#jA;\',\'&jz;\':\'&#jy;\',\'&jx;\':\'&#jw;\',\'&jv;\':\'&#ju;\',\'&jt;\':\'&#jr;\',\'&jq;\':\'&#jp;\',\'&jo;\':\'&#jn;\',\'&jm;\':\'&#jl;\',\'&jk;\':\'&#jj;\',\'&ji;\':\'&#jh;\',\'&jg;\':\'&#jf;\',\'&je;\':\'&#jd;\',\'&jc;\':\'&#jb;\',\'&ja;\':\'&#j9;\',\'&j8;\':\'&#j7;\',\'&j6;\':\'&#j5;\',\'μ\':\'&#j4;\',\'ν\':\'&#j3;\',\'&j2;\':\'&#j1;\',\'&j0;\':\'&#iZ;\',\'π\':\'&#iY;\',\'&iX;\':\'&#iW;\',\'&iV;\':\'&#iU;\',\'&iT;\':\'&#iS;\',\'&iR;\':\'&#iQ;\',\'&iP;\':\'&#iO;\',\'&iN;\':\'&#iM;\',\'&iL;\':\'&#iK;\',\'&iJ;\':\'&#iI;\',\'&iH;\':\'&#iG;\',\'&iF;\':\'&#iE;\',\'&iD;\':\'&#iC;\',\'&iB;\':\'&#iA;\',\'&iz;\':\'&#iy;\',\'&ix;\':\'&#iw;\',\'&iv;\':\'&#iu;\',\'⁢\':\'&#ir;\',\'&iq;\':\'&#ip;\',\'&io;\':\'&#im;\',\'&il;\':\'&#ik;\',\'&ij;\':\'&#ii;\',\'&ih;\':\'&#ie;\',\'⁣\':\'&#ib;\',\'&ia;\':\'&#i9;\',\'&i8;\':\'&#i7;\',\'&i6;\':\'&#i5;\',\'&i4;\':\'&#i3;\',\'&i2;\':\'&#i1;\',\'&i0;\':\'&#hZ;\',\'&hY;\':\'&#hX;\',\'&hW;\':\'&#hV;\',\'&hU;\':\'&#hT;\',\'&hS;\':\'&#hR;\',\'&hQ;\':\'&#hP;\',\'&hO;\':\'&#hN;\',\'&hM;\':\'&#hL;\',\'&hK;\':\'&#hJ;\',\'&hI;\':\'&#hH;\',\'&hG;\':\'&#hF;\',\'&hE;\':\'&#hD;\',\'&bx;\':\'&#hC;\',\'&hB;\':\'&#hA;\',\'&hz;\':\'&#hy;\',\'&hx;\':\'&#hw;\',\'&hv;\':\'&#hu;\',\'&ht;\':\'&#hs;\',\'&hq;\':\'&#hp;\',\'&ho;\':\'&#hn;\',\'&hm;\':\'&#hl;\',\'&hk;\':\'&#hj;\',\'&hi;\':\'&#hh;\',\'&hg;\':\'&#hf;\',\'&he;\':\'&#hd;\',\'&hc;\':\'&#hb;\',\'&ha;\':\'&#h9;\',\'&h8;\':\'&#h7;\',\'&h0;\':\'&#gZ;\',\'&gY;\':\'&#gX;\',\'&gW;\':\'&#gV;\',\'&gU;\':\'&#gT;\',\'&gS;\':\'&#gR;\',\'&gQ;\':\'&#gP;\',\'&gO;\':\'&#gN;\',\'∋\':\'&#gM;\',\'&gL;\':\'&#gK;\',\'&gJ;\':\'&#gI;\',\'&gH;\':\'&#gG;\',\'&gF;\':\'&#gE;\',\'&gD;\':\'&#gC;\',\'&6U;\':\'&#gB;\',\'&gA;\':\'&#gz;\',\'&gy;\':\'&#gx;\',\'&gw;\':\'&#gv;\',\'∨\':\'&#gu;\',\'>\':\'&#gs;\',\'&gr;\':\'&#gq;\',\'&gp;\':\'&#go;\',\'&gn;\':\'&#gl;\',\'&gk;\':\'&#gj;\',\'&gh;\':\'&#gg;\',\'&gf;\':\'&#gd;\',\'≠\':\'&#gc;\',\'&bw;\':\'&#gb;\',\'≤\':\'&#ga;\',\'≥\':\'&#g9;\',\'&3b;\':\'&#g8;\',\'&3P;\':\'&#g7;\',\'&g6;\':\'&#g5;\',\'&g4;\':\'&#g3;\',\'&g2;\':\'&#g1;\',\'&g0;\':\'&#fZ;\',\'&fY;\':\'&#fX;\',\'&fW;\':\'&#fV;\',\'&fU;\':\'&#fT;\',\'&fS;\':\'&#fR;\',\'&fQ;\':\'&#fP;\',\'&fO;\':\'&#fN;\',\'&fM;\':\'&#fL;\',\'&3H;\':\'&#fK;\',\'&fJ;\':\'&#fI;\',\'&fH;\':\'&#fG;\',\'&fF;\':\'&#fE;\',\'&fD;\':\'&#fC;\',\'&fB;\':\'&#fA;\',\'&fz;\':\'&#fy;\'};c.8u=["a","6T","8y","6L","bv","b","55","6S","bu","2J","1j","2t","bt","54","bs","6R","5K","dd","8x","N","bq","dl","dt","em","2U","1M","2T","h1","h2","h3","h4","h5","h6","O","i","bp","bo","1p","3k","li","bn","8E","4C","ol","bm","6O","p","1R","41","q","bl","2h","4X","bk","3r","3c","1m","3b","3P","3j","8D","4F","4G","8C","5I","8B","M","6P","bj","2I","l","fx"];c.b0=["br","hr","6Q","1y"];o c};f.1l.u.bi=j(C,5J,2S){l 2S=2S||J;if(C==\'4F\'){if((2S&&5J==\'6P\')||(!2S&&5J==\'4F\')){o R}}if(C==\'6O\'){if((2S&&5J==\'4X\')||(!2S&&5J==\'6O\')){o R}}o J};f.1l.u.6N=j(1w){c.1W=\'\';o 1w};f.1l.u.6M=j(1s){1s=c.bh(1s);1s=c.bg(1s);1s=c.bf(1s);1s=c.bc(1s);o 1s};f.1l.u.bh=j(1s){1h(l 8z in c.8A){1s=1s.S(1f 2O(8z,\'g\'),c.8A[8z])}o 1s};f.1l.u.bg=j(1s){l 3i=\'em|3c|3b|3P|8y|41|8x|6L\';o 1s.S(1f 2O(\'<\\/(\'+3i+\')><\\\\1>\',\'\'),\'\').S(1f 2O(\'(\\s*<(\'+3i+\')>\\s*){2}(.*)(\\s*<\\/\\\\2>\\s*){2}\',\'\'),\'<\\$2>\\$3<\\$2>\')};f.1l.u.bf=j(1s){o 1s.S(1f 2O(\'<(\'+c.8u.6u("|").S(/\\|4F/,\'\').S(/\\|5I/,\'\')+\')>(<br \\/>|&#be;|&bd;|\\\\s)*<\\/\\\\1>\',\'g\'),\'\')};f.1l.u.bc=j(1s){l 2g=1s.K(1f 2O(\'<41[^>]*>(.*?)<\\/41>\',\'fw\'));if(2g){1h(l i=0;i<2g.Y;i++){1s=1s.S(2g[i],2g[i].S(1f 2O(\'<br \\/>\',\'g\'),fv.fu(13,10)))}}o 1s};f.1l.u.bb=j(){o c.1W};f.1l.u.6K=j(){o{\'b\':\'3c\',\'i\':\'em\'}};f.1l.u.ba=j(X){c.1W+=X};f.1l.u.6J=j(X){if(c.ft){c.1W+=X}};f.1l.u.6I=j(X){if(!c.fs){c.1W+=X}};f.1l.u.6H=j(X){if(!c.fr){c.1W+=X}};f.1l.u.6k=j(C,G){c.1W+=c.4P.C(C,c.3s.5p(C,G),R)};f.1l.u.b9=j(C,G){c.1W+=c.4P.C(C,c.3s.5p(C,G))};f.1l.u.b8=j(C,G){};f.1l.u.b7=j(C){c.1W=c.1W.S(/<br \\/>$/,\'\')+c.8r(\'aZ\',C)+"</"+C+">"+c.8r(\'5G\',C)};f.1l.u.b6=j(C){};f.1l.u.b5=j(C){c.1W+="</"+C+">"};f.1l.u.b4=j(){c.5H=[\'N\',\'3r\'];c.3s.6G=[\'1m\'];c.3s.6F=[\'b3\',\'fq\'];c.8w=R};f.1l.u.b2=j(){c.5H=[];c.3s.6G=[];c.3s.6F=[];c.8w=J};f.1l.u.8v=j(C){o!f.1L.2F(c.5H,C)&&f.1L.2F(c.8u,C)};f.1l.u.b1=j(C){o!f.1L.2F(c.5H,C)&&f.1L.2F(c.b0,C)};f.1l.u.aX=j(C,2b){c.8s(\'5G\',C,2b)};f.1l.u.fp=j(C,2b){c.8s(\'aZ\',C,2b)};f.1l.u.aY=j(C,G){if(C!=\'li\'&&(C==\'2I\'||C==\'ol\')&&c.6E&&!c.8t&&c.6E==\'li\'){c.1W=c.1W.S(/<\\/li>$/,\'\');c.aX(C,\'</li>\')}};f.1l.u.8s=j(2R,C,2b){if(!c[\'3G\'+2R+\'3F\']){c[\'3G\'+2R+\'3F\']=[]}if(!c[\'3G\'+2R+\'3F\'][C]){c[\'3G\'+2R+\'3F\'][C]=[]}c[\'3G\'+2R+\'3F\'][C].1X(2b)};f.1l.u.8r=j(2R,C){if(c[\'3G\'+2R+\'3F\']&&c[\'3G\'+2R+\'3F\'][C]&&c[\'3G\'+2R+\'3F\'][C].Y>0){o c[\'3G\'+2R+\'3F\'][C].4Q()}o\'\'};f.aW=j(3Z,2s){l 2s=(1q 2s==\'2d\'?R:2s);D.53(c,1f f.2f(3Z,(2s?\'52\':\'4D\')));c.8q(\'4D\',\'52\');if(2s==R){c.2Q("/\\\\\\3Y[<\\\\s]*f[>\\\\s]*\\\\\\3Y/",\'52\',\'4D\');c.2H("/\\\\\\3Y[<\\/\\\\s]*f[>\\\\s]*\\\\\\3Y/",\'4D\')}c.4E("[\\\\fo-fm-6]*\\\\\\fl[a-z-8p-9]+",\'4D\',\'aV\');c.2Q("/\\\\\\3Y",\'4D\',\'8o\');c.2H("\\\\\\3Y/",\'8o\');c.2Q("\\fk",\'4D\',\'6C\');c.2H("\\fj",\'6C\');c.2Q("/\\\\\\3Y",\'6C\',\'8n\');c.2H("\\\\\\3Y/",\'8n\');o c};f.3D=j(){c.6B=J;c.5D=J;c.2s=R;c.4B={\'3W\':[],\'3g\':[],\'4A\':[]};o c};f.3D.u.3X=j(1w,2s){l 2s=(1q 2s==\'2d\'?c.2s:2s);c.6D=1f f.aW(c,2s);c.6D.3X(1w)};f.3D.u.52=j(K,2a){o R};f.3D.u.8o=j(X,2n){if(X.K(/fi[a-5F-9\\s]*E[a-5F-9\\s]*/mi)){o J}if(2n==f.3E){if(!c.6B){c.5D=R;c.2m={\'M\':f.1L.4w(X)}}V{if(c.2m[c.2e]){if(!c.2m[c.2e].6z){c.2m[c.2e].6z=[X]}V{c.2m[c.2e].6z.1X(X)}}}c.6B=R}o R};f.3D.u.6C=j(K,2n){if(2n==f.3E){K=f.1L.4w(K);if(K!=\'\'){c.2m[c.2e].1m=K}}V if(2n==f.5E){c.6B=J;c.5D=J;c.aU(c.2m)}o R};f.3D.u.8n=j(K,2n){if(2n==f.3E){c.2m[c.2e].8k=K.S(/^([\\s\\/\\*]*)|([\\s\\/\\*]*)$/gm,\'\')}o R};f.3D.u.aV=j(K){K=K.S(/^([\\s\\.]*)|([\\s\\.*]*)$/gm,\'\');l C=\'\';if(K.8h(\'.\')>0){l 8l=K.8m(\'.\');c.2e=8l[1];l C=8l[0]}V{c.2e=K}if(!c.5D){c.2m={\'M\':(!C?\'\':C.fh()+\': \')+c.2e};c.5D=R}if(!c.2m[c.2e]){c.2m[c.2e]={\'F\':c.2e}}if(C){if(!c.2m[c.2e].3i){c.2m[c.2e].3i=[C]}V{c.2m[c.2e].3i.1X(C)}}o R};f.3D.u.aU=j(6A){1h(l F in 6A){l 2P=6A[F];if(1q 2P==\'4C\'&&F!=\'M\'){c.4B.3W.1X({\'F\':f.1L.4w(2P.F),\'M\':6A.M,\'aT\':f.1L.4w((2P.6z||2P.3i).6u(\', \'))});if(2P.8k){c.4B.3g.1X({\'F\':\'.\'+f.1L.4w(2P.F),\'1b\':2P.8k})}if(2P.1m){c.4B.4A.1X({\'F\':\'.\'+f.1L.4w(2P.F),\'1b\':2P.1m})}}}};D.fn.aS=j(){if(c[0].8j==3)o!(/[^\\t\\n\\r ]/.2M(c[0].4z));o J};f.aS=j(n){if(n.8j==3)o!(/[^\\t\\n\\r ]/.2M(n.4z));o J};f.fg=j(3C){o!(/[^\\t\\n\\r ]/.2M(3C))};D.fn.4V=j(4y){l n=c;if(n[0].8j==3)n=n.5z().aR(0,1);if(n.51(4y).2G()==1)o n;V o n.5z(4y).aR(0,1)};f.1L={1k:j(3C,aQ,aO){l 4x=1f 2O(aQ,"g");o(3C.S(4x,aO))},ff:j(3C,aM,8i){o(3C.aN(0,8i)+aM+3C.6y(8i))},4w:j(3C){o 3C.S(/^(\\s*)|(\\s*)$/gm,\'\')},2F:j(3B,5C){1h(l i=0;i<3B.Y;i++){if(3B[i]===5C)o R}o J},8h:j(3B,4v){l 8g=-1;1h(l i=0;i<3B.Y;i++){if(3B[i]==4v){8g=i;1n}}o(8g)},aL:j(3B,F){1h(l i=0;i<3B.Y;i++){l 4v=3B[i];if(4v.F==F)o(4v)}o(1a)}};f.2D=j(E){c.1V=E;c.5x="fe";c.4s="\\r\\n"};f.2D.u.5w=j(1K){c.1E=1K;c.H=1K.1B.3A;l 1D=c.H.4U[0];l 2r=2B(c.B.3g);c.4T(c.H,2r);c.H.M=c.1V.3f;D(\'O\',c.H).1v(\'3z\',c.B.4S);D(c.H.1j).O(c.1V.4R);l E=c;c.H.1j.aK=j(){E.H.4r="on";E.H=1K.1B.3A};c.H.fd=j(){E.6x()};c.H.aJ=j(){E.6x();E.2x()};c.H.aI=j(){E.6x()};c.H.1j.fc=j(){E.1E.1B.aH.aG=J};c.H.1j.fb=j(){E.1E.1B.aH.aG=J;E.5B(2l.fa.f9("3h"))};if(c.aF){if(D.2A(c.B.3y))c.B.3y(c);c.1V.5v();if(D.2A(c.B.3w))c.B.3w(c);c.5u()}c.aF=R;c.H.4r="on";4u{c.H=1K.1B.3A}4t(e){}};f.2D.u.1C=j(1F,1R){3e(1F){1i f.6t:1i f.6s:l L=c.2N(c.L(),f.6r);if(L){l 3v=L.1z.1z;if(L.1z.6q.Y>1||3v.1r.1o()==f.6p||3v.1r.1o()==f.6o)c.H.2q(1F)}1n;3R:if(1R)c.H.2q(1F,J,1R);V c.H.2q(1F);1n}};f.2D.u.1d=j(){l 4Z=c.1E.1B.3A.4Z;if(4Z!=1a){if(4Z.5A!=2d)o(4Z.5A())}};f.2D.u.6x=j(){c.H.4Z=c.H.3V.4Y()};f.2D.u.5r=j(1D,1Y){1D.f8(1Y.F,1Y.1b)};f.2D.u.8e=j(O){l 1S=c.H.3V.4Y();if(D(1S.5A()).5z(c.B.6w).is(\'*\')){4u{1S.8f(O)}4t(e){}}V{c.5B(O)}};f.2D.u.aE=j(2k,2E){l 1S=c.H.3V.4Y();if(D(1S.5A()).5z(c.B.6w).is(\'*\')){4u{1S.8f(2k+1S.X+2E)}4t(e){}}};f.2D.u.aD=j(){l 1S=c.H.3V.4Y();if(D(1S.5A()).5z(c.B.6w).is(\'*\')){4u{l X=1S.X;c.1C(\'f7\');1S.8f(X)}4t(e){}}};f.2D.u.2x=j(){c.2j=1a};f.2D.u.5y=j(1c,3U){l 1S=c.H.3V.4Y();3U=3U?R:J;1S.f6(1c);1S.aC(3U);1S.4X();1c.4W()};f.2C=j(E){c.1V=E;c.5x="I";c.4s="\\n"};f.2C.u.5w=j(1K){l E=c;c.1E=1K;c.H=1K.at;l 1D=c.H.4U[0];l 2r=2B(c.B.3g);c.4T(c.H,2r);c.H.M=c.1V.3f;D(\'O\',c.H).1v(\'3z\',c.B.4S);c.O(c.1V.4R);c.6v();if(D.2A(c.B.3y))c.B.3y(c);c.1V.5v();D(c.H).3x("3u",c.3u);D(c.H).3x("2x",c.2x);D(c.H).3x("4W",j(){E.6v.f5(E)});if(D.2A(c.B.3w))c.B.3w(c);c.5u()};f.2C.u.O=j(O){if(1q O===\'3Q\'){4u{c.H.4r="aB"}4t(e){};O=O.S(/<em(\\b[^>]*)>/gi,"<i$1>").S(/<\\/em>/gi,"</i>").S(/<3c(\\b[^>]*)>/gi,"<b$1>").S(/<\\/3c>/gi,"</b>");D(c.H.1j).O(O);c.6v()}V o(D(c.H.1j).O())};f.2C.u.1C=j(1F,1R){if(!c.1d())o(J);3e(1F){1i f.6t:1i f.6s:l 1x=c.1d();l 2y=c.1E.1B.2z();l 1Z=2y.1Z;if(1Z.5s=="#X")1Z=1Z.1z;1x=c.2N(1x,f.5t);1Z=c.2N(1Z,f.5t);if(1x&&1x==1Z&&1x.1r.1o()==f.6r){l 3v=1x.1z.1z;if(1x.1z.6q.Y>1||3v.1r.1o()==f.6p||3v.1r.1o()==f.6o)c.H.2q(1F,\'\',1a)}1n;3R:if(1R)c.H.2q(1F,\'\',1R);V c.H.2q(1F,\'\',1a)}l L=c.1d();if(L.1r.1o()==f.3t)c.1C(f.4q,f.P)};f.2C.u.1d=j(){l 2y=c.1E.1B.2z();l 1c=2y.1x;if(1c){if(1c.5s=="#X")o(1c.1z);V o(1c)}V o(1a)};f.2C.u.5r=j(1D,1Y){1D.8c(1Y.F+" {"+1Y.1b+"}",1D.8b.Y)};f.2C.u.3u=j(W){l E=f.2w[c.M];l L=1a;if(W.6l){if(W.1A==66){E.1C(f.8a);o J}if(W.1A==73){E.1C(f.89);o J}}V if(W.1A==13){if(!W.6m){L=E.1d();if(L&&L.1r.1o()==f.5q){W.f4();E.8e(\'<p></p>\')}}}};f.2C.u.2x=j(W){l E=f.2w[c.M];E.2j=1a;l L=1a;if(W.1A==13&&!W.6m){D(E.H.1j).aq(f.88).ap()}if(W.1A!=8&&W.1A!=17&&W.1A!=46&&W.1A!=87&&!W.ao&&!W.6l){L=E.1d();l F=L.1r.1o();if(F=="3c"||F=="b"||F=="em"||F=="i"||F=="3b"||F=="3P"||F=="a")F=L.1z.1r.1o();if(F==f.3t)E.1C(f.4q,f.P)}};f.2C.u.6v=j(){if(c.H.4r=="aB"){4u{c.H.4r="on";c.H.2q("f3",\'\',J)}4t(e){}}};f.2C.u.6k=j(C,G){l G=c.3s.5p(C,G);if(C==\'3r\'&&G.1m){l 2v=c.6j(G.1m);if(2v){c.4p.4Q();l C=2v;c.4p.1X(2v);G.1m=\'\'}V{o}}c.1W+=c.4P.C(C,G,R)};f.2C.u.6j=j(1m){if(/am/.2M(1m))o\'3c\';if(/al/.2M(1m))o\'em\';if(/3b/.2M(1m))o\'3b\';if(/ak/.2M(1m))o\'3P\';o J};f.3S=j(E){c.1V=E;c.5x="I";c.4s="\\r\\n"};f.3S.u.5w=j(1K){c.1E=1K;c.H=1K.1B.3A;l 1D=c.H.4U[0];l 2r=2B(c.B.3g);c.4T(c.H,2r);c.H.M=c.1V.3f;D(\'O\',c.H).1v(\'3z\',c.B.4S);c.H.4r="on";c.O(c.1V.4R);if(D.2A(c.B.3y))c.B.3y(c);c.1V.5v();D(c.H).3x("3u",c.3u);D(c.H).3x("2x",c.2x);if(D.2A(c.B.3w))c.B.3w(c);c.5u()};f.3S.u.1C=j(1F,1R){if(1R)c.H.2q(1F,J,1R);V c.H.2q(1F)};f.3S.u.1d=j(){l 2y=c.1E.1B.2z();l 1c=2y.1x;if(1c){if(1c.5s=="#X")o(1c.1z);V o(1c)}V o(1a)};f.3S.u.5r=j(1D,1Y){1D.8c(1Y.F+" {"+1Y.1b+"}",1D.8b.Y)};f.3S.u.3u=j(W){l E=f.2w[c.M];l 2y=E.1E.1B.2z();8d=2y.f2(0).f1;if(!D(8d).4V(f.6n.6u(","))[0]&&!D(8d).4V(\'li\')&&W.1A!=f.3T.aA&&W.1A!=f.3T.az&&W.1A!=f.3T.ay&&W.1A!=f.3T.ax&&W.1A!=f.3T.aw&&W.1A!=f.3T.av&&W.1A!=f.3T.au)E.1C(f.4q,f.P)};f.3S.u.2x=j(W){l E=f.2w[c.M];E.2j=1a};f.3d=j(E){c.1V=E;c.5x="I";c.4s="\\n"};f.3d.u.5w=j(1K){c.1E=1K;c.H=1K.at;l 1D=c.H.4U[0];l 2r=2B(c.B.3g);c.4T(c.H,2r);c.H.M=c.1V.3f;D(\'O\',c.H).1v(\'3z\',c.B.4S);c.H.4r="on";c.O(c.1V.4R);if(D.2A(c.B.3y))c.B.3y(c);c.1V.5v();D(c.H).3x("3u",c.3u);D(c.H).3x("2x",c.2x);if(D.2A(c.B.3w))c.B.3w(c);c.5u()};f.3d.u.1C=j(1F,1R){if(!c.1d())o(J);3e(1F){1i f.6t:1i f.6s:l 1x=c.1d();l 2y=c.1E.1B.2z();l 1Z=2y.1Z;if(1Z.5s=="#X")1Z=1Z.1z;1x=c.2N(1x,f.5t);1Z=c.2N(1Z,f.5t);if(1x&&1x==1Z&&1x.1r.1o()==f.6r){l 3v=1x.1z.1z;if(1x.1z.6q.Y>1||3v.1r.1o()==f.6p||3v.1r.1o()==f.6o)c.H.2q(1F,\'\',1a)}1n;1i f.as:1i f.ar:c.H.2q(1F,\'\',1a);l 1x=c.1d();l L=c.2N(1x,f.6n);if(L)D(L).f0(D(L).O());1n;3R:if(1R)c.H.2q(1F,\'\',1R);V c.H.2q(1F,\'\',1a)}l L=c.1d();if(L&&L.1r.1o()==f.3t)c.1C(f.4q,f.P)};f.3d.u.1d=j(){l 2y=c.1E.1B.2z();l 1c=2y.1x;if(1c){if(1c.5s=="#X")o(1c.1z);V o(1c)}V o(1a)};f.3d.u.5r=j(1D,1Y){1D.8c(1Y.F+" {"+1Y.1b+"}",1D.8b.Y)};f.3d.u.3u=j(W){l E=f.2w[c.M];if(W.6l){if(W.1A==66){E.1C(f.8a);o J}if(W.1A==73){E.1C(f.89);o J}}};f.3d.u.2x=j(W){l E=f.2w[c.M];E.2j=1a;l L=1a;if(W.1A==13&&!W.6m){D(E.H.1j).aq(f.88).ap();L=E.1d();if(L&&L.1r.1o()==f.5q)E.1C(f.4q,f.P);}if(W.1A==13&&W.6m){E.1C(\'eZ\')}if(W.1A!=8&&W.1A!=17&&W.1A!=46&&W.1A!=87&&!W.ao&&!W.6l){L=E.1d();l F=L.1r.1o();if(F=="3c"||F=="b"||F=="em"||F=="i"||F=="3b"||F=="3P"||F=="a"||F=="3r")F=L.1z.1r.1o();if(F==f.3t||F==f.an)E.1C(f.4q,f.P);}};f.3d.u.6k=j(C,G){l G=c.3s.5p(C,G);if(C==\'3r\'&&G.1m){l 2v=c.6j(G.1m);if(2v){c.4p.4Q();l C=2v;c.4p.1X(2v);G.1m=\'\';if(1q G[\'I\']==\'3Q\')G[\'I\']=G[\'I\'].S(/eY-1m-3r/gi,\'\')}V{o}}c.1W+=c.4P.C(C,G,R)};f.3d.u.6j=j(1m){if(/am/.2M(1m))o\'3c\';if(/al/.2M(1m))o\'em\';if(/3b/.2M(1m))o\'3b\';if(/ak/.2M(1m))o\'3P\';o J};',62,1714,'||||||||||||this|||WYMeditor||||function||var|||return||||||prototype|||||||_options|tag|jQuery|wym|name|attributes|_doc|class|false|match|container|title|div|html||value|true|replace|mode||else|evt|text|length|_Listener|||||||||||null|css|node|selected|type|new|editor|for|case|body|replaceAll|XhtmlSaxListener|style|break|toLowerCase|label|typeof|tagName|xhtml|XhtmlParser|boxHtml|attr|raw|focusNode|input|parentNode|keyCode|contentWindow|_exec|styles|_iframe|cmd|scope|val|dialogHtml|_tags|iframe|Helper|form|result|row|href|options|param|range|key|src|_wym|output|push|oCss|anchorNode|||||||||||state|content|required|undefined|_current_element|Lexer|matches|script|attribute|_selected_image|left|window|_current_item|status|_regexes|_box|execCommand|aCss|only_wym_blocks|button|link|new_tag|INSTANCES|keyup|sel|getSelection|isFunction|eval|WymClassMozilla|WymClassExplorer|right|contains|size|addExitPattern|ul|blockquote|_mode_handlers|start|test|findUp|RegExp|details|addEntryPattern|position|closing|head|fieldset|_open_tags|XmlHelper|ParallelRegex|char|disabled|||||||||||skin|sub|strong|WymClassSafari|switch|_index|editorStyles|Text|tags|table|legend|XhtmlLexer|matched|pattern|top|stylesheet|sType|span|validator|BODY|keydown|ancestor|postInit|bind|preBind|dir|document|arr|str|WymCssParser|LEXER_UNMATCHED|_closing|_insert_|lang|parsed|defaults|inside|xml|sTmp|INDEX|newNode|sup|string|default|WymClassOpera|KEY|toStart|selection|classesItems|parse|x2a|parser||pre|_mode|addPattern|_patterns|baseline||bottom|middle|valign|charoff|justify|center|align|click|doc|find|sBodyHtml|tagname|sClass|oClass|sContainer|sTool|iframeHtml|WymClass|_tag_stack|FORMAT_BLOCK|designMode|_newLine|catch|try|item|trim|rExp|jqexpr|data|dialogStyles|css_settings|object|WymCss|addSpecialPattern|td|textarea|_invokeParser|_case|width|onload|basePath|dialog|sVal|console|helper|pop|_html|direction|addCssRules|styleSheets|parentsOrSelf|focus|select|createRange|caretPos||filter|Ignore|extend|cite|base|init|_stack|count|except|index|alt|tag_attributes|delimiter|close|sUrl|INIT_DIALOG|SKINS|skinPath|CssParser|wymeditor|TH|oContainer|oTool|wym_section|getValidTagAttributes|PRE|addCssRule|nodeName|BLOCKS|listen|bindEvents|initIframe|_class|setFocusToNode|parents|parentElement|paste|elem|_has_title|LEXER_EXIT|z0|after|avoided_tags|th|now_on_tag|colgroup|_tag_attributes|_non_tag|action|special|new_mode|accept|StateStack|_regex|_possible_tag_attributes|next|hidden|get|open|createElement|submitSelector|titleSelector|TITLE|sStamp|dialogImageSelector|DIALOG_LINK|dialogType||update|stringDelimiterRight|stringDelimiterLeft|toggleClass|BLOCKQUOTE|Array|TD|aClasses|wym_dialog|wym_cancel|wym_submit|wym_dialog_type|getTagForStyle|openBlockTag|ctrlKey|shiftKey|MAIN_CONTAINERS|UL|OL|childNodes|LI|OUTDENT|INDENT|join|enableDesignMode|iframeBodySelector|saveCaret|substring|expressions|style_details|_in_style|WymCssStyle|_Lexer|last_tag|skiped_attribute_values|skiped_attributes|addCss|addScript|addComment|getTagReplacements|address|afterParsing|beforeParsing|option|tr|img|col|bdo|abbr|prop|_current_attribute|SingleQuotedAttribute|DoubleQuotedAttribute|LEXER_SPECIAL|normalizeTag|expected_tag|LEXER_ENTER|OpeningTag||_addNonTagBlock|handler|unmatched|while|case_sensitive|regex|tag_defaults|only|valid_attributes|rows|cols|screen|charset|height|meta|icon|shortcut|subsection|section|prev|help|glossary|copyright|contents|chapter|bookmark|appendix|alternate|rel|escape_quotes|_entitiesDiv|mousedown|altSelector|ALT|SRC|srcSelector|SKINS_DEFAULT_CSS|loadSkin|grep|packed|min|pack|jquery|INSERT_HTML|jQueryPath|wymPath|PREVIEW|DIALOG_PASTE|DIALOG_TABLE|DIALOG_IMAGE|dialogFeatures|_element|STRINGS|bFound|firstNode|nodes|aTypes|NAME|CLASS_NAME|TOOL_TITLE|HTML|iframeBasePath|browser|Cancel|Submit|224|BR|ITALIC|BOLD|cssRules|insertRule|startNode|insert|pasteHTML|ret|indexOf|pos|nodeType|feedback_style|parts|split|WymCssFeedbackStyle|WymCssComment|_0|mapHandler|_getClosingTagContent|_insertContentWhenClosingTag|last_tag_opened|block_tags|isBlockTag|_avoiding_tags_implicitly|del|acronym|entity|entities|thead|tfoot|tbody|noscript|circ|_callCloseTagListener|_autoCloseUnclosed|_increaseOpenTagCounter|_callOpenTagListener|Css|Script|Comment|unparsed_character_count|getCurrent|_parser|enter|leave|_labels|default_attributes|default_attributes_and_events|_attributes|_events|readonly|all|media|javascript|http|ltr|toString|innerHTML|_formated_options|tagOptions|postInitDialog|newRow|iCols|iRows|INSERT_IMAGE|HREF|CREATE_LINK|hrefSelector|preInitDialog|responseText|async|url|ajax|found|htmlSelector|wDialog|replaceStrings|DIALOG_BODY|DIALOG_TITLE|JQUERY_PATH|WYM_PATH|CSS_PATH|DIRECTION|hasfocus|htmlValSelector|error|langPath|switchTo|lgt|H6|H5|H4|H3|H2|H1|sName|sContainers|CONTAINERS_ITEMS|CONTAINER_CLASS|CONTAINER_TITLE|CONTAINER_NAME|aContainers|sClasses|CLASSES_ITEMS|CLASS_TITLE|sTools|TOOLS_ITEMS|TOOL_CLASS|TOOL_NAME|aTools|STATUS|IFRAME|CLASSES|CONTAINERS|TOOLS|LOGO|IFRAME_BASE_PATH|WYM_INDEX|SaxListener|preInit|Paste_From_Word|indent|Table|wym_title|Image|Link|wym_classes|wym_containers|wym_tools|wym_iframe|Preview|Unlink|Outdent|Indent|names|super|italic|bold|DIV|metaKey|remove|children|INSERT_UNORDEREDLIST|INSERT_ORDEREDLIST|contentDocument|DELETE|BACKSPACE|DOWN|RIGHT|UP|LEFT|ENTER|off|collapse|unwrap|wrap|_initialized|returnValue|event|onclick|onkeyup|onfocus|findByName|inserted|substr|rep||old|slice|isPhantomNode|expr|addStyleSetting|WymCssStyleDeclaration|WymCssLexer|insertContentAfterClosingTag|fixNestingBeforeOpeningBlockTag|before|inline_tags|isInlineTag|allowStylingTagsAndAttributes|MsoNormal|avoidStylingTagsAndAttributes|closeUnopenedTag|closeUnknownTag|closeBlockTag|openUnknownTag|inlineTag|addContent|getResult|removeBrInPre|nbsp|160|removeEmptyTags|joinRepeatedEntities|replaceNamedEntities|shouldCloseTagAutomatically|tt|small|samp|optgroup|map|kbd|ins|dfn||code|caption|big|area|equiv|image|not|XhtmlValidator|UnquotedAttribute|TagAttributes|counter|autoCloseUnclosedBeforeTagClosing|autoCloseUnclosedBeforeNewOpening|_decreaseOpenTagCounter|ClosingTag|_tag|Listener|addAttributeTokens|addInTagDeclarationTokens|addTagTokens|addCssTokens|addScriptTokens|addCommentTokens|addTokens|unparsed|_reduce|is_match|current|_decodeSpecial|_|_isSpecialMode|__exit|_isModeEnd|LEXER_MATCHED|_dispatchTokens|_getPerlMatchingFlags|Tk7|Tk6|Tk5|Tk4|Tk3|Tk2|Tk1|_untokenizeRegex|_tokenizeRegex|_getCompoundedRegex|subject|getDefaultAttributesAndEventsForTag|getUniqueAttributesAndEventsForTag|getPossibleTagAttributes|validateAttribute|doesAttributeNeedsValidation|getDefaultAttributesAndEventsForTags|isValidTag|parseInt|possible_attributes|rowgroup|rowspan|headers|colspan|axis|summary|border|box|frame|braille|print|projection|multiple|defer|valuetype|usemap|home|rev|hreflang|datetime|submit|reset|file|checked|profile|rtl|polygon|poly|circle|rectangle|rect|shape|coords|designates|keyboard|tabindex|accesskey|language|escapeEntities|escapeOnce|escaped|_fixDoubleEscape|cancelSelector|previewSelector|dialogPreviewSelector|sText|textSelector|dialogPasteSelector|append|summarySelector|sCaption|newCaption|captionSelector||TABLE|colsSelector|rowsSelector|dialogTableSelector|dialogLinkSelector|uniqueStamp|dialogTypeSelector||SKINS_DEFAULT_JS|initSkin|addClass|loadCss|each|appendChild|target||IMG|configureEditorUsingRawCss|skins|computeJqueryPath|computeWymPath|computeBasePath|sData|now|toggleHtml|encloseString|BASE_PATH|bodyHtml|dialogPreviewHtml|dialogPasteHtml|dialogTableHtml|dialogImageHtml|dialogLinkHtml|features|sMessage|statusSelector|STRING|CLASS|insertBefore|dialogFeaturesPreview|TOGGLE_HTML|PASTE|INSERT_TABLE|exec|updateEvent|updateSelector|classSelector|containerSelector|toolSelector|hide|containersItemHtml|containersItems|classesItemHtml|toolsItemHtml|toolsItems|statusHtml|htmlHtml|classesHtml|containersHtml|toolsHtml|logoHtml|wym_dialog_preview|wym_text|wym_dialog_paste|wym_cols|wym_rows|wym_summary|wym_caption|wym_dialog_table|Title|||wym_alt|wym_src|URL|wym_dialog_image|wym_href|wym_dialog_link|xhtml1|DTD|org|www|300|560|resizable|toolbar|titlebar|menubar|wym_html_val|wym_status|wym_html|wym_box|ToggleHtml|Paste|InsertTable|InsertImage|CreateLink|Redo|Undo|InsertUnorderedList|InsertOrderedList|Subscript|Superscript|Italic|Bold|IFRAME_DEFAULT|LANG_DEFAULT_PATH|SKINS_DEFAULT_PATH|apple|InsertLineBreak|replaceWith|startContainer|getRangeAt|styleWithCSS|preventDefault|call|moveToElementText|Cut|addRule|getData|clipboardData|onpaste|onbeforepaste|onbeforedeactivate|className|insertAt|isPhantomString|toUpperCase|end|x7d|x7b|x2e|z1||sa|insertContentBeforeClosingTag|main1|remove_embeded_styles|remove_scripts|remove_comments|fromCharCode|String|gmi|extends|9830|diams|9829|hearts|9827|clubs|9824|spades|9674|loz|9002|rang|9001|8971|rfloor|8970|lfloor|8969|rceil|8968|lceil|8901|sdot|8869|perp|8855|otimes|8853|oplus|8839|supe|8838|sube|8836|nsub|8835|8834|8805|8804|8801|8800|8776||asymp|8773|cong||8764|sim|8756||there4|8747|int|8746|cup|8745|cap|8744|8743|and|8736|ang|8734|infin|8733|8730|radic|8727|lowast|8722|minus|8721|sum|8719|prod|8715|8713|notin|8712|isin|8711|nabla|8709|empty|8707|exist|8706|part|8704|forall|||||||8660|hArr|8659|dArr|8658|rArr|8657|uArr|8656|lArr|8629|crarr|8596|harr|8595|darr|8594|rarr|8593|uarr||8592|larr|8501|alefsym|8482|trade|8476|real|8472|weierp|8465|8364|euro|8260|frasl|8254|oline|8250|rsaquo|8249|lsaquo|8243|Prime|8242|prime|8240|permil|8230|hellip|8226|bull|8225|Dagger|8224|dagger|8222|bdquo|8221|rdquo|8220|ldquo|8218|sbquo|8217|rsquo|8216|lsquo||8212|||mdash|8211|ndash|8207|rlm|8206||lrm|8205|zwj|8204||zwnj|8201|thinsp|8195|emsp|8194|ensp|982|piv|978|upsih|977|thetasym|969|omega|968|psi|967|chi|966|phi|965|upsilon|964|tau|963|sigma|962|sigmaf|961|rho|960|959|omicron|958|xi|957|956|955|lambda|954|kappa|953|iota|952|theta|951|eta|950|zeta|949|epsilon|948|delta|947|gamma|946|beta|945|alpha|937||Omega|936|Psi|935|Chi|934|Phi|933|Upsilon|932|Tau|931|Sigma|929|Rho|928|Pi|927|Omicron|926|Xi|925|Nu|924|Mu|923|Lambda|922|Kappa|921|Iota|920|Theta|919|Eta|918|Zeta|917|Epsilon|916|Delta|915|Gamma|914|Beta|913|Alpha|732|tilde|710|402|fnof|376|Yuml|353|scaron|352|Scaron|339|oelig|338|OElig|255|yuml|254|thorn|253|yacute|252|uuml|251|ucirc|250|uacute|249|ugrave|248|oslash|247|divide|246|ouml|245|otilde|244|ocirc|243|oacute|242|ograve|241|ntilde|240|eth|239|iuml|238|icirc|237|iacute|236|igrave|235|euml|234|ecirc|233|eacute|232||egrave|231|ccedil||230|aelig|229|aring|228|auml|227|atilde|226|acirc|225|aacute|agrave|223|szlig|222|THORN|221|Yacute|220|Uuml|219|Ucirc|218|Uacute|217|Ugrave|216|Oslash|215|times|214|Ouml|213|Otilde|212|Ocirc|211|Oacute|210|Ograve|209|Ntilde|208|ETH|207|Iuml|206|Icirc|205|Iacute|204|Igrave|203|Euml|202|Ecirc|201|Eacute|200|Egrave||199|Ccedil|198|AElig|197|Aring|196|Auml|195|Atilde|194||Acirc|193|Aacute|192|Agrave|191|iquest|190|frac34|189|frac12|188|frac14|187|raquo|186|ordm|185|sup1|184|cedil|183|middot|182|para|181|micro|180|acute|179|sup3|178|sup2|177|plusmn|176|deg|175|macr|174|reg|173|shy|172|171||laquo|170|ordf||169|copy|168|uml|167||sect|166|brvbar||165||yen|164|curren|163|pound|162|cent|161|iexcl|last_tag_attributes|com|microsoft|schemas|urn|_current_match|_last_match|_matches|boolean|concat|events|continue|groups|none|rules|vsides|rhs|lhs|hsides|below|above|void|cellspacing|cellpadding|aural|handheld|tv|tty|vbs|vbscript|jscript|ecmascript|ref|standby|declare|codetype|codebase|classid|archive|scheme|cookie|set|refresh||expires||speech|radio|password||checkbox|maxlength|longdesc|ismap|xmlns|post|method|enctype|nohref|onmouseup|onmouseout|onmouseover|onmousemove|onmousedown|ondblclick|mouse|onkeypress|onkeydown|frameset|onblur|onselect|onreset|onsubmit|onchange|onunload|core|charAt|parseAttributes|039|quot|textContent|shift|formated_options|amp|CDATA|cdataSection|contentTag|insertCell|insertRow|createCaption|newCol|opener|wym_skin_|ownerDocument|computeCssPath|addRange|selectNodeContents|getTime|Date|toggle|write|parsing||replaceChild|removeAttr|removeChild|firstChild|ready|blur|wym_box_|safari|opera|mozilla|msie|wymeditors|Number_Of_Cols|Number_Of_Rows|Summary|Caption|Alternative_Text|dtd|strict|TR|w3|EN|Strict|XHTML|W3C|PUBLIC|DOCTYPE|yes|scrollbars|wymupdate|iframeSelector|classesSelector|containersSelector|toolsListSelector|toolsSelector|boxSelector|Source_Code|Status|wym_classes_|Classes|wym_containers_th|Table_Header|wym_containers_blockquote|Blockquote|wym_containers_pre|Preformatted|wym_containers_h6|Heading_6|wym_containers_h5|Heading_5|wym_containers_h4|Heading_4|wym_containers_h3|Heading_3|wym_containers_h2|Heading_2|wym_containers_h1|Heading_1|wym_containers_p|Paragraph|Containers|wym_tools_preview|wym_tools_html|wym_tools_paste|wym_tools_table|wym_tools_image|wym_tools_unlink|wym_tools_link|wym_tools_redo|wym_tools_undo|wym_tools_outdent|wym_tools_indent|wym_tools_unordered_list|Unordered_List|wym_tools_ordered_list|Ordered_List|wym_tools_subscript|wym_tools_superscript|wym_tools_emphasis|Emphasis|wym_tools_strong|Strong|Tools|parent|wymiframe|wym_wymeditor_link|wym_area_bottom|wym_area_main|wym_area_right|wym_area_left|wym_area_top|TEXT|ATTRIBUTE|ELEMENT|NODE|CURSOR|HOME|END|UNLINK|FormatBlock|InsertHTML|Wym_Dialog_Body|Wym_Dialog_Title|Wym_Status|Wym_Iframe|Wym_Html|Wym_Container_Class|Wym_Containers_Title|Wym_Container_Name|Wym_Containers_Items|Wym_Containers|Wym_Class_Title|Wym_Class_Name|Wym_Classes_Items|Wym_Classes|Wym_Tool_Class|Wym_Tool_Title|Wym_Tool_Name|Wym_Tools_Items||Wym_Tools|Wym_Logo|Wym_Direction|Wym_Jquery_Path|Wym_Iframe_Base_Path|Wym_Wym_Path|Wym_Css_Path|Wym_Base_Path|wym_index|Wym_Index|rc1|VERSION|profileEnd|trace|timeEnd|time|groupEnd|group|dirxml|assert|warn|info|debug|log|firebug'.split('|'),0,{})) diff --git a/gstudio/static/gstudio/js/wymeditor/lang/bg.js b/gstudio/static/gstudio/js/wymeditor/lang/bg.js new file mode 100644 index 0000000..576bca5 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/bg.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['bg'] = { + Strong: 'Получер', + Emphasis: 'Курсив', + Superscript: 'Горен индекс', + Subscript: 'Долен индекс', + Ordered_List: 'Подреден списък', + Unordered_List: 'Неподреден списък', + Indent: 'Блок навътре', + Outdent: 'Блок навън', + Undo: 'Стъпка назад', + Redo: 'Стъпка напред', + Link: 'Създай хипервръзка', + Unlink: 'Премахни хипервръзката', + Image: 'Изображение', + Table: 'Таблица', + HTML: 'HTML', + Paragraph: 'Абзац', + Heading_1: 'Заглавие 1', + Heading_2: 'Заглавие 2', + Heading_3: 'Заглавие 3', + Heading_4: 'Заглавие 4', + Heading_5: 'Заглавие 5', + Heading_6: 'Заглавие 6', + Preformatted: 'Преформатиран', + Blockquote: 'Цитат', + Table_Header: 'Заглавие на таблицата', + URL: 'URL', + Title: 'Заглавие', + Alternative_Text: 'Алтернативен текст', + Caption: 'Етикет', + Summary: 'Общо', + Number_Of_Rows: 'Брой редове', + Number_Of_Cols: 'Брой колони', + Submit: 'Изпрати', + Cancel: 'Отмени', + Choose: 'Затвори', + Preview: 'Предварителен преглед', + Paste_From_Word: 'Вмъкни от MS WORD', + Tools: 'Инструменти', + Containers: 'Контейнери', + Classes: 'Класове', + Status: 'Статус', + Source_Code: 'Източник, код' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/ca.js b/gstudio/static/gstudio/js/wymeditor/lang/ca.js new file mode 100644 index 0000000..c342406 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/ca.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['ca'] = { + Strong: 'Ressaltar', + Emphasis: 'Emfatitzar', + Superscript: 'Superindex', + Subscript: 'Subindex', + Ordered_List: 'Llistat ordenat', + Unordered_List: 'Llistat sense ordenar', + Indent: 'Indentat', + Outdent: 'Sense indentar', + Undo: 'Desfer', + Redo: 'Refer', + Link: 'Enllaçar', + Unlink: 'Eliminar enllaç', + Image: 'Imatge', + Table: 'Taula', + HTML: 'HTML', + Paragraph: 'Paràgraf', + Heading_1: 'Capçalera 1', + Heading_2: 'Capçalera 2', + Heading_3: 'Capçalera 3', + Heading_4: 'Capçalera 4', + Heading_5: 'Capçalera 5', + Heading_6: 'Capçalera 6', + Preformatted: 'Pre-formatejat', + Blockquote: 'Cita', + Table_Header: 'Capçalera de la taula', + URL: 'URL', + Title: 'Títol', + Alternative_Text: 'Text alternatiu', + Caption: 'Llegenda', + Summary: 'Summary', + Number_Of_Rows: 'Nombre de files', + Number_Of_Cols: 'Nombre de columnes', + Submit: 'Enviar', + Cancel: 'Cancel·lar', + Choose: 'Triar', + Preview: 'Vista prèvia', + Paste_From_Word: 'Pegar des de Word', + Tools: 'Eines', + Containers: 'Contenidors', + Classes: 'Classes', + Status: 'Estat', + Source_Code: 'Codi font' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/cs.js b/gstudio/static/gstudio/js/wymeditor/lang/cs.js new file mode 100644 index 0000000..3939d71 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/cs.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['cs'] = { + Strong: 'Tučné', + Emphasis: 'Kurzíva', + Superscript: 'Horní index', + Subscript: 'Dolní index', + Ordered_List: 'Číslovaný seznam', + Unordered_List: 'Nečíslovaný seznam', + Indent: 'Zvětšit odsazení', + Outdent: 'Zmenšit odsazení', + Undo: 'Zpět', + Redo: 'Znovu', + Link: 'Vytvořit odkaz', + Unlink: 'Zrušit odkaz', + Image: 'Obrázek', + Table: 'Tabulka', + HTML: 'HTML', + Paragraph: 'Odstavec', + Heading_1: 'Nadpis 1. úrovně', + Heading_2: 'Nadpis 2. úrovně', + Heading_3: 'Nadpis 3. úrovně', + Heading_4: 'Nadpis 4. úrovně', + Heading_5: 'Nadpis 5. úrovně', + Heading_6: 'Nadpis 6. úrovně', + Preformatted: 'Předformátovaný text', + Blockquote: 'Citace', + Table_Header: 'Hlavičková buňka tabulky', + URL: 'Adresa', + Title: 'Text po najetí myší', + Alternative_Text: 'Text pro případ nezobrazení obrázku', + Caption: 'Titulek tabulky', + Summary: 'Shrnutí obsahu', + Number_Of_Rows: 'Počet řádek', + Number_Of_Cols: 'Počet sloupců', + Submit: 'Vytvořit', + Cancel: 'Zrušit', + Choose: 'Vybrat', + Preview: 'Náhled', + Paste_From_Word: 'Vložit z Wordu', + Tools: 'Nástroje', + Containers: 'Typy obsahu', + Classes: 'Třídy', + Status: 'Stav', + Source_Code: 'Zdrojový kód' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/cy.js b/gstudio/static/gstudio/js/wymeditor/lang/cy.js new file mode 100644 index 0000000..7d15b79 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/cy.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['cy'] = {
+ Strong: 'Bras',
+ Emphasis: 'Italig',
+ Superscript: 'Uwchsgript',
+ Subscript: 'Is-sgript',
+ Ordered_List: 'Rhestr mewn Trefn',
+ Unordered_List: 'Pwyntiau Bwled',
+ Indent: 'Mewnoli',
+ Outdent: 'Alloli',
+ Undo: 'Dadwneud',
+ Redo: 'Ailwneud',
+ Link: 'Cysylltu',
+ Unlink: 'Datgysylltu',
+ Image: 'Delwedd',
+ Table: 'Tabl',
+ HTML: 'HTML',
+ Paragraph: 'Paragraff',
+ Heading_1: 'Pennawd 1',
+ Heading_2: 'Pennawd 2',
+ Heading_3: 'Pennawd 3',
+ Heading_4: 'Pennawd 4',
+ Heading_5: 'Pennawd 5',
+ Heading_6: 'Pennawd 6',
+ Preformatted: 'Rhagfformat',
+ Blockquote: 'Bloc Dyfyniad',
+ Table_Header: 'Pennyn Tabl',
+ URL: 'URL',
+ Title: 'Teitl',
+ Alternative_Text: 'Testun Amgen',
+ Caption: 'Pennawd',
+ Summary: 'Crynodeb',
+ Number_Of_Rows: 'Nifer y rhesi',
+ Number_Of_Cols: 'Nifer y colofnau',
+ Submit: 'Anfon',
+ Cancel: 'Diddymu',
+ Choose: 'Dewis',
+ Preview: 'Rhagolwg',
+ Paste_From_Word: 'Gludo o Word',
+ Tools: 'Offer',
+ Containers: 'Cynhwysyddion',
+ Classes: 'Dosbarthiadau',
+ Status: 'Statws',
+ Source_Code: 'Cod ffynhonnell'
+};
+
diff --git a/gstudio/static/gstudio/js/wymeditor/lang/de.js b/gstudio/static/gstudio/js/wymeditor/lang/de.js new file mode 100644 index 0000000..a1e01e1 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/de.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['de'] = { + Strong: 'Fett', + Emphasis: 'Kursiv', + Superscript: 'Text hochstellen', + Subscript: 'Text tiefstellen', + Ordered_List: 'Geordnete Liste einfügen', + Unordered_List: 'Ungeordnete Liste einfügen', + Indent: 'Einzug erhöhen', + Outdent: 'Einzug vermindern', + Undo: 'Befehle rückgängig machen', + Redo: 'Befehle wiederherstellen', + Link: 'Hyperlink einfügen', + Unlink: 'Hyperlink entfernen', + Image: 'Bild einfügen', + Table: 'Tabelle einfügen', + HTML: 'HTML anzeigen/verstecken', + Paragraph: 'Absatz', + Heading_1: 'Überschrift 1', + Heading_2: 'Überschrift 2', + Heading_3: 'Überschrift 3', + Heading_4: 'Überschrift 4', + Heading_5: 'Überschrift 5', + Heading_6: 'Überschrift 6', + Preformatted: 'Vorformatiert', + Blockquote: 'Zitat', + Table_Header: 'Tabellenüberschrift', + URL: 'URL', + Title: 'Titel', + Alternative_Text: 'Alternativer Text', + Caption: 'Tabellenüberschrift', + Summary: 'Summary', + Number_Of_Rows: 'Anzahl Zeilen', + Number_Of_Cols: 'Anzahl Spalten', + Submit: 'Absenden', + Cancel: 'Abbrechen', + Choose: 'Auswählen', + Preview: 'Vorschau', + Paste_From_Word: 'Aus Word einfügen', + Tools: 'Werkzeuge', + Containers: 'Inhaltstyp', + Classes: 'Klassen', + Status: 'Status', + Source_Code: 'Quellcode' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/en.js b/gstudio/static/gstudio/js/wymeditor/lang/en.js new file mode 100644 index 0000000..1e351e5 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/en.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['en'] = { + Strong: 'Strong', + Emphasis: 'Emphasis', + Superscript: 'Superscript', + Subscript: 'Subscript', + Ordered_List: 'Ordered List', + Unordered_List: 'Unordered List', + Indent: 'Indent', + Outdent: 'Outdent', + Undo: 'Undo', + Redo: 'Redo', + Link: 'Link', + Unlink: 'Unlink', + Image: 'Image', + Table: 'Table', + HTML: 'HTML', + Paragraph: 'Paragraph', + Heading_1: 'Heading 1', + Heading_2: 'Heading 2', + Heading_3: 'Heading 3', + Heading_4: 'Heading 4', + Heading_5: 'Heading 5', + Heading_6: 'Heading 6', + Preformatted: 'Preformatted', + Blockquote: 'Blockquote', + Table_Header: 'Table Header', + URL: 'URL', + Title: 'Title', + Alternative_Text: 'Alternative text', + Caption: 'Caption', + Summary: 'Summary', + Number_Of_Rows: 'Number of rows', + Number_Of_Cols: 'Number of cols', + Submit: 'Submit', + Cancel: 'Cancel', + Choose: 'Choose', + Preview: 'Preview', + Paste_From_Word: 'Paste from Word', + Tools: 'Tools', + Containers: 'Containers', + Classes: 'Classes', + Status: 'Status', + Source_Code: 'Source code' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/es.js b/gstudio/static/gstudio/js/wymeditor/lang/es.js new file mode 100644 index 0000000..cdb03c1 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/es.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['es'] = { + Strong: 'Resaltar', + Emphasis: 'Enfatizar', + Superscript: 'Superindice', + Subscript: 'Subindice', + Ordered_List: 'Lista ordenada', + Unordered_List: 'Lista sin ordenar', + Indent: 'Indentado', + Outdent: 'Sin indentar', + Undo: 'Deshacer', + Redo: 'Rehacer', + Link: 'Enlazar', + Unlink: 'Eliminar enlace', + Image: 'Imagen', + Table: 'Tabla', + HTML: 'HTML', + Paragraph: 'Párrafo', + Heading_1: 'Cabecera 1', + Heading_2: 'Cabecera 2', + Heading_3: 'Cabecera 3', + Heading_4: 'Cabecera 4', + Heading_5: 'Cabecera 5', + Heading_6: 'Cabecera 6', + Preformatted: 'Preformateado', + Blockquote: 'Cita', + Table_Header: 'Cabecera de la tabla', + URL: 'URL', + Title: 'Título', + Alternative_Text: 'Texto alternativo', + Caption: 'Leyenda', + Summary: 'Summary', + Number_Of_Rows: 'Número de filas', + Number_Of_Cols: 'Número de columnas', + Submit: 'Enviar', + Cancel: 'Cancelar', + Choose: 'Seleccionar', + Preview: 'Vista previa', + Paste_From_Word: 'Pegar desde Word', + Tools: 'Herramientas', + Containers: 'Contenedores', + Classes: 'Clases', + Status: 'Estado', + Source_Code: 'Código fuente' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/fa.js b/gstudio/static/gstudio/js/wymeditor/lang/fa.js new file mode 100644 index 0000000..9d70fcb --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/fa.js @@ -0,0 +1,46 @@ +//Translation To Persian: Ghassem Tofighi (http://ght.ir) +WYMeditor.STRINGS['fa'] = { + Strong: 'پررنگ',//Strong + Emphasis: 'ایتالیک',//Emphasis + Superscript: 'بالانويس ',//Superscript + Subscript: 'زيرنويس',//Subscript + Ordered_List: 'لیست مرتب',//Ordered List + Unordered_List: 'لیست نامرتب',//Unordered List + Indent: 'افزودن دندانه',//Indent + Outdent: 'کاهش دندانه',//Outdent + Undo: 'واگردانی',//Undo + Redo: 'تکرار',//Redo + Link: 'ساختن پیوند',//Link + Unlink: 'برداشتن پیوند',//Unlink + Image: 'تصویر',//Image + Table: 'جدول',//Table + HTML: 'HTML',//HTML + Paragraph: 'پاراگراف',//Paragraph + Heading_1: 'سرتیتر ۱',//Heading 1 + Heading_2: 'سرتیتر ۲',//Heading 2 + Heading_3: 'سرتیتر ۳',//Heading 3 + Heading_4: 'سرتیتر ۴',//Heading 4 + Heading_5: 'سرتیتر ۵',//Heading 5 + Heading_6: 'سرتیتر ۶',//Heading 6 + Preformatted: 'قالب آماده',//Preformatted + Blockquote: 'نقل قول',//Blockquote + Table_Header: 'سرجدول',//Table Header + URL: 'آدرس اینترنتی',//URL + Title: 'عنوان',//Title + Alternative_Text: 'متن جایگزین',//Alternative text + Caption: 'عنوان',//Caption + Summary: 'Summary', + Number_Of_Rows: 'تعداد سطرها',//Number of rows + Number_Of_Cols: 'تعداد ستونها',//Number of cols + Submit: 'فرستادن',//Submit + Cancel: 'لغو',//Cancel + Choose: 'انتخاب',//Choose + Preview: 'پیشنمایش',//Preview + Paste_From_Word: 'انتقال از ورد',//Paste from Word + Tools: 'ابزار',//Tools + Containers: 'قالبها',//Containers + Classes: 'کلاسها',//Classes + Status: 'وضعیت',//Status + Source_Code: 'کد مبدأ'//Source code +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/fi.js b/gstudio/static/gstudio/js/wymeditor/lang/fi.js new file mode 100644 index 0000000..fe1eab4 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/fi.js @@ -0,0 +1,44 @@ +WYMeditor.STRINGS['fi'] = { + Strong: 'Lihavoitu', + Emphasis: 'Korostus', + Superscript: 'Yläindeksi', + Subscript: 'Alaindeksi', + Ordered_List: 'Numeroitu lista', + Unordered_List: 'Luettelomerkit', + Indent: 'Suurenna sisennystä', + Outdent: 'Pienennä sisennystä', + Undo: 'Kumoa', + Redo: 'Toista', + Link: 'Linkitä', + Unlink: 'Poista linkitys', + Image: 'Kuva', + Table: 'Taulukko', + HTML: 'HTML', + Paragraph: 'Kappale', + Heading_1: 'Otsikko 1', + Heading_2: 'Otsikko 2', + Heading_3: 'Otsikko 3', + Heading_4: 'Otsikko 4', + Heading_5: 'Otsikko 5', + Heading_6: 'Otsikko 6', + Preformatted: 'Esimuotoilu', + Blockquote: 'Sitaatti', + Table_Header: 'Taulukon otsikko', + URL: 'URL', + Title: 'Otsikko', + Alternative_Text: 'Vaihtoehtoinen teksti', + Caption: 'Kuvateksti', + Summary: 'Yhteenveto', + Number_Of_Rows: 'Rivien määrä', + Number_Of_Cols: 'Palstojen määrä', + Submit: 'Lähetä', + Cancel: 'Peruuta', + Choose: 'Valitse', + Preview: 'Esikatsele', + Paste_From_Word: 'Tuo Wordista', + Tools: 'Työkalut', + Containers: 'Muotoilut', + Classes: 'Luokat', + Status: 'Tila', + Source_Code: 'Lähdekoodi' +}; diff --git a/gstudio/static/gstudio/js/wymeditor/lang/fr.js b/gstudio/static/gstudio/js/wymeditor/lang/fr.js new file mode 100644 index 0000000..9b6deb9 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/fr.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['fr'] = { + Strong: 'Mise en évidence', + Emphasis: 'Emphase', + Superscript: 'Exposant', + Subscript: 'Indice', + Ordered_List: 'Liste Ordonnée', + Unordered_List: 'Liste Non-Ordonnée', + Indent: 'Imbriqué', + Outdent: 'Non-imbriqué', + Undo: 'Annuler', + Redo: 'Rétablir', + Link: 'Lien', + Unlink: 'Supprimer le Lien', + Image: 'Image', + Table: 'Tableau', + HTML: 'HTML', + Paragraph: 'Paragraphe', + Heading_1: 'Titre 1', + Heading_2: 'Titre 2', + Heading_3: 'Titre 3', + Heading_4: 'Titre 4', + Heading_5: 'Titre 5', + Heading_6: 'Titre 6', + Preformatted: 'Pré-formatté', + Blockquote: 'Citation', + Table_Header: 'Cellule de titre', + URL: 'URL', + Title: 'Titre', + Alternative_Text: 'Texte alternatif', + Caption: 'Légende', + Summary: 'Résumé', + Number_Of_Rows: 'Nombre de lignes', + Number_Of_Cols: 'Nombre de colonnes', + Submit: 'Envoyer', + Cancel: 'Annuler', + Choose: 'Choisir', + Preview: 'Prévisualisation', + Paste_From_Word: 'Copier depuis Word', + Tools: 'Outils', + Containers: 'Type de texte', + Classes: 'Type de contenu', + Status: 'Infos', + Source_Code: 'Code source' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/gl.js b/gstudio/static/gstudio/js/wymeditor/lang/gl.js new file mode 100644 index 0000000..d4786b8 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/gl.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['gl'] = { + Strong: 'Moita énfase', + Emphasis: 'Énfase', + Superscript: 'Superíndice', + Subscript: 'Subíndice', + Ordered_List: 'Lista ordenada', + Unordered_List: 'Lista sen ordenar', + Indent: 'Aniñar', + Outdent: 'Desaniñar', + Undo: 'Desfacer', + Redo: 'Refacer', + Link: 'Ligazón', + Unlink: 'Desligar', + Image: 'Imaxe', + Table: 'Táboa', + HTML: 'HTML', + Paragraph: 'Parágrafo', + Heading_1: 'Título 1', + Heading_2: 'Título 2', + Heading_3: 'Título 3', + Heading_4: 'Título 4', + Heading_5: 'Título 5', + Heading_6: 'Título 6', + Preformatted: 'Preformatado', + Blockquote: 'Cita en parágrafo', + Table_Header: 'Cabeceira da táboa', + URL: 'URL', + Title: 'Título', + Alternative_Text: 'Texto alternativo', + Caption: 'Título', + Summary: 'Resumo', + Number_Of_Rows: 'Número de filas', + Number_Of_Cols: 'Número de columnas', + Submit: 'Enviar', + Cancel: 'Cancelar', + Choose: 'Escoller', + Preview: 'Previsualizar', + Paste_From_Word: 'Colar dende Word', + Tools: 'Ferramentas', + Containers: 'Contenedores', + Classes: 'Clases', + Status: 'Estado', + Source_Code: 'Código fonte' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/he.js b/gstudio/static/gstudio/js/wymeditor/lang/he.js new file mode 100644 index 0000000..97c9675 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/he.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['he'] = { + Strong: 'חזק', + Emphasis: 'מובלט', + Superscript: 'כתב עילי', + Subscript: 'כתב תחתי', + Ordered_List: 'רשימה ממוספרת', + Unordered_List: 'רשימה לא ממוספרת', + Indent: 'הזחה פנימה', + Outdent: 'הזחה החוצה', + Undo: 'בטל פעולה', + Redo: 'בצע מחדש פעולה', + Link: 'קישור', + Unlink: 'בטל קישור', + Image: 'תמונה', + Table: 'טבלה', + HTML: 'קוד HTML', + Paragraph: 'פסקה', + Heading_1: 'כותרת 1 ; תג <h1>', + Heading_2: 'כותרת 2 ; תג <h2>', + Heading_3: 'כותרת 3 ; תג <h3>', + Heading_4: 'כותרת 4 ; תג <h4>', + Heading_5: 'כותרת 5 ; תג <h5>', + Heading_6: 'כותרת 6 ; תג <h6>', + Preformatted: 'משמר רווחים', + Blockquote: 'ציטוט', + Table_Header: 'כותרת טבלה', + URL: 'קישור (URL)', + Title: 'כותרת', + Alternative_Text: 'טקסט חלופי', + Caption: 'כותרת', + Summary: 'סיכום', + Number_Of_Rows: 'מספר שורות', + Number_Of_Cols: 'מספר טורים', + Submit: 'שלח', + Cancel: 'בטל', + Choose: 'בחר', + Preview: 'תצוגה מקדימה', + Paste_From_Word: 'העתק מ-Word', + Tools: 'כלים', + Containers: 'מיכלים', + Classes: 'מחלקות', + Status: 'מצב', + Source_Code: 'קוד מקור' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/hr.js b/gstudio/static/gstudio/js/wymeditor/lang/hr.js new file mode 100644 index 0000000..193e31a --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/hr.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['hr'] = { + Strong: 'Podebljano', + Emphasis: 'Naglašeno', + Superscript: 'Iznad', + Subscript: 'Ispod', + Ordered_List: 'Pobrojana lista', + Unordered_List: 'Nepobrojana lista', + Indent: 'Uvuci', + Outdent: 'Izvuci', + Undo: 'Poništi promjenu', + Redo: 'Ponovno promjeni', + Link: 'Hiperveza', + Unlink: 'Ukloni hipervezu', + Image: 'Slika', + Table: 'Tablica', + HTML: 'HTML', + Paragraph: 'Paragraf', + Heading_1: 'Naslov 1', + Heading_2: 'Naslov 2', + Heading_3: 'Naslov 3', + Heading_4: 'Naslov 4', + Heading_5: 'Naslov 5', + Heading_6: 'Naslov 6', + Preformatted: 'Unaprijed formatirano', + Blockquote: 'Citat', + Table_Header: 'Zaglavlje tablice', + URL: 'URL', + Title: 'Naslov', + Alternative_Text: 'Alternativni tekst', + Caption: 'Zaglavlje', + Summary: 'Sažetak', + Number_Of_Rows: 'Broj redova', + Number_Of_Cols: 'Broj kolona', + Submit: 'Snimi', + Cancel: 'Odustani', + Choose: 'Izaberi', + Preview: 'Pregled', + Paste_From_Word: 'Zalijepi iz Word-a', + Tools: 'Alati', + Containers: 'Kontejneri', + Classes: 'Klase', + Status: 'Status', + Source_Code: 'Izvorni kod' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/hu.js b/gstudio/static/gstudio/js/wymeditor/lang/hu.js new file mode 100644 index 0000000..a8cdbc6 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/hu.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['hu'] = { + Strong: 'Félkövér', + Emphasis: 'Kiemelt', + Superscript: 'Felső index', + Subscript: 'Alsó index', + Ordered_List: 'Rendezett lista', + Unordered_List: 'Rendezetlen lista', + Indent: 'Bekezdés', + Outdent: 'Bekezdés törlése', + Undo: 'Visszavon', + Redo: 'Visszaállít', + Link: 'Link', + Unlink: 'Link törlése', + Image: 'Kép', + Table: 'Tábla', + HTML: 'HTML', + Paragraph: 'Bekezdés', + Heading_1: 'Címsor 1', + Heading_2: 'Címsor 2', + Heading_3: 'Címsor 3', + Heading_4: 'Címsor 4', + Heading_5: 'Címsor 5', + Heading_6: 'Címsor 6', + Preformatted: 'Előformázott', + Blockquote: 'Idézet', + Table_Header: 'Tábla Fejléc', + URL: 'Webcím', + Title: 'Megnevezés', + Alternative_Text: 'Alternatív szöveg', + Caption: 'Fejléc', + Summary: 'Summary', + Number_Of_Rows: 'Sorok száma', + Number_Of_Cols: 'Oszlopok száma', + Submit: 'Elküld', + Cancel: 'Mégsem', + Choose: 'Választ', + Preview: 'Előnézet', + Paste_From_Word: 'Másolás Word-ból', + Tools: 'Eszközök', + Containers: 'Tartalmak', + Classes: 'Osztályok', + Status: 'Állapot', + Source_Code: 'Forráskód' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/it.js b/gstudio/static/gstudio/js/wymeditor/lang/it.js new file mode 100644 index 0000000..ca632a9 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/it.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['it'] = { + Strong: 'Grassetto', + Emphasis: 'Corsetto', + Superscript: 'Apice', + Subscript: 'Pedice', + Ordered_List: 'Lista Ordinata', + Unordered_List: 'Lista Puntata', + Indent: 'Indenta', + Outdent: 'Caccia', + Undo: 'Indietro', + Redo: 'Avanti', + Link: 'Inserisci Link', + Unlink: 'Togli Link', + Image: 'Inserisci Immagine', + Table: 'Inserisci Tabella', + HTML: 'HTML', + Paragraph: 'Paragrafo', + Heading_1: 'Heading 1', + Heading_2: 'Heading 2', + Heading_3: 'Heading 3', + Heading_4: 'Heading 4', + Heading_5: 'Heading 5', + Heading_6: 'Heading 6', + Preformatted: 'Preformattato', + Blockquote: 'Blockquote', + Table_Header: 'Header Tabella', + URL: 'Indirizzo', + Title: 'Titolo', + Alternative_Text: 'Testo Alternativo', + Caption: 'Caption', + Summary: 'Summary', + Number_Of_Rows: 'Numero di Righe', + Number_Of_Cols: 'Numero di Colonne', + Submit: 'Invia', + Cancel: 'Cancella', + Choose: 'Scegli', + Preview: 'Anteprima', + Paste_From_Word: 'Incolla', + Tools: 'Tools', + Containers: 'Contenitori', + Classes: 'Classi', + Status: 'Stato', + Source_Code: 'Codice Sorgente' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/nb.js b/gstudio/static/gstudio/js/wymeditor/lang/nb.js new file mode 100644 index 0000000..7573b78 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/nb.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['nb'] = { + Strong: 'Fet', + Emphasis: 'Uthevet', + Superscript: 'Opphøyet', + Subscript: 'Nedsenket', + Ordered_List: 'Nummerert liste', + Unordered_List: 'Punktliste', + Indent: 'Rykk inn', + Outdent: 'Rykk ut', + Undo: 'Angre', + Redo: 'Gjenta', + Link: 'Lenke', + Unlink: 'Ta bort lenken', + Image: 'Bilde', + Table: 'Tabell', + HTML: 'HTML', + Paragraph: 'Avsnitt', + Heading_1: 'Overskrift 1', + Heading_2: 'Overskrift 2', + Heading_3: 'Overskrift 3', + Heading_4: 'Overskrift 4', + Heading_5: 'Overskrift 5', + Heading_6: 'Overskrift 6', + Preformatted: 'Preformatert', + Blockquote: 'Sitat', + Table_Header: 'Tabelloverskrift', + URL: 'URL', + Title: 'Tittel', + Alternative_Text: 'Alternativ tekst', + Caption: 'Overskrift', + Summary: 'Sammendrag', + Number_Of_Rows: 'Antall rader', + Number_Of_Cols: 'Antall kolonner', + Submit: 'Ok', + Cancel: 'Avbryt', + Choose: 'Velg', + Preview: 'Forhåndsvis', + Paste_From_Word: 'Lim inn fra Word', + Tools: 'Verktøy', + Containers: 'Formatering', + Classes: 'Klasser', + Status: 'Status', + Source_Code: 'Kildekode' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/nl.js b/gstudio/static/gstudio/js/wymeditor/lang/nl.js new file mode 100644 index 0000000..cdfa21c --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/nl.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['nl'] = { + Strong: 'Sterk benadrukken', + Emphasis: 'Benadrukken', + Superscript: 'Bovenschrift', + Subscript: 'Onderschrift', + Ordered_List: 'Geordende lijst', + Unordered_List: 'Ongeordende lijst', + Indent: 'Inspringen', + Outdent: 'Terugspringen', + Undo: 'Ongedaan maken', + Redo: 'Opnieuw uitvoeren', + Link: 'Linken', + Unlink: 'Ontlinken', + Image: 'Afbeelding', + Table: 'Tabel', + HTML: 'HTML', + Paragraph: 'Paragraaf', + Heading_1: 'Kop 1', + Heading_2: 'Kop 2', + Heading_3: 'Kop 3', + Heading_4: 'Kop 4', + Heading_5: 'Kop 5', + Heading_6: 'Kop 6', + Preformatted: 'Voorgeformatteerd', + Blockquote: 'Citaat', + Table_Header: 'Tabel-kop', + URL: 'URL', + Title: 'Titel', + Alternative_Text: 'Alternatieve tekst', + Caption: 'Bijschrift', + Summary: 'Summary', + Number_Of_Rows: 'Aantal rijen', + Number_Of_Cols: 'Aantal kolommen', + Submit: 'Versturen', + Cancel: 'Annuleren', + Choose: 'Kiezen', + Preview: 'Voorbeeld bekijken', + Paste_From_Word: 'Plakken uit Word', + Tools: 'Hulpmiddelen', + Containers: 'Teksttypes', + Classes: 'Klassen', + Status: 'Status', + Source_Code: 'Broncode' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/nn.js b/gstudio/static/gstudio/js/wymeditor/lang/nn.js new file mode 100644 index 0000000..51cec2b --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/nn.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['nn'] = { + Strong: 'Feit', + Emphasis: 'Utheva', + Superscript: 'Opphøgd', + Subscript: 'Nedsenka', + Ordered_List: 'Nummerert liste', + Unordered_List: 'Punktliste', + Indent: 'Rykk inn', + Outdent: 'Rykk ut', + Undo: 'Angre', + Redo: 'Gjentaka', + Link: 'Lenkje', + Unlink: 'Ta bort lenkja', + Image: 'Bilete', + Table: 'Tabell', + HTML: 'HTML', + Paragraph: 'Avsnitt', + Heading_1: 'Overskrift 1', + Heading_2: 'Overskrift 2', + Heading_3: 'Overskrift 3', + Heading_4: 'Overskrift 4', + Heading_5: 'Overskrift 5', + Heading_6: 'Overskrift 6', + Preformatted: 'Preformatert', + Blockquote: 'Sitat', + Table_Header: 'Tabelloverskrift', + URL: 'URL', + Title: 'Tittel', + Alternative_Text: 'Alternativ tekst', + Caption: 'Overskrift', + Summary: 'Samandrag', + Number_Of_Rows: 'Tal på rader', + Number_Of_Cols: 'Tal på kolonnar', + Submit: 'Ok', + Cancel: 'Avbryt', + Choose: 'Vel', + Preview: 'Førehandsvis', + Paste_From_Word: 'Lim inn frå Word', + Tools: 'Verkty', + Containers: 'Formatering', + Classes: 'Klassar', + Status: 'Status', + Source_Code: 'Kjeldekode' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/pl.js b/gstudio/static/gstudio/js/wymeditor/lang/pl.js new file mode 100644 index 0000000..d6c0471 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/pl.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['pl'] = { + Strong: 'Nacisk', + Emphasis: 'Emfaza', + Superscript: 'Indeks górny', + Subscript: 'Indeks dolny', + Ordered_List: 'Lista numerowana', + Unordered_List: 'Lista wypunktowana', + Indent: 'Zwiększ wcięcie', + Outdent: 'Zmniejsz wcięcie', + Undo: 'Cofnij', + Redo: 'Ponów', + Link: 'Wstaw link', + Unlink: 'Usuń link', + Image: 'Obraz', + Table: 'Tabela', + HTML: 'Źródło HTML', + Paragraph: 'Akapit', + Heading_1: 'Nagłówek 1', + Heading_2: 'Nagłówek 2', + Heading_3: 'Nagłówek 3', + Heading_4: 'Nagłówek 4', + Heading_5: 'Nagłówek 5', + Heading_6: 'Nagłówek 6', + Preformatted: 'Preformatowany', + Blockquote: 'Cytat blokowy', + Table_Header: 'Nagłówek tabeli', + URL: 'URL', + Title: 'Tytuł', + Alternative_Text: 'Tekst alternatywny', + Caption: 'Tytuł tabeli', + Summary: 'Summary', + Number_Of_Rows: 'Liczba wierszy', + Number_Of_Cols: 'Liczba kolumn', + Submit: 'Wyślij', + Cancel: 'Anuluj', + Choose: 'Wybierz', + Preview: 'Podgląd', + Paste_From_Word: 'Wklej z Worda', + Tools: 'Narzędzia', + Containers: 'Format', + Classes: 'Styl', + Status: 'Status', + Source_Code: 'Kod źródłowy' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/pt-br.js b/gstudio/static/gstudio/js/wymeditor/lang/pt-br.js new file mode 100644 index 0000000..2ec18fe --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/pt-br.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['pt-br'] = { + Strong: 'Resaltar', + Emphasis: 'Enfatizar', + Superscript: 'Sobre escrito', + Subscript: 'Sub escrito ', + Ordered_List: 'Lista ordenada', + Unordered_List: 'Lista desordenada', + Indent: 'Indentado', + Outdent: 'Desidentar', + Undo: 'Desfazer', + Redo: 'Refazer', + Link: 'Link', + Unlink: 'Remover Link', + Image: 'Imagem', + Table: 'Tabela', + HTML: 'HTML', + Paragraph: 'Parágrafo', + Heading_1: 'Título 1', + Heading_2: 'Título 2', + Heading_3: 'Título 3', + Heading_4: 'Título 4', + Heading_5: 'Título 5', + Heading_6: 'Título 6', + Preformatted: 'Preformatado', + Blockquote: 'Citação', + Table_Header: 'Título de tabela', + URL: 'URL', + Title: 'Título', + Alternative_Text: 'Texto alternativo', + Caption: 'Legenda', + Summary: 'Summary', + Number_Of_Rows: 'Número de linhas', + Number_Of_Cols: 'Número de colunas', + Submit: 'Enviar', + Cancel: 'Cancelar', + Choose: 'Selecionar', + Preview: 'Previsualizar', + Paste_From_Word: 'Copiar do Word', + Tools: 'Ferramentas', + Containers: 'Conteneiners', + Classes: 'Classes', + Status: 'Estado', + Source_Code: 'Código fonte' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/pt.js b/gstudio/static/gstudio/js/wymeditor/lang/pt.js new file mode 100644 index 0000000..a3d1a17 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/pt.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['pt'] = { + Strong: 'Negrito', + Emphasis: 'Itálico', + Superscript: 'Sobrescrito', + Subscript: 'Subsescrito', + Ordered_List: 'Lista Numerada', + Unordered_List: 'Lista Marcada', + Indent: 'Aumentar Indentaçã', + Outdent: 'Diminuir Indentaçã', + Undo: 'Desfazer', + Redo: 'Restaurar', + Link: 'Link', + Unlink: 'Tirar link', + Image: 'Imagem', + Table: 'Tabela', + HTML: 'HTML', + Paragraph: 'Parágrafo', + Heading_1: 'Título 1', + Heading_2: 'Título 2', + Heading_3: 'Título 3', + Heading_4: 'Título 4', + Heading_5: 'Título 5', + Heading_6: 'Título 6', + Preformatted: 'Pré-formatado', + Blockquote: 'Citação', + Table_Header: 'Cabeçalho Tabela', + URL: 'URL', + Title: 'Título', + Alternative_Text: 'Texto Alterativo', + Caption: 'Título Tabela', + Summary: 'Summary', + Number_Of_Rows: 'Número de Linhas', + Number_Of_Cols: 'Número de Colunas', + Submit: 'Enviar', + Cancel: 'Cancelar', + Choose: 'Escolha', + Preview: 'Prever', + Paste_From_Word: 'Colar do Word', + Tools: 'Ferramentas', + Containers: 'Containers', + Classes: 'Classes', + Status: 'Status', + Source_Code: 'Código Fonte' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/ru.js b/gstudio/static/gstudio/js/wymeditor/lang/ru.js new file mode 100644 index 0000000..7895f8d --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/ru.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['ru'] = { + Strong: 'Жирный', + Emphasis: 'Наклонный', + Superscript: 'Надстрочный', + Subscript: 'Подстрочный', + Ordered_List: 'Нумерованый список', + Unordered_List: 'Ненумерованый список', + Indent: 'Увеличить отступ', + Outdent: 'Уменьшить отступ', + Undo: 'Отменить', + Redo: 'Повторить', + Link: 'Ссылка', + Unlink: 'Удалить ссылку', + Image: 'Изображение', + Table: 'Таблица', + HTML: 'Править HTML', + Paragraph: 'Параграф', + Heading_1: 'Заголовок 1', + Heading_2: 'Заголовок 2', + Heading_3: 'Заголовок 3', + Heading_4: 'Заголовок 4', + Heading_5: 'Заголовок 5', + Heading_6: 'Заголовок 6', + Preformatted: 'Preformatted', + Blockquote: 'Цитата', + Table_Header: 'Заголовок таблицы', + URL: 'URL', + Title: 'Заголовок', + Alternative_Text: 'Альтернативный текст', + Caption: 'Надпись', + Summary: 'Summary', + Number_Of_Rows: 'Кол-во строк', + Number_Of_Cols: 'Кол-во столбцов', + Submit: 'Отправить', + Cancel: 'Отмена', + Choose: 'Выбор', + Preview: 'Просмотр', + Paste_From_Word: 'Вставить из Word', + Tools: 'Инструменты', + Containers: 'Контейнеры', + Classes: 'Классы', + Status: 'Статус', + Source_Code: 'Исходный код' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/sv.js b/gstudio/static/gstudio/js/wymeditor/lang/sv.js new file mode 100644 index 0000000..bc5485c --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/sv.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['sv'] = { + Strong: 'Viktigt', + Emphasis: 'Betoning', + Superscript: 'Upphöjt', + Subscript: 'Nedsänkt', + Ordered_List: 'Nummerlista', + Unordered_List: 'Punktlista', + Indent: 'Indrag', + Outdent: 'Utdrag', + Undo: 'Ångra', + Redo: 'Gör om', + Link: 'Länk', + Unlink: 'Ta bort länk', + Image: 'Bild', + Table: 'Tabell', + HTML: 'HTML', + Paragraph: 'Paragraf', + Heading_1: 'Rubrik 1', + Heading_2: 'Rubrik 2', + Heading_3: 'Rubrik 3', + Heading_4: 'Rubrik 4', + Heading_5: 'Rubrik 5', + Heading_6: 'Rubrik 6', + Preformatted: 'Förformaterad', + Blockquote: 'Blockcitat', + Table_Header: 'Tabellrubrik', + URL: 'URL', + Title: 'Titel', + Alternative_Text: 'Alternativ text', + Caption: 'Överskrift', + Summary: 'Summary', + Number_Of_Rows: 'Antal rader', + Number_Of_Cols: 'Antal kolumner', + Submit: 'Skicka', + Cancel: 'Avbryt', + Choose: 'Välj', + Preview: 'Förhandsgranska', + Paste_From_Word: 'Klistra in från Word', + Tools: 'Verktyg', + Containers: 'Formatering', + Classes: 'Klasser', + Status: 'Status', + Source_Code: 'Källkod' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/tr.js b/gstudio/static/gstudio/js/wymeditor/lang/tr.js new file mode 100644 index 0000000..d26f0ff --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/tr.js @@ -0,0 +1,45 @@ +WYMeditor.STRINGS['tr'] = { + Strong: 'Kalın', + Emphasis: 'Vurgu', + Superscript: 'Superscript', + Subscript: 'Subscript', + Ordered_List: 'Sıralı List', + Unordered_List: 'Sırasız List', + Indent: 'İçerlek', + Outdent: 'Çıkıntılı', + Undo: 'Geri Al', + Redo: 'Yinele', + Link: 'Bağlantı', + Unlink: 'Bağlantıyı Kaldır', + Image: 'İmaj', + Table: 'Tablo', + HTML: 'HTML', + Paragraph: 'Parağraf', + Heading_1: 'Başlık 1', + Heading_2: 'Başlık 2', + Heading_3: 'Başlık 3', + Heading_4: 'Başlık 4', + Heading_5: 'Başlık 5', + Heading_6: 'Başlık 6', + Preformatted: 'Önceden Formatlı', + Blockquote: 'Alıntı', + Table_Header: 'Tablo Başlığı', + URL: 'URL', + Title: 'Başlık', + Alternative_Text: 'Alternatif Metin', + Caption: 'Etiket', + Summary: 'Summary', + Number_Of_Rows: 'Satır sayısı', + Number_Of_Cols: 'Sütun sayısı', + Submit: 'Gönder', + Cancel: 'İptal', + Choose: 'Seç', + Preview: 'Önizleme', + Paste_From_Word: 'Wordden yapıştır', + Tools: 'Araçlar', + Containers: 'Kapsayıcılar', + Classes: 'Sınıflar', + Status: 'Durum', + Source_Code: 'Kaynak Kodu' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/lang/zh_cn.js b/gstudio/static/gstudio/js/wymeditor/lang/zh_cn.js new file mode 100644 index 0000000..72f5aaf --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/lang/zh_cn.js @@ -0,0 +1,47 @@ +WYMeditor.STRINGS['zh_cn'] = { + Strong: '加粗', + Emphasis: '斜体', + Superscript: '上标', + Subscript: '下标', + Ordered_List: '有序列表', + Unordered_List: '无序列表', + Indent: '增加缩进', + Outdent: '减少缩进', + Undo: '撤消', + Redo: '重做', + Link: '链接', + Unlink: '取消链接', + Image: '图片', + Table: '表格', + HTML: 'HTML源代码', + Paragraph: '段落', + Heading_1: '标题 1', + Heading_2: '标题 2', + Heading_3: '标题 3', + Heading_4: '标题 4', + Heading_5: '标题 5', + Heading_6: '标题 6', + Preformatted: '原始文本', + Blockquote: '引语', + Table_Header: '表头', + URL: '地址', + Title: '提示文字', + Alternative_Text: '失效文字', + Caption: '标题', + Summary: 'Summary', + Number_Of_Rows: '行数', + Number_Of_Cols: '列数', + Submit: '提交', + Cancel: '放弃', + Choose: '选择', + Preview: '预览', + Paste_From_Word: '从Word粘贴纯文本', + Tools: '工具', + Containers: '容器', + Classes: '预定义样式', + Status: '状态', + Source_Code: '源代码', + Attachment: '附件', + NewParagraph: '新段落' +}; + diff --git a/gstudio/static/gstudio/js/wymeditor/plugins/embed/jquery.wymeditor.embed.js b/gstudio/static/gstudio/js/wymeditor/plugins/embed/jquery.wymeditor.embed.js new file mode 100644 index 0000000..e553c3e --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/plugins/embed/jquery.wymeditor.embed.js @@ -0,0 +1,52 @@ +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * jquery.wymeditor.embed.js + * Experimental embed plugin + * + * File Authors: + * Jonatan Lundin (jonatan.lundin a-t gmail dotcom) + */ + +/* + * ISSUES: + * - The closing object tag seems to be stripped out... + */ +(function() { + if (WYMeditor && WYMeditor.XhtmlValidator['_tags']['param']['attributes']) { + + WYMeditor.XhtmlValidator['_tags']["embed"] = { + "attributes":[ + "allowscriptaccess", + "allowfullscreen", + "height", + "src", + "type", + "width" + ] + }; + + WYMeditor.XhtmlValidator['_tags']['param']['attributes'] = { + '0':'name', + '1':'type', + 'valuetype':/^(data|ref|object)$/, + '2':'valuetype', + '3':'value' + }; + + var XhtmlSaxListener = WYMeditor.XhtmlSaxListener; + WYMeditor.XhtmlSaxListener = function () { + var listener = XhtmlSaxListener.call(this); + listener.block_tags.push('embed'); + return listener; + }; + WYMeditor.XhtmlSaxListener.prototype = XhtmlSaxListener.prototype; + } +})(); diff --git a/gstudio/static/gstudio/js/wymeditor/plugins/fullscreen/icon_fullscreen.gif b/gstudio/static/gstudio/js/wymeditor/plugins/fullscreen/icon_fullscreen.gif Binary files differnew file mode 100644 index 0000000..d2a8b0a --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/plugins/fullscreen/icon_fullscreen.gif diff --git a/gstudio/static/gstudio/js/wymeditor/plugins/fullscreen/jquery.wymeditor.fullscreen.js b/gstudio/static/gstudio/js/wymeditor/plugins/fullscreen/jquery.wymeditor.fullscreen.js new file mode 100644 index 0000000..275c816 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/plugins/fullscreen/jquery.wymeditor.fullscreen.js @@ -0,0 +1,127 @@ +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * jquery.wymeditor.fullscreen.js + * Fullscreen plugin for WYMeditor + * + * File Authors: + * Luis Santos (luis.santos a-t openquest dotpt) + * Jonatan Lundin (jonatan.lundin a-t gmail dotcom) + * Gerd Riesselmann (gerd a-t gyro-php dot org) : Fixed issue with new skin layout + */ + +//Extend WYMeditor +WYMeditor.editor.prototype.fullscreen = function() { + var wym = this, + $box = jQuery(this._box), + $iframe = jQuery(this._iframe), + $overlay = null, + $window = jQuery(window), + + editorMargin = 15; // Margin from window (without padding) + + + //construct the button's html + var html = "<li class='wym_tools_fullscreen'>" + + "<a name='Fullscreen' href='#'" + + " style='background-image:" + + " url(" + wym._options.basePath +"plugins/fullscreen/icon_fullscreen.gif)'>" + + "Fullscreen" + + "</a></li>"; + + //add the button to the tools box + $box.find(wym._options.toolsSelector + wym._options.toolsListSelector) + .append(html); + + function resize () { + // Calculate margins + var uiHeight = $box.outerHeight(true) + - $iframe.outerHeight(true), + editorPadding = $box.outerWidth() - $box.width(), + + // Calculate heights + screenHeight = $window.height(), + iframeHeight = (screenHeight + - uiHeight + - (editorMargin * 2)) + 'px', + + // Calculate witdths + screenWidth = $window.width(), + boxWidth = (screenWidth + - editorPadding + - (editorMargin * 2)) + 'px'; + + $box.css('width', boxWidth); + $iframe.css('height', iframeHeight); + $overlay.css({ + 'height': screenHeight + 'px', + 'width': screenWidth + 'px' + }); + }; + + //handle click event + $box.find('li.wym_tools_fullscreen a').click(function() { + if ($box.css('position') != 'fixed') { + // Store previous inline styles + $box.data('wym-inline-css', $box.attr('style')); + $iframe.data('wym-inline-css', $iframe.attr('style')); + + // Create overlay + $overlay = jQuery('<div id="wym-fullscreen-overlay"></div>') + .appendTo('body').css({ + 'position': 'fixed', + 'background-color': 'rgb(0, 0, 0)', + 'opacity': '0.75', + 'z-index': '98', + 'top': '0px', + 'left': '0px' + }); + + // Possition the editor + $box.css({ + 'position': 'fixed', + 'z-index': '99', + 'top': editorMargin + 'px', + 'left': editorMargin + 'px' + }); + + // Bind event listeners + $window.bind('resize', resize); + $box.find('li.wym_tools_html a').bind('click', resize); + + // Force resize + resize(); + } else { + // Unbind event listeners + $window.unbind('resize', resize); + $box.find('li.wym_tools_html a').unbind('click', resize); + + // Remove inline styles + $box.css({ + 'position': 'static', + 'z-index': '', + 'width': '', + 'top': '', + 'left': '' + }); + $iframe.css('height', ''); + + // Remove overlay + $overlay.remove(); + $overlay = null; + + // Retore previous inline styles + $box.attr('style', $box.data('wym-inline-css')); + $iframe.attr('style', $iframe.data('wym-inline-css')); + } + + return false; + }); +}; diff --git a/gstudio/static/gstudio/js/wymeditor/plugins/hovertools/jquery.wymeditor.hovertools.js b/gstudio/static/gstudio/js/wymeditor/plugins/hovertools/jquery.wymeditor.hovertools.js new file mode 100644 index 0000000..2c71ba5 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/plugins/hovertools/jquery.wymeditor.hovertools.js @@ -0,0 +1,57 @@ +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * jquery.wymeditor.hovertools.js + * hovertools plugin for WYMeditor + * + * File Authors: + * Jean-Francois Hovinne (jf.hovinne a-t wymeditor dotorg) + */ + +//Extend WYMeditor +WYMeditor.editor.prototype.hovertools = function() { + + var wym = this; + + //bind events on buttons + jQuery(this._box).find(this._options.toolSelector).hover( + function() { + wym.status(jQuery(this).html()); + }, + function() { + wym.status(' '); + } + ); + + //classes: add/remove a style attr to matching elems + //while mouseover/mouseout + jQuery(this._box).find(this._options.classSelector).hover( + function() { + var aClasses = eval(wym._options.classesItems); + var sName = jQuery(this).attr(WYMeditor.NAME); + var oClass = WYMeditor.Helper.findByName(aClasses, sName); + + if(oClass){ + jqexpr = oClass.expr; + //don't use jQuery.find() on the iframe body + //because of MSIE + jQuery + expando issue (#JQ1143) + if(!jQuery.browser.msie) + jQuery(wym._doc).find(jqexpr).css('background-color','#cfc'); + } + }, + function() { + //don't use jQuery.find() on the iframe body + //because of MSIE + jQuery + expando issue (#JQ1143) + if(!jQuery.browser.msie) + jQuery(wym._doc).find('*').removeAttr('style'); + } + ); + +}; diff --git a/gstudio/static/gstudio/js/wymeditor/plugins/resizable/jquery.wymeditor.resizable.js b/gstudio/static/gstudio/js/wymeditor/plugins/resizable/jquery.wymeditor.resizable.js new file mode 100644 index 0000000..1ba2d2e --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/plugins/resizable/jquery.wymeditor.resizable.js @@ -0,0 +1,91 @@ +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * jquery.wymeditor.resizable.js + * resize plugin for WYMeditor + * + * File Authors: + * Peter Eschler (peschler _at_ gmail.com) + * Jean-Francois Hovinne - http://www.hovinne.com/ + * + * Version: + * 0.4 + * + * Changelog: + * + * 0.4 + * - Removed UI and UI.resizable scripts loading - see #167 (jfh). + * + * 0.3 + * - Added 'iframeOriginalSize' and removed 'ui.instance' calls (jfh). + * + * 0.2 + * - Added full support for all jQueryUI resizable plugin options. + * - Refactored and documented code. + * 0.1 + * - Initial release. + */ + +/** + * The resizable plugin makes the wymeditor box vertically resizable. + * It it based on the ui.resizable.js plugin of the jQuery UI library. + * + * The WYMeditor resizable plugin supports all parameters of the jQueryUI + * resizable plugin. The parameters are passed like this: + * + * wym.resizable({ handles: "s,e", + * maxHeight: 600 }); + * + * DEPENDENCIES: jQuery UI, jQuery UI resizable + * + * @param options options for the plugin + */ +WYMeditor.editor.prototype.resizable = function(options) { + + var wym = this; + var iframe = jQuery(wym._box).find('iframe'); + var iframeOriginalSize = {}; + + // Define some default options + var default_options = { + start: function(e, ui) { + iframeOriginalSize = { + width: jQuery(iframe).width(), + height: jQuery(iframe).height() + } + }, + + // resize is called by the jQuery resizable plugin whenever the + // client area was resized. + resize: function(e, ui) { + var diff = ui.size.height - ui.originalSize.height; + jQuery(iframe).height( iframeOriginalSize.height + diff ); + + // If the plugin has horizontal resizing disabled we need to + // adjust the "width" attribute of the area css, because the + // resizing will set a fixed width (which breaks liquid layout + // of the wymeditor area). + if( !ui.options.handles['w'] && !ui.options.handles['e'] ) { + ui.size.width = "inherit"; + } + }, + handles: "s,e,se", + minHeight: 250, + maxHeight: 600 + }; + + // Merge given options with default options. Given options override + // default ones. + var final_options = jQuery.extend(default_options, options); + + if(jQuery.isFunction( jQuery.fn.resizable )) jQuery(wym._box).resizable(final_options); + else WYMeditor.console.error('Oops, jQuery UI.resizable unavailable.'); + +}; diff --git a/gstudio/static/gstudio/js/wymeditor/plugins/resizable/readme.txt b/gstudio/static/gstudio/js/wymeditor/plugins/resizable/readme.txt new file mode 100644 index 0000000..2a0444e --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/plugins/resizable/readme.txt @@ -0,0 +1,124 @@ + + +resizable plugin for WYMeditor +############################## + +The ``resizable`` plugin for WYMeditor_ enables vertical resizing of the +editor area. The plugin is based on the jQuery UI library. + +Requirements +============ +The following packages are required for using the WYMeditor ``resizable`` +plugin: + +* jQuery (tested with jQuery ``jquery-1.2.4a.js`` from ``jquery.ui`` package) +* WYMeditor SVN trunk (Revision: 482) +* jQuery-UI (tested with ``jquery.ui-1.5b2``) + +It should be possible to use this plugin with ``WYMeditor-0.4`` but I have not +tried. + +Download +======== +You can download the WYMeditor ``resizable`` plugin here: + +* wymeditor-resizable-plugin-0.2.tgz_ +* wymeditor-resizable-plugin-0.1.tgz_ + +See the Changelog_ for more infos about the releases. + +.. _wymeditor-resizable-plugin-0.2.tgz: http://pyjax.net/download/wymeditor-resizable-plugin-0.2.tgz +.. _wymeditor-resizable-plugin-0.1.tgz: http://pyjax.net/download/wymeditor-resizable-plugin-0.1.tgz + +Installation +============ +Just extract the downloaded archive into your WYMeditor's ``plugin`` +directory. + +Usage +===== +For general instructions on WYMeditor plugins please refer to the `WYMeditor +plugin page`_. + +To use the ``resizable`` plugin simply include the plugin's JavaScript file in +your code. You **do not** need to include the jQuery UI files - this is done +automatically by the plugin (see `Internals`_):: + + <script type="text/javascript" + src="/js/wymeditor/plugins/resizable/jquery.wymeditor.resizable.js"> + </script> + +Make sure to adjust the ``src`` attribute to your needs, then initialize the +plugin in WYMeditor's ``postInit`` function:: + + wymeditor({postInit: function(wym) { + wym.hovertools(); // other plugins... + wym.resizable({handles: "s,e", + maxHeight: 600}); + } + }) + +The ``resizable`` plugin takes exactly one parameter, which is an object literal +containing the options of the plugin. The WYMeditor ``resizable`` plugin +supports all options of the jQuery UI ``resizable`` plugin. These are the +default values used by the plugin:: + + handles: "s,e,se", + minHeight: 250, + maxHeight: 600 + +See the `jQuery UI resizable plugin docs`_ for a list of all options. + +That's it! You are now able to resize the WYMeditor vertically, horizontally or +both, depending on your options. + +.. _jQuery UI resizable plugin docs: http://docs.jquery.com/UI/Resizables + +Internals +========= +The plugin takes care of loading the necessary jQuery UI files (``base`` and +``resizable``) from the same path the jQuery library was loaded. Here's how +it's done:: + + // Get the jQuery path from the editor, stripping away the jQuery file. + // see http://www.oreilly.com/catalog/regex/chapter/ch04.html + // The match result array contains the path and the filename. + var jQueryPath = wym.computeJqueryPath().match(/^(.*)\/(.*)$/)[1]; + + // Make an array of the external JavaScript files required by the plugin. + var jQueryPlugins = [jQueryPath + '/ui.base.js', + jQueryPath + '/ui.resizable.js']; + + // First get the jQuery UI base file + $.getScript(jQueryPlugins[0]); + + // Get the jQuery UI resizeable plugin and then init the wymeditor resizable + // plugin. It is import to do the initialisation after loading the + // necessary jQuery UI files has finished, otherwise the "resizable" method + // would not be available. + $.getScript(jQueryPlugins[1], function() { + jQuery(wym._box).resizable(final_options); + }); + +An alternative approach would be to use an AJAX queue when getting the script +files to ensure that all jQuery files are loaded before the initialisation code +of the plugin is executed. There is an `jQuery AJAX queue plugin`_ which does +that. + +.. _jQuery AJAX queue plugin: http://plugins.jquery.com/project/ajaxqueue + +Changelog +========= + +0.2 +--- +- Added full support for all jQuery UI resizable plugin options. +- Refactored and documented code. +- Now contains a packed version (775 bytes). + +0.1 +--- +- Initial release. + +.. _WYMeditor: http://www.wymeditor.org/ +.. _WYMeditor plugin page: http://trac.wymeditor.org/trac/wiki/0.4/Plugins diff --git a/gstudio/static/gstudio/js/wymeditor/plugins/tidy/README b/gstudio/static/gstudio/js/wymeditor/plugins/tidy/README new file mode 100644 index 0000000..acc7ffd --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/plugins/tidy/README @@ -0,0 +1,19 @@ +WYMeditor : what you see is What You Mean web-based editor +Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ +Dual licensed under the MIT (MIT-license.txt) +and GPL (GPL-license.txt) licenses. + +For further information visit: + http://www.wymeditor.org/ + +File Name: + README - HTML Tidy plugin for WYMeditor + +File Authors: + Jean-François Hovinne (jf.hovinne a-t wymeditor dotorg) + +Credits: + 'HTML Tidy' by Dave Ragget - http://tidy.sourceforge.net/ + Icon 'wand' by Mark James - http://famfamfam.com/ + +WYMeditor documentation is available online at http://www.wymeditor.org/ diff --git a/gstudio/static/gstudio/js/wymeditor/plugins/tidy/jquery.wymeditor.tidy.js b/gstudio/static/gstudio/js/wymeditor/plugins/tidy/jquery.wymeditor.tidy.js new file mode 100644 index 0000000..bf30c4c --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/plugins/tidy/jquery.wymeditor.tidy.js @@ -0,0 +1,82 @@ +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * jquery.wymeditor.tidy.js + * HTML Tidy plugin for WYMeditor + * + * File Authors: + * Jean-Francois Hovinne (jf.hovinne a-t wymeditor dotorg) + */ + +//Extend WYMeditor +WYMeditor.editor.prototype.tidy = function(options) { + var tidy = new WymTidy(options, this); + return(tidy); +}; + +//WymTidy constructor +function WymTidy(options, wym) { + + options = jQuery.extend({ + + sUrl: wym._options.basePath + "plugins/tidy/tidy.php", + sButtonHtml: "<li class='wym_tools_tidy'>" + + "<a name='CleanUp' href='#'" + + " style='background-image:" + + " url(" + wym._options.basePath + "plugins/tidy/wand.png)'>" + + "Clean up HTML" + + "</a></li>", + + sButtonSelector: "li.wym_tools_tidy a" + + }, options); + + this._options = options; + this._wym = wym; + +}; + +//WymTidy initialization +WymTidy.prototype.init = function() { + + var tidy = this; + + jQuery(this._wym._box).find( + this._wym._options.toolsSelector + this._wym._options.toolsListSelector) + .append(this._options.sButtonHtml); + + //handle click event + jQuery(this._wym._box).find(this._options.sButtonSelector).click(function() { + tidy.cleanup(); + return(false); + }); + +}; + +//WymTidy cleanup +WymTidy.prototype.cleanup = function() { + + var wym = this._wym; + var html = "<html><body>" + wym.xhtml() + "</body></html>"; + + jQuery.post(this._options.sUrl, { html: html}, function(data) { + + if(data.length > 0 && data != '0') { + if(data.indexOf("<?php") == 0) { + wym.status("Ooops... Is PHP installed?"); + } else { + wym.html(data); + wym.status("HTML has been cleaned up."); + } + } else { + wym.status("An error occurred."); + } + }); +}; diff --git a/gstudio/static/gstudio/js/wymeditor/plugins/tidy/tidy.php b/gstudio/static/gstudio/js/wymeditor/plugins/tidy/tidy.php new file mode 100644 index 0000000..23b9bec --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/plugins/tidy/tidy.php @@ -0,0 +1,36 @@ +<?php + +if (get_magic_quotes_gpc()) $html = stripslashes($_REQUEST['html']); +else $html = $_REQUEST['html']; + +if(strlen($html) > 0) { + + // Specify configuration + $config = array( + 'bare' => true, + 'clean' => true, + 'doctype' => 'strict', + 'drop-empty-paras' => true, + 'drop-font-tags' => true, + 'drop-proprietary-attributes' => true, + 'enclose-block-text' => true, + 'indent' => false, + 'join-classes' => true, + 'join-styles' => true, + 'logical-emphasis' => true, + 'output-xhtml' => true, + 'show-body-only' => true, + 'wrap' => 0); + + // Tidy + $tidy = new tidy; + $tidy->parseString($html, $config, 'utf8'); + $tidy->cleanRepair(); + + // Output + echo $tidy; +} else { + +echo ('0'); +} +?> diff --git a/gstudio/static/gstudio/js/wymeditor/plugins/tidy/wand.png b/gstudio/static/gstudio/js/wymeditor/plugins/tidy/wand.png Binary files differnew file mode 100644 index 0000000..bb55eea --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/plugins/tidy/wand.png diff --git a/gstudio/static/gstudio/js/wymeditor/skins/compact/icons.png b/gstudio/static/gstudio/js/wymeditor/skins/compact/icons.png Binary files differnew file mode 100644 index 0000000..c6eb463 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/compact/icons.png diff --git a/gstudio/static/gstudio/js/wymeditor/skins/compact/skin.css b/gstudio/static/gstudio/js/wymeditor/skins/compact/skin.css new file mode 100644 index 0000000..4a6a0c6 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/compact/skin.css @@ -0,0 +1,134 @@ +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * screen.css + * main stylesheet for the WYMeditor skin + * See the documentation for more info. + * + * File Authors: + * Daniel Reszka (d.reszka a-t wymeditor dotorg) + * Jean-Francois Hovinne (jf.hovinne a-t wymeditor dotorg) +*/ + +/*TRYING TO RESET STYLES THAT MAY INTERFERE WITH WYMEDITOR*/ + .wym_skin_compact p, .wym_skin_compact h2, .wym_skin_compact h3, + .wym_skin_compact ul, .wym_skin_compact li { background: transparent url(); margin: 0; padding: 0; border-width:0; list-style: none; } + + +/*HIDDEN BY DEFAULT*/ + .wym_skin_compact .wym_area_left { display: none; } + .wym_skin_compact .wym_area_right { display: none; } + + +/*TYPO*/ + .wym_skin_compact { font-size: 10px; font-family: Verdana, Arial, sans-serif; } + .wym_skin_compact h2 { font-size: 110%; /* = 11px */} + .wym_skin_compact h3 { font-size: 100%; /* = 10px */} + .wym_skin_compact li { font-size: 100%; /* = 10px */} + + +/*WYM_BOX*/ + .wym_skin_compact { border: 1px solid gray; padding: 5px} + + /*auto-clear the wym_box*/ + .wym_skin_compact:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } + * html .wym_skin_compact { height: 1%;} + + +/*WYM_HTML*/ + .wym_skin_compact .wym_html { width: 98%;} + .wym_skin_compact .wym_html textarea { font-size: 120%; width: 100%; height: 200px; border: 1px solid gray; background: white; } + + +/*WYM_IFRAME*/ + .wym_skin_compact .wym_iframe { width: 98%;} + .wym_skin_compact .wym_iframe iframe { width: 100%; height: 200px; border: 1px solid gray; background: white } + + +/*AREAS*/ + .wym_skin_compact .wym_area_left { width: 100px; float: left;} + .wym_skin_compact .wym_area_right { width: 150px; float: right;} + .wym_skin_compact .wym_area_bottom { height: 1%; clear: both;} + * html .wym_skin_compact .wym_area_main { height: 1%;} + * html .wym_skin_compact .wym_area_top { height: 1%;} + *+html .wym_skin_compact .wym_area_top { height: 1%;} + +/*SECTIONS SYSTEM*/ + + /*common defaults for all sections*/ + .wym_skin_compact .wym_section { margin-bottom: 5px; } + .wym_skin_compact .wym_section h2, + .wym_skin_compact .wym_section h3 { padding: 1px 3px; margin: 0; } + .wym_skin_compact .wym_section a { padding: 0 3px; display: block; text-decoration: none; color: black; } + .wym_skin_compact .wym_section a:hover { background-color: yellow; } + /*hide section titles by default*/ + .wym_skin_compact .wym_section h2 { display: none; } + /*disable any margin-collapse*/ + .wym_skin_compact .wym_section { padding-top: 1px; padding-bottom: 1px; } + /*auto-clear sections*/ + .wym_skin_compact .wym_section ul:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } + * html .wym_skin_compact .wym_section ul { height: 1%;} + + /*option: add this class to a section to make it render as a panel*/ + .wym_skin_compact .wym_panel { } + .wym_skin_compact .wym_panel h2 { display: block; } + + /*option: add this class to a section to make it render as a dropdown menu*/ + .wym_skin_compact .wym_dropdown h2 { display: block; } + .wym_skin_compact .wym_dropdown ul { display: none; position: absolute; background: white; } + .wym_skin_compact .wym_dropdown:hover ul, + .wym_skin_compact .wym_dropdown.hover ul { display: block; } + + /*option: add this class to a section to make its elements render buttons (icons are only available for the wym_tools section for now)*/ + .wym_skin_compact .wym_buttons li { float:left;} + .wym_skin_compact .wym_buttons a { width: 20px; height: 20px; overflow: hidden; padding: 2px } + /*image replacements*/ + .wym_skin_compact .wym_buttons li a { background: url(icons.png) no-repeat; text-indent: -9999px;} + .wym_skin_compact .wym_buttons li.wym_tools_strong a { background-position: 0 -382px;} + .wym_skin_compact .wym_buttons li.wym_tools_emphasis a { background-position: 0 -22px;} + .wym_skin_compact .wym_buttons li.wym_tools_superscript a { background-position: 0 -430px;} + .wym_skin_compact .wym_buttons li.wym_tools_subscript a { background-position: 0 -454px;} + .wym_skin_compact .wym_buttons li.wym_tools_ordered_list a { background-position: 0 -48px;} + .wym_skin_compact .wym_buttons li.wym_tools_unordered_list a{ background-position: 0 -72px;} + .wym_skin_compact .wym_buttons li.wym_tools_indent a { background-position: 0 -574px;} + .wym_skin_compact .wym_buttons li.wym_tools_outdent a { background-position: 0 -598px;} + .wym_skin_compact .wym_buttons li.wym_tools_undo a { background-position: 0 -502px;} + .wym_skin_compact .wym_buttons li.wym_tools_redo a { background-position: 0 -526px;} + .wym_skin_compact .wym_buttons li.wym_tools_link a { background-position: 0 -96px;} + .wym_skin_compact .wym_buttons li.wym_tools_unlink a { background-position: 0 -168px;} + .wym_skin_compact .wym_buttons li.wym_tools_image a { background-position: 0 -121px;} + .wym_skin_compact .wym_buttons li.wym_tools_table a { background-position: 0 -144px;} + .wym_skin_compact .wym_buttons li.wym_tools_paste a { background-position: 0 -552px;} + .wym_skin_compact .wym_buttons li.wym_tools_html a { background-position: 0 -193px;} + .wym_skin_compact .wym_buttons li.wym_tools_preview a { background-position: 0 -408px;} + +/*DECORATION*/ + .wym_skin_compact .wym_section h2 { background: #f0f0f0; border: solid gray; border-width: 0 0 1px;} + .wym_skin_compact .wym_section h2 span { color: gray;} + .wym_skin_compact .wym_panel { padding: 0; border: solid gray; border-width: 1px; background: white;} + .wym_skin_compact .wym_panel ul { margin: 2px 0 5px; } + .wym_skin_compact .wym_dropdown { padding: 0; border: solid gray; border-width: 1px 1px 0 1px; } + .wym_skin_compact .wym_dropdown ul { border: solid gray; border-width: 0 1px 1px 1px; margin-left: -1px; padding: 5px 10px 5px 3px;} + +/*DIALOGS*/ + .wym_dialog div.row { margin-bottom: 5px;} + .wym_dialog div.row input { margin-right: 5px;} + .wym_dialog div.row label { float: left; width: 150px; display: block; text-align: right; margin-right: 10px; } + .wym_dialog div.row-indent { padding-left: 160px; } + /*autoclearing*/ + .wym_dialog div.row:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } + .wym_dialog div.row { display: inline-block; } + /* Hides from IE-mac \*/ + * html .wym_dialog div.row { height: 1%; } + .wym_dialog div.row { display: block; } + /* End hide from IE-mac */ + +/*WYMEDITOR_LINK*/ + a.wym_wymeditor_link { text-indent: -9999px; float: right; display: block; width: 50px; height: 15px; background: url(../wymeditor_icon.png); overflow: hidden; text-decoration: none; } diff --git a/gstudio/static/gstudio/js/wymeditor/skins/compact/skin.js b/gstudio/static/gstudio/js/wymeditor/skins/compact/skin.js new file mode 100644 index 0000000..cfb7cc1 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/compact/skin.js @@ -0,0 +1,35 @@ +WYMeditor.SKINS['compact'] = { + + init: function(wym) { + + //move the containers panel to the top area + jQuery(wym._options.containersSelector + ', ' + + wym._options.classesSelector, wym._box) + .appendTo( jQuery("div.wym_area_top", wym._box) ) + .addClass("wym_dropdown") + .css({"margin-right": "10px", "width": "120px", "float": "left"}); + + //render following sections as buttons + jQuery(wym._options.toolsSelector, wym._box) + .addClass("wym_buttons") + .css({"margin-right": "10px", "float": "left"}); + + //make hover work under IE < 7 + jQuery(".wym_section", wym._box).hover(function(){ + jQuery(this).addClass("hover"); + },function(){ + jQuery(this).removeClass("hover"); + }); + + var postInit = wym._options.postInit; + wym._options.postInit = function(wym) { + + if(postInit) postInit.call(wym, wym); + var rule = { + name: 'body', + css: 'background-color: #f0f0f0;' + }; + wym.addCssRule( wym._doc.styleSheets[0], rule); + }; + } +}; diff --git a/gstudio/static/gstudio/js/wymeditor/skins/default/icons.png b/gstudio/static/gstudio/js/wymeditor/skins/default/icons.png Binary files differnew file mode 100644 index 0000000..c6eb463 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/default/icons.png diff --git a/gstudio/static/gstudio/js/wymeditor/skins/default/skin.css b/gstudio/static/gstudio/js/wymeditor/skins/default/skin.css new file mode 100644 index 0000000..eb4680f --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/default/skin.css @@ -0,0 +1,133 @@ +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * skin.css + * main stylesheet for the default WYMeditor skin + * See the documentation for more info. + * + * File Authors: + * Daniel Reszka (d.reszka a-t wymeditor dotorg) +*/ + +/*TRYING TO RESET STYLES THAT MAY INTERFERE WITH WYMEDITOR*/ + .wym_skin_default p, .wym_skin_default h2, .wym_skin_default h3, + .wym_skin_default ul, .wym_skin_default li { background: transparent url(); margin: 0; padding: 0; border-width:0; list-style: none; } + + +/*HIDDEN BY DEFAULT*/ + .wym_skin_default .wym_area_left { display: none; } + .wym_skin_default .wym_area_right { display: block; } + + +/*TYPO*/ + .wym_skin_default { font-size: 62.5%; font-family: Verdana, Arial, sans-serif; } + .wym_skin_default h2 { font-size: 110%; /* = 11px */} + .wym_skin_default h3 { font-size: 100%; /* = 10px */} + .wym_skin_default li { font-size: 100%; /* = 10px */} + + +/*WYM_BOX*/ + .wym_skin_default { border: 1px solid gray; background: #f2f2f2; padding: 5px} + + /*auto-clear the wym_box*/ + .wym_skin_default:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } + * html .wym_skin_default { height: 1%;} + + +/*WYM_HTML*/ + .wym_skin_default .wym_html { width: 98%;} + .wym_skin_default .wym_html textarea { width: 100%; height: 200px; border: 1px solid gray; background: white; } + + +/*WYM_IFRAME*/ + .wym_skin_default .wym_iframe { width: 98%;} + .wym_skin_default .wym_iframe iframe { width: 100%; height: 200px; border: 1px solid gray; background: white } + + +/*AREAS*/ + .wym_skin_default .wym_area_left { width: 150px; float: left;} + .wym_skin_default .wym_area_right { width: 150px; float: right;} + .wym_skin_default .wym_area_bottom { height: 1%; clear: both;} + * html .wym_skin_default .wym_area_main { height: 1%;} + * html .wym_skin_default .wym_area_top { height: 1%;} + *+html .wym_skin_default .wym_area_top { height: 1%;} + +/*SECTIONS SYSTEM*/ + + /*common defaults for all sections*/ + .wym_skin_default .wym_section { margin-bottom: 5px; } + .wym_skin_default .wym_section h2, + .wym_skin_default .wym_section h3 { padding: 1px 3px; margin: 0; } + .wym_skin_default .wym_section a { padding: 0 3px; display: block; text-decoration: none; color: black; } + .wym_skin_default .wym_section a:hover { background-color: yellow; } + /*hide section titles by default*/ + .wym_skin_default .wym_section h2 { display: none; } + /*disable any margin-collapse*/ + .wym_skin_default .wym_section { padding-top: 1px; padding-bottom: 1px; } + /*auto-clear sections*/ + .wym_skin_default .wym_section ul:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } + * html .wym_skin_default .wym_section ul { height: 1%;} + + /*option: add this class to a section to make it render as a panel*/ + .wym_skin_default .wym_panel { } + .wym_skin_default .wym_panel h2 { display: block; } + + /*option: add this class to a section to make it render as a dropdown menu*/ + .wym_skin_default .wym_dropdown h2 { display: block; } + .wym_skin_default .wym_dropdown ul { display: none; position: absolute; background: white; } + .wym_skin_default .wym_dropdown:hover ul, + .wym_skin_default .wym_dropdown.hover ul { display: block; } + + /*option: add this class to a section to make its elements render buttons (icons are only available for the wym_tools section for now)*/ + .wym_skin_default .wym_buttons li { float:left;} + .wym_skin_default .wym_buttons a { width: 20px; height: 20px; overflow: hidden; padding: 2px } + /*image replacements*/ + .wym_skin_default .wym_buttons li a { background: url(icons.png) no-repeat; text-indent: -9999px;} + .wym_skin_default .wym_buttons li.wym_tools_strong a { background-position: 0 -382px;} + .wym_skin_default .wym_buttons li.wym_tools_emphasis a { background-position: 0 -22px;} + .wym_skin_default .wym_buttons li.wym_tools_superscript a { background-position: 0 -430px;} + .wym_skin_default .wym_buttons li.wym_tools_subscript a { background-position: 0 -454px;} + .wym_skin_default .wym_buttons li.wym_tools_ordered_list a { background-position: 0 -48px;} + .wym_skin_default .wym_buttons li.wym_tools_unordered_list a{ background-position: 0 -72px;} + .wym_skin_default .wym_buttons li.wym_tools_indent a { background-position: 0 -574px;} + .wym_skin_default .wym_buttons li.wym_tools_outdent a { background-position: 0 -598px;} + .wym_skin_default .wym_buttons li.wym_tools_undo a { background-position: 0 -502px;} + .wym_skin_default .wym_buttons li.wym_tools_redo a { background-position: 0 -526px;} + .wym_skin_default .wym_buttons li.wym_tools_link a { background-position: 0 -96px;} + .wym_skin_default .wym_buttons li.wym_tools_unlink a { background-position: 0 -168px;} + .wym_skin_default .wym_buttons li.wym_tools_image a { background-position: 0 -121px;} + .wym_skin_default .wym_buttons li.wym_tools_table a { background-position: 0 -144px;} + .wym_skin_default .wym_buttons li.wym_tools_paste a { background-position: 0 -552px;} + .wym_skin_default .wym_buttons li.wym_tools_html a { background-position: 0 -193px;} + .wym_skin_default .wym_buttons li.wym_tools_preview a { background-position: 0 -408px;} + +/*DECORATION*/ + .wym_skin_default .wym_section h2 { background: #ddd; border: solid gray; border-width: 0 0 1px;} + .wym_skin_default .wym_section h2 span { color: gray;} + .wym_skin_default .wym_panel { padding: 0; border: solid gray; border-width: 1px; background: white;} + .wym_skin_default .wym_panel ul { margin: 2px 0 5px; } + .wym_skin_default .wym_dropdown { padding: 0; border: solid gray; border-width: 1px 1px 0 1px; } + .wym_skin_default .wym_dropdown ul { border: solid gray; border-width: 0 1px 1px 1px; margin-left: -1px; padding: 5px 10px 5px 3px;} + +/*DIALOGS*/ + .wym_dialog div.row { margin-bottom: 5px;} + .wym_dialog div.row input { margin-right: 5px;} + .wym_dialog div.row label { float: left; width: 150px; display: block; text-align: right; margin-right: 10px; } + .wym_dialog div.row-indent { padding-left: 160px; } + /*autoclearing*/ + .wym_dialog div.row:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } + .wym_dialog div.row { display: inline-block; } + /* Hides from IE-mac \*/ + * html .wym_dialog div.row { height: 1%; } + .wym_dialog div.row { display: block; } + /* End hide from IE-mac */ + +/*WYMEDITOR_LINK*/ + a.wym_wymeditor_link { text-indent: -9999px; float: right; display: block; width: 50px; height: 15px; background: url(../wymeditor_icon.png); overflow: hidden; text-decoration: none; } diff --git a/gstudio/static/gstudio/js/wymeditor/skins/default/skin.js b/gstudio/static/gstudio/js/wymeditor/skins/default/skin.js new file mode 100644 index 0000000..3d204e0 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/default/skin.js @@ -0,0 +1,40 @@ +WYMeditor.SKINS['default'] = { + + init: function(wym) { + + //render following sections as panels + jQuery(wym._box).find(wym._options.classesSelector) + .addClass("wym_panel"); + + //render following sections as buttons + jQuery(wym._box).find(wym._options.toolsSelector) + .addClass("wym_buttons"); + + //render following sections as dropdown menus + jQuery(wym._box).find(wym._options.containersSelector) + .addClass("wym_dropdown") + .find(WYMeditor.H2) + .append("<span> ></span>"); + + // auto add some margin to the main area sides if left area + // or right area are not empty (if they contain sections) + jQuery(wym._box).find("div.wym_area_right ul") + .parents("div.wym_area_right").show() + .parents(wym._options.boxSelector) + .find("div.wym_area_main") + .css({"margin-right": "155px"}); + + jQuery(wym._box).find("div.wym_area_left ul") + .parents("div.wym_area_left").show() + .parents(wym._options.boxSelector) + .find("div.wym_area_main") + .css({"margin-left": "155px"}); + + //make hover work under IE < 7 + jQuery(wym._box).find(".wym_section").hover(function(){ + jQuery(this).addClass("hover"); + },function(){ + jQuery(this).removeClass("hover"); + }); + } +}; diff --git a/gstudio/static/gstudio/js/wymeditor/skins/django/icons.png b/gstudio/static/gstudio/js/wymeditor/skins/django/icons.png Binary files differnew file mode 100644 index 0000000..0e04964 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/django/icons.png diff --git a/gstudio/static/gstudio/js/wymeditor/skins/django/skin.css b/gstudio/static/gstudio/js/wymeditor/skins/django/skin.css new file mode 100644 index 0000000..6ae3772 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/django/skin.css @@ -0,0 +1,136 @@ +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2008 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * skin.css + * main stylesheet for the django WYMeditor skin + * See the documentation for more info. + * + * File Authors: + * Daniel Reszka (d.reszka a-t wymeditor dotorg) + * Jannis Leidel (jannis@leidel.info) +*/ + +/*TRYING TO RESET STYLES THAT MAY INTERFERE WITH WYMEDITOR*/ + .wym_skin_django p, .wym_skin_django h2, .wym_skin_django h3, + .wym_skin_django ul, .wym_skin_django li { background: transparent url(); margin: 0; padding: 0; border-width:0; list-style: none; } + + +/*HIDDEN BY DEFAULT*/ + .wym_skin_django .wym_area_left { display: none; } + .wym_skin_django .wym_area_right { display: block; } + + +/*TYPO*/ + .wym_skin_django { font-size: 62,5%; font-family: "Lucida Grande", "DejaVu Sans", "Bitstream Vera Sans", Verdana, Arial, sans-serif } + .wym_skin_django h2 { font-size: 110%; /* = 11px */} + .wym_skin_django h3 { font-size: 100%; /* = 10px */} + .wym_skin_django li { font-size: 100%; /* = 10px */} + + +/*WYM_BOX*/ + .wym_skin_django { border: 0px; background: none; padding: 10px} + + /*auto-clear the wym_box*/ + .wym_skin_django:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } + * html .wym_skin_django { height: 1%;} + + +/*WYM_HTML*/ + .wym_skin_django .wym_html { width: 98%;} + .wym_skin_django .wym_html textarea { width: 100%; height: 235px; border: 1px solid #ccc; background: white; } + + +/*WYM_IFRAME*/ + .wym_skin_django .wym_iframe { width: 98%;} + .wym_skin_django .wym_iframe iframe { width: 100%; height: 235px; border: 1px solid #ccc; background: white } + + +/*AREAS*/ + .wym_skin_django .wym_area_left { width: 150px; float: left;} + .wym_skin_django .wym_area_right { width: 150px; float: right;} + .wym_skin_django .wym_area_bottom { clear: both; display: none;} + * html .wym_skin_django .wym_area_main { height: 1%;} + * html .wym_skin_django .wym_area_top { height: 1%;} + *+html .wym_skin_django .wym_area_top { height: 1%;} + +/*SECTIONS SYSTEM*/ + + /*common defaults for all sections*/ + .wym_skin_django .wym_section { margin-bottom: 5px; } + .wym_skin_django .wym_section h2, + .wym_skin_django .wym_section h3 { padding: 1px 3px; margin: 0; color:#333; } + .wym_skin_django .wym_section a { padding: 0 3px; display: block; text-decoration: none; color: black; } + .wym_skin_django .wym_section a:hover { background-color: #eaeaea; } + /*hide section titles by default*/ + .wym_skin_django .wym_section h2 { display: none; } + /*disable any margin-collapse*/ + .wym_skin_django .wym_section { padding-top: 1px; padding-bottom: 1px; } + /*auto-clear sections*/ + .wym_skin_django .wym_section ul:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } + * html .wym_skin_django .wym_section ul { height: 1%;} + + /*option: add this class to a section to make it render as a panel*/ + .wym_skin_django .wym_panel { } + .wym_skin_django .wym_panel h2 { display: block; } + + /*option: add this class to a section to make it render as a dropdown menu*/ + .wym_skin_django .wym_dropdown h2 { display: block; } + .wym_skin_django .wym_dropdown ul { display: none; position: absolute; background: white; } + .wym_skin_django .wym_dropdown:hover ul, + .wym_skin_django .wym_dropdown.hover ul { display: block; } + + .wym_skin_django .wym_tools ul { padding-left: 0px !important; margin-left: 0px; } + + /*option: add this class to a section to make its elements render buttons (icons are only available for the wym_tools section for now)*/ + .wym_skin_django .wym_buttons li { float:left;} + .wym_skin_django .wym_buttons a { width: 20px; height: 20px; overflow: hidden; padding: 2px } + /*image replacements*/ + .wym_skin_django .wym_buttons li a { background: url(icons.png) no-repeat; text-indent: -9999px;} + .wym_skin_django .wym_buttons li.wym_tools_strong a { background-position: 0 -382px;} + .wym_skin_django .wym_buttons li.wym_tools_emphasis a { background-position: 0 -22px;} + .wym_skin_django .wym_buttons li.wym_tools_superscript a { background-position: 0 -430px;} + .wym_skin_django .wym_buttons li.wym_tools_subscript a { background-position: 0 -454px;} + .wym_skin_django .wym_buttons li.wym_tools_ordered_list a { background-position: 0 -48px;} + .wym_skin_django .wym_buttons li.wym_tools_unordered_list a{ background-position: 0 -72px;} + .wym_skin_django .wym_buttons li.wym_tools_indent a { background-position: 0 -574px;} + .wym_skin_django .wym_buttons li.wym_tools_outdent a { background-position: 0 -598px;} + .wym_skin_django .wym_buttons li.wym_tools_undo a { background-position: 0 -502px;} + .wym_skin_django .wym_buttons li.wym_tools_redo a { background-position: 0 -526px;} + .wym_skin_django .wym_buttons li.wym_tools_link a { background-position: 0 -96px;} + .wym_skin_django .wym_buttons li.wym_tools_unlink a { background-position: 0 -168px;} + .wym_skin_django .wym_buttons li.wym_tools_image a { background-position: 0 -121px;} + .wym_skin_django .wym_buttons li.wym_tools_table a { background-position: 0 -144px;} + .wym_skin_django .wym_buttons li.wym_tools_paste a { background-position: 0 -552px;} + .wym_skin_django .wym_buttons li.wym_tools_html a { background-position: 0 -193px;} + .wym_skin_django .wym_buttons li.wym_tools_preview a { background-position: 0 -408px;} + +/*DECORATION*/ + .wym_skin_django .wym_section h2 { background: #fff;} + .wym_skin_django .wym_section h2 span { color: gray;} + .wym_skin_django .wym_panel { padding: 0; background: white;} + .wym_skin_django .wym_panel ul { margin: 2px 0 5px; } + .wym_skin_django .wym_dropdown { padding: 0; border: solid gray; border-width: 1px 1px 0 1px; } + .wym_skin_django .wym_dropdown ul { border: solid gray; border-width: 0 1px 1px 1px; margin-left: -1px; padding: 5px 10px 5px 3px;} + +/*DIALOGS*/ + .wym_dialog div.row { margin-bottom: 5px;} + .wym_dialog div.row input { margin-right: 5px;} + .wym_dialog div.row label { float: left; width: 150px; display: block; text-align: right; margin-right: 10px; } + .wym_dialog div.row-indent { padding-left: 160px; } + /*autoclearing*/ + .wym_dialog div.row:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } + .wym_dialog div.row { display: inline-block; } + /* Hides from IE-mac \*/ + * html .wym_dialog div.row { height: 1%; } + .wym_dialog div.row { display: block; } + /* End hide from IE-mac */ + +/*WYMEDITOR_LINK*/ + a.wym_wymeditor_link { text-indent: -9999px; float: right; display: block; width: 50px; height: 15px; background: url(../wymeditor_icon.png); overflow: hidden; text-decoration: none; } diff --git a/gstudio/static/gstudio/js/wymeditor/skins/django/skin.js b/gstudio/static/gstudio/js/wymeditor/skins/django/skin.js new file mode 100644 index 0000000..47597e6 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/django/skin.js @@ -0,0 +1,42 @@ +WYMeditor.SKINS['django'] = { + + init: function(wym) { + + //render following sections as panels + jQuery(wym._box).find(wym._options.classesSelector) + .addClass("wym_panel"); + + //render following sections as buttons + jQuery(wym._box).find(wym._options.toolsSelector) + .addClass("wym_buttons"); + + //render following sections as dropdown menus + jQuery(wym._box).find(wym._options.containersSelector) + .addClass("wym_panel") + .find(WYMeditor.H2); + + //replace the status markup in h2 + wym.status(' '); + + // auto add some margin to the main area sides if left area + // or right area are not empty (if they contain sections) + jQuery(wym._box).find("div.wym_area_right ul") + .parents("div.wym_area_right").show() + .parents(wym._options.boxSelector) + .find("div.wym_area_main") + .css({"margin-right": "155px"}); + + jQuery(wym._box).find("div.wym_area_left ul") + .parents("div.wym_area_left").show() + .parents(wym._options.boxSelector) + .find("div.wym_area_main") + .css({"margin-left": "155px"}); + + //make hover work under IE < 7 + jQuery(wym._box).find(".wym_section").hover(function(){ + jQuery(this).addClass("hover"); + },function(){ + jQuery(this).removeClass("hover"); + }); + } +}; diff --git a/gstudio/static/gstudio/js/wymeditor/skins/minimal/images/bg.header.gif b/gstudio/static/gstudio/js/wymeditor/skins/minimal/images/bg.header.gif Binary files differnew file mode 100644 index 0000000..b2d2907 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/minimal/images/bg.header.gif diff --git a/gstudio/static/gstudio/js/wymeditor/skins/minimal/images/bg.selector.silver.gif b/gstudio/static/gstudio/js/wymeditor/skins/minimal/images/bg.selector.silver.gif Binary files differnew file mode 100644 index 0000000..e65976b --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/minimal/images/bg.selector.silver.gif diff --git a/gstudio/static/gstudio/js/wymeditor/skins/minimal/images/bg.wymeditor.png b/gstudio/static/gstudio/js/wymeditor/skins/minimal/images/bg.wymeditor.png Binary files differnew file mode 100644 index 0000000..1e84813 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/minimal/images/bg.wymeditor.png diff --git a/gstudio/static/gstudio/js/wymeditor/skins/minimal/images/icons.silver.gif b/gstudio/static/gstudio/js/wymeditor/skins/minimal/images/icons.silver.gif Binary files differnew file mode 100644 index 0000000..8c6a4fb --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/minimal/images/icons.silver.gif diff --git a/gstudio/static/gstudio/js/wymeditor/skins/minimal/skin.css b/gstudio/static/gstudio/js/wymeditor/skins/minimal/skin.css new file mode 100644 index 0000000..cea8d84 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/minimal/skin.css @@ -0,0 +1,131 @@ +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * skin.css + * main stylesheet for the minimal WYMeditor skin + * See the documentation for more info. + * + * File Authors: + * Jean-Francois Hovinne + * Scott Lewis (see Silver skin) +*/ + +/* Set iframe */ +.wym_skin_minimal div.wym_iframe iframe { + width: 90%; + height: 200px; +} + +/* Hide h2 by default */ +.wym_skin_minimal h2 { + display: none; +} + +/* Show specific h2 */ +.wym_skin_minimal div.wym_tools h2, +.wym_skin_minimal div.wym_containers h2, +.wym_skin_minimal div.wym_classes h2 { + display: block; +} + +.wym_skin_minimal div.wym_section ul { + margin: 0; +} + +.wym_skin_minimal div.wym_section ul li { + float: left; + list-style-type: none; + margin-right: 5px; +} + +.wym_skin_minimal div.wym_area_top, +.wym_skin_minimal div.wym_area_right, +.wym_skin_minimal div.wym_containers, +.wym_skin_minimal div.wym_classes { + float: left; +} + +.wym_skin_minimal div.wym_area_main { + clear: both; +} + +.wym_skin_minimal div.wym_html { + width: 90%; +} + +.wym_skin_minimal textarea.wym_html_val { + width: 100%; + height: 100px; +} + +/* DROPDOWNS (see Silver skin) */ +.wym_skin_minimal div.wym_dropdown { + cursor: pointer; + margin: 0px 4px 10px 0px; + padding: 0px; + z-index: 1001; + display: block; +} + +.wym_skin_minimal div.wym_dropdown ul { + display: none; + width: 124px; + padding: 0px; + margin: 0px; + list-style-type: none; + list-style-image: none; + z-index: 1002; + position: absolute; + border-top: 1px solid #AAA; +} + +.wym_skin_minimal div.wym_dropdown ul li { + width: 146px; + height: 20px; + padding: 0px; + margin: 0px; + border: 1px solid #777; + border-top: none; + background: #EEE; + list-style-image: none; +} + +.wym_skin_minimal div.wym_dropdown h2 { + width: 138px; + height: 16px; + color: #000; + background-image: url(images/bg.selector.silver.gif); + background-position: 0px -18px; + background-repeat: no-repeat; + border: none; + font-family: "Trebuchet MS", Verdana, Arial, Helvetica, Sanserif; + font-size: 12px; + font-weight: bold; + padding: 2px 0px 0px 10px; + margin: 0px; +} + +.wym_skin_minimal div.wym_dropdown a { + text-decoration: none; + font-family: "Trebuchet MS", Verdana, Arial, Helvetica, Sanserif; + font-size: 12px; + padding: 5px 0px 0px 10px; + display: block; + width: 136px; + height: 15px; + color: #000; + text-align: left; + margin-left: 0px; +} + +.wym_skin_minimal div.wym_dropdown a:hover { + background: #BBB; + border-bottom: none; +} diff --git a/gstudio/static/gstudio/js/wymeditor/skins/minimal/skin.js b/gstudio/static/gstudio/js/wymeditor/skins/minimal/skin.js new file mode 100644 index 0000000..af29ed4 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/minimal/skin.js @@ -0,0 +1,30 @@ +jQuery.fn.selectify = function() { + return this.each(function() { + jQuery(this).hover( + function() { + jQuery("h2", this).css("background-position", "0px -18px"); + jQuery("ul", this).fadeIn("fast"); + }, + function() { + jQuery("h2", this).css("background-position", ""); + jQuery("ul", this).fadeOut("fast"); + } + ); + }); +}; + +WYMeditor.SKINS['minimal'] = { + //placeholder for the skin JS, if needed + + //init the skin + //wym is the WYMeditor.editor instance + init: function(wym) { + + //render following sections as dropdown menus + jQuery(wym._box).find(wym._options.toolsSelector + ', ' + wym._options.containersSelector + ', ' + wym._options.classesSelector) + .addClass("wym_dropdown") + .selectify(); + + + } +}; diff --git a/gstudio/static/gstudio/js/wymeditor/skins/silver/COPYING b/gstudio/static/gstudio/js/wymeditor/skins/silver/COPYING new file mode 100644 index 0000000..94a9ed0 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/silver/COPYING @@ -0,0 +1,674 @@ + GNU GENERAL PUBLIC LICENSE + Version 3, 29 June 2007 + + Copyright (C) 2007 Free Software Foundation, Inc. <http://fsf.org/> + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + + Preamble + + The GNU General Public License is a free, copyleft license for +software and other kinds of works. + + The licenses for most software and other practical works are designed +to take away your freedom to share and change the works. By contrast, +the GNU General Public License is intended to guarantee your freedom to +share and change all versions of a program--to make sure it remains free +software for all its users. We, the Free Software Foundation, use the +GNU General Public License for most of our software; it applies also to +any other work released this way by its authors. You can apply it to +your programs, too. + + When we speak of free software, we are referring to freedom, not +price. Our General Public Licenses are designed to make sure that you +have the freedom to distribute copies of free software (and charge for +them if you wish), that you receive source code or can get it if you +want it, that you can change the software or use pieces of it in new +free programs, and that you know you can do these things. + + To protect your rights, we need to prevent others from denying you +these rights or asking you to surrender the rights. Therefore, you have +certain responsibilities if you distribute copies of the software, or if +you modify it: responsibilities to respect the freedom of others. + + For example, if you distribute copies of such a program, whether +gratis or for a fee, you must pass on to the recipients the same +freedoms that you received. You must make sure that they, too, receive +or can get the source code. And you must show them these terms so they +know their rights. + + Developers that use the GNU GPL protect your rights with two steps: +(1) assert copyright on the software, and (2) offer you this License +giving you legal permission to copy, distribute and/or modify it. + + For the developers' and authors' protection, the GPL clearly explains +that there is no warranty for this free software. For both users' and +authors' sake, the GPL requires that modified versions be marked as +changed, so that their problems will not be attributed erroneously to +authors of previous versions. + + Some devices are designed to deny users access to install or run +modified versions of the software inside them, although the manufacturer +can do so. This is fundamentally incompatible with the aim of +protecting users' freedom to change the software. The systematic +pattern of such abuse occurs in the area of products for individuals to +use, which is precisely where it is most unacceptable. Therefore, we +have designed this version of the GPL to prohibit the practice for those +products. If such problems arise substantially in other domains, we +stand ready to extend this provision to those domains in future versions +of the GPL, as needed to protect the freedom of users. + + Finally, every program is threatened constantly by software patents. +States should not allow patents to restrict development and use of +software on general-purpose computers, but in those that do, we wish to +avoid the special danger that patents applied to a free program could +make it effectively proprietary. To prevent this, the GPL assures that +patents cannot be used to render the program non-free. + + The precise terms and conditions for copying, distribution and +modification follow. + + TERMS AND CONDITIONS + + 0. Definitions. + + "This License" refers to version 3 of the GNU General Public License. + + "Copyright" also means copyright-like laws that apply to other kinds of +works, such as semiconductor masks. + + "The Program" refers to any copyrightable work licensed under this +License. Each licensee is addressed as "you". "Licensees" and +"recipients" may be individuals or organizations. + + To "modify" a work means to copy from or adapt all or part of the work +in a fashion requiring copyright permission, other than the making of an +exact copy. The resulting work is called a "modified version" of the +earlier work or a work "based on" the earlier work. + + A "covered work" means either the unmodified Program or a work based +on the Program. + + To "propagate" a work means to do anything with it that, without +permission, would make you directly or secondarily liable for +infringement under applicable copyright law, except executing it on a +computer or modifying a private copy. Propagation includes copying, +distribution (with or without modification), making available to the +public, and in some countries other activities as well. + + To "convey" a work means any kind of propagation that enables other +parties to make or receive copies. Mere interaction with a user through +a computer network, with no transfer of a copy, is not conveying. + + An interactive user interface displays "Appropriate Legal Notices" +to the extent that it includes a convenient and prominently visible +feature that (1) displays an appropriate copyright notice, and (2) +tells the user that there is no warranty for the work (except to the +extent that warranties are provided), that licensees may convey the +work under this License, and how to view a copy of this License. If +the interface presents a list of user commands or options, such as a +menu, a prominent item in the list meets this criterion. + + 1. Source Code. + + The "source code" for a work means the preferred form of the work +for making modifications to it. "Object code" means any non-source +form of a work. + + A "Standard Interface" means an interface that either is an official +standard defined by a recognized standards body, or, in the case of +interfaces specified for a particular programming language, one that +is widely used among developers working in that language. + + The "System Libraries" of an executable work include anything, other +than the work as a whole, that (a) is included in the normal form of +packaging a Major Component, but which is not part of that Major +Component, and (b) serves only to enable use of the work with that +Major Component, or to implement a Standard Interface for which an +implementation is available to the public in source code form. A +"Major Component", in this context, means a major essential component +(kernel, window system, and so on) of the specific operating system +(if any) on which the executable work runs, or a compiler used to +produce the work, or an object code interpreter used to run it. + + The "Corresponding Source" for a work in object code form means all +the source code needed to generate, install, and (for an executable +work) run the object code and to modify the work, including scripts to +control those activities. However, it does not include the work's +System Libraries, or general-purpose tools or generally available free +programs which are used unmodified in performing those activities but +which are not part of the work. For example, Corresponding Source +includes interface definition files associated with source files for +the work, and the source code for shared libraries and dynamically +linked subprograms that the work is specifically designed to require, +such as by intimate data communication or control flow between those +subprograms and other parts of the work. + + The Corresponding Source need not include anything that users +can regenerate automatically from other parts of the Corresponding +Source. + + The Corresponding Source for a work in source code form is that +same work. + + 2. Basic Permissions. + + All rights granted under this License are granted for the term of +copyright on the Program, and are irrevocable provided the stated +conditions are met. This License explicitly affirms your unlimited +permission to run the unmodified Program. The output from running a +covered work is covered by this License only if the output, given its +content, constitutes a covered work. This License acknowledges your +rights of fair use or other equivalent, as provided by copyright law. + + You may make, run and propagate covered works that you do not +convey, without conditions so long as your license otherwise remains +in force. You may convey covered works to others for the sole purpose +of having them make modifications exclusively for you, or provide you +with facilities for running those works, provided that you comply with +the terms of this License in conveying all material for which you do +not control copyright. Those thus making or running the covered works +for you must do so exclusively on your behalf, under your direction +and control, on terms that prohibit them from making any copies of +your copyrighted material outside their relationship with you. + + Conveying under any other circumstances is permitted solely under +the conditions stated below. Sublicensing is not allowed; section 10 +makes it unnecessary. + + 3. Protecting Users' Legal Rights From Anti-Circumvention Law. + + No covered work shall be deemed part of an effective technological +measure under any applicable law fulfilling obligations under article +11 of the WIPO copyright treaty adopted on 20 December 1996, or +similar laws prohibiting or restricting circumvention of such +measures. + + When you convey a covered work, you waive any legal power to forbid +circumvention of technological measures to the extent such circumvention +is effected by exercising rights under this License with respect to +the covered work, and you disclaim any intention to limit operation or +modification of the work as a means of enforcing, against the work's +users, your or third parties' legal rights to forbid circumvention of +technological measures. + + 4. Conveying Verbatim Copies. + + You may convey verbatim copies of the Program's source code as you +receive it, in any medium, provided that you conspicuously and +appropriately publish on each copy an appropriate copyright notice; +keep intact all notices stating that this License and any +non-permissive terms added in accord with section 7 apply to the code; +keep intact all notices of the absence of any warranty; and give all +recipients a copy of this License along with the Program. + + You may charge any price or no price for each copy that you convey, +and you may offer support or warranty protection for a fee. + + 5. Conveying Modified Source Versions. + + You may convey a work based on the Program, or the modifications to +produce it from the Program, in the form of source code under the +terms of section 4, provided that you also meet all of these conditions: + + a) The work must carry prominent notices stating that you modified + it, and giving a relevant date. + + b) The work must carry prominent notices stating that it is + released under this License and any conditions added under section + 7. This requirement modifies the requirement in section 4 to + "keep intact all notices". + + c) You must license the entire work, as a whole, under this + License to anyone who comes into possession of a copy. This + License will therefore apply, along with any applicable section 7 + additional terms, to the whole of the work, and all its parts, + regardless of how they are packaged. This License gives no + permission to license the work in any other way, but it does not + invalidate such permission if you have separately received it. + + d) If the work has interactive user interfaces, each must display + Appropriate Legal Notices; however, if the Program has interactive + interfaces that do not display Appropriate Legal Notices, your + work need not make them do so. + + A compilation of a covered work with other separate and independent +works, which are not by their nature extensions of the covered work, +and which are not combined with it such as to form a larger program, +in or on a volume of a storage or distribution medium, is called an +"aggregate" if the compilation and its resulting copyright are not +used to limit the access or legal rights of the compilation's users +beyond what the individual works permit. Inclusion of a covered work +in an aggregate does not cause this License to apply to the other +parts of the aggregate. + + 6. Conveying Non-Source Forms. + + You may convey a covered work in object code form under the terms +of sections 4 and 5, provided that you also convey the +machine-readable Corresponding Source under the terms of this License, +in one of these ways: + + a) Convey the object code in, or embodied in, a physical product + (including a physical distribution medium), accompanied by the + Corresponding Source fixed on a durable physical medium + customarily used for software interchange. + + b) Convey the object code in, or embodied in, a physical product + (including a physical distribution medium), accompanied by a + written offer, valid for at least three years and valid for as + long as you offer spare parts or customer support for that product + model, to give anyone who possesses the object code either (1) a + copy of the Corresponding Source for all the software in the + product that is covered by this License, on a durable physical + medium customarily used for software interchange, for a price no + more than your reasonable cost of physically performing this + conveying of source, or (2) access to copy the + Corresponding Source from a network server at no charge. + + c) Convey individual copies of the object code with a copy of the + written offer to provide the Corresponding Source. This + alternative is allowed only occasionally and noncommercially, and + only if you received the object code with such an offer, in accord + with subsection 6b. + + d) Convey the object code by offering access from a designated + place (gratis or for a charge), and offer equivalent access to the + Corresponding Source in the same way through the same place at no + further charge. You need not require recipients to copy the + Corresponding Source along with the object code. If the place to + copy the object code is a network server, the Corresponding Source + may be on a different server (operated by you or a third party) + that supports equivalent copying facilities, provided you maintain + clear directions next to the object code saying where to find the + Corresponding Source. Regardless of what server hosts the + Corresponding Source, you remain obligated to ensure that it is + available for as long as needed to satisfy these requirements. + + e) Convey the object code using peer-to-peer transmission, provided + you inform other peers where the object code and Corresponding + Source of the work are being offered to the general public at no + charge under subsection 6d. + + A separable portion of the object code, whose source code is excluded +from the Corresponding Source as a System Library, need not be +included in conveying the object code work. + + A "User Product" is either (1) a "consumer product", which means any +tangible personal property which is normally used for personal, family, +or household purposes, or (2) anything designed or sold for incorporation +into a dwelling. In determining whether a product is a consumer product, +doubtful cases shall be resolved in favor of coverage. For a particular +product received by a particular user, "normally used" refers to a +typical or common use of that class of product, regardless of the status +of the particular user or of the way in which the particular user +actually uses, or expects or is expected to use, the product. A product +is a consumer product regardless of whether the product has substantial +commercial, industrial or non-consumer uses, unless such uses represent +the only significant mode of use of the product. + + "Installation Information" for a User Product means any methods, +procedures, authorization keys, or other information required to install +and execute modified versions of a covered work in that User Product from +a modified version of its Corresponding Source. The information must +suffice to ensure that the continued functioning of the modified object +code is in no case prevented or interfered with solely because +modification has been made. + + If you convey an object code work under this section in, or with, or +specifically for use in, a User Product, and the conveying occurs as +part of a transaction in which the right of possession and use of the +User Product is transferred to the recipient in perpetuity or for a +fixed term (regardless of how the transaction is characterized), the +Corresponding Source conveyed under this section must be accompanied +by the Installation Information. But this requirement does not apply +if neither you nor any third party retains the ability to install +modified object code on the User Product (for example, the work has +been installed in ROM). + + The requirement to provide Installation Information does not include a +requirement to continue to provide support service, warranty, or updates +for a work that has been modified or installed by the recipient, or for +the User Product in which it has been modified or installed. Access to a +network may be denied when the modification itself materially and +adversely affects the operation of the network or violates the rules and +protocols for communication across the network. + + Corresponding Source conveyed, and Installation Information provided, +in accord with this section must be in a format that is publicly +documented (and with an implementation available to the public in +source code form), and must require no special password or key for +unpacking, reading or copying. + + 7. Additional Terms. + + "Additional permissions" are terms that supplement the terms of this +License by making exceptions from one or more of its conditions. +Additional permissions that are applicable to the entire Program shall +be treated as though they were included in this License, to the extent +that they are valid under applicable law. If additional permissions +apply only to part of the Program, that part may be used separately +under those permissions, but the entire Program remains governed by +this License without regard to the additional permissions. + + When you convey a copy of a covered work, you may at your option +remove any additional permissions from that copy, or from any part of +it. (Additional permissions may be written to require their own +removal in certain cases when you modify the work.) You may place +additional permissions on material, added by you to a covered work, +for which you have or can give appropriate copyright permission. + + Notwithstanding any other provision of this License, for material you +add to a covered work, you may (if authorized by the copyright holders of +that material) supplement the terms of this License with terms: + + a) Disclaiming warranty or limiting liability differently from the + terms of sections 15 and 16 of this License; or + + b) Requiring preservation of specified reasonable legal notices or + author attributions in that material or in the Appropriate Legal + Notices displayed by works containing it; or + + c) Prohibiting misrepresentation of the origin of that material, or + requiring that modified versions of such material be marked in + reasonable ways as different from the original version; or + + d) Limiting the use for publicity purposes of names of licensors or + authors of the material; or + + e) Declining to grant rights under trademark law for use of some + trade names, trademarks, or service marks; or + + f) Requiring indemnification of licensors and authors of that + material by anyone who conveys the material (or modified versions of + it) with contractual assumptions of liability to the recipient, for + any liability that these contractual assumptions directly impose on + those licensors and authors. + + All other non-permissive additional terms are considered "further +restrictions" within the meaning of section 10. If the Program as you +received it, or any part of it, contains a notice stating that it is +governed by this License along with a term that is a further +restriction, you may remove that term. If a license document contains +a further restriction but permits relicensing or conveying under this +License, you may add to a covered work material governed by the terms +of that license document, provided that the further restriction does +not survive such relicensing or conveying. + + If you add terms to a covered work in accord with this section, you +must place, in the relevant source files, a statement of the +additional terms that apply to those files, or a notice indicating +where to find the applicable terms. + + Additional terms, permissive or non-permissive, may be stated in the +form of a separately written license, or stated as exceptions; +the above requirements apply either way. + + 8. Termination. + + You may not propagate or modify a covered work except as expressly +provided under this License. Any attempt otherwise to propagate or +modify it is void, and will automatically terminate your rights under +this License (including any patent licenses granted under the third +paragraph of section 11). + + However, if you cease all violation of this License, then your +license from a particular copyright holder is reinstated (a) +provisionally, unless and until the copyright holder explicitly and +finally terminates your license, and (b) permanently, if the copyright +holder fails to notify you of the violation by some reasonable means +prior to 60 days after the cessation. + + Moreover, your license from a particular copyright holder is +reinstated permanently if the copyright holder notifies you of the +violation by some reasonable means, this is the first time you have +received notice of violation of this License (for any work) from that +copyright holder, and you cure the violation prior to 30 days after +your receipt of the notice. + + Termination of your rights under this section does not terminate the +licenses of parties who have received copies or rights from you under +this License. If your rights have been terminated and not permanently +reinstated, you do not qualify to receive new licenses for the same +material under section 10. + + 9. Acceptance Not Required for Having Copies. + + You are not required to accept this License in order to receive or +run a copy of the Program. Ancillary propagation of a covered work +occurring solely as a consequence of using peer-to-peer transmission +to receive a copy likewise does not require acceptance. However, +nothing other than this License grants you permission to propagate or +modify any covered work. These actions infringe copyright if you do +not accept this License. Therefore, by modifying or propagating a +covered work, you indicate your acceptance of this License to do so. + + 10. Automatic Licensing of Downstream Recipients. + + Each time you convey a covered work, the recipient automatically +receives a license from the original licensors, to run, modify and +propagate that work, subject to this License. You are not responsible +for enforcing compliance by third parties with this License. + + An "entity transaction" is a transaction transferring control of an +organization, or substantially all assets of one, or subdividing an +organization, or merging organizations. If propagation of a covered +work results from an entity transaction, each party to that +transaction who receives a copy of the work also receives whatever +licenses to the work the party's predecessor in interest had or could +give under the previous paragraph, plus a right to possession of the +Corresponding Source of the work from the predecessor in interest, if +the predecessor has it or can get it with reasonable efforts. + + You may not impose any further restrictions on the exercise of the +rights granted or affirmed under this License. For example, you may +not impose a license fee, royalty, or other charge for exercise of +rights granted under this License, and you may not initiate litigation +(including a cross-claim or counterclaim in a lawsuit) alleging that +any patent claim is infringed by making, using, selling, offering for +sale, or importing the Program or any portion of it. + + 11. Patents. + + A "contributor" is a copyright holder who authorizes use under this +License of the Program or a work on which the Program is based. The +work thus licensed is called the contributor's "contributor version". + + A contributor's "essential patent claims" are all patent claims +owned or controlled by the contributor, whether already acquired or +hereafter acquired, that would be infringed by some manner, permitted +by this License, of making, using, or selling its contributor version, +but do not include claims that would be infringed only as a +consequence of further modification of the contributor version. For +purposes of this definition, "control" includes the right to grant +patent sublicenses in a manner consistent with the requirements of +this License. + + Each contributor grants you a non-exclusive, worldwide, royalty-free +patent license under the contributor's essential patent claims, to +make, use, sell, offer for sale, import and otherwise run, modify and +propagate the contents of its contributor version. + + In the following three paragraphs, a "patent license" is any express +agreement or commitment, however denominated, not to enforce a patent +(such as an express permission to practice a patent or covenant not to +sue for patent infringement). To "grant" such a patent license to a +party means to make such an agreement or commitment not to enforce a +patent against the party. + + If you convey a covered work, knowingly relying on a patent license, +and the Corresponding Source of the work is not available for anyone +to copy, free of charge and under the terms of this License, through a +publicly available network server or other readily accessible means, +then you must either (1) cause the Corresponding Source to be so +available, or (2) arrange to deprive yourself of the benefit of the +patent license for this particular work, or (3) arrange, in a manner +consistent with the requirements of this License, to extend the patent +license to downstream recipients. "Knowingly relying" means you have +actual knowledge that, but for the patent license, your conveying the +covered work in a country, or your recipient's use of the covered work +in a country, would infringe one or more identifiable patents in that +country that you have reason to believe are valid. + + If, pursuant to or in connection with a single transaction or +arrangement, you convey, or propagate by procuring conveyance of, a +covered work, and grant a patent license to some of the parties +receiving the covered work authorizing them to use, propagate, modify +or convey a specific copy of the covered work, then the patent license +you grant is automatically extended to all recipients of the covered +work and works based on it. + + A patent license is "discriminatory" if it does not include within +the scope of its coverage, prohibits the exercise of, or is +conditioned on the non-exercise of one or more of the rights that are +specifically granted under this License. You may not convey a covered +work if you are a party to an arrangement with a third party that is +in the business of distributing software, under which you make payment +to the third party based on the extent of your activity of conveying +the work, and under which the third party grants, to any of the +parties who would receive the covered work from you, a discriminatory +patent license (a) in connection with copies of the covered work +conveyed by you (or copies made from those copies), or (b) primarily +for and in connection with specific products or compilations that +contain the covered work, unless you entered into that arrangement, +or that patent license was granted, prior to 28 March 2007. + + Nothing in this License shall be construed as excluding or limiting +any implied license or other defenses to infringement that may +otherwise be available to you under applicable patent law. + + 12. No Surrender of Others' Freedom. + + If conditions are imposed on you (whether by court order, agreement or +otherwise) that contradict the conditions of this License, they do not +excuse you from the conditions of this License. If you cannot convey a +covered work so as to satisfy simultaneously your obligations under this +License and any other pertinent obligations, then as a consequence you may +not convey it at all. For example, if you agree to terms that obligate you +to collect a royalty for further conveying from those to whom you convey +the Program, the only way you could satisfy both those terms and this +License would be to refrain entirely from conveying the Program. + + 13. Use with the GNU Affero General Public License. + + Notwithstanding any other provision of this License, you have +permission to link or combine any covered work with a work licensed +under version 3 of the GNU Affero General Public License into a single +combined work, and to convey the resulting work. The terms of this +License will continue to apply to the part which is the covered work, +but the special requirements of the GNU Affero General Public License, +section 13, concerning interaction through a network will apply to the +combination as such. + + 14. Revised Versions of this License. + + The Free Software Foundation may publish revised and/or new versions of +the GNU General Public License from time to time. Such new versions will +be similar in spirit to the present version, but may differ in detail to +address new problems or concerns. + + Each version is given a distinguishing version number. If the +Program specifies that a certain numbered version of the GNU General +Public License "or any later version" applies to it, you have the +option of following the terms and conditions either of that numbered +version or of any later version published by the Free Software +Foundation. If the Program does not specify a version number of the +GNU General Public License, you may choose any version ever published +by the Free Software Foundation. + + If the Program specifies that a proxy can decide which future +versions of the GNU General Public License can be used, that proxy's +public statement of acceptance of a version permanently authorizes you +to choose that version for the Program. + + Later license versions may give you additional or different +permissions. However, no additional obligations are imposed on any +author or copyright holder as a result of your choosing to follow a +later version. + + 15. Disclaimer of Warranty. + + THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY +APPLICABLE LAW. EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT +HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY +OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, +THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM +IS WITH YOU. SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF +ALL NECESSARY SERVICING, REPAIR OR CORRECTION. + + 16. Limitation of Liability. + + IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING +WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MODIFIES AND/OR CONVEYS +THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY +GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE +USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF +DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD +PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS), +EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF +SUCH DAMAGES. + + 17. Interpretation of Sections 15 and 16. + + If the disclaimer of warranty and limitation of liability provided +above cannot be given local legal effect according to their terms, +reviewing courts shall apply local law that most closely approximates +an absolute waiver of all civil liability in connection with the +Program, unless a warranty or assumption of liability accompanies a +copy of the Program in return for a fee. + + END OF TERMS AND CONDITIONS + + How to Apply These Terms to Your New Programs + + If you develop a new program, and you want it to be of the greatest +possible use to the public, the best way to achieve this is to make it +free software which everyone can redistribute and change under these terms. + + To do so, attach the following notices to the program. It is safest +to attach them to the start of each source file to most effectively +state the exclusion of warranty; and each file should have at least +the "copyright" line and a pointer to where the full notice is found. + + <one line to give the program's name and a brief idea of what it does.> + Copyright (C) <year> <name of author> + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. + + This program is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + You should have received a copy of the GNU General Public License + along with this program. If not, see <http://www.gnu.org/licenses/>. + +Also add information on how to contact you by electronic and paper mail. + + If the program does terminal interaction, make it output a short +notice like this when it starts in an interactive mode: + + <program> Copyright (C) <year> <name of author> + This program comes with ABSOLUTELY NO WARRANTY; for details type `show w'. + This is free software, and you are welcome to redistribute it + under certain conditions; type `show c' for details. + +The hypothetical commands `show w' and `show c' should show the appropriate +parts of the General Public License. Of course, your program's commands +might be different; for a GUI interface, you would use an "about box". + + You should also get your employer (if you work as a programmer) or school, +if any, to sign a "copyright disclaimer" for the program, if necessary. +For more information on this, and how to apply and follow the GNU GPL, see +<http://www.gnu.org/licenses/>. + + The GNU General Public License does not permit incorporating your program +into proprietary programs. If your program is a subroutine library, you +may consider it more useful to permit linking proprietary applications with +the library. If this is what you want to do, use the GNU Lesser General +Public License instead of this License. But first, please read +<http://www.gnu.org/philosophy/why-not-lgpl.html>. diff --git a/gstudio/static/gstudio/js/wymeditor/skins/silver/README b/gstudio/static/gstudio/js/wymeditor/skins/silver/README new file mode 100644 index 0000000..130dc46 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/silver/README @@ -0,0 +1,27 @@ +/** +* @version Alpha 0.1 2008-05-10 23:28:43 $ +* @package Silver skin for WYMeditor +* @copyright Copyright (C) 2008 Scott Edwin Lewis. All rights reserved. +* @license GNU/GPL, see COPYING +* Silver skin for WYMeditor is free software and is licensed under the +* GNU General Public License. See COPYING for copyright notices and details. +*/ + +Adds custom buttons and color palette to the WYMeditor XHTML Editor. + +INSTALLATION: + +1. Copy the entire /silver/ directory to /wymeditor/skins/ +2. Initialize the WYMeditor 'skin' option as below: + +<script type="text/javascript"> +jQuery(function() { + + jQuery('.wymeditor').wymeditor({ + skin: 'silver' + }); + +}); +</script> + +That's it. You're done. diff --git a/gstudio/static/gstudio/js/wymeditor/skins/silver/images/bg.header.gif b/gstudio/static/gstudio/js/wymeditor/skins/silver/images/bg.header.gif Binary files differnew file mode 100644 index 0000000..b2d2907 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/silver/images/bg.header.gif diff --git a/gstudio/static/gstudio/js/wymeditor/skins/silver/images/bg.selector.silver.gif b/gstudio/static/gstudio/js/wymeditor/skins/silver/images/bg.selector.silver.gif Binary files differnew file mode 100644 index 0000000..e65976b --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/silver/images/bg.selector.silver.gif diff --git a/gstudio/static/gstudio/js/wymeditor/skins/silver/images/bg.wymeditor.png b/gstudio/static/gstudio/js/wymeditor/skins/silver/images/bg.wymeditor.png Binary files differnew file mode 100644 index 0000000..1e84813 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/silver/images/bg.wymeditor.png diff --git a/gstudio/static/gstudio/js/wymeditor/skins/silver/images/icons.silver.gif b/gstudio/static/gstudio/js/wymeditor/skins/silver/images/icons.silver.gif Binary files differnew file mode 100644 index 0000000..8c6a4fb --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/silver/images/icons.silver.gif diff --git a/gstudio/static/gstudio/js/wymeditor/skins/silver/skin.css b/gstudio/static/gstudio/js/wymeditor/skins/silver/skin.css new file mode 100644 index 0000000..8284d81 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/silver/skin.css @@ -0,0 +1,297 @@ +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * screen.css + * main stylesheet for the default WYMeditor skin + * See the documentation for more info. + * + * File Authors: + * Daniel Reszka (d.reszka a-t wymeditor dotorg) + * Scott Edwin Lewis +*/ + +/*TRYING TO RESET STYLES THAT MAY INTERFERE WITH WYMEDITOR*/ + .wym_skin_silver p, .wym_skin_silver h2, .wym_skin_silver h3, + .wym_skin_silver ul, .wym_skin_silver li { background: transparent url(); margin: 0; padding: 0; border-width:0; list-style: none; } + + +/*HIDDEN BY DEFAULT*/ + .wym_skin_silver .wym_area_left { display: none; } + .wym_skin_silver .wym_area_right { display: block; } + + +/*TYPO*/ + .wym_skin_silver { font-size: 62.5%; font-family: Verdana, Arial, sans-serif; } + .wym_skin_silver h2 { font-size: 110%; /* = 11px */} + .wym_skin_silver h3 { font-size: 100%; /* = 10px */} + .wym_skin_silver li { font-size: 100%; /* = 10px */} + + +/*WYM_BOX*/ + .wym_skin_silver { border: 1px solid gray; background: #f2f2f2; padding: 0px; margin: 0px;} + + /*auto-clear the wym_box*/ + .wym_skin_silver:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } + * html .wym_skin_silver { height: 1%;} + + +/*WYM_HTML*/ + .wym_skin_silver .wym_html { width: 98%;} + .wym_skin_silver .wym_html textarea { width: 100%; height: 200px; border: 1px solid gray; background: white; } + + +/*WYM_IFRAME*/ + .wym_skin_silver .wym_iframe { width: 98%;} + .wym_skin_silver .wym_iframe iframe { width: 100%; height: 200px; border: 1px solid gray; background: white } + + +/*AREAS*/ + .wym_skin_silver .wym_area_left { width: 150px; float: left;} + .wym_skin_silver .wym_area_right { width: 150px; float: right;} + .wym_skin_silver .wym_area_bottom { height: 1%; clear: both;} + * html .wym_skin_silver .wym_area_main { height: 1%;} + * html .wym_skin_silver .wym_area_top { height: 1%;} + *+html .wym_skin_silver .wym_area_top { height: 1%;} + +/*SECTIONS SYSTEM*/ + + /*common defaults for all sections*/ + .wym_skin_silver .wym_section { margin-bottom: 5px; } + .wym_skin_silver .wym_section h2, + .wym_skin_silver .wym_section h3 { padding: 1px 3px; margin: 0; cursor: pointer; } + .wym_skin_silver .wym_section a { padding: 5px 0px 0px 10px; display: block; text-decoration: none; color: black; } + .wym_skin_silver .wym_section a:hover { /*background-color: #DDD;*/} + /*hide section titles by default*/ + .wym_skin_silver .wym_section h2 { display: none; } + /*disable any margin-collapse*/ + .wym_skin_silver .wym_section { padding-top: 1px; padding-bottom: 1px; } + /*auto-clear sections*/ + .wym_skin_silver .wym_section ul:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; padding: 0px; } + * html .wym_skin_silver .wym_section ul { height: 1%;} + .wym_skin_silver .wym_section li {} + + /*option: add this class to a section to make it render as a panel*/ + .wym_skin_silver .wym_panel { } + .wym_skin_silver .wym_panel h2 { display: block; font-size: 11px; } + + /*option: add this class to a section to make it render as a dropdown menu*/ + .wym_skin_silver .wym_dropdown h2 { display: block; font-size: 11px;} + .wym_skin_silver .wym_dropdown ul { position: absolute; background: white; padding: 0px;} + .wym_skin_silver .wym_dropdown:hover ul, + .wym_skin_silver .wym_dropdown.hover ul { cursor: pointer;} + .wym_skin_silver .wym_dropdown ul li a {/*border-bottom: 1px solid #AAA;*/} + + /*option: add this class to a section to make its elements render buttons (icons are only available for the wym_tools section for now)*/ + .wym_skin_silver .wym_buttons li { float:left;} + .wym_skin_silver .wym_buttons a { width: 20px; height: 20px; overflow: hidden; padding: 2px; text-decoration: none !important; border: 1px solid #666; } + .wym_skin_silver .wym_buttons a:hover { text-decoration: none !important; border: 1px solid #000;} + /*image replacements*/ + .wym_skin_silver .wym_buttons li a { background: url(images/icons.silver.gif) no-repeat; text-indent: -9999px;} + .wym_skin_silver .wym_buttons li.wym_tools_strong a { background-position: 0 -384px;} + .wym_skin_silver .wym_buttons li.wym_tools_emphasis a { background-position: 0 -24px;} + .wym_skin_silver .wym_buttons li.wym_tools_superscript a { background-position: 0 -432px;} + .wym_skin_silver .wym_buttons li.wym_tools_subscript a { background-position: 0 -456px;} + .wym_skin_silver .wym_buttons li.wym_tools_ordered_list a { background-position: 0 -48px;} + .wym_skin_silver .wym_buttons li.wym_tools_unordered_list a{ background-position: 0 -72px;} + .wym_skin_silver .wym_buttons li.wym_tools_indent a { background-position: 0 -600px;} + .wym_skin_silver .wym_buttons li.wym_tools_outdent a { background-position: 0 -624px;} + .wym_skin_silver .wym_buttons li.wym_tools_undo a { background-position: 0 -504px;} + .wym_skin_silver .wym_buttons li.wym_tools_redo a { background-position: 0 -528px;} + .wym_skin_silver .wym_buttons li.wym_tools_link a { background-position: 0 -96px;} + .wym_skin_silver .wym_buttons li.wym_tools_unlink a { background-position: 0 -168px;} + .wym_skin_silver .wym_buttons li.wym_tools_image a { background-position: 0 -120px;} + .wym_skin_silver .wym_buttons li.wym_tools_table a { background-position: 0 -144px;} + .wym_skin_silver .wym_buttons li.wym_tools_paste a { background-position: 0 -552px;} + .wym_skin_silver .wym_buttons li.wym_tools_html a { background-position: 0 -192px;} + .wym_skin_silver .wym_buttons li.wym_tools_preview a { background-position: 0 -408px;} + .wym_skin_silver .wym_buttons li.wym_tools_gadget a { background-position: 0 -576px;} + + .wym_skin_silver .wym_buttons li.wym_tools_strong a:hover { background-position: -24px -384px;} + .wym_skin_silver .wym_buttons li.wym_tools_emphasis a:hover { background-position: -24px -24px;} + .wym_skin_silver .wym_buttons li.wym_tools_superscript a:hover { background-position: -24px -432px;} + .wym_skin_silver .wym_buttons li.wym_tools_subscript a:hover { background-position: -24px -456px;} + .wym_skin_silver .wym_buttons li.wym_tools_ordered_list a:hover { background-position: -24px -48px;} + .wym_skin_silver .wym_buttons li.wym_tools_unordered_list a:hover{ background-position: -24px -72px;} + .wym_skin_silver .wym_buttons li.wym_tools_indent a:hover { background-position: -24px -600px;} + .wym_skin_silver .wym_buttons li.wym_tools_outdent a:hover { background-position: -24px -624px;} + .wym_skin_silver .wym_buttons li.wym_tools_undo a:hover { background-position: -24px -504px;} + .wym_skin_silver .wym_buttons li.wym_tools_redo a:hover { background-position: -24px -528px;} + .wym_skin_silver .wym_buttons li.wym_tools_link a:hover { background-position: -24px -96px;} + .wym_skin_silver .wym_buttons li.wym_tools_unlink a:hover { background-position: -24px -168px;} + .wym_skin_silver .wym_buttons li.wym_tools_image a:hover { background-position: -24px -120px;} + .wym_skin_silver .wym_buttons li.wym_tools_table a:hover { background-position: -24px -144px;} + .wym_skin_silver .wym_buttons li.wym_tools_paste a:hover { background-position: -24px -552px;} + .wym_skin_silver .wym_buttons li.wym_tools_html a:hover { background-position: -24px -192px;} + .wym_skin_silver .wym_buttons li.wym_tools_preview a:hover { background-position: -24px -408px;} + .wym_skin_silver .wym_buttons li.wym_tools_gadget a:hover { background-position: -24px -576px;} + +/*DECORATION*/ + .wym_skin_silver .wym_section h2 { background: #ddd; border: none;} + .wym_skin_silver .wym_section h2 span { color: gray;} + .wym_skin_silver .wym_panel { padding: 0; border: solid gray; border-width: 0px;} + .wym_skin_silver .wym_panel ul { margin: 2px 0 5px; } + .wym_skin_silver .wym_dropdown { padding: 0; border: none; } + .wym_skin_silver .wym_dropdown ul { border: none; margin-left: -1px; padding: 0px;} + +/*DIALOGS*/ + .wym_dialog div.row { margin-bottom: 5px;} + .wym_dialog div.row input { margin-right: 5px;} + .wym_dialog div.row label { float: left; width: 150px; display: block; text-align: right; margin-right: 10px; } + .wym_dialog div.row-indent { padding-left: 160px; } + /*autoclearing*/ + .wym_dialog div.row:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } + .wym_dialog div.row { display: inline-block; } + /* Hides from IE-mac \*/ + * html .wym_dialog div.row { height: 1%; } + .wym_dialog div.row { display: block; } + /* End hide from IE-mac */ + +/*WYMEDITOR_LINK*/ + a.wym_wymeditor_link + { + text-indent: -9999px; + float: right; + display: block; + width: 50px; + height: 15px; + background: url(../wymeditor_icon.png); + background-position: 1px 1px; + background-repeat: no-repeat; + overflow: hidden; + text-decoration: none; + padding: 1px !important; + border: 1px solid #333 !important; + background-color: #FFF !important; + } + +.wym_box +{ + padding: 0px !important; + margin: 0px; +} +.wym_inner +{ + border-left: 1px solid #FFF; + border-top: 1px solid #FFF; + border-right: 1px solid #FFF; + border-bottom: 1px solid #FFF; + padding: 5px; + background-color: #B8C1C4; + height: auto; +} + +.clear {clear: both;} + +div.wym_dropdown +{ + cursor: pointer; + width: 138px !important; + margin: 0px 4px 10px 0px !important; + padding: 0px; + z-index: 1001; + display: block; + border: 1px solid red; +} + +div.wym_dropdown ul +{ + display: none; + width: 124px; + padding: 0px !important; + margin: 0px !important; + list-style-type: none; + list-style-image: none; + z-index: 1002; + position: absolute; + border-top: 1px solid #AAA; +} + +div.wym_dropdown ul li +{ + width: 146px; + height: 20px; + padding: 0px !important; + margin: 0px; + border: 1px solid #777; + border-top: none; + background: #DDD; + list-style-image: none; +} + +div.wym_dropdown h2 +{ + width: 138px; + height: 16px; + color: #000 !important; + background-image: url(images/bg.selector.silver.gif) !important; + background-position: 0px -18px; + background-repeat: no-repeat; + border: none; + font-family: "Trebuchet MS", Verdana, Arial, Helvetica, Sanserif; + font-size: 12px !important; + font-weight: bold !important; + padding: 2px 0px 0px 10px !important; + margin: 0px !important; +} + +.wym_skin_silver .wym_panel h2 +{ + width: 138px; + height: 16px; + color: #000 !important; + background-image: url(images/bg.header.gif) !important; + background-position: 0px 0px; + background-repeat: no-repeat; + border: none; + font-family: "Trebuchet MS", Verdana, Arial, Helvetica, Sanserif; + font-size: 12px !important; + font-weight: bold !important; + padding: 2px 0px 0px 10px !important; + margin: 0px !important; +} + +.wym_skin_silver .wym_panel ul +{ + margin-top: 0px !important; +} + +.wym_skin_silver .wym_panel ul li +{ + width: 146px; + height: 20px; + padding: 0px !important; + margin: 0px; + border: 1px solid #777; + border-top: none; + background: #DDD; + list-style-image: none; +} + +.wym_skin_silver .wym_panel a, +div.wym_dropdown a +{ + text-decoration: none; + font-family: "Trebuchet MS", Verdana, Arial, Helvetica, Sanserif; + font-size: 12px; + padding: 5px 0px 0px 10px !important; + display: block; + width: 136px; + height: 15px; + color: #000; + text-align: left !important; + margin-left: 0px !important; +} + +div.wym_dropdown a:hover, +.wym_skin_silver .wym_panel a:hover +{ + background: #BBB; + border-bottom: none !important; +} diff --git a/gstudio/static/gstudio/js/wymeditor/skins/silver/skin.js b/gstudio/static/gstudio/js/wymeditor/skins/silver/skin.js new file mode 100644 index 0000000..948ed91 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/silver/skin.js @@ -0,0 +1,61 @@ +/* This file is part of the Silver skin for WYMeditor by Scott Edwin Lewis */ + +jQuery.fn.selectify = function() { + return this.each(function() { + jQuery(this).hover( + function() { + jQuery("h2", this).css("background-position", "0px -18px"); + jQuery("ul", this).fadeIn("fast"); + }, + function() { + jQuery("h2", this).css("background-position", ""); + jQuery("ul", this).fadeOut("fast"); + } + ); + }); +}; + +WYMeditor.SKINS['silver'] = { + + init: function(wym) { + + //add some elements to improve the rendering + jQuery(wym._box) + .append('<div class="clear"></div>') + .wrapInner('<div class="wym_inner"></div>'); + + //render following sections as panels + jQuery(wym._box).find(wym._options.classesSelector) + .addClass("wym_panel"); + + //render following sections as buttons + jQuery(wym._box).find(wym._options.toolsSelector) + .addClass("wym_buttons"); + + //render following sections as dropdown menus + jQuery(wym._box).find(wym._options.containersSelector) + .addClass("wym_dropdown") + .selectify(); + + // auto add some margin to the main area sides if left area + // or right area are not empty (if they contain sections) + jQuery(wym._box).find("div.wym_area_right ul") + .parents("div.wym_area_right").show() + .parents(wym._options.boxSelector) + .find("div.wym_area_main") + .css({"margin-right": "155px"}); + + jQuery(wym._box).find("div.wym_area_left ul") + .parents("div.wym_area_left").show() + .parents(wym._options.boxSelector) + .find("div.wym_area_main") + .css({"margin-left": "155px"}); + + //make hover work under IE < 7 + jQuery(wym._box).find(".wym_section").hover(function(){ + jQuery(this).addClass("hover"); + },function(){ + jQuery(this).removeClass("hover"); + }); + } +}; diff --git a/gstudio/static/gstudio/js/wymeditor/skins/twopanels/icons.png b/gstudio/static/gstudio/js/wymeditor/skins/twopanels/icons.png Binary files differnew file mode 100644 index 0000000..c6eb463 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/twopanels/icons.png diff --git a/gstudio/static/gstudio/js/wymeditor/skins/twopanels/skin.css b/gstudio/static/gstudio/js/wymeditor/skins/twopanels/skin.css new file mode 100644 index 0000000..7e6b8fd --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/twopanels/skin.css @@ -0,0 +1,134 @@ +/* + * WYMeditor : what you see is What You Mean web-based editor + * Copyright (c) 2005 - 2009 Jean-Francois Hovinne, http://www.wymeditor.org/ + * Dual licensed under the MIT (MIT-license.txt) + * and GPL (GPL-license.txt) licenses. + * + * For further information visit: + * http://www.wymeditor.org/ + * + * File Name: + * screen.css + * main stylesheet for the WYMeditor skin + * See the documentation for more info. + * + * File Authors: + * Daniel Reszka (d.reszka a-t wymeditor dotorg) + * Jean-Francois Hovinne +*/ + +/*TRYING TO RESET STYLES THAT MAY INTERFERE WITH WYMEDITOR*/ + .wym_skin_twopanels p, .wym_skin_twopanels h2, .wym_skin_twopanels h3, + .wym_skin_twopanels ul, .wym_skin_twopanels li { background: transparent url(); margin: 0; padding: 0; border-width:0; list-style: none; } + + +/*HIDDEN BY DEFAULT*/ + .wym_skin_twopanels .wym_area_left { display: block; } + .wym_skin_twopanels .wym_area_right { display: block; } + + +/*TYPO*/ + .wym_skin_twopanels { font-size: 62.5%; font-family: Verdana, Arial, sans-serif; } + .wym_skin_twopanels h2 { font-size: 110%; /* = 11px */} + .wym_skin_twopanels h3 { font-size: 100%; /* = 10px */} + .wym_skin_twopanels li { font-size: 100%; /* = 10px */} + + +/*WYM_BOX*/ + .wym_skin_twopanels { border: 1px solid gray; background: #f2f2f2; padding: 5px} + + /*auto-clear the wym_box*/ + .wym_skin_twopanels:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } + * html .wym_skin_twopanels { height: 1%;} + + +/*WYM_HTML*/ + .wym_skin_twopanels .wym_html { width: 98%;} + .wym_skin_twopanels .wym_html textarea { width: 100%; height: 200px; border: 1px solid gray; background: white; } + + +/*WYM_IFRAME*/ + .wym_skin_twopanels .wym_iframe { width: 98%;} + .wym_skin_twopanels .wym_iframe iframe { width: 100%; height: 200px; border: 1px solid gray; background: white } + + +/*AREAS*/ + .wym_skin_twopanels .wym_area_left { width: 100px; float: left;} + .wym_skin_twopanels .wym_area_right { width: 150px; float: right;} + .wym_skin_twopanels .wym_area_bottom { height: 1%; clear: both;} + * html .wym_skin_twopanels .wym_area_main { height: 1%;} + * html .wym_skin_twopanels .wym_area_top { height: 1%;} + *+html .wym_skin_twopanels .wym_area_top { height: 1%;} + +/*SECTIONS SYSTEM*/ + + /*common defaults for all sections*/ + .wym_skin_twopanels .wym_section { margin-bottom: 5px; } + .wym_skin_twopanels .wym_section h2, + .wym_skin_twopanels .wym_section h3 { padding: 1px 3px; margin: 0; } + .wym_skin_twopanels .wym_section a { padding: 0 3px; display: block; text-decoration: none; color: black; } + .wym_skin_twopanels .wym_section a:hover { background-color: yellow; } + /*hide section titles by default*/ + .wym_skin_twopanels .wym_section h2 { display: none; } + /*disable any margin-collapse*/ + .wym_skin_twopanels .wym_section { padding-top: 1px; padding-bottom: 1px; } + /*auto-clear sections*/ + .wym_skin_twopanels .wym_section ul:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } + * html .wym_skin_twopanels .wym_section ul { height: 1%;} + + /*option: add this class to a section to make it render as a panel*/ + .wym_skin_twopanels .wym_panel { } + .wym_skin_twopanels .wym_panel h2 { display: block; } + + /*option: add this class to a section to make it render as a dropdown menu*/ + .wym_skin_twopanels .wym_dropdown h2 { display: block; } + .wym_skin_twopanels .wym_dropdown ul { display: none; position: absolute; background: white; } + .wym_skin_twopanels .wym_dropdown:hover ul, + .wym_skin_twopanels .wym_dropdown.hover ul { display: block; } + + /*option: add this class to a section to make its elements render buttons (icons are only available for the wym_tools section for now)*/ + .wym_skin_twopanels .wym_buttons li { float:left;} + .wym_skin_twopanels .wym_buttons a { width: 20px; height: 20px; overflow: hidden; padding: 2px } + /*image replacements*/ + .wym_skin_twopanels .wym_buttons li a { background: url(icons.png) no-repeat; text-indent: -9999px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_strong a { background-position: 0 -382px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_emphasis a { background-position: 0 -22px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_superscript a { background-position: 0 -430px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_subscript a { background-position: 0 -454px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_ordered_list a { background-position: 0 -48px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_unordered_list a{ background-position: 0 -72px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_indent a { background-position: 0 -574px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_outdent a { background-position: 0 -598px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_undo a { background-position: 0 -502px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_redo a { background-position: 0 -526px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_link a { background-position: 0 -96px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_unlink a { background-position: 0 -168px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_image a { background-position: 0 -121px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_table a { background-position: 0 -144px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_paste a { background-position: 0 -552px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_html a { background-position: 0 -193px;} + .wym_skin_twopanels .wym_buttons li.wym_tools_preview a { background-position: 0 -408px;} + +/*DECORATION*/ + .wym_skin_twopanels .wym_section h2 { background: #ddd; border: solid gray; border-width: 0 0 1px;} + .wym_skin_twopanels .wym_section h2 span { color: gray;} + .wym_skin_twopanels .wym_panel { padding: 0; border: solid gray; border-width: 1px; background: white;} + .wym_skin_twopanels .wym_panel ul { margin: 2px 0 5px; } + .wym_skin_twopanels .wym_dropdown { padding: 0; border: solid gray; border-width: 1px 1px 0 1px; } + .wym_skin_twopanels .wym_dropdown ul { border: solid gray; border-width: 0 1px 1px 1px; margin-left: -1px; padding: 5px 10px 5px 3px;} + +/*DIALOGS*/ + .wym_dialog div.row { margin-bottom: 5px;} + .wym_dialog div.row input { margin-right: 5px;} + .wym_dialog div.row label { float: left; width: 150px; display: block; text-align: right; margin-right: 10px; } + .wym_dialog div.row-indent { padding-left: 160px; } + /*autoclearing*/ + .wym_dialog div.row:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } + .wym_dialog div.row { display: inline-block; } + /* Hides from IE-mac \*/ + * html .wym_dialog div.row { height: 1%; } + .wym_dialog div.row { display: block; } + /* End hide from IE-mac */ + +/*WYMEDITOR_LINK*/ + a.wym_wymeditor_link { text-indent: -9999px; float: right; display: block; width: 50px; height: 15px; background: url(../wymeditor_icon.png); overflow: hidden; text-decoration: none; } diff --git a/gstudio/static/gstudio/js/wymeditor/skins/twopanels/skin.js b/gstudio/static/gstudio/js/wymeditor/skins/twopanels/skin.js new file mode 100644 index 0000000..e82efc5 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/twopanels/skin.js @@ -0,0 +1,39 @@ +WYMeditor.SKINS['twopanels'] = { + + init: function(wym) { + + //move the containers panel to the left area + jQuery(wym._box).find(wym._options.containersSelector) + .appendTo("div.wym_area_left"); + + //render following sections as panels + jQuery(wym._box).find(wym._options.classesSelector + ', ' + + wym._options.containersSelector) + .addClass("wym_panel"); + + //render following sections as buttons + jQuery(wym._box).find(wym._options.toolsSelector) + .addClass("wym_buttons"); + + // auto add some margin to the main area sides if left area + // or right area are not empty (if they contain sections) + jQuery(wym._box).find("div.wym_area_right ul") + .parents("div.wym_area_right").show() + .parents(wym._options.boxSelector) + .find("div.wym_area_main") + .css({"margin-right": "155px"}); + + jQuery(wym._box).find("div.wym_area_left ul") + .parents("div.wym_area_left").show() + .parents(wym._options.boxSelector) + .find("div.wym_area_main") + .css({"margin-left": "115px"}); + + //make hover work under IE < 7 + jQuery(wym._box).find(".wym_section").hover(function(){ + jQuery(this).addClass("hover"); + },function(){ + jQuery(this).removeClass("hover"); + }); + } +}; diff --git a/gstudio/static/gstudio/js/wymeditor/skins/wymeditor_icon.png b/gstudio/static/gstudio/js/wymeditor/skins/wymeditor_icon.png Binary files differnew file mode 100644 index 0000000..d4fc155 --- /dev/null +++ b/gstudio/static/gstudio/js/wymeditor/skins/wymeditor_icon.png |